diff options
Diffstat (limited to 'src')
-rw-r--r-- | src/python/CMakeLists.txt | 11 | ||||
-rw-r--r-- | src/python/doc/cubical_complex_sum.inc | 25 | ||||
-rw-r--r-- | src/python/doc/cubical_complex_tflow_itf_ref.rst | 40 | ||||
-rw-r--r-- | src/python/doc/differentiation_sum.inc | 12 | ||||
-rw-r--r-- | src/python/doc/installation.rst | 6 | ||||
-rw-r--r-- | src/python/doc/ls_simplex_tree_tflow_itf_ref.rst | 53 | ||||
-rw-r--r-- | src/python/doc/rips_complex_sum.inc | 5 | ||||
-rw-r--r-- | src/python/doc/rips_complex_tflow_itf_ref.rst | 48 | ||||
-rw-r--r-- | src/python/doc/simplex_tree_sum.inc | 23 | ||||
-rw-r--r-- | src/python/gudhi/tensorflow/__init__.py | 5 | ||||
-rw-r--r-- | src/python/gudhi/tensorflow/cubical_layer.py | 76 | ||||
-rw-r--r-- | src/python/gudhi/tensorflow/lower_star_simplex_tree_layer.py | 84 | ||||
-rw-r--r-- | src/python/gudhi/tensorflow/rips_layer.py | 91 | ||||
-rw-r--r-- | src/python/test/test_diff.py | 78 |
14 files changed, 532 insertions, 25 deletions
diff --git a/src/python/CMakeLists.txt b/src/python/CMakeLists.txt index fbfb0d1f..26c229d5 100644 --- a/src/python/CMakeLists.txt +++ b/src/python/CMakeLists.txt @@ -70,6 +70,7 @@ if(PYTHONINTERP_FOUND) set(GUDHI_PYTHON_MODULES "${GUDHI_PYTHON_MODULES}'euclidean_strong_witness_complex', ") # Modules that should not be auto-imported in __init__.py set(GUDHI_PYTHON_MODULES_EXTRA "${GUDHI_PYTHON_MODULES_EXTRA}'representations', ") + set(GUDHI_PYTHON_MODULES_EXTRA "${GUDHI_PYTHON_MODULES_EXTRA}'tensorflow', ") set(GUDHI_PYTHON_MODULES_EXTRA "${GUDHI_PYTHON_MODULES_EXTRA}'wasserstein', ") set(GUDHI_PYTHON_MODULES_EXTRA "${GUDHI_PYTHON_MODULES_EXTRA}'point_cloud', ") set(GUDHI_PYTHON_MODULES_EXTRA "${GUDHI_PYTHON_MODULES_EXTRA}'weighted_rips_complex', ") @@ -283,7 +284,8 @@ if(PYTHONINTERP_FOUND) # Other .py files file(COPY "gudhi/persistence_graphical_tools.py" DESTINATION "${CMAKE_CURRENT_BINARY_DIR}/gudhi") file(COPY "gudhi/representations" DESTINATION "${CMAKE_CURRENT_BINARY_DIR}/gudhi/") - file(COPY "gudhi/wasserstein" DESTINATION "${CMAKE_CURRENT_BINARY_DIR}/gudhi") + file(COPY "gudhi/wasserstein" DESTINATION "${CMAKE_CURRENT_BINARY_DIR}/gudhi") + file(COPY "gudhi/tensorflow" DESTINATION "${CMAKE_CURRENT_BINARY_DIR}/gudhi") file(COPY "gudhi/point_cloud" DESTINATION "${CMAKE_CURRENT_BINARY_DIR}/gudhi") file(COPY "gudhi/clustering" DESTINATION "${CMAKE_CURRENT_BINARY_DIR}/gudhi" FILES_MATCHING PATTERN "*.py") file(COPY "gudhi/weighted_rips_complex.py" DESTINATION "${CMAKE_CURRENT_BINARY_DIR}/gudhi") @@ -556,6 +558,11 @@ if(PYTHONINTERP_FOUND) add_gudhi_py_test(test_representations) endif() + # Differentiation + if(TENSORFLOW_FOUND) + add_gudhi_py_test(test_diff) + endif() + # Betti curves if(SKLEARN_FOUND AND SCIPY_FOUND) add_gudhi_py_test(test_betti_curve_representations) @@ -595,4 +602,4 @@ if(PYTHONINTERP_FOUND) else(PYTHONINTERP_FOUND) message("++ Python module will not be compiled because no Python interpreter was found") set(GUDHI_MISSING_MODULES ${GUDHI_MISSING_MODULES} "python" CACHE INTERNAL "GUDHI_MISSING_MODULES") -endif(PYTHONINTERP_FOUND)
\ No newline at end of file +endif(PYTHONINTERP_FOUND) diff --git a/src/python/doc/cubical_complex_sum.inc b/src/python/doc/cubical_complex_sum.inc index 87db184d..90ec9fc2 100644 --- a/src/python/doc/cubical_complex_sum.inc +++ b/src/python/doc/cubical_complex_sum.inc @@ -1,14 +1,17 @@ .. table:: :widths: 30 40 30 - +--------------------------------------------------------------------------+----------------------------------------------------------------------+-----------------------------+ - | .. figure:: | The cubical complex represents a grid as a cell complex with | :Author: Pawel Dlotko | - | ../../doc/Bitmap_cubical_complex/Cubical_complex_representation.png | cells of all dimensions. | | - | :alt: Cubical complex representation | | :Since: GUDHI 2.0.0 | - | :figclass: align-center | | | - | | | :License: MIT | - | | | | - +--------------------------------------------------------------------------+----------------------------------------------------------------------+-----------------------------+ - | * :doc:`cubical_complex_user` | * :doc:`cubical_complex_ref` | - | | * :doc:`periodic_cubical_complex_ref` | - +--------------------------------------------------------------------------+----------------------------------------------------------------------------------------------------+ + +--------------------------------------------------------------------------+----------------------------------------------------------------------+---------------------------------------------------------+ + | .. figure:: | The cubical complex represents a grid as a cell complex with | :Author: Pawel Dlotko | + | ../../doc/Bitmap_cubical_complex/Cubical_complex_representation.png | cells of all dimensions. | | + | :alt: Cubical complex representation | | :Since: GUDHI 2.0.0 | + | :figclass: align-center | | | + | | | :License: MIT | + | | | | + +--------------------------------------------------------------------------+----------------------------------------------------------------------+---------------------------------------------------------+ + | * :doc:`cubical_complex_user` | * :doc:`cubical_complex_ref` | + | | * :doc:`periodic_cubical_complex_ref` | + +--------------------------------------------------------------------------+----------------------------------------------------------------------+---------------------------------------------------------+ + | | * :doc:`cubical_complex_tflow_itf_ref` | :requires: `TensorFlow <installation.html#tensorflow>`_ | + | | | | + +--------------------------------------------------------------------------+----------------------------------------------------------------------+---------------------------------------------------------+ diff --git a/src/python/doc/cubical_complex_tflow_itf_ref.rst b/src/python/doc/cubical_complex_tflow_itf_ref.rst new file mode 100644 index 00000000..18b97adf --- /dev/null +++ b/src/python/doc/cubical_complex_tflow_itf_ref.rst @@ -0,0 +1,40 @@ +:orphan: + +.. To get rid of WARNING: document isn't included in any toctree + +TensorFlow layer for cubical persistence +######################################## + +.. include:: differentiation_sum.inc + +Example of gradient computed from cubical persistence +----------------------------------------------------- + +.. testcode:: + + from gudhi.tensorflow import CubicalLayer + import tensorflow as tf + + X = tf.Variable([[0.,2.,2.],[2.,2.,2.],[2.,2.,1.]], dtype=tf.float32, trainable=True) + cl = CubicalLayer(dimensions=[0]) + + with tf.GradientTape() as tape: + dgm = cl.call(X)[0][0] + loss = tf.math.reduce_sum(tf.square(.5*(dgm[:,1]-dgm[:,0]))) + + grads = tape.gradient(loss, [X]) + print(grads[0].numpy()) + +.. testoutput:: + + [[ 0. 0. 0. ] + [ 0. 0.5 0. ] + [ 0. 0. -0.5]] + +Documentation for CubicalLayer +------------------------------ + +.. autoclass:: gudhi.tensorflow.CubicalLayer + :members: + :special-members: __init__ + :show-inheritance: diff --git a/src/python/doc/differentiation_sum.inc b/src/python/doc/differentiation_sum.inc new file mode 100644 index 00000000..3aec33df --- /dev/null +++ b/src/python/doc/differentiation_sum.inc @@ -0,0 +1,12 @@ +.. list-table:: + :widths: 40 30 30 + :header-rows: 0 + + * - :Since: GUDHI 3.5.0 + - :License: MIT + - :Requires: `TensorFlow <installation.html#tensorflow>`_ + +We provide TensorFlow 2 models that can handle automatic differentiation for the computation of persistence diagrams from complexes available in the Gudhi library. +This includes simplex trees, cubical complexes and Vietoris-Rips complexes. Detailed example on how to use these layers in practice are available +in the following `notebook <https://github.com/GUDHI/TDA-tutorial/blob/master/Tuto-GUDHI-optimization.ipynb>`_. Note that even if TensorFlow GPU is enabled, all +internal computations using Gudhi will be done on CPU. diff --git a/src/python/doc/installation.rst b/src/python/doc/installation.rst index cff84691..dd476054 100644 --- a/src/python/doc/installation.rst +++ b/src/python/doc/installation.rst @@ -396,7 +396,11 @@ mathematics, science, and engineering. TensorFlow ---------- -`TensorFlow <https://www.tensorflow.org>`_ is currently only used in some automatic differentiation tests. +The :doc:`cubical complex </cubical_complex_tflow_itf_ref>`, :doc:`simplex tree </ls_simplex_tree_tflow_itf_ref>` +and :doc:`Rips complex </rips_complex_tflow_itf_ref>` modules require `TensorFlow <https://www.tensorflow.org>`_ +for incorporating them in neural nets. + +`TensorFlow <https://www.tensorflow.org>`_ is also used in some automatic differentiation tests. Bug reports and contributions ***************************** diff --git a/src/python/doc/ls_simplex_tree_tflow_itf_ref.rst b/src/python/doc/ls_simplex_tree_tflow_itf_ref.rst new file mode 100644 index 00000000..b8518cdb --- /dev/null +++ b/src/python/doc/ls_simplex_tree_tflow_itf_ref.rst @@ -0,0 +1,53 @@ +:orphan: + +.. To get rid of WARNING: document isn't included in any toctree + +TensorFlow layer for lower-star persistence on simplex trees +############################################################ + +.. include:: differentiation_sum.inc + +Example of gradient computed from lower-star filtration of a simplex tree +------------------------------------------------------------------------- + +.. testcode:: + + from gudhi.tensorflow import LowerStarSimplexTreeLayer + import tensorflow as tf + import gudhi as gd + + st = gd.SimplexTree() + st.insert([0, 1]) + st.insert([1, 2]) + st.insert([2, 3]) + st.insert([3, 4]) + st.insert([4, 5]) + st.insert([5, 6]) + st.insert([6, 7]) + st.insert([7, 8]) + st.insert([8, 9]) + st.insert([9, 10]) + + F = tf.Variable([6.,4.,3.,4.,5.,4.,3.,2.,3.,4.,5.], dtype=tf.float32, trainable=True) + sl = LowerStarSimplexTreeLayer(simplextree=st, dimensions=[0]) + + with tf.GradientTape() as tape: + dgm = sl.call(F)[0][0] + loss = tf.math.reduce_sum(tf.square(.5*(dgm[:,1]-dgm[:,0]))) + + grads = tape.gradient(loss, [F]) + print(grads[0].indices.numpy()) + print(grads[0].values.numpy()) + +.. testoutput:: + + [2 4] + [-1. 1.] + +Documentation for LowerStarSimplexTreeLayer +------------------------------------------- + +.. autoclass:: gudhi.tensorflow.LowerStarSimplexTreeLayer + :members: + :special-members: __init__ + :show-inheritance: diff --git a/src/python/doc/rips_complex_sum.inc b/src/python/doc/rips_complex_sum.inc index 2cb24990..6931ebee 100644 --- a/src/python/doc/rips_complex_sum.inc +++ b/src/python/doc/rips_complex_sum.inc @@ -11,4 +11,7 @@ | | | | +----------------------------------------------------------------+------------------------------------------------------------------------+----------------------------------------------------------------------------------+ | * :doc:`rips_complex_user` | * :doc:`rips_complex_ref` | - +----------------------------------------------------------------+-----------------------------------------------------------------------------------------------------------------------------------------------------------+ + +----------------------------------------------------------------+------------------------------------------------------------------------+----------------------------------------------------------------------------------+ + | | * :doc:`rips_complex_tflow_itf_ref` | :requires: `TensorFlow <installation.html#tensorflow>`_ | + | | | | + +----------------------------------------------------------------+------------------------------------------------------------------------+----------------------------------------------------------------------------------+ diff --git a/src/python/doc/rips_complex_tflow_itf_ref.rst b/src/python/doc/rips_complex_tflow_itf_ref.rst new file mode 100644 index 00000000..6c65c562 --- /dev/null +++ b/src/python/doc/rips_complex_tflow_itf_ref.rst @@ -0,0 +1,48 @@ +:orphan: + +.. To get rid of WARNING: document isn't included in any toctree + +TensorFlow layer for Vietoris-Rips persistence +############################################## + +.. include:: differentiation_sum.inc + +Example of gradient computed from Vietoris-Rips persistence +----------------------------------------------------------- + +.. testsetup:: + + import numpy + numpy.set_printoptions(precision=4) + +.. testcode:: + + from gudhi.tensorflow import RipsLayer + import tensorflow as tf + + X = tf.Variable([[1.,1.],[2.,2.]], dtype=tf.float32, trainable=True) + rl = RipsLayer(maximum_edge_length=2., dimensions=[0]) + + with tf.GradientTape() as tape: + dgm = rl.call(X)[0][0] + loss = tf.math.reduce_sum(tf.square(.5*(dgm[:,1]-dgm[:,0]))) + + grads = tape.gradient(loss, [X]) + print(grads[0].numpy()) + +.. testcleanup:: + + numpy.set_printoptions(precision=8) + +.. testoutput:: + + [[-0.5 -0.5] + [ 0.5 0.5]] + +Documentation for RipsLayer +--------------------------- + +.. autoclass:: gudhi.tensorflow.RipsLayer + :members: + :special-members: __init__ + :show-inheritance: diff --git a/src/python/doc/simplex_tree_sum.inc b/src/python/doc/simplex_tree_sum.inc index a8858f16..3ad1292c 100644 --- a/src/python/doc/simplex_tree_sum.inc +++ b/src/python/doc/simplex_tree_sum.inc @@ -1,13 +1,16 @@ .. table:: :widths: 30 40 30 - +----------------------------------------------------------------+------------------------------------------------------------------------+-----------------------------+ - | .. figure:: | The simplex tree is an efficient and flexible data structure for | :Author: Clément Maria | - | ../../doc/Simplex_tree/Simplex_tree_representation.png | representing general (filtered) simplicial complexes. | | - | :alt: Simplex tree representation | | :Since: GUDHI 2.0.0 | - | :figclass: align-center | The data structure is described in | | - | | :cite:`boissonnatmariasimplextreealgorithmica` | :License: MIT | - | | | | - +----------------------------------------------------------------+------------------------------------------------------------------------+-----------------------------+ - | * :doc:`simplex_tree_user` | * :doc:`simplex_tree_ref` | - +----------------------------------------------------------------+------------------------------------------------------------------------------------------------------+ + +----------------------------------------------------------------+------------------------------------------------------------------------+---------------------------------------------------------+ + | .. figure:: | The simplex tree is an efficient and flexible data structure for | :Author: Clément Maria | + | ../../doc/Simplex_tree/Simplex_tree_representation.png | representing general (filtered) simplicial complexes. | | + | :alt: Simplex tree representation | | :Since: GUDHI 2.0.0 | + | :figclass: align-center | The data structure is described in | | + | | :cite:`boissonnatmariasimplextreealgorithmica` | :License: MIT | + | | | | + +----------------------------------------------------------------+------------------------------------------------------------------------+---------------------------------------------------------+ + | * :doc:`simplex_tree_user` | * :doc:`simplex_tree_ref` | + +----------------------------------------------------------------+------------------------------------------------------------------------+---------------------------------------------------------+ + | | * :doc:`ls_simplex_tree_tflow_itf_ref` | :requires: `TensorFlow <installation.html#tensorflow>`_ | + | | | | + +----------------------------------------------------------------+------------------------------------------------------------------------+---------------------------------------------------------+ diff --git a/src/python/gudhi/tensorflow/__init__.py b/src/python/gudhi/tensorflow/__init__.py new file mode 100644 index 00000000..1599cf52 --- /dev/null +++ b/src/python/gudhi/tensorflow/__init__.py @@ -0,0 +1,5 @@ +from .cubical_layer import CubicalLayer +from .lower_star_simplex_tree_layer import LowerStarSimplexTreeLayer +from .rips_layer import RipsLayer + +__all__ = ["LowerStarSimplexTreeLayer", "RipsLayer", "CubicalLayer"] diff --git a/src/python/gudhi/tensorflow/cubical_layer.py b/src/python/gudhi/tensorflow/cubical_layer.py new file mode 100644 index 00000000..369b0e54 --- /dev/null +++ b/src/python/gudhi/tensorflow/cubical_layer.py @@ -0,0 +1,76 @@ +import numpy as np +import tensorflow as tf +from ..cubical_complex import CubicalComplex + +###################### +# Cubical filtration # +###################### + +# The parameters of the model are the pixel values. + +def _Cubical(Xflat, Xdim, dimensions): + # Parameters: Xflat (flattened image), + # Xdim (shape of non-flattened image) + # dimensions (homology dimensions) + + # Compute the persistence pairs with Gudhi + # We reverse the dimensions because CubicalComplex uses Fortran ordering + cc = CubicalComplex(dimensions=Xdim[::-1], top_dimensional_cells=Xflat) + cc.compute_persistence() + + # Retrieve and ouput image indices/pixels corresponding to positive and negative simplices + cof_pp = cc.cofaces_of_persistence_pairs() + + L_cofs = [] + for dim in dimensions: + + try: + cof = cof_pp[0][dim] + except IndexError: + cof = np.array([]) + + L_cofs.append(np.array(cof, dtype=np.int32)) + + return L_cofs + +class CubicalLayer(tf.keras.layers.Layer): + """ + TensorFlow layer for computing the persistent homology of a cubical complex + """ + def __init__(self, dimensions, min_persistence=None, **kwargs): + """ + Constructor for the CubicalLayer class + + Parameters: + dimensions (List[int]): homology dimensions + min_persistence (List[float]): minimum distance-to-diagonal of the points in the output persistence diagrams (default None, in which case 0. is used for all dimensions) + """ + super().__init__(dynamic=True, **kwargs) + self.dimensions = dimensions + self.min_persistence = min_persistence if min_persistence != None else [0.] * len(self.dimensions) + assert len(self.min_persistence) == len(self.dimensions) + + def call(self, X): + """ + Compute persistence diagram associated to a cubical complex filtered by some pixel values + + Parameters: + X (TensorFlow variable): pixel values of the cubical complex + + Returns: + dgms (list of TensorFlow variables): list of cubical persistence diagrams of length self.dimensions, where each element contains a finite persistence diagram of shape [num_finite_points, 2] + """ + # Compute pixels associated to positive and negative simplices + # Don't compute gradient for this operation + Xflat = tf.reshape(X, [-1]) + Xdim = X.shape + indices_list = _Cubical(Xflat.numpy(), Xdim, self.dimensions) + # Get persistence diagram by simply picking the corresponding entries in the image + self.dgms = [tf.reshape(tf.gather(Xflat, indices), [-1,2]) for indices in indices_list] + for idx_dim in range(len(self.min_persistence)): + min_pers = self.min_persistence[idx_dim] + if min_pers >= 0: + finite_dgm = self.dgms[idx_dim] + persistent_indices = tf.where(tf.math.abs(finite_dgm[:,1]-finite_dgm[:,0]) > min_pers) + self.dgms[idx_dim] = tf.gather(finite_dgm, indices=persistent_indices) + return self.dgms diff --git a/src/python/gudhi/tensorflow/lower_star_simplex_tree_layer.py b/src/python/gudhi/tensorflow/lower_star_simplex_tree_layer.py new file mode 100644 index 00000000..cf7df6de --- /dev/null +++ b/src/python/gudhi/tensorflow/lower_star_simplex_tree_layer.py @@ -0,0 +1,84 @@ +import numpy as np +import tensorflow as tf + +######################################### +# Lower star filtration on simplex tree # +######################################### + +# The parameters of the model are the vertex function values of the simplex tree. + +def _LowerStarSimplexTree(simplextree, filtration, dimensions): + # Parameters: simplextree (simplex tree on which to compute persistence) + # filtration (function values on the vertices of st), + # dimensions (homology dimensions), + + simplextree.reset_filtration(-np.inf, 0) + + # Assign new filtration values + for i in range(simplextree.num_vertices()): + simplextree.assign_filtration([i], filtration[i]) + simplextree.make_filtration_non_decreasing() + + # Compute persistence diagram + simplextree.compute_persistence() + + # Get vertex pairs for optimization. First, get all simplex pairs + pairs = simplextree.lower_star_persistence_generators() + + L_indices = [] + for dimension in dimensions: + + finite_pairs = pairs[0][dimension] if len(pairs[0]) >= dimension+1 else np.empty(shape=[0,2]) + essential_pairs = pairs[1][dimension] if len(pairs[1]) >= dimension+1 else np.empty(shape=[0,1]) + + finite_indices = np.array(finite_pairs.flatten(), dtype=np.int32) + essential_indices = np.array(essential_pairs.flatten(), dtype=np.int32) + + L_indices.append((finite_indices, essential_indices)) + + return L_indices + +class LowerStarSimplexTreeLayer(tf.keras.layers.Layer): + """ + TensorFlow layer for computing lower-star persistence out of a simplex tree + """ + def __init__(self, simplextree, dimensions, min_persistence=None, **kwargs): + """ + Constructor for the LowerStarSimplexTreeLayer class + + Parameters: + simplextree (gudhi.SimplexTree): underlying simplex tree. Its vertices MUST be named with integers from 0 to n = number of vertices. Note that its filtration values are modified in each call of the class. + dimensions (List[int]): homology dimensions + min_persistence (List[float]): minimum distance-to-diagonal of the points in the output persistence diagrams (default None, in which case 0. is used for all dimensions) + """ + super().__init__(dynamic=True, **kwargs) + self.dimensions = dimensions + self.simplextree = simplextree + self.min_persistence = min_persistence if min_persistence != None else [0. for _ in range(len(self.dimensions))] + assert len(self.min_persistence) == len(self.dimensions) + + def call(self, filtration): + """ + Compute lower-star persistence diagram associated to a function defined on the vertices of the simplex tree + + Parameters: + F (TensorFlow variable): filter function values over the vertices of the simplex tree. The ith entry of F corresponds to vertex i in self.simplextree + + Returns: + dgms (list of tuple of TensorFlow variables): list of lower-star persistence diagrams of length self.dimensions, where each element of the list is a tuple that contains the finite and essential persistence diagrams of shapes [num_finite_points, 2] and [num_essential_points, 1] respectively + """ + # Don't try to compute gradients for the vertex pairs + indices = _LowerStarSimplexTree(self.simplextree, filtration.numpy(), self.dimensions) + # Get persistence diagrams + self.dgms = [] + for idx_dim, dimension in enumerate(self.dimensions): + finite_dgm = tf.reshape(tf.gather(filtration, indices[idx_dim][0]), [-1,2]) + essential_dgm = tf.reshape(tf.gather(filtration, indices[idx_dim][1]), [-1,1]) + min_pers = self.min_persistence[idx_dim] + if min_pers >= 0: + persistent_indices = tf.where(tf.math.abs(finite_dgm[:,1]-finite_dgm[:,0]) > min_pers) + self.dgms.append((tf.reshape(tf.gather(finite_dgm, indices=persistent_indices),[-1,2]), essential_dgm)) + else: + self.dgms.append((finite_dgm, essential_dgm)) + return self.dgms + diff --git a/src/python/gudhi/tensorflow/rips_layer.py b/src/python/gudhi/tensorflow/rips_layer.py new file mode 100644 index 00000000..7b5edfa3 --- /dev/null +++ b/src/python/gudhi/tensorflow/rips_layer.py @@ -0,0 +1,91 @@ +import numpy as np +import tensorflow as tf +from ..rips_complex import RipsComplex + +############################ +# Vietoris-Rips filtration # +############################ + +# The parameters of the model are the point coordinates. + +def _Rips(DX, max_edge, dimensions): + # Parameters: DX (distance matrix), + # max_edge (maximum edge length for Rips filtration), + # dimensions (homology dimensions) + + # Compute the persistence pairs with Gudhi + rc = RipsComplex(distance_matrix=DX, max_edge_length=max_edge) + st = rc.create_simplex_tree(max_dimension=max(dimensions)+1) + st.compute_persistence() + pairs = st.flag_persistence_generators() + + L_indices = [] + for dimension in dimensions: + + if dimension == 0: + finite_pairs = pairs[0] + essential_pairs = pairs[2] + else: + finite_pairs = pairs[1][dimension-1] if len(pairs[1]) >= dimension else np.empty(shape=[0,4]) + essential_pairs = pairs[3][dimension-1] if len(pairs[3]) >= dimension else np.empty(shape=[0,2]) + + finite_indices = np.array(finite_pairs.flatten(), dtype=np.int32) + essential_indices = np.array(essential_pairs.flatten(), dtype=np.int32) + + L_indices.append((finite_indices, essential_indices)) + + return L_indices + +class RipsLayer(tf.keras.layers.Layer): + """ + TensorFlow layer for computing Rips persistence out of a point cloud + """ + def __init__(self, dimensions, maximum_edge_length=np.inf, min_persistence=None, **kwargs): + """ + Constructor for the RipsLayer class + + Parameters: + maximum_edge_length (float): maximum edge length for the Rips complex + dimensions (List[int]): homology dimensions + min_persistence (List[float]): minimum distance-to-diagonal of the points in the output persistence diagrams (default None, in which case 0. is used for all dimensions) + """ + super().__init__(dynamic=True, **kwargs) + self.max_edge = maximum_edge_length + self.dimensions = dimensions + self.min_persistence = min_persistence if min_persistence != None else [0. for _ in range(len(self.dimensions))] + assert len(self.min_persistence) == len(self.dimensions) + + def call(self, X): + """ + Compute Rips persistence diagram associated to a point cloud + + Parameters: + X (TensorFlow variable): point cloud of shape [number of points, number of dimensions] + + Returns: + dgms (list of tuple of TensorFlow variables): list of Rips persistence diagrams of length self.dimensions, where each element of the list is a tuple that contains the finite and essential persistence diagrams of shapes [num_finite_points, 2] and [num_essential_points, 1] respectively + """ + # Compute distance matrix + DX = tf.norm(tf.expand_dims(X, 1)-tf.expand_dims(X, 0), axis=2) + # Compute vertices associated to positive and negative simplices + # Don't compute gradient for this operation + indices = _Rips(DX.numpy(), self.max_edge, self.dimensions) + # Get persistence diagrams by simply picking the corresponding entries in the distance matrix + self.dgms = [] + for idx_dim, dimension in enumerate(self.dimensions): + cur_idx = indices[idx_dim] + if dimension > 0: + finite_dgm = tf.reshape(tf.gather_nd(DX, tf.reshape(cur_idx[0], [-1,2])), [-1,2]) + essential_dgm = tf.reshape(tf.gather_nd(DX, tf.reshape(cur_idx[1], [-1,2])), [-1,1]) + else: + reshaped_cur_idx = tf.reshape(cur_idx[0], [-1,3]) + finite_dgm = tf.concat([tf.zeros([reshaped_cur_idx.shape[0],1]), tf.reshape(tf.gather_nd(DX, reshaped_cur_idx[:,1:]), [-1,1])], axis=1) + essential_dgm = tf.zeros([cur_idx[1].shape[0],1]) + min_pers = self.min_persistence[idx_dim] + if min_pers >= 0: + persistent_indices = tf.where(tf.math.abs(finite_dgm[:,1]-finite_dgm[:,0]) > min_pers) + self.dgms.append((tf.reshape(tf.gather(finite_dgm, indices=persistent_indices),[-1,2]), essential_dgm)) + else: + self.dgms.append((finite_dgm, essential_dgm)) + return self.dgms + diff --git a/src/python/test/test_diff.py b/src/python/test/test_diff.py new file mode 100644 index 00000000..bab0d10c --- /dev/null +++ b/src/python/test/test_diff.py @@ -0,0 +1,78 @@ +from gudhi.tensorflow import * +import numpy as np +import tensorflow as tf +import gudhi as gd + +def test_rips_diff(): + + Xinit = np.array([[1.,1.],[2.,2.]], dtype=np.float32) + X = tf.Variable(initial_value=Xinit, trainable=True) + rl = RipsLayer(maximum_edge_length=2., dimensions=[0]) + + with tf.GradientTape() as tape: + dgm = rl.call(X)[0][0] + loss = tf.math.reduce_sum(tf.square(.5*(dgm[:,1]-dgm[:,0]))) + grads = tape.gradient(loss, [X]) + assert np.abs(grads[0].numpy()-np.array([[-.5,-.5],[.5,.5]])).sum() <= 1e-6 + +def test_cubical_diff(): + + Xinit = np.array([[0.,2.,2.],[2.,2.,2.],[2.,2.,1.]], dtype=np.float32) + X = tf.Variable(initial_value=Xinit, trainable=True) + cl = CubicalLayer(dimensions=[0]) + + with tf.GradientTape() as tape: + dgm = cl.call(X)[0][0] + loss = tf.math.reduce_sum(tf.square(.5*(dgm[:,1]-dgm[:,0]))) + grads = tape.gradient(loss, [X]) + assert np.abs(grads[0].numpy()-np.array([[0.,0.,0.],[0.,.5,0.],[0.,0.,-.5]])).sum() <= 1e-6 + +def test_nonsquare_cubical_diff(): + + Xinit = np.array([[-1.,1.,0.],[1.,1.,1.]], dtype=np.float32) + X = tf.Variable(initial_value=Xinit, trainable=True) + cl = CubicalLayer(dimensions=[0]) + + with tf.GradientTape() as tape: + dgm = cl.call(X)[0][0] + loss = tf.math.reduce_sum(tf.square(.5*(dgm[:,1]-dgm[:,0]))) + grads = tape.gradient(loss, [X]) + assert np.abs(grads[0].numpy()-np.array([[0.,0.5,-0.5],[0.,0.,0.]])).sum() <= 1e-6 + +def test_st_diff(): + + st = gd.SimplexTree() + st.insert([0]) + st.insert([1]) + st.insert([2]) + st.insert([3]) + st.insert([4]) + st.insert([5]) + st.insert([6]) + st.insert([7]) + st.insert([8]) + st.insert([9]) + st.insert([10]) + st.insert([0, 1]) + st.insert([1, 2]) + st.insert([2, 3]) + st.insert([3, 4]) + st.insert([4, 5]) + st.insert([5, 6]) + st.insert([6, 7]) + st.insert([7, 8]) + st.insert([8, 9]) + st.insert([9, 10]) + + Finit = np.array([6.,4.,3.,4.,5.,4.,3.,2.,3.,4.,5.], dtype=np.float32) + F = tf.Variable(initial_value=Finit, trainable=True) + sl = LowerStarSimplexTreeLayer(simplextree=st, dimensions=[0]) + + with tf.GradientTape() as tape: + dgm = sl.call(F)[0][0] + loss = tf.math.reduce_sum(tf.square(.5*(dgm[:,1]-dgm[:,0]))) + grads = tape.gradient(loss, [F]) + + assert np.array_equal(np.array(grads[0].indices), np.array([2,4])) + assert np.array_equal(np.array(grads[0].values), np.array([-1,1])) + |