diff options
Diffstat (limited to 'src')
310 files changed, 13752 insertions, 5567 deletions
diff --git a/src/Alpha_complex/doc/Intro_alpha_complex.h b/src/Alpha_complex/doc/Intro_alpha_complex.h index c068b268..41e5e16d 100644 --- a/src/Alpha_complex/doc/Intro_alpha_complex.h +++ b/src/Alpha_complex/doc/Intro_alpha_complex.h @@ -83,7 +83,7 @@ Table of Contents * * Then, it is asked to display information about the simplicial complex. * - * \include Alpha_complex/Alpha_complex_from_points.cpp + * \include Alpha_complex_from_points.cpp * * When launching: * @@ -92,7 +92,7 @@ Table of Contents * * the program output is: * - * \include Alpha_complex/alphaoffreader_for_doc_60.txt + * \include alphaoffreader_for_doc_60.txt * * \section createcomplexalgorithm Create complex algorithm * @@ -107,6 +107,7 @@ Table of Contents * \subsection filtrationcomputation Filtration value computation algorithm * <br> * \f$ + * \begin{array}{l} * \textbf{for } \text{i : dimension } \rightarrow 0 \textbf{ do}\\ * \quad \textbf{for all } \sigma \text{ of dimension i}\\ * \quad\quad \textbf{if } \text{filtration(} \sigma ) \text{ is NaN} \textbf{ then}\\ @@ -127,6 +128,7 @@ Table of Contents * \textbf{end for}\\ * \text{make_filtration_non_decreasing()}\\ * \text{prune_above_filtration()}\\ + * \end{array} * \f$ * * \subsubsection dimension2 Dimension 2 @@ -152,6 +154,8 @@ Table of Contents * not quite define a proper filtration (i.e. non-decreasing with respect to inclusion). * We fix that up by calling `SimplicialComplexForAlpha::make_filtration_non_decreasing()`. * + * \note This is not the case in `exact` version, this is the reason why it is not called in this case. + * * \subsubsection pruneabove Prune above given filtration value * * The simplex tree is pruned from the given maximum \f$ \alpha^2 \f$ value (cf. @@ -162,16 +166,16 @@ Table of Contents * <b>Requires:</b> \ref eigen ≥ 3.1.0 and \ref cgal ≥ 5.1.0. * * A weighted version for Alpha complex is available (cf. Alpha_complex). It is like a usual Alpha complex, but based - * on a <a href="https://doc.cgal.org/latest/Triangulation/index.html#title20">CGAL regular triangulation</a> instead + * on a <a href="https://doc.cgal.org/latest/Triangulation/index.html#TriangulationSecRT">CGAL regular triangulation</a> instead * of Delaunay. * * This example builds the CGAL weighted alpha shapes from a small molecule, and initializes the alpha complex with - * it. This example is taken from <a href="https://doc.cgal.org/latest/Alpha_shapes_3/index.html#title13">CGAL 3d + * it. This example is taken from <a href="https://doc.cgal.org/latest/Alpha_shapes_3/index.html#AlphaShape_3DExampleforWeightedAlphaShapes">CGAL 3d * weighted alpha shapes</a>. * * Then, it is asked to display information about the alpha complex. * - * \include Alpha_complex/Weighted_alpha_complex_from_points.cpp + * \include Weighted_alpha_complex_from_points.cpp * * When launching: * @@ -180,7 +184,7 @@ Table of Contents * * the program output is: * - * \include Alpha_complex/weightedalpha3dfrompoints_for_doc.txt + * \include weightedalpha3dfrompoints_for_doc.txt * * * \section offexample Example from OFF file @@ -190,7 +194,7 @@ Table of Contents * * Then, it is asked to display information about the alpha complex. * - * \include Alpha_complex/Alpha_complex_from_off.cpp + * \include Alpha_complex_from_off.cpp * * When launching: * @@ -199,7 +203,7 @@ Table of Contents * * the program output is: * - * \include Alpha_complex/alphaoffreader_for_doc_32.txt + * \include alphaoffreader_for_doc_32.txt * * * \section weighted3dexample 3d specific version @@ -210,12 +214,12 @@ Table of Contents * Gudhi::alpha_complex::complexity::EXACT. * * This example builds the CGAL 3d weighted alpha shapes from a small molecule, and initializes the alpha complex with - * it. This example is taken from <a href="https://doc.cgal.org/latest/Alpha_shapes_3/index.html#title13">CGAL 3d + * it. This example is taken from <a href="https://doc.cgal.org/latest/Alpha_shapes_3/index.html#AlphaShape_3DExampleforWeightedAlphaShapes">CGAL 3d * weighted alpha shapes</a>. * * Then, it is asked to display information about the alpha complex. * - * \include Alpha_complex/Weighted_alpha_complex_3d_from_points.cpp + * \include Weighted_alpha_complex_3d_from_points.cpp * * The results will be the same as in \ref weightedversion . * diff --git a/src/Alpha_complex/include/gudhi/Alpha_complex.h b/src/Alpha_complex/include/gudhi/Alpha_complex.h index b315fa99..a7372f19 100644 --- a/src/Alpha_complex/include/gudhi/Alpha_complex.h +++ b/src/Alpha_complex/include/gudhi/Alpha_complex.h @@ -17,9 +17,9 @@ // to construct Alpha_complex from a OFF file of points #include <gudhi/Points_off_io.h> -#include <stdlib.h> -#include <math.h> // isnan, fmax +#include <cmath> // isnan, fmax #include <memory> // for std::unique_ptr +#include <cstddef> // for std::size_t #include <CGAL/Delaunay_triangulation.h> #include <CGAL/Regular_triangulation.h> // aka. Weighted Delaunay triangulation @@ -44,6 +44,7 @@ #include <utility> // std::pair #include <stdexcept> #include <numeric> // for std::iota +#include <algorithm> // for std::sort // Make compilation fail - required for external projects - https://github.com/GUDHI/gudhi-devel/issues/10 #if CGAL_VERSION_NR < 1041101000 @@ -68,7 +69,7 @@ template<typename D> struct Is_Epeck_D<CGAL::Epeck_d<D>> { static const bool val * \ingroup alpha_complex * * \details - * The data structure is constructing a CGAL Delaunay triangulation (for more informations on CGAL Delaunay + * The data structure is constructing a CGAL Delaunay triangulation (for more information on CGAL Delaunay * triangulation, please refer to the corresponding chapter in page http://doc.cgal.org/latest/Triangulation/) from a * range of points or from an OFF file (cf. Points_off_reader). * @@ -100,13 +101,17 @@ template<typename D> struct Is_Epeck_D<CGAL::Epeck_d<D>> { static const bool val */ template<class Kernel = CGAL::Epeck_d<CGAL::Dynamic_dimension_tag>, bool Weighted = false> class Alpha_complex { + private: + // Vertex_handle internal type (required by triangulation_ and vertices_). + using Internal_vertex_handle = std::ptrdiff_t; + public: /** \brief Geometric traits class that provides the geometric types and predicates needed by the triangulations.*/ using Geom_traits = std::conditional_t<Weighted, CGAL::Regular_triangulation_traits_adapter<Kernel>, Kernel>; // Add an int in TDS to save point index in the structure using TDS = CGAL::Triangulation_data_structure<typename Geom_traits::Dimension, - CGAL::Triangulation_vertex<Geom_traits, std::ptrdiff_t>, + CGAL::Triangulation_vertex<Geom_traits, Internal_vertex_handle>, CGAL::Triangulation_full_cell<Geom_traits> >; /** \brief A (Weighted or not) Delaunay triangulation of a set of points in \f$ \mathbb{R}^D\f$.*/ @@ -131,9 +136,6 @@ class Alpha_complex { // Vertex_iterator type from CGAL. using CGAL_vertex_iterator = typename Triangulation::Vertex_iterator; - // size_type type from CGAL. - using size_type = typename Triangulation::size_type; - // Structure to switch from simplex tree vertex handle to CGAL vertex iterator. using Vector_vertex_iterator = std::vector< CGAL_vertex_iterator >; @@ -145,6 +147,10 @@ class Alpha_complex { std::unique_ptr<Triangulation> triangulation_; /** \brief Kernel for triangulation_ functions access.*/ A_kernel_d kernel_; + /** \brief Vertices to be inserted first by the create_complex method to avoid quadratic complexity. + * It isn't just [0, n) if some points have multiplicity (only one copy appears in the complex). + */ + std::vector<Internal_vertex_handle> vertices_; /** \brief Cache for geometric constructions: circumcenter and squared radius of a simplex.*/ std::vector<Sphere> cache_, old_cache_; @@ -213,6 +219,15 @@ class Alpha_complex { Alpha_complex (Alpha_complex&& other) = delete; Alpha_complex& operator= (Alpha_complex&& other) = delete; + /** \brief Returns the number of finite vertices in the triangulation. + */ + std::size_t num_vertices() const { + if (triangulation_ == nullptr) + return 0; + else + return triangulation_->number_of_vertices(); + } + /** \brief get_point returns the point corresponding to the vertex given as parameter. * * @param[in] vertex Vertex handle of the point to retrieve. @@ -247,11 +262,11 @@ class Alpha_complex { std::vector<Point_d> point_cloud(first, last); // Creates a vector {0, 1, ..., N-1} - std::vector<std::ptrdiff_t> indices(boost::counting_iterator<std::ptrdiff_t>(0), - boost::counting_iterator<std::ptrdiff_t>(point_cloud.size())); + std::vector<Internal_vertex_handle> indices(boost::counting_iterator<Internal_vertex_handle>(0), + boost::counting_iterator<Internal_vertex_handle>(point_cloud.size())); using Point_property_map = boost::iterator_property_map<typename std::vector<Point_d>::iterator, - CGAL::Identity_property_map<std::ptrdiff_t>>; + CGAL::Identity_property_map<Internal_vertex_handle>>; using Search_traits_d = CGAL::Spatial_sort_traits_adapter_d<Geom_traits, Point_property_map>; CGAL::spatial_sort(indices.begin(), indices.end(), Search_traits_d(std::begin(point_cloud))); @@ -269,6 +284,9 @@ class Alpha_complex { // structure to retrieve CGAL points from vertex handle - one vertex handle per point. // Needs to be constructed before as vertex handles arrives in no particular order. vertex_handle_to_iterator_.resize(point_cloud.size()); + // List of sorted unique vertices in the triangulation. We take advantage of the existing loop to construct it + // Vertices list avoids quadratic complexity with the Simplex_tree. We should not fill it up with Toplex_map e.g. + vertices_.reserve(triangulation_->number_of_vertices()); // Loop on triangulation vertices list for (CGAL_vertex_iterator vit = triangulation_->vertices_begin(); vit != triangulation_->vertices_end(); ++vit) { if (!triangulation_->is_infinite(*vit)) { @@ -276,8 +294,10 @@ class Alpha_complex { std::clog << "Vertex insertion - " << vit->data() << " -> " << vit->point() << std::endl; #endif // DEBUG_TRACES vertex_handle_to_iterator_[vit->data()] = vit; + vertices_.push_back(vit->data()); } } + std::sort(vertices_.begin(), vertices_.end()); // -------------------------------------------------------------------------------------------- } } @@ -373,13 +393,22 @@ class Alpha_complex { // -------------------------------------------------------------------------------------------- // Simplex_tree construction from loop on triangulation finite full cells list - if (triangulation_->number_of_vertices() > 0) { + if (num_vertices() > 0) { + std::vector<Vertex_handle> one_vertex(1); + for (auto vertex : vertices_) { +#ifdef DEBUG_TRACES + std::clog << "SimplicialComplex insertion " << vertex << std::endl; +#endif // DEBUG_TRACES + one_vertex[0] = vertex; + complex.insert_simplex_and_subfaces(one_vertex, std::numeric_limits<double>::quiet_NaN()); + } + for (auto cit = triangulation_->finite_full_cells_begin(); cit != triangulation_->finite_full_cells_end(); ++cit) { Vector_vertex vertexVector; #ifdef DEBUG_TRACES - std::clog << "Simplex_tree insertion "; + std::clog << "SimplicialComplex insertion "; #endif // DEBUG_TRACES for (auto vit = cit->vertices_begin(); vit != cit->vertices_end(); ++vit) { if (*vit != nullptr) { @@ -435,8 +464,10 @@ class Alpha_complex { // -------------------------------------------------------------------------------------------- // -------------------------------------------------------------------------------------------- - // As Alpha value is an approximation, we have to make filtration non decreasing while increasing the dimension - complex.make_filtration_non_decreasing(); + if (!exact) + // As Alpha value is an approximation, we have to make filtration non decreasing while increasing the dimension + // Only in not exact version, cf. https://github.com/GUDHI/gudhi-devel/issues/57 + complex.make_filtration_non_decreasing(); // Remove all simplices that have a filtration value greater than max_alpha_square complex.prune_above_filtration(max_alpha_square); // -------------------------------------------------------------------------------------------- @@ -449,10 +480,10 @@ class Alpha_complex { void propagate_alpha_filtration(SimplicialComplexForAlpha& complex, Simplex_handle f_simplex) { // From SimplicialComplexForAlpha type required to assign filtration values. using Filtration_value = typename SimplicialComplexForAlpha::Filtration_value; - using Vertex_handle = typename SimplicialComplexForAlpha::Vertex_handle; // ### Foreach Tau face of Sigma - for (auto f_boundary : complex.boundary_simplex_range(f_simplex)) { + for (auto face_opposite_vertex : complex.boundary_opposite_vertex_simplex_range(f_simplex)) { + auto f_boundary = face_opposite_vertex.first; #ifdef DEBUG_TRACES std::clog << " | --------------------------------------------------\n"; std::clog << " | Tau "; @@ -473,18 +504,10 @@ class Alpha_complex { #endif // DEBUG_TRACES // ### Else } else { - // Find which vertex of f_simplex is missing in f_boundary. We could actually write a variant of boundary_simplex_range that gives pairs (f_boundary, vertex). We rely on the fact that simplex_vertex_range is sorted. - auto longlist = complex.simplex_vertex_range(f_simplex); - auto shortlist = complex.simplex_vertex_range(f_boundary); - auto longiter = std::begin(longlist); - auto shortiter = std::begin(shortlist); - auto enditer = std::end(shortlist); - while(shortiter != enditer && *longiter == *shortiter) { ++longiter; ++shortiter; } - Vertex_handle extra = *longiter; auto const& cache=get_cache(complex, f_boundary); - bool is_gab = kernel_.is_gabriel(cache, get_point_(extra)); + bool is_gab = kernel_.is_gabriel(cache, get_point_(face_opposite_vertex.second)); #ifdef DEBUG_TRACES - std::clog << " | Tau is_gabriel(Sigma)=" << is_gab << " - vertexForGabriel=" << extra << std::endl; + std::clog << " | Tau is_gabriel(Sigma)=" << is_gab << " - vertexForGabriel=" << face_opposite_vertex.second << std::endl; #endif // DEBUG_TRACES // ### If Tau is not Gabriel of Sigma if (false == is_gab) { diff --git a/src/Alpha_complex/include/gudhi/Alpha_complex_3d.h b/src/Alpha_complex/include/gudhi/Alpha_complex_3d.h index 4e5fc933..562ef139 100644 --- a/src/Alpha_complex/include/gudhi/Alpha_complex_3d.h +++ b/src/Alpha_complex/include/gudhi/Alpha_complex_3d.h @@ -12,7 +12,6 @@ #ifndef ALPHA_COMPLEX_3D_H_ #define ALPHA_COMPLEX_3D_H_ -#include <boost/version.hpp> #include <boost/variant.hpp> #include <boost/range/size.hpp> #include <boost/range/combine.hpp> @@ -58,8 +57,6 @@ namespace Gudhi { namespace alpha_complex { -thread_local double RELATIVE_PRECISION_OF_TO_DOUBLE = 0.00001; - // Value_from_iterator returns the filtration value from an iterator on alpha shapes values // // FAST SAFE EXACT @@ -101,7 +98,7 @@ struct Value_from_iterator<complexity::EXACT> { * \tparam Periodic Boolean used to set/unset the periodic version of Alpha_complex_3d. Default value is false. * * For the weighted version, weights values are explained on CGAL - * <a href="https://doc.cgal.org/latest/Alpha_shapes_3/index.html#title0">Alpha shapes 3d</a> and + * <a href="https://doc.cgal.org/latest/Alpha_shapes_3/index.html#Alpha_shapes_3Definitions">Alpha shapes 3d</a> and * <a href="https://doc.cgal.org/latest/Triangulation_3/index.html#Triangulation3secclassRegulartriangulation">Regular * triangulation</a> documentation. * @@ -554,8 +551,10 @@ Weighted_alpha_complex_3d::Weighted_point_3 wp0(Weighted_alpha_complex_3d::Bare_ std::clog << "cells \t\t" << count_cells << std::endl; #endif // DEBUG_TRACES // -------------------------------------------------------------------------------------------- - // As Alpha value is an approximation, we have to make filtration non decreasing while increasing the dimension - complex.make_filtration_non_decreasing(); + if (Complexity == complexity::FAST) + // As Alpha value is an approximation, we have to make filtration non decreasing while increasing the dimension + // Only in FAST version, cf. https://github.com/GUDHI/gudhi-devel/issues/57 + complex.make_filtration_non_decreasing(); // Remove all simplices that have a filtration value greater than max_alpha_square complex.prune_above_filtration(max_alpha_square); // -------------------------------------------------------------------------------------------- diff --git a/src/Alpha_complex/test/Alpha_complex_dim3_unit_test.cpp b/src/Alpha_complex/test/Alpha_complex_dim3_unit_test.cpp new file mode 100644 index 00000000..e7c261f1 --- /dev/null +++ b/src/Alpha_complex/test/Alpha_complex_dim3_unit_test.cpp @@ -0,0 +1,117 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Vincent Rouvreau + * + * Copyright (C) 2015 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#define BOOST_TEST_DYN_LINK +#define BOOST_TEST_MODULE "alpha_complex_dim3" +#include <boost/test/unit_test.hpp> +#include <boost/mpl/list.hpp> + +#include <CGAL/Epick_d.h> +#include <CGAL/Epeck_d.h> + +#include <stdexcept> // std::out_of_range +#include <string> +#include <vector> + +#include <gudhi/Alpha_complex.h> +#include <gudhi/Simplex_tree.h> + +// Use dynamic_dimension_tag for the user to be able to set dimension +typedef CGAL::Epeck_d< CGAL::Dynamic_dimension_tag > Exact_kernel_d; +// Use static dimension_tag for the user not to be able to set dimension +typedef CGAL::Epeck_d< CGAL::Dimension_tag<3> > Exact_kernel_s; +// Use dynamic_dimension_tag for the user to be able to set dimension +typedef CGAL::Epick_d< CGAL::Dynamic_dimension_tag > Inexact_kernel_d; +// Use static dimension_tag for the user not to be able to set dimension +typedef CGAL::Epick_d< CGAL::Dimension_tag<3> > Inexact_kernel_s; +// The triangulation uses the default instantiation of the TriangulationDataStructure template parameter + +typedef boost::mpl::list<Exact_kernel_d, Exact_kernel_s, Inexact_kernel_d, Inexact_kernel_s> list_of_kernel_variants; + +BOOST_AUTO_TEST_CASE_TEMPLATE(Alpha_complex_from_OFF_file, TestedKernel, list_of_kernel_variants) { + // ---------------------------------------------------------------------------- + // + // Init of an alpha-complex from a OFF file + // + // ---------------------------------------------------------------------------- + std::string off_file_name("alphacomplexdoc.off"); + double max_alpha_square_value = 60.0; + std::clog << "========== OFF FILE NAME = " << off_file_name << " - alpha²=" << + max_alpha_square_value << "==========" << std::endl; + + Gudhi::alpha_complex::Alpha_complex<TestedKernel> alpha_complex_from_file(off_file_name); + + Gudhi::Simplex_tree<> simplex_tree_60; + BOOST_CHECK(alpha_complex_from_file.create_complex(simplex_tree_60, max_alpha_square_value)); + + std::clog << "alpha_complex_from_file.num_vertices()=" << alpha_complex_from_file.num_vertices() << std::endl; + BOOST_CHECK(alpha_complex_from_file.num_vertices() == 7); + + std::clog << "simplex_tree_60.dimension()=" << simplex_tree_60.dimension() << std::endl; + BOOST_CHECK(simplex_tree_60.dimension() == 2); + + std::clog << "simplex_tree_60.num_vertices()=" << simplex_tree_60.num_vertices() << std::endl; + BOOST_CHECK(simplex_tree_60.num_vertices() == 7); + + std::clog << "simplex_tree_60.num_simplices()=" << simplex_tree_60.num_simplices() << std::endl; + BOOST_CHECK(simplex_tree_60.num_simplices() == 25); + + max_alpha_square_value = 59.0; + std::clog << "========== OFF FILE NAME = " << off_file_name << " - alpha²=" << + max_alpha_square_value << "==========" << std::endl; + + Gudhi::Simplex_tree<> simplex_tree_59; + BOOST_CHECK(alpha_complex_from_file.create_complex(simplex_tree_59, max_alpha_square_value)); + + std::clog << "alpha_complex_from_file.num_vertices()=" << alpha_complex_from_file.num_vertices() << std::endl; + BOOST_CHECK(alpha_complex_from_file.num_vertices() == 7); + + std::clog << "simplex_tree_59.dimension()=" << simplex_tree_59.dimension() << std::endl; + BOOST_CHECK(simplex_tree_59.dimension() == 2); + + std::clog << "simplex_tree_59.num_vertices()=" << simplex_tree_59.num_vertices() << std::endl; + BOOST_CHECK(simplex_tree_59.num_vertices() == 7); + + std::clog << "simplex_tree_59.num_simplices()=" << simplex_tree_59.num_simplices() << std::endl; + BOOST_CHECK(simplex_tree_59.num_simplices() == 23); +} + + +BOOST_AUTO_TEST_CASE_TEMPLATE(Alpha_complex_from_empty_points, TestedKernel, list_of_kernel_variants) { + std::clog << "========== Alpha_complex_from_empty_points ==========" << std::endl; + + // ---------------------------------------------------------------------------- + // Init of an empty list of points + // ---------------------------------------------------------------------------- + std::vector<typename TestedKernel::Point_d> points; + + // ---------------------------------------------------------------------------- + // Init of an alpha complex from the list of points + // ---------------------------------------------------------------------------- + Gudhi::alpha_complex::Alpha_complex<TestedKernel> alpha_complex_from_points(points); + + std::clog << "alpha_complex_from_points.num_vertices()=" << alpha_complex_from_points.num_vertices() << std::endl; + BOOST_CHECK(alpha_complex_from_points.num_vertices() == points.size()); + + // Test to the limit + BOOST_CHECK_THROW (alpha_complex_from_points.get_point(0), std::out_of_range); + + Gudhi::Simplex_tree<> simplex_tree; + BOOST_CHECK(!alpha_complex_from_points.create_complex(simplex_tree)); + + std::clog << "simplex_tree.num_simplices()=" << simplex_tree.num_simplices() << std::endl; + BOOST_CHECK(simplex_tree.num_simplices() == 0); + + std::clog << "simplex_tree.dimension()=" << simplex_tree.dimension() << std::endl; + BOOST_CHECK(simplex_tree.dimension() == -1); + + std::clog << "simplex_tree.num_vertices()=" << simplex_tree.num_vertices() << std::endl; + BOOST_CHECK(simplex_tree.num_vertices() == points.size()); +} diff --git a/src/Alpha_complex/test/Alpha_complex_unit_test.cpp b/src/Alpha_complex/test/Alpha_complex_unit_test.cpp index 4b37e4bd..b474917f 100644 --- a/src/Alpha_complex/test/Alpha_complex_unit_test.cpp +++ b/src/Alpha_complex/test/Alpha_complex_unit_test.cpp @@ -13,75 +13,17 @@ #include <boost/test/unit_test.hpp> #include <boost/mpl/list.hpp> -#include <CGAL/Delaunay_triangulation.h> #include <CGAL/Epick_d.h> #include <CGAL/Epeck_d.h> -#include <cmath> // float comparison -#include <limits> +#include <stdexcept> // std::out_of_range #include <string> #include <vector> #include <gudhi/Alpha_complex.h> -// to construct a simplex_tree from Delaunay_triangulation -#include <gudhi/graph_simplicial_complex.h> #include <gudhi/Simplex_tree.h> #include <gudhi/Unitary_tests_utils.h> -// Use dynamic_dimension_tag for the user to be able to set dimension -typedef CGAL::Epeck_d< CGAL::Dynamic_dimension_tag > Exact_kernel_d; -// Use static dimension_tag for the user not to be able to set dimension -typedef CGAL::Epeck_d< CGAL::Dimension_tag<3> > Exact_kernel_s; -// Use dynamic_dimension_tag for the user to be able to set dimension -typedef CGAL::Epick_d< CGAL::Dynamic_dimension_tag > Inexact_kernel_d; -// Use static dimension_tag for the user not to be able to set dimension -typedef CGAL::Epick_d< CGAL::Dimension_tag<3> > Inexact_kernel_s; -// The triangulation uses the default instantiation of the TriangulationDataStructure template parameter - -typedef boost::mpl::list<Exact_kernel_d, Exact_kernel_s, Inexact_kernel_d, Inexact_kernel_s> list_of_kernel_variants; - -BOOST_AUTO_TEST_CASE_TEMPLATE(Alpha_complex_from_OFF_file, TestedKernel, list_of_kernel_variants) { - // ---------------------------------------------------------------------------- - // - // Init of an alpha-complex from a OFF file - // - // ---------------------------------------------------------------------------- - std::string off_file_name("alphacomplexdoc.off"); - double max_alpha_square_value = 60.0; - std::clog << "========== OFF FILE NAME = " << off_file_name << " - alpha²=" << - max_alpha_square_value << "==========" << std::endl; - - Gudhi::alpha_complex::Alpha_complex<TestedKernel> alpha_complex_from_file(off_file_name); - - Gudhi::Simplex_tree<> simplex_tree_60; - BOOST_CHECK(alpha_complex_from_file.create_complex(simplex_tree_60, max_alpha_square_value)); - - std::clog << "simplex_tree_60.dimension()=" << simplex_tree_60.dimension() << std::endl; - BOOST_CHECK(simplex_tree_60.dimension() == 2); - - std::clog << "simplex_tree_60.num_vertices()=" << simplex_tree_60.num_vertices() << std::endl; - BOOST_CHECK(simplex_tree_60.num_vertices() == 7); - - std::clog << "simplex_tree_60.num_simplices()=" << simplex_tree_60.num_simplices() << std::endl; - BOOST_CHECK(simplex_tree_60.num_simplices() == 25); - - max_alpha_square_value = 59.0; - std::clog << "========== OFF FILE NAME = " << off_file_name << " - alpha²=" << - max_alpha_square_value << "==========" << std::endl; - - Gudhi::Simplex_tree<> simplex_tree_59; - BOOST_CHECK(alpha_complex_from_file.create_complex(simplex_tree_59, max_alpha_square_value)); - - std::clog << "simplex_tree_59.dimension()=" << simplex_tree_59.dimension() << std::endl; - BOOST_CHECK(simplex_tree_59.dimension() == 2); - - std::clog << "simplex_tree_59.num_vertices()=" << simplex_tree_59.num_vertices() << std::endl; - BOOST_CHECK(simplex_tree_59.num_vertices() == 7); - - std::clog << "simplex_tree_59.num_simplices()=" << simplex_tree_59.num_simplices() << std::endl; - BOOST_CHECK(simplex_tree_59.num_simplices() == 23); -} - // Use static dimension_tag for the user not to be able to set dimension typedef CGAL::Epeck_d< CGAL::Dimension_tag<4> > Kernel_4; typedef Kernel_4::Point_d Point_4; @@ -120,6 +62,9 @@ BOOST_AUTO_TEST_CASE(Alpha_complex_from_points) { Gudhi::Simplex_tree<> simplex_tree; BOOST_CHECK(alpha_complex_from_points.create_complex(simplex_tree)); + std::clog << "alpha_complex_from_points.num_vertices()=" << alpha_complex_from_points.num_vertices() << std::endl; + BOOST_CHECK(alpha_complex_from_points.num_vertices() == points.size()); + // Another way to check num_simplices std::clog << "Iterator on alpha complex simplices in the filtration order, with [filtration value]:" << std::endl; int num_simplices = 0; @@ -227,34 +172,6 @@ BOOST_AUTO_TEST_CASE(Alpha_complex_from_points) { } -BOOST_AUTO_TEST_CASE_TEMPLATE(Alpha_complex_from_empty_points, TestedKernel, list_of_kernel_variants) { - std::clog << "========== Alpha_complex_from_empty_points ==========" << std::endl; - - // ---------------------------------------------------------------------------- - // Init of an empty list of points - // ---------------------------------------------------------------------------- - std::vector<typename TestedKernel::Point_d> points; - - // ---------------------------------------------------------------------------- - // Init of an alpha complex from the list of points - // ---------------------------------------------------------------------------- - Gudhi::alpha_complex::Alpha_complex<TestedKernel> alpha_complex_from_points(points); - - // Test to the limit - BOOST_CHECK_THROW (alpha_complex_from_points.get_point(0), std::out_of_range); - - Gudhi::Simplex_tree<> simplex_tree; - BOOST_CHECK(!alpha_complex_from_points.create_complex(simplex_tree)); - - std::clog << "simplex_tree.num_simplices()=" << simplex_tree.num_simplices() << std::endl; - BOOST_CHECK(simplex_tree.num_simplices() == 0); - - std::clog << "simplex_tree.dimension()=" << simplex_tree.dimension() << std::endl; - BOOST_CHECK(simplex_tree.dimension() == -1); - - std::clog << "simplex_tree.num_vertices()=" << simplex_tree.num_vertices() << std::endl; - BOOST_CHECK(simplex_tree.num_vertices() == points.size()); -} using Inexact_kernel_2 = CGAL::Epick_d< CGAL::Dimension_tag<2> >; using Exact_kernel_2 = CGAL::Epeck_d< CGAL::Dimension_tag<2> >; @@ -291,6 +208,9 @@ BOOST_AUTO_TEST_CASE_TEMPLATE(Alpha_complex_with_duplicated_points, TestedKernel std::clog << "create_complex" << std::endl; BOOST_CHECK(alpha_complex_from_points.create_complex(simplex_tree)); + std::clog << "alpha_complex_from_points.num_vertices()=" << alpha_complex_from_points.num_vertices() << std::endl; + BOOST_CHECK(alpha_complex_from_points.num_vertices() < points.size()); + std::clog << "simplex_tree.num_vertices()=" << simplex_tree.num_vertices() << std::endl; BOOST_CHECK(simplex_tree.num_vertices() < points.size()); diff --git a/src/Alpha_complex/test/CMakeLists.txt b/src/Alpha_complex/test/CMakeLists.txt index 0595ca92..dd2c235f 100644 --- a/src/Alpha_complex/test/CMakeLists.txt +++ b/src/Alpha_complex/test/CMakeLists.txt @@ -8,14 +8,18 @@ if (NOT CGAL_WITH_EIGEN3_VERSION VERSION_LESS 4.11.0) add_executable ( Alpha_complex_test_unit Alpha_complex_unit_test.cpp ) target_link_libraries(Alpha_complex_test_unit ${CGAL_LIBRARY}) + add_executable ( Alpha_complex_dim3_test_unit Alpha_complex_dim3_unit_test.cpp ) + target_link_libraries(Alpha_complex_dim3_test_unit ${CGAL_LIBRARY}) add_executable ( Delaunay_complex_test_unit Delaunay_complex_unit_test.cpp ) target_link_libraries(Delaunay_complex_test_unit ${CGAL_LIBRARY}) if (TBB_FOUND) target_link_libraries(Alpha_complex_test_unit ${TBB_LIBRARIES}) + target_link_libraries(Alpha_complex_dim3_test_unit ${TBB_LIBRARIES}) target_link_libraries(Delaunay_complex_test_unit ${TBB_LIBRARIES}) endif() gudhi_add_boost_test(Alpha_complex_test_unit) + gudhi_add_boost_test(Alpha_complex_dim3_test_unit) gudhi_add_boost_test(Delaunay_complex_test_unit) endif (NOT CGAL_WITH_EIGEN3_VERSION VERSION_LESS 4.11.0) @@ -73,4 +77,4 @@ if (NOT CGAL_WITH_EIGEN3_VERSION VERSION_LESS 5.1.0) endif() gudhi_add_boost_test(Zero_weighted_alpha_complex_test_unit) -endif (NOT CGAL_WITH_EIGEN3_VERSION VERSION_LESS 5.1.0)
\ No newline at end of file +endif (NOT CGAL_WITH_EIGEN3_VERSION VERSION_LESS 5.1.0) diff --git a/src/Alpha_complex/utilities/alpha_complex_3d_persistence.cpp b/src/Alpha_complex/utilities/alpha_complex_3d_persistence.cpp index 91899040..e65d8c6f 100644 --- a/src/Alpha_complex/utilities/alpha_complex_3d_persistence.cpp +++ b/src/Alpha_complex/utilities/alpha_complex_3d_persistence.cpp @@ -263,7 +263,7 @@ void program_options(int argc, char *argv[], std::string &off_file_points, bool "cuboid-file,c", po::value<std::string>(&cuboid_file), "Name of file describing the periodic domain. Format is:\n min_hx min_hy min_hz\n max_hx max_hy max_hz")( "output-file,o", po::value<std::string>(&output_file_diag)->default_value(std::string()), - "Name of file in which the persistence diagram is written. Default print in std::clog")( + "Name of file in which the persistence diagram is written. Default print in standard output")( "max-alpha-square-value,r", po::value<Filtration_value>(&alpha_square_max_value) ->default_value(std::numeric_limits<Filtration_value>::infinity()), diff --git a/src/Alpha_complex/utilities/alpha_complex_persistence.cpp b/src/Alpha_complex/utilities/alpha_complex_persistence.cpp index e86b34e2..29edbd8e 100644 --- a/src/Alpha_complex/utilities/alpha_complex_persistence.cpp +++ b/src/Alpha_complex/utilities/alpha_complex_persistence.cpp @@ -163,7 +163,7 @@ void program_options(int argc, char *argv[], std::string &off_file_points, bool "weight-file,w", po::value<std::string>(&weight_file)->default_value(std::string()), "Name of file containing a point weights. Format is one weight per line:\n W1\n ...\n Wn ")( "output-file,o", po::value<std::string>(&output_file_diag)->default_value(std::string()), - "Name of file in which the persistence diagram is written. Default print in std::clog")( + "Name of file in which the persistence diagram is written. Default print in standard output")( "max-alpha-square-value,r", po::value<Filtration_value>(&alpha_square_max_value) ->default_value(std::numeric_limits<Filtration_value>::infinity()), "Maximal alpha square value for the Alpha complex construction.")( diff --git a/src/Alpha_complex/utilities/alphacomplex.md b/src/Alpha_complex/utilities/alphacomplex.md index 0d3c6027..1e3b8fab 100644 --- a/src/Alpha_complex/utilities/alphacomplex.md +++ b/src/Alpha_complex/utilities/alphacomplex.md @@ -64,7 +64,7 @@ N.B.: * Weights values are explained on CGAL
[dD Triangulations](https://doc.cgal.org/latest/Triangulation/index.html)
and
-[Regular triangulation](https://doc.cgal.org/latest/Triangulation/index.html#title20) documentation.
+[Regular triangulation](https://doc.cgal.org/latest/Triangulation/index.html#TriangulationSecRT) documentation.
## alpha_complex_3d_persistence ##
@@ -131,6 +131,6 @@ N.B.: * `alpha_complex_3d_persistence` only accepts OFF files in dimension 3.
* Filtration values are alpha square values.
* Weights values are explained on CGAL
-[Alpha shape](https://doc.cgal.org/latest/Alpha_shapes_3/index.html#title0)
+[Alpha shape](https://doc.cgal.org/latest/Alpha_shapes_3/index.html#Alpha_shapes_3Definitions)
and
[Regular triangulation](https://doc.cgal.org/latest/Triangulation_3/index.html#Triangulation3secclassRegulartriangulation) documentation.
diff --git a/src/Bitmap_cubical_complex/include/gudhi/Bitmap_cubical_complex.h b/src/Bitmap_cubical_complex/include/gudhi/Bitmap_cubical_complex.h index aa255ec2..29fabc6c 100644 --- a/src/Bitmap_cubical_complex/include/gudhi/Bitmap_cubical_complex.h +++ b/src/Bitmap_cubical_complex/include/gudhi/Bitmap_cubical_complex.h @@ -237,14 +237,20 @@ class Bitmap_cubical_complex : public T { * Filtration_simplex_iterator class provides an iterator though the whole structure in the order of filtration. * Secondary criteria for filtration are: * (1) Dimension of a cube (lower dimensional comes first). - * (2) Position in the data structure (the ones that are earlies in the data structure comes first). + * (2) Position in the data structure (the ones that are earliest in the data structure come first). **/ class Filtration_simplex_range; - class Filtration_simplex_iterator : std::iterator<std::input_iterator_tag, Simplex_handle> { + class Filtration_simplex_iterator { // Iterator over all simplices of the complex in the order of the indexing scheme. // 'value_type' must be 'Simplex_handle'. public: + typedef std::input_iterator_tag iterator_category; + typedef Simplex_handle value_type; + typedef std::ptrdiff_t difference_type; + typedef value_type* pointer; + typedef value_type reference; + Filtration_simplex_iterator(Bitmap_cubical_complex* b) : b(b), position(0) {} Filtration_simplex_iterator() : b(NULL), position(0) {} @@ -386,10 +392,16 @@ class Bitmap_cubical_complex : public T { **/ class Skeleton_simplex_range; - class Skeleton_simplex_iterator : std::iterator<std::input_iterator_tag, Simplex_handle> { + class Skeleton_simplex_iterator { // Iterator over all simplices of the complex in the order of the indexing scheme. // 'value_type' must be 'Simplex_handle'. public: + typedef std::input_iterator_tag iterator_category; + typedef Simplex_handle value_type; + typedef std::ptrdiff_t difference_type; + typedef value_type* pointer; + typedef value_type reference; + Skeleton_simplex_iterator(Bitmap_cubical_complex* b, std::size_t d) : b(b), dimension(d) { if (globalDbg) { std::clog << "Skeleton_simplex_iterator ( Bitmap_cubical_complex* b , std::size_t d )\n"; diff --git a/src/Bitmap_cubical_complex/include/gudhi/Bitmap_cubical_complex_base.h b/src/Bitmap_cubical_complex/include/gudhi/Bitmap_cubical_complex_base.h index f8f80ded..2bf62f9b 100644 --- a/src/Bitmap_cubical_complex/include/gudhi/Bitmap_cubical_complex_base.h +++ b/src/Bitmap_cubical_complex/include/gudhi/Bitmap_cubical_complex_base.h @@ -43,7 +43,7 @@ namespace cubical_complex { * Each cell is represented by a single * bit (in case of black and white bitmaps, or by a single element of a type T * (here T is a filtration type of a bitmap, typically a double). - * All the informations needed for homology and + * All the information needed for homology and * persistent homology computations (like dimension of a cell, boundary and * coboundary elements of a cell, are then obtained from the * position of the element in C. @@ -251,8 +251,14 @@ class Bitmap_cubical_complex_base { * @brief Iterator through all cells in the complex (in order they appear in the structure -- i.e. * in lexicographical order). **/ - class All_cells_iterator : std::iterator<std::input_iterator_tag, T> { + class All_cells_iterator { public: + typedef std::input_iterator_tag iterator_category; + typedef std::size_t value_type; + typedef std::ptrdiff_t difference_type; + typedef value_type* pointer; + typedef value_type reference; + All_cells_iterator() { this->counter = 0; } All_cells_iterator operator++() { @@ -355,8 +361,14 @@ class Bitmap_cubical_complex_base { * @brief Iterator through top dimensional cells of the complex. The cells appear in order they are stored * in the structure (i.e. in lexicographical order) **/ - class Top_dimensional_cells_iterator : std::iterator<std::input_iterator_tag, T> { + class Top_dimensional_cells_iterator { public: + typedef std::input_iterator_tag iterator_category; + typedef std::size_t value_type; + typedef std::ptrdiff_t difference_type; + typedef value_type* pointer; + typedef value_type reference; + Top_dimensional_cells_iterator(Bitmap_cubical_complex_base& b) : b(b) { this->counter = std::vector<std::size_t>(b.dimension()); // std::fill( this->counter.begin() , this->counter.end() , 0 ); diff --git a/src/Bottleneck_distance/doc/Intro_bottleneck_distance.h b/src/Bottleneck_distance/doc/Intro_bottleneck_distance.h index 2a988b4b..4f5a956c 100644 --- a/src/Bottleneck_distance/doc/Intro_bottleneck_distance.h +++ b/src/Bottleneck_distance/doc/Intro_bottleneck_distance.h @@ -64,7 +64,7 @@ int main() { * \section bottleneckbasicexample Basic example * * This other example computes the bottleneck distance from 2 persistence diagrams: - * \include Bottleneck_distance/bottleneck_basic_example.cpp + * \include bottleneck_basic_example.cpp * * \code Bottleneck distance = 0.75 diff --git a/src/Bottleneck_distance/doc/perturb_pd.png b/src/Bottleneck_distance/doc/perturb_pd.png Binary files differindex be638de0..eabf3c8c 100644 --- a/src/Bottleneck_distance/doc/perturb_pd.png +++ b/src/Bottleneck_distance/doc/perturb_pd.png diff --git a/src/Bottleneck_distance/include/gudhi/Neighbors_finder.h b/src/Bottleneck_distance/include/gudhi/Neighbors_finder.h index c65e6082..1d56f0b4 100644 --- a/src/Bottleneck_distance/include/gudhi/Neighbors_finder.h +++ b/src/Bottleneck_distance/include/gudhi/Neighbors_finder.h @@ -86,7 +86,7 @@ class Neighbors_finder { }; /** \internal \brief data structure used to find any point (including projections) in V near to a query point from U - * (which can be a projection) in a layered graph layer given as parmeter. + * (which can be a projection) in a layered graph layer given as parameter. * * V points have to be added manually using their index and before the first pull. A neighbor pulled is automatically * removed. diff --git a/src/Bottleneck_distance/include/gudhi/Persistence_graph.h b/src/Bottleneck_distance/include/gudhi/Persistence_graph.h index 33f03b9c..c1e10f8e 100644 --- a/src/Bottleneck_distance/include/gudhi/Persistence_graph.h +++ b/src/Bottleneck_distance/include/gudhi/Persistence_graph.h @@ -20,6 +20,7 @@ #include <vector> #include <algorithm> #include <limits> // for numeric_limits +#include <cmath> namespace Gudhi { @@ -31,7 +32,7 @@ namespace persistence_diagram { * \ingroup bottleneck_distance */ class Persistence_graph { - public: +public: /** \internal \brief Constructor taking 2 PersistenceDiagrams (concept) as parameters. */ template<typename Persistence_diagram1, typename Persistence_diagram2> Persistence_graph(const Persistence_diagram1& diag1, const Persistence_diagram2& diag2, double e); @@ -58,7 +59,7 @@ class Persistence_graph { /** \internal \brief Returns the corresponding internal point */ Internal_point get_v_point(int v_point_index) const; - private: +private: std::vector<Internal_point> u; std::vector<Internal_point> v; double b_alive; @@ -67,30 +68,54 @@ class Persistence_graph { template<typename Persistence_diagram1, typename Persistence_diagram2> Persistence_graph::Persistence_graph(const Persistence_diagram1 &diag1, const Persistence_diagram2 &diag2, double e) - : u(), v(), b_alive(0.) { + : u(), v(), b_alive(0.) { std::vector<double> u_alive; std::vector<double> v_alive; + std::vector<double> u_nalive; + std::vector<double> v_nalive; + int u_inf = 0; + int v_inf = 0; + double inf = std::numeric_limits<double>::infinity(); + double neginf = -inf; + for (auto it = std::begin(diag1); it != std::end(diag1); ++it) { - if (std::get<1>(*it) == std::numeric_limits<double>::infinity()) - u_alive.push_back(std::get<0>(*it)); - else if (std::get<1>(*it) - std::get<0>(*it) > e) - u.push_back(Internal_point(std::get<0>(*it), std::get<1>(*it), u.size())); + if (std::get<0>(*it) != inf && std::get<1>(*it) != neginf){ + if (std::get<0>(*it) == neginf && std::get<1>(*it) == inf) + u_inf++; + else if (std::get<0>(*it) == neginf) + u_nalive.push_back(std::get<1>(*it)); + else if (std::get<1>(*it) == inf) + u_alive.push_back(std::get<0>(*it)); + else if (std::get<1>(*it) - std::get<0>(*it) > e) + u.push_back(Internal_point(std::get<0>(*it), std::get<1>(*it), u.size())); + } } for (auto it = std::begin(diag2); it != std::end(diag2); ++it) { - if (std::get<1>(*it) == std::numeric_limits<double>::infinity()) - v_alive.push_back(std::get<0>(*it)); - else if (std::get<1>(*it) - std::get<0>(*it) > e) - v.push_back(Internal_point(std::get<0>(*it), std::get<1>(*it), v.size())); + if (std::get<0>(*it) != inf && std::get<1>(*it) != neginf){ + if (std::get<0>(*it) == neginf && std::get<1>(*it) == inf) + v_inf++; + else if (std::get<0>(*it) == neginf) + v_nalive.push_back(std::get<1>(*it)); + else if (std::get<1>(*it) == inf) + v_alive.push_back(std::get<0>(*it)); + else if (std::get<1>(*it) - std::get<0>(*it) > e) + v.push_back(Internal_point(std::get<0>(*it), std::get<1>(*it), v.size())); + } } if (u.size() < v.size()) swap(u, v); - std::sort(u_alive.begin(), u_alive.end()); - std::sort(v_alive.begin(), v_alive.end()); - if (u_alive.size() != v_alive.size()) { + + if (u_alive.size() != v_alive.size() || u_nalive.size() != v_nalive.size() || u_inf != v_inf) { b_alive = std::numeric_limits<double>::infinity(); } else { + std::sort(u_alive.begin(), u_alive.end()); + std::sort(v_alive.begin(), v_alive.end()); + std::sort(u_nalive.begin(), u_nalive.end()); + std::sort(v_nalive.begin(), v_nalive.end()); for (auto it_u = u_alive.cbegin(), it_v = v_alive.cbegin(); it_u != u_alive.cend(); ++it_u, ++it_v) b_alive = (std::max)(b_alive, std::fabs(*it_u - *it_v)); + for (auto it_u = u_nalive.cbegin(), it_v = v_nalive.cbegin(); it_u != u_nalive.cend(); ++it_u, ++it_v) + b_alive = (std::max)(b_alive, std::fabs(*it_u - *it_v)); } } @@ -104,12 +129,12 @@ inline bool Persistence_graph::on_the_v_diagonal(int v_point_index) const { inline int Persistence_graph::corresponding_point_in_u(int v_point_index) const { return on_the_v_diagonal(v_point_index) ? - v_point_index - static_cast<int> (v.size()) : v_point_index + static_cast<int> (u.size()); + v_point_index - static_cast<int> (v.size()) : v_point_index + static_cast<int> (u.size()); } inline int Persistence_graph::corresponding_point_in_v(int u_point_index) const { return on_the_u_diagonal(u_point_index) ? - u_point_index - static_cast<int> (u.size()) : u_point_index + static_cast<int> (v.size()); + u_point_index - static_cast<int> (u.size()) : u_point_index + static_cast<int> (v.size()); } inline double Persistence_graph::distance(int u_point_index, int v_point_index) const { diff --git a/src/Bottleneck_distance/test/bottleneck_unit_test.cpp b/src/Bottleneck_distance/test/bottleneck_unit_test.cpp index 44141baa..9872f20c 100644 --- a/src/Bottleneck_distance/test/bottleneck_unit_test.cpp +++ b/src/Bottleneck_distance/test/bottleneck_unit_test.cpp @@ -159,3 +159,81 @@ BOOST_AUTO_TEST_CASE(global) { BOOST_CHECK(bottleneck_distance(empty, empty) == 0); BOOST_CHECK(bottleneck_distance(empty, one) == 1); } + +BOOST_AUTO_TEST_CASE(neg_global) { + std::uniform_real_distribution<double> unif1(0., upper_bound); + std::uniform_real_distribution<double> unif2(upper_bound / 10000., upper_bound / 100.); + std::default_random_engine re; + std::vector< std::pair<double, double> > v1, v2; + for (int i = 0; i < n1; i++) { + double a = std::log(unif1(re)); + double b = std::log(unif1(re)); + double x = std::log(unif2(re)); + double y = std::log(unif2(re)); + v1.emplace_back(std::min(a, b), std::max(a, b)); + v2.emplace_back(std::min(a, b) + std::min(x, y), std::max(a, b) + std::max(x, y)); + if (i % 5 == 0) + v1.emplace_back(std::min(a, b), std::min(a, b) + x); + if (i % 3 == 0) + v2.emplace_back(std::max(a, b), std::max(a, b) + y); + } + BOOST_CHECK(bottleneck_distance(v1, v2, 0.) <= upper_bound / 100.); + BOOST_CHECK(bottleneck_distance(v1, v2, upper_bound / 10000.) <= upper_bound / 100. + upper_bound / 10000.); + BOOST_CHECK(std::abs(bottleneck_distance(v1, v2, 0.) - bottleneck_distance(v1, v2, upper_bound / 10000.)) <= upper_bound / 10000.); + + std::vector< std::pair<double, double> > empty; + std::vector< std::pair<double, double> > one = {{8, 10}}; + BOOST_CHECK(bottleneck_distance(empty, empty) == 0); + BOOST_CHECK(bottleneck_distance(empty, one) == 1); +} + +BOOST_AUTO_TEST_CASE(bottleneck_simple_test) { + std::vector< std::pair<double, double> > v1, v2; + double inf = std::numeric_limits<double>::infinity(); + double neginf = -inf; + double b; + + v1.emplace_back(9.6, 14.); + v2.emplace_back(9.5, 14.1); + + b = Gudhi::persistence_diagram::bottleneck_distance(v1, v2, 0.); + BOOST_CHECK(b > 0.09 && b < 0.11); + + v1.emplace_back(-34.974, -34.2); + + b = Gudhi::persistence_diagram::bottleneck_distance(v1, v2, 0.); + BOOST_CHECK(b > 0.386 && b < 0.388); + + v1.emplace_back(neginf, 3.7); + + b = Gudhi::persistence_diagram::bottleneck_distance(v1, v2, 0.); + BOOST_CHECK_EQUAL(b, inf); + + v2.emplace_back(neginf, 4.45); + + b = Gudhi::persistence_diagram::bottleneck_distance(v1, v2, 0.); + BOOST_CHECK(b > 0.74 && b < 0.76); + + v1.emplace_back(-60.6, 52.1); + v2.emplace_back(-61.5, 53.); + + b = Gudhi::persistence_diagram::bottleneck_distance(v1, v2, 0.); + BOOST_CHECK(b > 0.89 && b < 0.91); + + v1.emplace_back(3., inf); + v2.emplace_back(3.2, inf); + + b = Gudhi::persistence_diagram::bottleneck_distance(v1, v2, 0.); + BOOST_CHECK(b > 0.89 && b < 0.91); + + v1.emplace_back(neginf, inf); + v2.emplace_back(neginf, inf); + + b = Gudhi::persistence_diagram::bottleneck_distance(v1, v2, 0.); + BOOST_CHECK(b > 0.89 && b < 0.91); + + v2.emplace_back(6, inf); + + b = Gudhi::persistence_diagram::bottleneck_distance(v1, v2, 0.); + BOOST_CHECK_EQUAL(b, inf); +} diff --git a/src/Bottleneck_distance/utilities/bottleneckdistance.md b/src/Bottleneck_distance/utilities/bottleneckdistance.md index a81426cf..2f5dedc9 100644 --- a/src/Bottleneck_distance/utilities/bottleneckdistance.md +++ b/src/Bottleneck_distance/utilities/bottleneckdistance.md @@ -10,14 +10,14 @@ Leave the lines above as it is required by the web site generator 'Jekyll' {:/comment}
-## bottleneck_read_file_example ##
+## bottleneck_distance ##
This program computes the Bottleneck distance between two persistence diagram files.
**Usage**
```
- bottleneck_read_file_example <file_1.pers> <file_2.pers> [<tolerance>]
+ bottleneck_distance <file_1.pers> <file_2.pers> [<tolerance>]
```
where
diff --git a/src/CMakeLists.txt b/src/CMakeLists.txt index 79ec42c1..f9f77ef7 100644 --- a/src/CMakeLists.txt +++ b/src/CMakeLists.txt @@ -2,9 +2,9 @@ cmake_minimum_required(VERSION 3.5) project(GUDHI) -include(CMakeGUDHIVersion.txt) - list(APPEND CMAKE_MODULE_PATH "${CMAKE_SOURCE_DIR}/cmake/modules/") +include(CMakeGUDHIVersion.txt) +include(GUDHI_options) set(GUDHI_MODULES "" CACHE INTERNAL "GUDHI_MODULES") set(GUDHI_MISSING_MODULES "" CACHE INTERNAL "GUDHI_MISSING_MODULES") @@ -12,8 +12,12 @@ set(GUDHI_MISSING_MODULES "" CACHE INTERNAL "GUDHI_MISSING_MODULES") # This variable is used by Cython CMakeLists.txt and by GUDHI_third_party_libraries to know its path set(GUDHI_PYTHON_PATH "python") -# For third parties libraries management - To be done last as CGAL updates CMAKE_MODULE_PATH -include(GUDHI_third_party_libraries NO_POLICY_SCOPE) +include(GUDHI_submodules) + +if (WITH_GUDHI_THIRD_PARTY) + # For third parties libraries management - To be done last as CGAL updates CMAKE_MODULE_PATH + include(GUDHI_third_party_libraries NO_POLICY_SCOPE) +endif() include(GUDHI_compilation_flags) @@ -27,6 +31,7 @@ add_gudhi_module(Bottleneck_distance) add_gudhi_module(Cech_complex) add_gudhi_module(Contraction) add_gudhi_module(Collapse) +add_gudhi_module(Coxeter_triangulation) add_gudhi_module(Hasse_complex) add_gudhi_module(Persistence_representations) add_gudhi_module(Persistent_cohomology) @@ -66,7 +71,9 @@ foreach(GUDHI_MODULE ${GUDHI_MODULES}) endforeach() endforeach() -add_subdirectory(GudhUI) +if (WITH_GUDHI_THIRD_PARTY) + add_subdirectory(GudhUI) +endif() message("++ GUDHI_MODULES list is:\"${GUDHI_MODULES}\"") message("++ GUDHI_MISSING_MODULES list is:\"${GUDHI_MISSING_MODULES}\"") diff --git a/src/Cech_complex/benchmark/CMakeLists.txt b/src/Cech_complex/benchmark/CMakeLists.txt index bc54c0f3..a6b3d70b 100644 --- a/src/Cech_complex/benchmark/CMakeLists.txt +++ b/src/Cech_complex/benchmark/CMakeLists.txt @@ -1,13 +1,15 @@ project(Cech_complex_benchmark) -# Do not forget to copy test files in current binary dir -file(COPY "${CMAKE_SOURCE_DIR}/data/points/tore3D_1307.off" DESTINATION ${CMAKE_CURRENT_BINARY_DIR}/) +if (NOT CGAL_WITH_EIGEN3_VERSION VERSION_LESS 5.0.1) + # Do not forget to copy test files in current binary dir + file(COPY "${CMAKE_SOURCE_DIR}/data/points/tore3D_1307.off" DESTINATION ${CMAKE_CURRENT_BINARY_DIR}/) -if(TARGET Boost::filesystem) - add_executable(cech_complex_benchmark cech_complex_benchmark.cpp) - target_link_libraries(cech_complex_benchmark Boost::filesystem) + if(TARGET Boost::filesystem) + add_executable(cech_complex_benchmark cech_complex_benchmark.cpp) + target_link_libraries(cech_complex_benchmark Boost::filesystem) - if (TBB_FOUND) - target_link_libraries(cech_complex_benchmark ${TBB_LIBRARIES}) + if (TBB_FOUND) + target_link_libraries(cech_complex_benchmark ${TBB_LIBRARIES}) + endif() endif() -endif()
\ No newline at end of file +endif() diff --git a/src/Cech_complex/benchmark/cech_complex_benchmark.cpp b/src/Cech_complex/benchmark/cech_complex_benchmark.cpp index e489e8a4..a0e727be 100644 --- a/src/Cech_complex/benchmark/cech_complex_benchmark.cpp +++ b/src/Cech_complex/benchmark/cech_complex_benchmark.cpp @@ -10,12 +10,13 @@ #include <gudhi/Points_off_io.h> #include <gudhi/distance_functions.h> -#include <gudhi/graph_simplicial_complex.h> #include <gudhi/Clock.h> #include <gudhi/Rips_complex.h> #include <gudhi/Cech_complex.h> #include <gudhi/Simplex_tree.h> -#include <gudhi/Miniball.hpp> + +#include <CGAL/Epick_d.h> +#include <CGAL/Epeck_d.h> #include "boost/filesystem.hpp" // includes all needed Boost.Filesystem declarations @@ -26,107 +27,81 @@ using Simplex_tree = Gudhi::Simplex_tree<>; using Filtration_value = Simplex_tree::Filtration_value; using Point = std::vector<Filtration_value>; -using Point_cloud = std::vector<Point>; using Points_off_reader = Gudhi::Points_off_reader<Point>; -using Proximity_graph = Gudhi::Proximity_graph<Simplex_tree>; using Rips_complex = Gudhi::rips_complex::Rips_complex<Filtration_value>; -using Cech_complex = Gudhi::cech_complex::Cech_complex<Simplex_tree, Point_cloud>; - -class Minimal_enclosing_ball_radius { - public: - // boost::range_value is not SFINAE-friendly so we cannot use it in the return type - template <typename Point> - typename std::iterator_traits<typename boost::range_iterator<Point>::type>::value_type operator()( - const Point& p1, const Point& p2) const { - // Type def - using Point_cloud = std::vector<Point>; - using Point_iterator = typename Point_cloud::const_iterator; - using Coordinate_iterator = typename Point::const_iterator; - using Min_sphere = - typename Gudhi::Miniball::Miniball<Gudhi::Miniball::CoordAccessor<Point_iterator, Coordinate_iterator>>; - - Point_cloud point_cloud; - point_cloud.push_back(p1); - point_cloud.push_back(p2); - - GUDHI_CHECK((p1.end() - p1.begin()) != (p2.end() - p2.begin()), "inconsistent point dimensions"); - Min_sphere min_sphere(p1.end() - p1.begin(), point_cloud.begin(), point_cloud.end()); - return std::sqrt(min_sphere.squared_radius()); - } -}; +template<typename Kernel> +Simplex_tree benchmark_cech(const std::string& off_file_points, const Filtration_value& radius, const int& dim_max, const bool exact) { + using Point_cgal = typename Kernel::Point_d; + using Points_off_reader_cgal = Gudhi::Points_off_reader<Point_cgal>; + using Cech_complex = Gudhi::cech_complex::Cech_complex<Kernel, Simplex_tree>; + + // Extract the points from the file filepoints + Points_off_reader_cgal off_reader_cgal(off_file_points); + + Gudhi::Clock cech_clock("Cech computation"); + Cech_complex cech_complex_from_points(off_reader_cgal.get_point_cloud(), radius, exact); + Simplex_tree cech_stree; + cech_complex_from_points.create_complex(cech_stree, dim_max); + + // ------------------------------------------ + // Display information about the Cech complex + // ------------------------------------------ + double cech_sec = cech_clock.num_seconds(); + std::clog << cech_sec << " ; "; + return cech_stree; +} int main(int argc, char* argv[]) { - std::string off_file_points = "tore3D_1307.off"; - Filtration_value threshold = 1e20; - - // Extract the points from the file filepoints - Points_off_reader off_reader(off_file_points); - - Gudhi::Clock euclidean_clock("Gudhi::Euclidean_distance"); - // Compute the proximity graph of the points - Proximity_graph euclidean_prox_graph = Gudhi::compute_proximity_graph<Simplex_tree>( - off_reader.get_point_cloud(), threshold, Gudhi::Euclidean_distance()); - - std::clog << euclidean_clock << std::endl; - - Gudhi::Clock miniball_clock("Minimal_enclosing_ball_radius"); - // Compute the proximity graph of the points - Proximity_graph miniball_prox_graph = Gudhi::compute_proximity_graph<Simplex_tree>( - off_reader.get_point_cloud(), threshold, Minimal_enclosing_ball_radius()); - std::clog << miniball_clock << std::endl; - - Gudhi::Clock common_miniball_clock("Gudhi::Minimal_enclosing_ball_radius()"); - // Compute the proximity graph of the points - Proximity_graph common_miniball_prox_graph = Gudhi::compute_proximity_graph<Simplex_tree>( - off_reader.get_point_cloud(), threshold, Gudhi::Minimal_enclosing_ball_radius()); - std::clog << common_miniball_clock << std::endl; - - boost::filesystem::path full_path(boost::filesystem::current_path()); - std::clog << "Current path is : " << full_path << std::endl; - - std::clog << "File name;Radius;Rips time;Cech time; Ratio Rips/Cech time;Rips nb simplices;Cech nb simplices;" - << std::endl; - boost::filesystem::directory_iterator end_itr; // default construction yields past-the-end - for (boost::filesystem::directory_iterator itr(boost::filesystem::current_path()); itr != end_itr; ++itr) { - if (!boost::filesystem::is_directory(itr->status())) { - if (itr->path().extension() == ".off") // see below - { - Points_off_reader off_reader(itr->path().string()); - Point p0 = off_reader.get_point_cloud()[0]; - - for (Filtration_value radius = 0.1; radius < 0.4; radius += 0.1) { - std::clog << itr->path().stem() << ";"; - std::clog << radius << ";"; - Gudhi::Clock rips_clock("Rips computation"); - Rips_complex rips_complex_from_points(off_reader.get_point_cloud(), radius, - Gudhi::Minimal_enclosing_ball_radius()); - Simplex_tree rips_stree; - rips_complex_from_points.create_complex(rips_stree, p0.size() - 1); - // ------------------------------------------ - // Display information about the Rips complex - // ------------------------------------------ - double rips_sec = rips_clock.num_seconds(); - std::clog << rips_sec << ";"; - - Gudhi::Clock cech_clock("Cech computation"); - Cech_complex cech_complex_from_points(off_reader.get_point_cloud(), radius); - Simplex_tree cech_stree; - cech_complex_from_points.create_complex(cech_stree, p0.size() - 1); - // ------------------------------------------ - // Display information about the Cech complex - // ------------------------------------------ - double cech_sec = cech_clock.num_seconds(); - std::clog << cech_sec << ";"; - std::clog << cech_sec / rips_sec << ";"; - - assert(rips_stree.num_simplices() >= cech_stree.num_simplices()); - std::clog << rips_stree.num_simplices() << ";"; - std::clog << cech_stree.num_simplices() << ";" << std::endl; + boost::filesystem::path full_path(boost::filesystem::current_path()); + std::clog << "Current path is : " << full_path << std::endl; + + std::clog << "File name ; Radius ; Rips time ; Dim-3 Fast Cech time ; Dynamic_dim Fast Cech time ; " + "Dim-3 Safe Cech time ; Dynamic_dim Safe Cech time ; Dim-3 Exact Cech time ; Dynamic_dim Exact Cech time ; " + "Cech nb simplices ; Rips nb simplices;" + << std::endl; + boost::filesystem::directory_iterator end_itr; // default construction yields past-the-end + // For every ".off" file in the current directory, and for 3 predefined thresholds, compare Rips and various Cech constructions + for (boost::filesystem::directory_iterator itr(boost::filesystem::current_path()); itr != end_itr; ++itr) { + if (!boost::filesystem::is_directory(itr->status())) { + if (itr->path().extension() == ".off") { + Points_off_reader off_reader(itr->path().string()); + Point p0 = off_reader.get_point_cloud()[0]; + // Loop over the different thresholds + for (Filtration_value radius = 0.1; radius < 0.35; radius += 0.1) { + std::clog << itr->path().stem() << " ; "; + std::clog << radius << " ; "; + + Gudhi::Clock rips_clock("Rips computation"); + Rips_complex rips_complex_from_points(off_reader.get_point_cloud(), radius, Gudhi::Euclidean_distance()); + Simplex_tree rips_stree; + int dim_max = p0.size() - 1; + rips_complex_from_points.create_complex(rips_stree, dim_max); + // ------------------------------------------ + // Display information about the Rips complex + // ------------------------------------------ + double rips_sec = rips_clock.num_seconds(); + std::clog << rips_sec << " ; "; + + // -------------- + // Cech complex + // -------------- + // Fast + benchmark_cech<CGAL::Epick_d<CGAL::Dimension_tag<3>>>(itr->path().string(), radius, dim_max, false); + benchmark_cech<CGAL::Epick_d<CGAL::Dynamic_dimension_tag>>(itr->path().string(), radius, dim_max, false); + // Safe + benchmark_cech<CGAL::Epeck_d<CGAL::Dimension_tag<3>>>(itr->path().string(), radius, dim_max, false); + benchmark_cech<CGAL::Epeck_d<CGAL::Dynamic_dimension_tag>>(itr->path().string(), radius, dim_max, false); + // Exact + benchmark_cech<CGAL::Epeck_d<CGAL::Dimension_tag<3>>>(itr->path().string(), radius, dim_max, true); + auto cech_stree = benchmark_cech<CGAL::Epeck_d<CGAL::Dynamic_dimension_tag>>(itr->path().string(), radius, dim_max, true); + + std::clog << cech_stree.num_simplices() << " ; "; + std::clog << rips_stree.num_simplices() << ";" << std::endl; + } + } } - } } - } - return 0; + return 0; } diff --git a/src/Cech_complex/concept/SimplicialComplexForCech.h b/src/Cech_complex/concept/SimplicialComplexForCech.h index 00c7df3a..6202fe92 100644 --- a/src/Cech_complex/concept/SimplicialComplexForCech.h +++ b/src/Cech_complex/concept/SimplicialComplexForCech.h @@ -47,8 +47,8 @@ struct SimplicialComplexForCech { }; -} // namespace alpha_complex +} // namespace cech_complex } // namespace Gudhi -#endif // CONCEPT_ALPHA_COMPLEX_SIMPLICIAL_COMPLEX_FOR_ALPHA_H_ +#endif // CONCEPT_CECH_COMPLEX_SIMPLICIAL_COMPLEX_FOR_CECH_H_ diff --git a/src/Cech_complex/doc/Intro_cech_complex.h b/src/Cech_complex/doc/Intro_cech_complex.h index 80c88dc6..73093c07 100644 --- a/src/Cech_complex/doc/Intro_cech_complex.h +++ b/src/Cech_complex/doc/Intro_cech_complex.h @@ -17,7 +17,7 @@ namespace cech_complex { /** \defgroup cech_complex Čech complex * - * \author Vincent Rouvreau + * \author Vincent Rouvreau, Hind montassif * * @{ * @@ -28,7 +28,7 @@ namespace cech_complex { * <a target="_blank" href="https://en.wikipedia.org/wiki/Simplicial_complex">simplicial complex</a> constructed * from a proximity graph. The set of all simplices is filtered by the radius of their minimal enclosing ball. * - * The input shall be a point cloud in an Euclidean space. + * The input shall be a range of points where a point is defined as <a target="_blank" href="https://doc.cgal.org/latest/Kernel_d/classCGAL_1_1Point__d.html">CGAL kernel Point_d.</a> * * \remark For people only interested in the topology of the \ref cech_complex (for instance persistence), * \ref alpha_complex is equivalent to the \ref cech_complex and much smaller if you do not bound the radii. @@ -37,8 +37,7 @@ namespace cech_complex { * \subsection cechalgorithm Algorithm * * Cech_complex first builds a proximity graph from a point cloud. - * The filtration value of each edge of the `Gudhi::Proximity_graph` is computed from - * `Gudhi::Minimal_enclosing_ball_radius` function. + * The filtration value of each edge of the `Gudhi::Proximity_graph` is computed using CGAL kernel functions. * * All edges that have a filtration value strictly greater than a user given maximal radius value, \f$max\_radius\f$, * are not inserted into the complex. @@ -60,20 +59,9 @@ namespace cech_complex { * * \image html "cech_complex_representation.png" "Čech complex expansion" * - * The minimal ball radius computation is insured by - * <a target="_blank" href="https://people.inf.ethz.ch/gaertner/subdir/software/miniball.html"> - * the miniball software (V3.0)</a> - Smallest Enclosing Balls of Points - and distributed with GUDHI. - * Please refer to - * <a target="_blank" href="https://people.inf.ethz.ch/gaertner/subdir/texts/own_work/esa99_final.pdf"> - * the miniball software design description</a> for more information about this computation. - * * This radius computation is the reason why the Cech_complex is taking much more time to be computed than the * \ref rips_complex but it offers more topological guarantees. * - * If the Cech_complex interfaces are not detailed enough for your need, please refer to - * <a href="_cech_complex_2cech_complex_step_by_step_8cpp-example.html"> - * cech_complex_step_by_step.cpp</a> example, where the graph construction over the Simplex_tree is more detailed. - * * \subsection cechpointscloudexample Example from a point cloud * * This example builds the proximity graph from the given points, and maximal radius values. @@ -81,7 +69,7 @@ namespace cech_complex { * * Then, it is asked to display information about the simplicial complex. * - * \include Cech_complex/cech_complex_example_from_points.cpp + * \include cech_complex_example_from_points.cpp * * When launching (maximal enclosing ball radius is 1., is expanded until dimension 2): * @@ -90,7 +78,7 @@ namespace cech_complex { * * the program output is: * - * \include Cech_complex/cech_complex_example_from_points_for_doc.txt + * \include cech_complex_example_from_points_for_doc.txt * */ /** @} */ // end defgroup cech_complex diff --git a/src/Cech_complex/example/CMakeLists.txt b/src/Cech_complex/example/CMakeLists.txt index 1b08c7cb..7d52ed5e 100644 --- a/src/Cech_complex/example/CMakeLists.txt +++ b/src/Cech_complex/example/CMakeLists.txt @@ -1,17 +1,9 @@ project(Cech_complex_examples) -if (TARGET Boost::program_options) - add_executable ( Cech_complex_example_step_by_step cech_complex_step_by_step.cpp ) - target_link_libraries(Cech_complex_example_step_by_step Boost::program_options) +if (NOT CGAL_WITH_EIGEN3_VERSION VERSION_LESS 5.0.1) + add_executable ( Cech_complex_example_from_points cech_complex_example_from_points.cpp) if (TBB_FOUND) - target_link_libraries(Cech_complex_example_step_by_step ${TBB_LIBRARIES}) + target_link_libraries(Cech_complex_example_from_points ${TBB_LIBRARIES}) endif() - add_test(NAME Cech_complex_utility_from_rips_on_tore_3D COMMAND $<TARGET_FILE:Cech_complex_example_step_by_step> - "${CMAKE_SOURCE_DIR}/data/points/tore3D_300.off" "-r" "0.25" "-d" "3") + add_test(NAME Cech_complex_example_from_points COMMAND $<TARGET_FILE:Cech_complex_example_from_points>) endif() - -add_executable ( Cech_complex_example_from_points cech_complex_example_from_points.cpp) -if (TBB_FOUND) - target_link_libraries(Cech_complex_example_from_points ${TBB_LIBRARIES}) -endif() -add_test(NAME Cech_complex_example_from_points COMMAND $<TARGET_FILE:Cech_complex_example_from_points>) diff --git a/src/Cech_complex/example/cech_complex_example_from_points.cpp b/src/Cech_complex/example/cech_complex_example_from_points.cpp index 1a1f708c..ef9071ec 100644 --- a/src/Cech_complex/example/cech_complex_example_from_points.cpp +++ b/src/Cech_complex/example/cech_complex_example_from_points.cpp @@ -1,30 +1,33 @@ #include <gudhi/Cech_complex.h> #include <gudhi/Simplex_tree.h> +#include <CGAL/Epeck_d.h> // For EXACT or SAFE version + #include <iostream> #include <string> #include <vector> -#include <array> int main() { // Type definitions - using Point_cloud = std::vector<std::array<double, 2>>; using Simplex_tree = Gudhi::Simplex_tree<Gudhi::Simplex_tree_options_fast_persistence>; using Filtration_value = Simplex_tree::Filtration_value; - using Cech_complex = Gudhi::cech_complex::Cech_complex<Simplex_tree, Point_cloud>; + using Kernel = CGAL::Epeck_d<CGAL::Dimension_tag<2>>; + using Point = typename Kernel::Point_d; + using Point_cloud = std::vector<Point>; + using Cech_complex = Gudhi::cech_complex::Cech_complex<Kernel, Simplex_tree>; Point_cloud points; - points.push_back({1., 0.}); // 0 - points.push_back({0., 1.}); // 1 - points.push_back({2., 1.}); // 2 - points.push_back({3., 2.}); // 3 - points.push_back({0., 3.}); // 4 - points.push_back({3. + std::sqrt(3.), 3.}); // 5 - points.push_back({1., 4.}); // 6 - points.push_back({3., 4.}); // 7 - points.push_back({2., 4. + std::sqrt(3.)}); // 8 - points.push_back({0., 4.}); // 9 - points.push_back({-0.5, 2.}); // 10 + points.emplace_back(1., 0.); // 0 + points.emplace_back(0., 1.); // 1 + points.emplace_back(2., 1.); // 2 + points.emplace_back(3., 2.); // 3 + points.emplace_back(0., 3.); // 4 + points.emplace_back(3. + std::sqrt(3.), 3.); // 5 + points.emplace_back(1., 4.); // 6 + points.emplace_back(3., 4.); // 7 + points.emplace_back(2., 4. + std::sqrt(3.)); // 8 + points.emplace_back(0., 4.); // 9 + points.emplace_back(-0.5, 2.); // 10 // ---------------------------------------------------------------------------- // Init of a Cech complex from points diff --git a/src/Cech_complex/example/cech_complex_step_by_step.cpp b/src/Cech_complex/example/cech_complex_step_by_step.cpp deleted file mode 100644 index f59f0293..00000000 --- a/src/Cech_complex/example/cech_complex_step_by_step.cpp +++ /dev/null @@ -1,154 +0,0 @@ -/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. - * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. - * Author(s): Vincent Rouvreau - * - * Copyright (C) 2018 Inria - * - * Modification(s): - * - YYYY/MM Author: Description of the modification - */ - -#include <gudhi/graph_simplicial_complex.h> -#include <gudhi/distance_functions.h> -#include <gudhi/Simplex_tree.h> -#include <gudhi/Points_off_io.h> - -#include <gudhi/Miniball.hpp> - -#include <boost/program_options.hpp> - -#include <string> -#include <vector> -#include <limits> // infinity -#include <utility> // for pair -#include <map> - -// ---------------------------------------------------------------------------- -// rips_persistence_step_by_step is an example of each step that is required to -// build a Rips over a Simplex_tree. Please refer to rips_persistence to see -// how to do the same thing with the Rips_complex wrapper for less detailed -// steps. -// ---------------------------------------------------------------------------- - -// Types definition -using Simplex_tree = Gudhi::Simplex_tree<>; -using Simplex_handle = Simplex_tree::Simplex_handle; -using Filtration_value = Simplex_tree::Filtration_value; -using Point = std::vector<double>; -using Points_off_reader = Gudhi::Points_off_reader<Point>; -using Proximity_graph = Gudhi::Proximity_graph<Simplex_tree>; - -class Cech_blocker { - private: - using Point_cloud = std::vector<Point>; - using Point_iterator = Point_cloud::const_iterator; - using Coordinate_iterator = Point::const_iterator; - using Min_sphere = Gudhi::Miniball::Miniball<Gudhi::Miniball::CoordAccessor<Point_iterator, Coordinate_iterator>>; - - public: - bool operator()(Simplex_handle sh) { - std::vector<Point> points; - for (auto vertex : simplex_tree_.simplex_vertex_range(sh)) { - points.push_back(point_cloud_[vertex]); -#ifdef DEBUG_TRACES - std::clog << "#(" << vertex << ")#"; -#endif // DEBUG_TRACES - } - Filtration_value radius = Gudhi::Minimal_enclosing_ball_radius()(points); -#ifdef DEBUG_TRACES - std::clog << "radius = " << radius << " - " << (radius > max_radius_) << std::endl; -#endif // DEBUG_TRACES - simplex_tree_.assign_filtration(sh, radius); - return (radius > max_radius_); - } - Cech_blocker(Simplex_tree& simplex_tree, Filtration_value max_radius, const std::vector<Point>& point_cloud) - : simplex_tree_(simplex_tree), max_radius_(max_radius), point_cloud_(point_cloud) { - dimension_ = point_cloud_[0].size(); - } - - private: - Simplex_tree simplex_tree_; - Filtration_value max_radius_; - std::vector<Point> point_cloud_; - int dimension_; -}; - -void program_options(int argc, char* argv[], std::string& off_file_points, Filtration_value& max_radius, int& dim_max); - -int main(int argc, char* argv[]) { - std::string off_file_points; - Filtration_value max_radius; - int dim_max; - - program_options(argc, argv, off_file_points, max_radius, dim_max); - - // Extract the points from the file filepoints - Points_off_reader off_reader(off_file_points); - - // Compute the proximity graph of the points - Proximity_graph prox_graph = Gudhi::compute_proximity_graph<Simplex_tree>(off_reader.get_point_cloud(), max_radius, - Gudhi::Minimal_enclosing_ball_radius()); - - // Construct the Rips complex in a Simplex Tree - Simplex_tree st; - // insert the proximity graph in the simplex tree - st.insert_graph(prox_graph); - // expand the graph until dimension dim_max - st.expansion_with_blockers(dim_max, Cech_blocker(st, max_radius, off_reader.get_point_cloud())); - - std::clog << "The complex contains " << st.num_simplices() << " simplices \n"; - std::clog << " and has dimension " << st.dimension() << " \n"; - - // Sort the simplices in the order of the filtration - st.initialize_filtration(); - -#if DEBUG_TRACES - std::clog << "********************************************************************\n"; - std::clog << "* The complex contains " << st.num_simplices() << " simplices - dimension=" << st.dimension() << "\n"; - std::clog << "* Iterator on Simplices in the filtration, with [filtration value]:\n"; - for (auto f_simplex : st.filtration_simplex_range()) { - std::clog << " " - << "[" << st.filtration(f_simplex) << "] "; - for (auto vertex : st.simplex_vertex_range(f_simplex)) { - std::clog << static_cast<int>(vertex) << " "; - } - std::clog << std::endl; - } -#endif // DEBUG_TRACES - - return 0; -} - -void program_options(int argc, char* argv[], std::string& off_file_points, Filtration_value& max_radius, int& dim_max) { - namespace po = boost::program_options; - po::options_description hidden("Hidden options"); - hidden.add_options()("input-file", po::value<std::string>(&off_file_points), - "Name of an OFF file containing a point set.\n"); - - po::options_description visible("Allowed options", 100); - visible.add_options()("help,h", "produce help message")( - "max-radius,r", - po::value<Filtration_value>(&max_radius)->default_value(std::numeric_limits<Filtration_value>::infinity()), - "Maximal length of an edge for the Rips complex construction.")( - "cpx-dimension,d", po::value<int>(&dim_max)->default_value(1), - "Maximal dimension of the Rips complex we want to compute."); - - po::positional_options_description pos; - pos.add("input-file", 1); - - po::options_description all; - all.add(visible).add(hidden); - - po::variables_map vm; - po::store(po::command_line_parser(argc, argv).options(all).positional(pos).run(), vm); - po::notify(vm); - - if (vm.count("help") || !vm.count("input-file")) { - std::clog << std::endl; - std::clog << "Construct a Cech complex defined on a set of input points.\n \n"; - - std::clog << "Usage: " << argv[0] << " [options] input-file" << std::endl << std::endl; - std::clog << visible << std::endl; - exit(-1); - } -} diff --git a/src/Cech_complex/include/gudhi/Cech_complex.h b/src/Cech_complex/include/gudhi/Cech_complex.h index b0871e10..dbdf5e93 100644 --- a/src/Cech_complex/include/gudhi/Cech_complex.h +++ b/src/Cech_complex/include/gudhi/Cech_complex.h @@ -1,24 +1,24 @@ /* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. - * Author(s): Vincent Rouvreau + * Author(s): Vincent Rouvreau, Hind Montassif * * Copyright (C) 2018 Inria * * Modification(s): * - YYYY/MM Author: Description of the modification + * - 2022/02 Hind Montassif : Replace MiniBall with Sphere_circumradius */ #ifndef CECH_COMPLEX_H_ #define CECH_COMPLEX_H_ -#include <gudhi/distance_functions.h> // for Gudhi::Minimal_enclosing_ball_radius +#include <gudhi/Sphere_circumradius.h> // for Gudhi::cech_complex::Sphere_circumradius #include <gudhi/graph_simplicial_complex.h> // for Gudhi::Proximity_graph #include <gudhi/Debug_utils.h> // for GUDHI_CHECK #include <gudhi/Cech_complex_blocker.h> // for Gudhi::cech_complex::Cech_blocker #include <iostream> #include <stdexcept> // for exception management -#include <vector> namespace Gudhi { @@ -26,55 +26,55 @@ namespace cech_complex { /** * \class Cech_complex - * \brief Cech complex data structure. + * \brief Cech complex class. * * \ingroup cech_complex * * \details - * The data structure is a proximity graph, containing edges when the edge length is less or equal - * to a given max_radius. Edge length is computed from `Gudhi::Minimal_enclosing_ball_radius` distance function. + * Cech complex is a simplicial complex where the set of all simplices is filtered + * by the radius of their minimal enclosing ball and bounded by the given max_radius. * - * \tparam SimplicialComplexForProximityGraph furnishes `Vertex_handle` and `Filtration_value` type definition required - * by `Gudhi::Proximity_graph`. + * \tparam Kernel CGAL kernel: either Epick_d or Epeck_d. + * + * \tparam SimplicialComplexForCechComplex furnishes `Vertex_handle` and `Filtration_value` type definition required + * by `Gudhi::Proximity_graph` and Cech blocker. * - * \tparam ForwardPointRange must be a range for which `std::begin()` and `std::end()` methods return input - * iterators on a point. `std::begin()` and `std::end()` methods are also required for a point. */ -template <typename SimplicialComplexForProximityGraph, typename ForwardPointRange> +template <typename Kernel, typename SimplicialComplexForCechComplex> class Cech_complex { private: // Required by compute_proximity_graph - using Vertex_handle = typename SimplicialComplexForProximityGraph::Vertex_handle; - using Filtration_value = typename SimplicialComplexForProximityGraph::Filtration_value; - using Proximity_graph = Gudhi::Proximity_graph<SimplicialComplexForProximityGraph>; - - // Retrieve Coordinate type from ForwardPointRange - using Point_from_range_iterator = typename boost::range_const_iterator<ForwardPointRange>::type; - using Point_from_range = typename std::iterator_traits<Point_from_range_iterator>::value_type; - using Coordinate_iterator = typename boost::range_const_iterator<Point_from_range>::type; - using Coordinate = typename std::iterator_traits<Coordinate_iterator>::value_type; - - public: - // Point and Point_cloud type definition - using Point = std::vector<Coordinate>; - using Point_cloud = std::vector<Point>; - - public: - /** \brief Cech_complex constructor from a list of points. + using Vertex_handle = typename SimplicialComplexForCechComplex::Vertex_handle; + using Filtration_value = typename SimplicialComplexForCechComplex::Filtration_value; + using Proximity_graph = Gudhi::Proximity_graph<SimplicialComplexForCechComplex>; + + using cech_blocker = Cech_blocker<SimplicialComplexForCechComplex, Cech_complex, Kernel>; + + using Point_d = typename cech_blocker::Point_d; + using Point_cloud = std::vector<Point_d>; + + // Numeric type of coordinates in the kernel + using FT = typename cech_blocker::FT; + // Sphere is a pair of point and squared radius. + using Sphere = typename cech_blocker::Sphere; + + public: + /** \brief Cech_complex constructor from a range of points. * - * @param[in] points Range of points. + * @param[in] points Range of points where each point is defined as `kernel::Point_d`. * @param[in] max_radius Maximal radius value. - * - * \tparam ForwardPointRange must be a range of Point. Point must be a range of <b>copyable</b> Cartesian coordinates. + * @param[in] exact Exact filtration values computation. Not exact if `Kernel` is not <a target="_blank" + * href="https://doc.cgal.org/latest/Kernel_d/structCGAL_1_1Epeck__d.html">CGAL::Epeck_d</a>. + * Default is false. * */ - Cech_complex(const ForwardPointRange& points, Filtration_value max_radius) : max_radius_(max_radius) { - // Point cloud deep copy - point_cloud_.reserve(boost::size(points)); - for (auto&& point : points) point_cloud_.emplace_back(std::begin(point), std::end(point)); + template<typename InputPointRange > + Cech_complex(const InputPointRange & points, Filtration_value max_radius, const bool exact = false) : max_radius_(max_radius), exact_(exact) { - cech_skeleton_graph_ = Gudhi::compute_proximity_graph<SimplicialComplexForProximityGraph>( - point_cloud_, max_radius_, Gudhi::Minimal_enclosing_ball_radius()); + point_cloud_.assign(std::begin(points), std::end(points)); + + cech_skeleton_graph_ = Gudhi::compute_proximity_graph<SimplicialComplexForCechComplex>( + point_cloud_, max_radius_, Sphere_circumradius<Kernel, Filtration_value>(exact)); } /** \brief Initializes the simplicial complex from the proximity graph and expands it until a given maximal @@ -85,7 +85,6 @@ class Cech_complex { * @exception std::invalid_argument In debug mode, if `complex.num_vertices()` does not return 0. * */ - template <typename SimplicialComplexForCechComplex> void create_complex(SimplicialComplexForCechComplex& complex, int dim_max) { GUDHI_CHECK(complex.num_vertices() == 0, std::invalid_argument("Cech_complex::create_complex - simplicial complex is not empty")); @@ -93,8 +92,7 @@ class Cech_complex { // insert the proximity graph in the simplicial complex complex.insert_graph(cech_skeleton_graph_); // expand the graph until dimension dim_max - complex.expansion_with_blockers(dim_max, - Cech_blocker<SimplicialComplexForCechComplex, Cech_complex>(&complex, this)); + complex.expansion_with_blockers(dim_max, cech_blocker(&complex, this)); } /** @return max_radius value given at construction. */ @@ -103,12 +101,24 @@ class Cech_complex { /** @param[in] vertex Point position in the range. * @return The point. */ - const Point& get_point(Vertex_handle vertex) const { return point_cloud_[vertex]; } + const Point_d& get_point(Vertex_handle vertex) const { return point_cloud_[vertex]; } + + /** + * @return Vector of cached spheres. + */ + std::vector<Sphere> & get_cache() { return cache_; } + + /** \brief Check exact option + * @return Exact option. + */ + const bool is_exact() { return exact_; } private: Proximity_graph cech_skeleton_graph_; Filtration_value max_radius_; Point_cloud point_cloud_; + std::vector<Sphere> cache_; + const bool exact_; }; } // namespace cech_complex diff --git a/src/Cech_complex/include/gudhi/Cech_complex_blocker.h b/src/Cech_complex/include/gudhi/Cech_complex_blocker.h index 31b9aab5..e78e37b7 100644 --- a/src/Cech_complex/include/gudhi/Cech_complex_blocker.h +++ b/src/Cech_complex/include/gudhi/Cech_complex_blocker.h @@ -11,10 +11,12 @@ #ifndef CECH_COMPLEX_BLOCKER_H_ #define CECH_COMPLEX_BLOCKER_H_ -#include <gudhi/distance_functions.h> // for Gudhi::Minimal_enclosing_ball_radius +#include <CGAL/NT_converter.h> // for casting from FT to Filtration_value +#include <CGAL/Lazy_exact_nt.h> // for CGAL::exact #include <iostream> #include <vector> +#include <set> #include <cmath> // for std::sqrt namespace Gudhi { @@ -30,37 +32,104 @@ namespace cech_complex { * \details * Čech blocker is an oracle constructed from a Cech_complex and a simplicial complex. * - * \tparam SimplicialComplexForProximityGraph furnishes `Simplex_handle` and `Filtration_value` type definition, + * \tparam SimplicialComplexForCech furnishes `Simplex_handle` and `Filtration_value` type definition, * `simplex_vertex_range(Simplex_handle sh)`and `assign_filtration(Simplex_handle sh, Filtration_value filt)` methods. * - * \tparam Chech_complex is required by the blocker. + * \tparam Cech_complex is required by the blocker. + * + * \tparam Kernel CGAL kernel: either Epick_d or Epeck_d. */ -template <typename SimplicialComplexForCech, typename Cech_complex> +template <typename SimplicialComplexForCech, typename Cech_complex, typename Kernel> class Cech_blocker { + + public: + + using Point_d = typename Kernel::Point_d; + // Numeric type of coordinates in the kernel + using FT = typename Kernel::FT; + // Sphere is a pair of point and squared radius. + using Sphere = typename std::pair<Point_d, FT>; + private: - using Point_cloud = typename Cech_complex::Point_cloud; using Simplex_handle = typename SimplicialComplexForCech::Simplex_handle; using Filtration_value = typename SimplicialComplexForCech::Filtration_value; + using Simplex_key = typename SimplicialComplexForCech::Simplex_key; + + template<class PointIterator> + Sphere get_sphere(PointIterator begin, PointIterator end) const { + Point_d c = kernel_.construct_circumcenter_d_object()(begin, end); + FT r = kernel_.squared_distance_d_object()(c, *begin); + return std::make_pair(std::move(c), std::move(r)); + } public: + /** \internal \brief Čech complex blocker operator() - the oracle - assigns the filtration value from the simplex * radius and returns if the simplex expansion must be blocked. * \param[in] sh The Simplex_handle. * \return true if the simplex radius is greater than the Cech_complex max_radius*/ bool operator()(Simplex_handle sh) { + using Point_cloud = std::vector<Point_d>; + Filtration_value radius = 0; + bool is_min_enclos_ball = false; Point_cloud points; - for (auto vertex : sc_ptr_->simplex_vertex_range(sh)) { - points.push_back(cc_ptr_->get_point(vertex)); + points.reserve(sc_ptr_->dimension(sh)+1); + + // for each face of simplex sh, test outsider point is indeed inside enclosing ball, if yes, take it and exit loop, otherwise, new sphere is circumsphere of all vertices + for (auto face_opposite_vertex : sc_ptr_->boundary_opposite_vertex_simplex_range(sh)) { + auto k = sc_ptr_->key(face_opposite_vertex.first); + Simplex_key sph_key; + if(k != sc_ptr_->null_key()) { + sph_key = k; + } + else { + for (auto vertex : sc_ptr_->simplex_vertex_range(face_opposite_vertex.first)) { + points.push_back(cc_ptr_->get_point(vertex)); +#ifdef DEBUG_TRACES + std::clog << "#(" << vertex << ")#"; +#endif // DEBUG_TRACES + } + // Put edge sphere in cache + sph_key = cc_ptr_->get_cache().size(); + sc_ptr_->assign_key(face_opposite_vertex.first, sph_key); + cc_ptr_->get_cache().push_back(get_sphere(points.cbegin(), points.cend())); + // Clear face points + points.clear(); + } + // Check if the minimal enclosing ball of current face contains the extra point/opposite vertex + Sphere const& sph = cc_ptr_->get_cache()[sph_key]; + if (kernel_.squared_distance_d_object()(sph.first, cc_ptr_->get_point(face_opposite_vertex.second)) <= sph.second) { + is_min_enclos_ball = true; + sc_ptr_->assign_key(sh, sph_key); + radius = sc_ptr_->filtration(face_opposite_vertex.first); #ifdef DEBUG_TRACES - std::clog << "#(" << vertex << ")#"; + std::clog << "center: " << sph.first << ", radius: " << radius << std::endl; #endif // DEBUG_TRACES + break; + } } - Filtration_value radius = Gudhi::Minimal_enclosing_ball_radius()(points); + // Spheres of each face don't contain the whole simplex + if(!is_min_enclos_ball) { + for (auto vertex : sc_ptr_->simplex_vertex_range(sh)) { + points.push_back(cc_ptr_->get_point(vertex)); + } + Sphere sph = get_sphere(points.cbegin(), points.cend()); +#if CGAL_VERSION_NR >= 1050000000 + if(cc_ptr_->is_exact()) CGAL::exact(sph.second); +#endif + CGAL::NT_converter<FT, Filtration_value> cast_to_fv; + radius = std::sqrt(cast_to_fv(sph.second)); + + sc_ptr_->assign_key(sh, cc_ptr_->get_cache().size()); + cc_ptr_->get_cache().push_back(std::move(sph)); + } + #ifdef DEBUG_TRACES if (radius > cc_ptr_->max_radius()) std::clog << "radius > max_radius => expansion is blocked\n"; #endif // DEBUG_TRACES - sc_ptr_->assign_filtration(sh, radius); + // Check that the filtration to be assigned (radius) would be valid + if (radius > sc_ptr_->filtration(sh)) sc_ptr_->assign_filtration(sh, radius); return (radius > cc_ptr_->max_radius()); } @@ -70,6 +139,7 @@ class Cech_blocker { private: SimplicialComplexForCech* sc_ptr_; Cech_complex* cc_ptr_; + Kernel kernel_; }; } // namespace cech_complex diff --git a/src/Cech_complex/include/gudhi/Miniball.COPYRIGHT b/src/Cech_complex/include/gudhi/Miniball.COPYRIGHT deleted file mode 100644 index dbe4c553..00000000 --- a/src/Cech_complex/include/gudhi/Miniball.COPYRIGHT +++ /dev/null @@ -1,4 +0,0 @@ -The miniball software is available under the GNU General Public License (GPLv3 - https://www.gnu.org/copyleft/gpl.html). -If your intended use is not compliant with this license, please buy a commercial license (EUR 500 - https://people.inf.ethz.ch/gaertner/subdir/software/miniball/license.html). -You need a license if the software that you develop using Miniball V3.0 is not open source. - diff --git a/src/Cech_complex/include/gudhi/Miniball.README b/src/Cech_complex/include/gudhi/Miniball.README deleted file mode 100644 index 033d8953..00000000 --- a/src/Cech_complex/include/gudhi/Miniball.README +++ /dev/null @@ -1,26 +0,0 @@ -https://people.inf.ethz.ch/gaertner/subdir/software/miniball.html - -Smallest Enclosing Balls of Points - Fast and Robust in C++. -(high-quality software for smallest enclosing balls of balls is available in the computational geometry algorithms library CGAL) - - -This is the miniball software (V3.0) for computing smallest enclosing balls of points in arbitrary dimensions. It consists of a C++ header file Miniball.hpp (around 500 lines of code) and two example programs miniball_example.cpp and miniball_example_containers.cpp that demonstrate the usage. The first example stores the coordinates of the input points in a two-dimensional array, the second example uses a list of vectors to show how generic containers can be used. - -Credits: Aditya Gupta and Alexandros Konstantinakis-Karmis have significantly contributed to this version of the software. - -Changes - https://people.inf.ethz.ch/gaertner/subdir/software/miniball/changes.txt - from previous versions. - -The theory - https://people.inf.ethz.ch/gaertner/subdir/texts/own_work/esa99_final.pdf - behind the miniball software (Proc. 7th Annual European Symposium on Algorithms (ESA), Lecture Notes in Computer Science 1643, Springer-Verlag, pp.325-338, 1999). - -Main Features: - - Very fast in low dimensions. 1 million points in 5-space are processed within 0.05 seconds on any recent machine. - - High numerical stability. Almost all input degeneracies (cospherical points, multiple points, points very close together) are routinely handled. - - Easily integrates into your code. You can freely choose the coordinate type of your points and the container to store the points. If you still need to adapt the code, the header is small and readable and contains documentation for all major methods. - - -Changes done for the GUDHI version of MiniBall: - - Add include guard - - Move Miniball namespace inside a new Gudhi namespace diff --git a/src/Cech_complex/include/gudhi/Miniball.hpp b/src/Cech_complex/include/gudhi/Miniball.hpp deleted file mode 100644 index ce6cbb5b..00000000 --- a/src/Cech_complex/include/gudhi/Miniball.hpp +++ /dev/null @@ -1,523 +0,0 @@ -// Copright (C) 1999-2013, Bernd Gaertner -// $Rev: 3581 $ -// -// This program is free software: you can redistribute it and/or modify -// it under the terms of the GNU General Public License as published by -// the Free Software Foundation, either version 3 of the License, or -// (at your option) any later version. - -// This program is distributed in the hope that it will be useful, -// but WITHOUT ANY WARRANTY; without even the implied warranty of -// MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE. See the -// GNU General Public License for more details. - -// You should have received a copy of the GNU General Public License -// along with this program. If not, see <http://www.gnu.org/licenses/>. -// -// Contact: -// -------- -// Bernd Gaertner -// Institute of Theoretical Computer Science -// ETH Zuerich -// CAB G31.1 -// CH-8092 Zuerich, Switzerland -// http://www.inf.ethz.ch/personal/gaertner - -#ifndef MINIBALL_HPP_ -#define MINIBALL_HPP_ - -#include <cassert> -#include <algorithm> -#include <list> -#include <ctime> -#include <limits> - -namespace Gudhi { - -namespace Miniball { - - // Global Functions - // ================ - template <typename NT> - inline NT mb_sqr (NT r) {return r*r;} - - // Functors - // ======== - - // functor to map a point iterator to the corresponding coordinate iterator; - // generic version for points whose coordinate containers have begin() - template < typename Pit_, typename Cit_ > - struct CoordAccessor { - typedef Pit_ Pit; - typedef Cit_ Cit; - inline Cit operator() (Pit it) const { return (*it).begin(); } - }; - - // partial specialization for points whose coordinate containers are arrays - template < typename Pit_, typename Cit_ > - struct CoordAccessor<Pit_, Cit_*> { - typedef Pit_ Pit; - typedef Cit_* Cit; - inline Cit operator() (Pit it) const { return *it; } - }; - - // Class Declaration - // ================= - - template <typename CoordAccessor> - class Miniball { - private: - // types - // The iterator type to go through the input points - typedef typename CoordAccessor::Pit Pit; - // The iterator type to go through the coordinates of a single point. - typedef typename CoordAccessor::Cit Cit; - // The coordinate type - typedef typename std::iterator_traits<Cit>::value_type NT; - // The iterator to go through the support points - typedef typename std::list<Pit>::iterator Sit; - - // data members... - const int d; // dimension - Pit points_begin; - Pit points_end; - CoordAccessor coord_accessor; - double time; - const NT nt0; // NT(0) - - //...for the algorithms - std::list<Pit> L; - Sit support_end; - int fsize; // number of forced points - int ssize; // number of support points - - // ...for the ball updates - NT* current_c; - NT current_sqr_r; - NT** c; - NT* sqr_r; - - // helper arrays - NT* q0; - NT* z; - NT* f; - NT** v; - NT** a; - - public: - // The iterator type to go through the support points - typedef typename std::list<Pit>::const_iterator SupportPointIterator; - - // PRE: [begin, end) is a nonempty range - // POST: computes the smallest enclosing ball of the points in the range - // [begin, end); the functor a maps a point iterator to an iterator - // through the d coordinates of the point - Miniball (int d_, Pit begin, Pit end, CoordAccessor ca = CoordAccessor()); - - // POST: returns a pointer to the first element of an array that holds - // the d coordinates of the center of the computed ball - const NT* center () const; - - // POST: returns the squared radius of the computed ball - NT squared_radius () const; - - // POST: returns the number of support points of the computed ball; - // the support points form a minimal set with the same smallest - // enclosing ball as the input set; in particular, the support - // points are on the boundary of the computed ball, and their - // number is at most d+1 - int nr_support_points () const; - - // POST: returns an iterator to the first support point - SupportPointIterator support_points_begin () const; - - // POST: returns a past-the-end iterator for the range of support points - SupportPointIterator support_points_end () const; - - // POST: returns the maximum excess of any input point w.r.t. the computed - // ball, divided by the squared radius of the computed ball. The - // excess of a point is the difference between its squared distance - // from the center and the squared radius; Ideally, the return value - // is 0. subopt is set to the absolute value of the most negative - // coefficient in the affine combination of the support points that - // yields the center. Ideally, this is a convex combination, and there - // is no negative coefficient in which case subopt is set to 0. - NT relative_error (NT& subopt) const; - - // POST: return true if the relative error is at most tol, and the - // suboptimality is 0; the default tolerance is 10 times the - // coordinate type's machine epsilon - bool is_valid (NT tol = NT(10) * std::numeric_limits<NT>::epsilon()) const; - - // POST: returns the time in seconds taken by the constructor call for - // computing the smallest enclosing ball - double get_time() const; - - // POST: deletes dynamically allocated arrays - ~Miniball(); - - private: - void mtf_mb (Sit n); - void mtf_move_to_front (Sit j); - void pivot_mb (Pit n); - void pivot_move_to_front (Pit j); - NT excess (Pit pit) const; - void pop (); - bool push (Pit pit); - NT suboptimality () const; - void create_arrays(); - void delete_arrays(); - }; - - // Class Definition - // ================ - template <typename CoordAccessor> - Miniball<CoordAccessor>::Miniball (int d_, Pit begin, Pit end, - CoordAccessor ca) - : d (d_), - points_begin (begin), - points_end (end), - coord_accessor (ca), - time (clock()), - nt0 (NT(0)), - L(), - support_end (L.begin()), - fsize(0), - ssize(0), - current_c (NULL), - current_sqr_r (NT(-1)), - c (NULL), - sqr_r (NULL), - q0 (NULL), - z (NULL), - f (NULL), - v (NULL), - a (NULL) - { - assert (points_begin != points_end); - create_arrays(); - - // set initial center - for (int j=0; j<d; ++j) c[0][j] = nt0; - current_c = c[0]; - - // compute miniball - pivot_mb (points_end); - - // update time - time = (clock() - time) / CLOCKS_PER_SEC; - } - - template <typename CoordAccessor> - Miniball<CoordAccessor>::~Miniball() - { - delete_arrays(); - } - - template <typename CoordAccessor> - void Miniball<CoordAccessor>::create_arrays() - { - c = new NT*[d+1]; - v = new NT*[d+1]; - a = new NT*[d+1]; - for (int i=0; i<d+1; ++i) { - c[i] = new NT[d]; - v[i] = new NT[d]; - a[i] = new NT[d]; - } - sqr_r = new NT[d+1]; - q0 = new NT[d]; - z = new NT[d+1]; - f = new NT[d+1]; - } - - template <typename CoordAccessor> - void Miniball<CoordAccessor>::delete_arrays() - { - delete[] f; - delete[] z; - delete[] q0; - delete[] sqr_r; - for (int i=0; i<d+1; ++i) { - delete[] a[i]; - delete[] v[i]; - delete[] c[i]; - } - delete[] a; - delete[] v; - delete[] c; - } - - template <typename CoordAccessor> - const typename Miniball<CoordAccessor>::NT* - Miniball<CoordAccessor>::center () const - { - return current_c; - } - - template <typename CoordAccessor> - typename Miniball<CoordAccessor>::NT - Miniball<CoordAccessor>::squared_radius () const - { - return current_sqr_r; - } - - template <typename CoordAccessor> - int Miniball<CoordAccessor>::nr_support_points () const - { - assert (ssize < d+2); - return ssize; - } - - template <typename CoordAccessor> - typename Miniball<CoordAccessor>::SupportPointIterator - Miniball<CoordAccessor>::support_points_begin () const - { - return L.begin(); - } - - template <typename CoordAccessor> - typename Miniball<CoordAccessor>::SupportPointIterator - Miniball<CoordAccessor>::support_points_end () const - { - return support_end; - } - - template <typename CoordAccessor> - typename Miniball<CoordAccessor>::NT - Miniball<CoordAccessor>::relative_error (NT& subopt) const - { - NT e, max_e = nt0; - // compute maximum absolute excess of support points - for (SupportPointIterator it = support_points_begin(); - it != support_points_end(); ++it) { - e = excess (*it); - if (e < nt0) e = -e; - if (e > max_e) { - max_e = e; - } - } - // compute maximum excess of any point - for (Pit i = points_begin; i != points_end; ++i) - if ((e = excess (i)) > max_e) - max_e = e; - - subopt = suboptimality(); - assert (current_sqr_r > nt0 || max_e == nt0); - return (current_sqr_r == nt0 ? nt0 : max_e / current_sqr_r); - } - - template <typename CoordAccessor> - bool Miniball<CoordAccessor>::is_valid (NT tol) const - { - NT suboptimality; - return ( (relative_error (suboptimality) <= tol) && (suboptimality == 0) ); - } - - template <typename CoordAccessor> - double Miniball<CoordAccessor>::get_time() const - { - return time; - } - - template <typename CoordAccessor> - void Miniball<CoordAccessor>::mtf_mb (Sit n) - { - // Algorithm 1: mtf_mb (L_{n-1}, B), where L_{n-1} = [L.begin, n) - // B: the set of forced points, defining the current ball - // S: the superset of support points computed by the algorithm - // -------------------------------------------------------------- - // from B. Gaertner, Fast and Robust Smallest Enclosing Balls, ESA 1999, - // http://www.inf.ethz.ch/personal/gaertner/texts/own_work/esa99_final.pdf - - // PRE: B = S - assert (fsize == ssize); - - support_end = L.begin(); - if ((fsize) == d+1) return; - - // incremental construction - for (Sit i = L.begin(); i != n;) - { - // INV: (support_end - L.begin() == |S|-|B|) - assert (std::distance (L.begin(), support_end) == ssize - fsize); - - Sit j = i++; - if (excess(*j) > nt0) - if (push(*j)) { // B := B + p_i - mtf_mb (j); // mtf_mb (L_{i-1}, B + p_i) - pop(); // B := B - p_i - mtf_move_to_front(j); - } - } - // POST: the range [L.begin(), support_end) stores the set S\B - } - - template <typename CoordAccessor> - void Miniball<CoordAccessor>::mtf_move_to_front (Sit j) - { - if (support_end == j) - support_end++; - L.splice (L.begin(), L, j); - } - - template <typename CoordAccessor> - void Miniball<CoordAccessor>::pivot_mb (Pit n) - { - // Algorithm 2: pivot_mb (L_{n-1}), where L_{n-1} = [L.begin, n) - // -------------------------------------------------------------- - // from B. Gaertner, Fast and Robust Smallest Enclosing Balls, ESA 1999, - // http://www.inf.ethz.ch/personal/gaertner/texts/own_work/esa99_final.pdf - NT old_sqr_r; - const NT* c; - Pit pivot, k; - NT e, max_e, sqr_r; - Cit p; - do { - old_sqr_r = current_sqr_r; - sqr_r = current_sqr_r; - - pivot = points_begin; - max_e = nt0; - for (k = points_begin; k != n; ++k) { - p = coord_accessor(k); - e = -sqr_r; - c = current_c; - for (int j=0; j<d; ++j) - e += mb_sqr<NT>(*p++-*c++); - if (e > max_e) { - max_e = e; - pivot = k; - } - } - - if (max_e > nt0) { - // check if the pivot is already contained in the support set - if (std::find(L.begin(), support_end, pivot) == support_end) { - assert (fsize == 0); - if (push (pivot)) { - mtf_mb(support_end); - pop(); - pivot_move_to_front(pivot); - } - } - } - } while (old_sqr_r < current_sqr_r); - } - - template <typename CoordAccessor> - void Miniball<CoordAccessor>::pivot_move_to_front (Pit j) - { - L.push_front(j); - if (std::distance(L.begin(), support_end) == d+2) - support_end--; - } - - template <typename CoordAccessor> - inline typename Miniball<CoordAccessor>::NT - Miniball<CoordAccessor>::excess (Pit pit) const - { - Cit p = coord_accessor(pit); - NT e = -current_sqr_r; - NT* c = current_c; - for (int k=0; k<d; ++k){ - e += mb_sqr<NT>(*p++-*c++); - } - return e; - } - - template <typename CoordAccessor> - void Miniball<CoordAccessor>::pop () - { - --fsize; - } - - template <typename CoordAccessor> - bool Miniball<CoordAccessor>::push (Pit pit) - { - int i, j; - NT eps = mb_sqr<NT>(std::numeric_limits<NT>::epsilon()); - - Cit cit = coord_accessor(pit); - Cit p = cit; - - if (fsize==0) { - for (i=0; i<d; ++i) - q0[i] = *p++; - for (i=0; i<d; ++i) - c[0][i] = q0[i]; - sqr_r[0] = nt0; - } - else { - // set v_fsize to Q_fsize - for (i=0; i<d; ++i) - //v[fsize][i] = p[i]-q0[i]; - v[fsize][i] = *p++-q0[i]; - - // compute the a_{fsize,i}, i< fsize - for (i=1; i<fsize; ++i) { - a[fsize][i] = nt0; - for (j=0; j<d; ++j) - a[fsize][i] += v[i][j] * v[fsize][j]; - a[fsize][i]*=(2/z[i]); - } - - // update v_fsize to Q_fsize-\bar{Q}_fsize - for (i=1; i<fsize; ++i) { - for (j=0; j<d; ++j) - v[fsize][j] -= a[fsize][i]*v[i][j]; - } - - // compute z_fsize - z[fsize]=nt0; - for (j=0; j<d; ++j) - z[fsize] += mb_sqr<NT>(v[fsize][j]); - z[fsize]*=2; - - // reject push if z_fsize too small - if (z[fsize]<eps*current_sqr_r) { - return false; - } - - // update c, sqr_r - p=cit; - NT e = -sqr_r[fsize-1]; - for (i=0; i<d; ++i) - e += mb_sqr<NT>(*p++-c[fsize-1][i]); - f[fsize]=e/z[fsize]; - - for (i=0; i<d; ++i) - c[fsize][i] = c[fsize-1][i]+f[fsize]*v[fsize][i]; - sqr_r[fsize] = sqr_r[fsize-1] + e*f[fsize]/2; - } - current_c = c[fsize]; - current_sqr_r = sqr_r[fsize]; - ssize = ++fsize; - return true; - } - - template <typename CoordAccessor> - typename Miniball<CoordAccessor>::NT - Miniball<CoordAccessor>::suboptimality () const - { - NT* l = new NT[d+1]; - NT min_l = nt0; - l[0] = NT(1); - for (int i=ssize-1; i>0; --i) { - l[i] = f[i]; - for (int k=ssize-1; k>i; --k) - l[i]-=a[k][i]*l[k]; - if (l[i] < min_l) min_l = l[i]; - l[0] -= l[i]; - } - if (l[0] < min_l) min_l = l[0]; - delete[] l; - if (min_l < nt0) - return -min_l; - return nt0; - } -} // namespace Miniball - -} // namespace Gudhi - -#endif // MINIBALL_HPP_ diff --git a/src/Cech_complex/include/gudhi/Sphere_circumradius.h b/src/Cech_complex/include/gudhi/Sphere_circumradius.h new file mode 100644 index 00000000..2f916c0a --- /dev/null +++ b/src/Cech_complex/include/gudhi/Sphere_circumradius.h @@ -0,0 +1,78 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Hind Montassif + * + * Copyright (C) 2021 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef SPHERE_CIRCUMRADIUS_H_ +#define SPHERE_CIRCUMRADIUS_H_ + +#include <CGAL/Epick_d.h> // for #include <CGAL/NT_converter.h> which is not working/compiling alone +#include <CGAL/Lazy_exact_nt.h> // for CGAL::exact + +#include <cmath> // for std::sqrt +#include <vector> + +namespace Gudhi { + +namespace cech_complex { + +/** \private @brief Compute the circumradius of the sphere passing through points given by a range of coordinates. + * The points are assumed to have the same dimension. */ +template<typename Kernel, typename Filtration_value> +class Sphere_circumradius { + private: + Kernel kernel_; + const bool exact_; + public: + using FT = typename Kernel::FT; + using Point = typename Kernel::Point_d; + using Point_cloud = typename std::vector<Point>; + + CGAL::NT_converter<FT, Filtration_value> cast_to_fv; + + /** \brief Circumradius of sphere passing through two points using CGAL. + * + * @param[in] point_1 + * @param[in] point_2 + * @return Sphere circumradius passing through two points. + * \tparam Point must be a Kernel::Point_d from CGAL. + * + */ + Filtration_value operator()(const Point& point_1, const Point& point_2) const { + auto squared_dist_obj = kernel_.squared_distance_d_object()(point_1, point_2); + if(exact_) CGAL::exact(squared_dist_obj); + return std::sqrt(cast_to_fv(squared_dist_obj)) / 2.; + } + + /** \brief Circumradius of sphere passing through point cloud using CGAL. + * + * @param[in] point_cloud The points. + * @return Sphere circumradius passing through the points. + * \tparam Point_cloud must be a range of Kernel::Point_d points from CGAL. + * + */ + Filtration_value operator()(const Point_cloud& point_cloud) const { + auto squared_radius_obj = kernel_.compute_squared_radius_d_object()(point_cloud.begin(), point_cloud.end()); + if(exact_) CGAL::exact(squared_radius_obj); + return std::sqrt(cast_to_fv(squared_radius_obj)); + } + + /** \brief Constructor + * @param[in] exact Option for exact filtration values computation. Not exact if `Kernel` is not <a target="_blank" + * href="https://doc.cgal.org/latest/Kernel_d/structCGAL_1_1Epeck__d.html">CGAL::Epeck_d</a>. + * Default is false. + */ + Sphere_circumradius(const bool exact = false) : exact_(exact) {} + +}; + +} // namespace cech_complex + +} // namespace Gudhi + +#endif // SPHERE_CIRCUMRADIUS_H_ diff --git a/src/Cech_complex/test/CMakeLists.txt b/src/Cech_complex/test/CMakeLists.txt index e6a2a18f..2d736f27 100644 --- a/src/Cech_complex/test/CMakeLists.txt +++ b/src/Cech_complex/test/CMakeLists.txt @@ -1,11 +1,14 @@ -include(GUDHI_boost_test) +if (NOT CGAL_WITH_EIGEN3_VERSION VERSION_LESS 5.0.1) + include(GUDHI_boost_test) -add_executable ( Cech_complex_test_unit test_cech_complex.cpp ) -if (TBB_FOUND) - target_link_libraries(Cech_complex_test_unit ${TBB_LIBRARIES}) -endif() + add_executable ( Cech_complex_test_unit test_cech_complex.cpp ) + if (TBB_FOUND) + target_link_libraries(Cech_complex_test_unit ${TBB_LIBRARIES}) + endif() + + # Do not forget to copy test files in current binary dir + file(COPY "${CMAKE_SOURCE_DIR}/data/points/alphacomplexdoc.off" DESTINATION ${CMAKE_CURRENT_BINARY_DIR}/) -# Do not forget to copy test files in current binary dir -file(COPY "${CMAKE_SOURCE_DIR}/data/points/alphacomplexdoc.off" DESTINATION ${CMAKE_CURRENT_BINARY_DIR}/) + gudhi_add_boost_test(Cech_complex_test_unit) -gudhi_add_boost_test(Cech_complex_test_unit) +endif() diff --git a/src/Cech_complex/test/test_cech_complex.cpp b/src/Cech_complex/test/test_cech_complex.cpp index 6e00d7b5..f5980e6d 100644 --- a/src/Cech_complex/test/test_cech_complex.cpp +++ b/src/Cech_complex/test/test_cech_complex.cpp @@ -22,21 +22,20 @@ // to construct Cech_complex from a OFF file of points #include <gudhi/Points_off_io.h> #include <gudhi/Simplex_tree.h> -#include <gudhi/distance_functions.h> #include <gudhi/Unitary_tests_utils.h> -#include <gudhi/Miniball.hpp> + +#include <CGAL/Epeck_d.h> // For EXACT or SAFE version // Type definitions using Simplex_tree = Gudhi::Simplex_tree<>; using Filtration_value = Simplex_tree::Filtration_value; -using Point = std::vector<Filtration_value>; +using Kernel = CGAL::Epeck_d<CGAL::Dynamic_dimension_tag>; +using FT = typename Kernel::FT; +using Point = typename Kernel::Point_d; + using Point_cloud = std::vector<Point>; using Points_off_reader = Gudhi::Points_off_reader<Point>; -using Cech_complex = Gudhi::cech_complex::Cech_complex<Simplex_tree, Point_cloud>; - -using Point_iterator = Point_cloud::const_iterator; -using Coordinate_iterator = Point::const_iterator; -using Min_sphere = Gudhi::Miniball::Miniball<Gudhi::Miniball::CoordAccessor<Point_iterator, Coordinate_iterator>>; +using Cech_complex = Gudhi::cech_complex::Cech_complex<Kernel, Simplex_tree>; BOOST_AUTO_TEST_CASE(Cech_complex_for_documentation) { // ---------------------------------------------------------------------------- @@ -45,17 +44,29 @@ BOOST_AUTO_TEST_CASE(Cech_complex_for_documentation) { // // ---------------------------------------------------------------------------- Point_cloud points; - points.push_back({1., 0.}); // 0 - points.push_back({0., 1.}); // 1 - points.push_back({2., 1.}); // 2 - points.push_back({3., 2.}); // 3 - points.push_back({0., 3.}); // 4 - points.push_back({3. + std::sqrt(3.), 3.}); // 5 - points.push_back({1., 4.}); // 6 - points.push_back({3., 4.}); // 7 - points.push_back({2., 4. + std::sqrt(3.)}); // 8 - points.push_back({0., 4.}); // 9 - points.push_back({-0.5, 2.}); // 10 + + std::vector<FT> point0({1., 0.}); + points.emplace_back(point0.begin(), point0.end()); + std::vector<FT> point1({0., 1.}); + points.emplace_back(point1.begin(), point1.end()); + std::vector<FT> point2({2., 1.}); + points.emplace_back(point2.begin(), point2.end()); + std::vector<FT> point3({3., 2.}); + points.emplace_back(point3.begin(), point3.end()); + std::vector<FT> point4({0., 3.}); + points.emplace_back(point4.begin(), point4.end()); + std::vector<FT> point5({3. + std::sqrt(3.), 3.}); + points.emplace_back(point5.begin(), point5.end()); + std::vector<FT> point6({1., 4.}); + points.emplace_back(point6.begin(), point6.end()); + std::vector<FT> point7({3., 4.}); + points.emplace_back(point7.begin(), point7.end()); + std::vector<FT> point8({2., 4. + std::sqrt(3.)}); + points.emplace_back(point8.begin(), point8.end()); + std::vector<FT> point9({0., 4.}); + points.emplace_back(point9.begin(), point9.end()); + std::vector<FT> point10({-0.5, 2.}); + points.emplace_back(point10.begin(), point10.end()); Filtration_value max_radius = 1.0; std::clog << "========== NUMBER OF POINTS = " << points.size() << " - Cech max_radius = " << max_radius @@ -96,11 +107,11 @@ BOOST_AUTO_TEST_CASE(Cech_complex_for_documentation) { std::clog << vertex << ","; vp.push_back(points.at(vertex)); } - std::clog << ") - distance =" << Gudhi::Minimal_enclosing_ball_radius()(vp.at(0), vp.at(1)) + std::clog << ") - distance =" << Gudhi::cech_complex::Sphere_circumradius<Kernel, Filtration_value>()(vp.at(0), vp.at(1)) << " - filtration =" << st.filtration(f_simplex) << std::endl; BOOST_CHECK(vp.size() == 2); GUDHI_TEST_FLOAT_EQUALITY_CHECK(st.filtration(f_simplex), - Gudhi::Minimal_enclosing_ball_radius()(vp.at(0), vp.at(1))); + Gudhi::cech_complex::Sphere_circumradius<Kernel, Filtration_value>()(vp.at(0), vp.at(1))); } } @@ -125,35 +136,34 @@ BOOST_AUTO_TEST_CASE(Cech_complex_for_documentation) { for (std::size_t vertex = 0; vertex <= 2; vertex++) { points012.push_back(cech_complex_for_doc.get_point(vertex)); } - std::size_t dimension = points[0].end() - points[0].begin(); - Min_sphere ms012(dimension, points012.begin(), points012.end()); - Simplex_tree::Filtration_value f012 = st2.filtration(st2.find({0, 1, 2})); - std::clog << "f012= " << f012 << " | ms012_radius= " << std::sqrt(ms012.squared_radius()) << std::endl; + Kernel kern; + Filtration_value f012 = st2.filtration(st2.find({0, 1, 2})); + std::clog << "f012= " << f012 << std::endl; - GUDHI_TEST_FLOAT_EQUALITY_CHECK(f012, std::sqrt(ms012.squared_radius())); + CGAL::NT_converter<FT, Filtration_value> cast_to_fv; + GUDHI_TEST_FLOAT_EQUALITY_CHECK(f012, std::sqrt(cast_to_fv(kern.compute_squared_radius_d_object()(points012.begin(), points012.end())))); Point_cloud points1410; points1410.push_back(cech_complex_for_doc.get_point(1)); points1410.push_back(cech_complex_for_doc.get_point(4)); points1410.push_back(cech_complex_for_doc.get_point(10)); - Min_sphere ms1410(dimension, points1410.begin(), points1410.end()); - Simplex_tree::Filtration_value f1410 = st2.filtration(st2.find({1, 4, 10})); - std::clog << "f1410= " << f1410 << " | ms1410_radius= " << std::sqrt(ms1410.squared_radius()) << std::endl; + Filtration_value f1410 = st2.filtration(st2.find({1, 4, 10})); + std::clog << "f1410= " << f1410 << std::endl; - GUDHI_TEST_FLOAT_EQUALITY_CHECK(f1410, std::sqrt(ms1410.squared_radius())); + // In this case, the computed circumsphere using CGAL kernel does not match the minimal enclosing ball; the filtration value check is therefore done against a hardcoded value + GUDHI_TEST_FLOAT_EQUALITY_CHECK(f1410, 1.); Point_cloud points469; points469.push_back(cech_complex_for_doc.get_point(4)); points469.push_back(cech_complex_for_doc.get_point(6)); points469.push_back(cech_complex_for_doc.get_point(9)); - Min_sphere ms469(dimension, points469.begin(), points469.end()); - Simplex_tree::Filtration_value f469 = st2.filtration(st2.find({4, 6, 9})); - std::clog << "f469= " << f469 << " | ms469_radius= " << std::sqrt(ms469.squared_radius()) << std::endl; + Filtration_value f469 = st2.filtration(st2.find({4, 6, 9})); + std::clog << "f469= " << f469 << std::endl; - GUDHI_TEST_FLOAT_EQUALITY_CHECK(f469, std::sqrt(ms469.squared_radius())); + GUDHI_TEST_FLOAT_EQUALITY_CHECK(f469, std::sqrt(cast_to_fv(kern.compute_squared_radius_d_object()(points469.begin(), points469.end())))); BOOST_CHECK((st2.find({6, 7, 8}) == st2.null_simplex())); BOOST_CHECK((st2.find({3, 5, 7}) == st2.null_simplex())); @@ -235,7 +245,7 @@ BOOST_AUTO_TEST_CASE(Cech_create_complex_throw) { // // ---------------------------------------------------------------------------- std::string off_file_name("alphacomplexdoc.off"); - double max_radius = 12.0; + Filtration_value max_radius = 12.0; std::clog << "========== OFF FILE NAME = " << off_file_name << " - Cech max_radius=" << max_radius << "==========" << std::endl; diff --git a/src/Cech_complex/utilities/CMakeLists.txt b/src/Cech_complex/utilities/CMakeLists.txt index b183c8d8..64557cee 100644 --- a/src/Cech_complex/utilities/CMakeLists.txt +++ b/src/Cech_complex/utilities/CMakeLists.txt @@ -1,15 +1,33 @@ -project(Cech_complex_utilities) +if (NOT CGAL_WITH_EIGEN3_VERSION VERSION_LESS 5.0.1) + project(Cech_complex_utilities) -if (TARGET Boost::program_options) - add_executable(cech_persistence cech_persistence.cpp) - target_link_libraries(cech_persistence Boost::program_options) + if (TARGET Boost::program_options) + add_executable(cech_persistence cech_persistence.cpp) + target_link_libraries(cech_persistence Boost::program_options) - if (TBB_FOUND) - target_link_libraries(cech_persistence ${TBB_LIBRARIES}) - endif() + if (TBB_FOUND) + target_link_libraries(cech_persistence ${TBB_LIBRARIES}) + endif() + + add_test(NAME Cech_complex_utility_from_rips_on_tore_3D_safe COMMAND $<TARGET_FILE:cech_persistence> + "${CMAKE_SOURCE_DIR}/data/points/tore3D_300.off" "-r" "0.25" "-m" "0.5" "-d" "3" "-p" "3" "-o" "safe.pers") + add_test(NAME Cech_complex_utility_from_rips_on_tore_3D_fast COMMAND $<TARGET_FILE:cech_persistence> + "${CMAKE_SOURCE_DIR}/data/points/tore3D_300.off" "-r" "0.25" "-m" "0.5" "-d" "3" "-p" "3" "-o" "fast.pers" "-f") + add_test(NAME Cech_complex_utility_from_rips_on_tore_3D_exact COMMAND $<TARGET_FILE:cech_persistence> + "${CMAKE_SOURCE_DIR}/data/points/tore3D_300.off" "-r" "0.25" "-m" "0.5" "-d" "3" "-p" "3" "-o" "exact.pers" "-e") - add_test(NAME Cech_complex_utility_from_rips_on_tore_3D COMMAND $<TARGET_FILE:cech_persistence> - "${CMAKE_SOURCE_DIR}/data/points/tore3D_300.off" "-r" "0.25" "-m" "0.5" "-d" "3" "-p" "3") + if (DIFF_PATH) + add_test(Cech_complex_utilities_diff_exact ${DIFF_PATH} + "exact.pers" "safe.pers") + set_tests_properties(Cech_complex_utilities_diff_exact PROPERTIES DEPENDS + "Cech_complex_utility_from_rips_on_tore_3D_safe;Cech_complex_utility_from_rips_on_tore_3D_exact") - install(TARGETS cech_persistence DESTINATION bin) -endif()
\ No newline at end of file + add_test(Cech_complex_utilities_diff_fast ${DIFF_PATH} + "fast.pers" "safe.pers") + set_tests_properties(Cech_complex_utilities_diff_fast PROPERTIES DEPENDS + "Cech_complex_utility_from_rips_on_tore_3D_safe;Cech_complex_utility_from_rips_on_tore_3D_fast") + endif() + + install(TARGETS cech_persistence DESTINATION bin) + endif() +endif() diff --git a/src/Cech_complex/utilities/cech_persistence.cpp b/src/Cech_complex/utilities/cech_persistence.cpp index daea08e2..e6419f3d 100644 --- a/src/Cech_complex/utilities/cech_persistence.cpp +++ b/src/Cech_complex/utilities/cech_persistence.cpp @@ -9,13 +9,15 @@ */ #include <gudhi/Cech_complex.h> -#include <gudhi/distance_functions.h> #include <gudhi/Simplex_tree.h> #include <gudhi/Persistent_cohomology.h> #include <gudhi/Points_off_io.h> #include <boost/program_options.hpp> +#include <CGAL/Epeck_d.h> // For EXACT or SAFE version +#include <CGAL/Epick_d.h> // For FAST version + #include <string> #include <vector> #include <limits> // infinity @@ -23,41 +25,67 @@ // Types definition using Simplex_tree = Gudhi::Simplex_tree<Gudhi::Simplex_tree_options_fast_persistence>; using Filtration_value = Simplex_tree::Filtration_value; -using Point = std::vector<double>; -using Point_cloud = std::vector<Point>; -using Points_off_reader = Gudhi::Points_off_reader<Point>; -using Cech_complex = Gudhi::cech_complex::Cech_complex<Simplex_tree, Point_cloud>; + using Field_Zp = Gudhi::persistent_cohomology::Field_Zp; using Persistent_cohomology = Gudhi::persistent_cohomology::Persistent_cohomology<Simplex_tree, Field_Zp>; -void program_options(int argc, char* argv[], std::string& off_file_points, std::string& filediag, - Filtration_value& max_radius, int& dim_max, int& p, Filtration_value& min_persistence); +void program_options(int argc, char* argv[], std::string& off_file_points, bool& exact, bool& fast, + std::string& filediag, Filtration_value& max_radius, int& dim_max, int& p, + Filtration_value& min_persistence); + +template<class Kernel> +Simplex_tree create_simplex_tree(const std::string &off_file_points, bool exact_version, + Filtration_value max_radius, int dim_max) { + using Point = typename Kernel::Point_d; + using Points_off_reader = Gudhi::Points_off_reader<Point>; + using Cech_complex = Gudhi::cech_complex::Cech_complex<Kernel, Simplex_tree>; + + Simplex_tree stree; + + Points_off_reader off_reader(off_file_points); + Cech_complex cech_complex_from_file(off_reader.get_point_cloud(), max_radius, exact_version); + cech_complex_from_file.create_complex(stree, dim_max); + + return stree; +} int main(int argc, char* argv[]) { std::string off_file_points; std::string filediag; + bool exact_version = false; + bool fast_version = false; Filtration_value max_radius; int dim_max; int p; Filtration_value min_persistence; - program_options(argc, argv, off_file_points, filediag, max_radius, dim_max, p, min_persistence); + program_options(argc, argv, off_file_points, exact_version, fast_version, filediag, max_radius, dim_max, p, + min_persistence); - Points_off_reader off_reader(off_file_points); - Cech_complex cech_complex_from_file(off_reader.get_point_cloud(), max_radius); + if ((exact_version) && (fast_version)) { + std::cerr << "You cannot set the exact and the fast version." << std::endl; + exit(-1); + } - // Construct the Cech complex in a Simplex Tree - Simplex_tree simplex_tree; + Simplex_tree stree; + if (fast_version) { + // WARNING : CGAL::Epick_d is fast but not safe (unlike CGAL::Epeck_d) + // (i.e. when the points are on a grid) + using Fast_kernel = CGAL::Epick_d<CGAL::Dynamic_dimension_tag>; + stree = create_simplex_tree<Fast_kernel>(off_file_points, exact_version, max_radius, dim_max); + } else { + using Kernel = CGAL::Epeck_d<CGAL::Dynamic_dimension_tag>; + stree = create_simplex_tree<Kernel>(off_file_points, exact_version, max_radius, dim_max); + } - cech_complex_from_file.create_complex(simplex_tree, dim_max); - std::clog << "The complex contains " << simplex_tree.num_simplices() << " simplices \n"; - std::clog << " and has dimension " << simplex_tree.dimension() << " \n"; + std::clog << "The complex contains " << stree.num_simplices() << " simplices \n"; + std::clog << " and has dimension " << stree.dimension() << " \n"; // Sort the simplices in the order of the filtration - simplex_tree.initialize_filtration(); + stree.initialize_filtration(); // Compute the persistence diagram of the complex - Persistent_cohomology pcoh(simplex_tree); + Persistent_cohomology pcoh(stree); // initializes the coefficient field for homology pcoh.init_coefficients(p); @@ -75,8 +103,9 @@ int main(int argc, char* argv[]) { return 0; } -void program_options(int argc, char* argv[], std::string& off_file_points, std::string& filediag, - Filtration_value& max_radius, int& dim_max, int& p, Filtration_value& min_persistence) { +void program_options(int argc, char* argv[], std::string& off_file_points, bool& exact, bool& fast, + std::string& filediag, Filtration_value& max_radius, int& dim_max, int& p, + Filtration_value& min_persistence) { namespace po = boost::program_options; po::options_description hidden("Hidden options"); hidden.add_options()("input-file", po::value<std::string>(&off_file_points), @@ -84,8 +113,12 @@ void program_options(int argc, char* argv[], std::string& off_file_points, std:: po::options_description visible("Allowed options", 100); visible.add_options()("help,h", "produce help message")( + "exact,e", po::bool_switch(&exact), + "To activate exact version of Cech complex (default is false, not available if fast is set)")( + "fast,f", po::bool_switch(&fast), + "To activate fast version of Cech complex (default is false, not available if exact is set)")( "output-file,o", po::value<std::string>(&filediag)->default_value(std::string()), - "Name of file in which the persistence diagram is written. Default print in std::clog")( + "Name of file in which the persistence diagram is written. Default print in standard output")( "max-radius,r", po::value<Filtration_value>(&max_radius)->default_value(std::numeric_limits<Filtration_value>::infinity()), "Maximal length of an edge for the Cech complex construction.")( diff --git a/src/Cech_complex/utilities/cechcomplex.md b/src/Cech_complex/utilities/cechcomplex.md index 821e4dad..54c4e88d 100644 --- a/src/Cech_complex/utilities/cechcomplex.md +++ b/src/Cech_complex/utilities/cechcomplex.md @@ -26,18 +26,24 @@ a prime number). **Usage** -`cech_persistence [options] <OFF input file>` +`cech_persistence [options] <input OFF file>` + +where +`<input OFF file>` is the path to the input point cloud in +[nOFF ASCII format]({{ site.officialurl }}/doc/latest/fileformats.html#FileFormatsOFF). **Allowed options** * `-h [ --help ]` Produce help message * `-o [ --output-file ]` Name of file in which the persistence diagram is written. Default print in standard output. -* `-r [ --max-edge-length ]` (default = inf) Maximal length of an edge for the Čech complex construction. +* `-r [ --max-radius ]` (default = inf) Maximal radius for the Čech complex construction. * `-d [ --cpx-dimension ]` (default = 1) Maximal dimension of the Čech complex we want to compute. * `-p [ --field-charac ]` (default = 11) Characteristic p of the coefficient field Z/pZ for computing homology. * `-m [ --min-persistence ]` (default = 0) Minimal lifetime of homology feature to be recorded. Enter a negative value to see zero length intervals. +* `-e [ --exact ]` for the exact computation version. +* `-f [ --fast ]` for the fast computation version. -Beware: this program may use a lot of RAM and take a lot of time if `max-edge-length` is set to a large value. +Beware: this program may use a lot of RAM and take a lot of time if `max-radius` is set to a large value. **Example 1 with Z/2Z coefficients** diff --git a/src/Collapse/doc/intro_edge_collapse.h b/src/Collapse/doc/intro_edge_collapse.h index 81edd79f..12e909c8 100644 --- a/src/Collapse/doc/intro_edge_collapse.h +++ b/src/Collapse/doc/intro_edge_collapse.h @@ -17,80 +17,60 @@ namespace collapse { /** \defgroup edge_collapse Edge collapse * - * \author Siddharth Pritam + * \author Siddharth Pritam and Marc Glisse * * @{ * - * This module implements edge collapse of a filtered flag complex, in particular it reduces a filtration of - * Vietoris-Rips complex from its graph to another smaller flag filtration with same persistence. - * Where a filtration is a sequence of simplicial (here Rips) complexes connected with inclusions. + * This module implements edge collapse of a filtered flag complex as described in \cite edgecollapsearxiv, in + * particular it reduces a filtration of Vietoris-Rips complex represented by a graph to a smaller flag filtration with + * the same persistent homology. * * \section edge_collapse_definition Edge collapse definition * * An edge \f$e\f$ in a simplicial complex \f$K\f$ is called a <b>dominated edge</b> if the link of \f$e\f$ in * \f$K\f$, \f$lk_K(e)\f$ is a simplicial cone, that is, there exists a vertex \f$v^{\prime} \notin e\f$ and a - * subcomplex \f$L\f$ in \f$K\f$, such that \f$lk_K(e) = v^{\prime}L\f$. We say that the vertex \f$v^{\prime}\f$ is - * {dominating} \f$e\f$ and \f$e\f$ is {dominated} by \f$v^{\prime}\f$. - * An <b> elementary egde collapse </b> is the removal of a dominated edge \f$e\f$ from \f$K\f$, - * which we denote with \f$K\f$ \f${\searrow\searrow}^1 \f$ \f$K\setminus e\f$. - * The symbol \f$\mathbf{K\setminus e}\f$ (deletion of \f$e\f$ from \f$K\f$) refers to the subcomplex of \f$K\f$ which - * has all simplices of \f$K\f$ except \f$e\f$ and the ones containing \f$e\f$. - * There is an <b>edge collapse</b> from a simplicial complex \f$K\f$ to its subcomplex \f$L\f$, - * if there exists a series of elementary edge collapses from \f$K\f$ to \f$L\f$, denoted as \f$K\f$ - * \f${\searrow\searrow}\f$ \f$L\f$. - * - * An edge collapse is a homotopy preserving operation, and it can be further expressed as sequence of the classical - * elementary simple collapse. - * A complex without any dominated edge is called a \f$1\f$- minimal complex and the core \f$K^1\f$ of simplicial - * complex is a minimal complex such that \f$K\f$ \f${\searrow\searrow}\f$ \f$K^1\f$. - * Computation of a core (not unique) involves computation of dominated edges and the dominated edges can be easily - * characterized as follows: + * subcomplex \f$L\f$ in \f$K\f$, such that \f$lk_K(e) = v^{\prime}L\f$. We say that the vertex \f$v^{\prime}\f$ + * \e dominates \f$e\f$ and \f$e\f$ is \e dominated by \f$v^{\prime}\f$. + * An <b> elementary edge collapse </b> is the removal of a dominated edge \f$e\f$ from \f$K\f$ (the cofaces of \f$e\f$ + * are implicitly removed as well). + * Domination is used as a simple sufficient condition that ensures that this removal is a homotopy preserving + * operation. + * + * The dominated edges can be easily characterized as follows: * - * -- For general simplicial complex: An edge \f$e \in K\f$ is dominated by another vertex \f$v^{\prime} \in K\f$, - * <i>if and only if</i> all the maximal simplices of \f$K\f$ that contain \f$e\f$ also contain \f$v^{\prime}\f$ + * -- For a general simplicial complex: an edge \f$e \in K\f$ is dominated by another vertex \f$v^{\prime} \in K\f$, + * if and only if all the maximal simplices of \f$K\f$ that contain \f$e\f$ also contain \f$v^{\prime}\f$. * - * -- For a flag complex: An edge \f$e \in K\f$ is dominated by another vertex \f$v^{\prime} \in K\f$, <i>if and only - * if</i> all the vertices in \f$K\f$ that has an edge with both vertices of \f$e\f$ also has an edge with - * \f$v^{\prime}\f$. + * -- For a flag complex: an edge \f$e \in K\f$ is dominated by another vertex \f$v^{\prime} \in K\f$, if and only + * if all the vertices in \f$K\f$ that have an edge with both vertices of \f$e\f$ also have an edge with + * \f$v^{\prime}\f$. Notice that this only depends on the graph. * - * The algorithm to compute the smaller induced filtration is described in Section 5 \cite edgecollapsesocg2020. - * Edge collapse can be successfully employed to reduce any given filtration of flag complexes to a smaller induced + * In the context of a filtration, an edge collapse may translate into an increase of the filtration value of an edge, + * or its removal if it already had the largest filtration value. + * The algorithm to compute the smaller induced filtration is described in \cite edgecollapsearxiv. + * Edge collapse can be successfully employed to reduce any input filtration of flag complexes to a smaller induced * filtration which preserves the persistent homology of the original filtration and is a flag complex as well. * - * The general idea is that we consider edges in the filtered graph and sort them according to their filtration value - * giving them a total order. - * Each edge gets a unique index denoted as \f$i\f$ in this order. To reduce the filtration, we move forward with - * increasing filtration value - * in the graph and check if the current edge \f$e_i\f$ is dominated in the current graph \f$G_i := \{e_1, .. e_i\} \f$ - * or not. - * If the edge \f$e_i\f$ is dominated we remove it from the filtration and move forward to the next edge \f$e_{i+1}\f$. - * If \f$e_i\f$ is non-dominated then we keep it in the reduced filtration and then go backward in the current graph - * \f$G_i\f$ to look for new non-dominated edges that was dominated before but might become non-dominated at this - * point. - * If an edge \f$e_j, j < i \f$ during the backward search is found to be non-dominated, we include \f$e_j\f$ in to the - * reduced filtration and we set its new filtration value to be \f$i\f$ that is the index of \f$e_i\f$. - * The precise mechanism for this reduction has been described in Section 5 \cite edgecollapsesocg2020. - * Here we implement this mechanism for a filtration of Rips complex. - * After perfoming the reduction the filtration reduces to a flag-filtration with the same persistence as the original - * filtration. - * + * The algorithm implemented here does not produce a minimal filtration. Taking its output and applying the algorithm a + * second time may further simplify the filtration. + * * \subsection edgecollapseexample Basic edge collapse * * This example calls `Gudhi::collapse::flag_complex_collapse_edges()` from a proximity graph represented as a list of * `Filtered_edge`. - * Then it collapses edges and displays a new list of `Filtered_edge` (with less edges) + * Then it collapses edges and displays a new list of `Filtered_edge` (with fewer edges) * that will preserve the persistence homology computation. * - * \include Collapse/edge_collapse_basic_example.cpp + * \include edge_collapse_basic_example.cpp * * When launching the example: * * \code $> ./Edge_collapse_example_basic * \endcode * - * the program output is: + * the program output could be: * - * \include Collapse/edge_collapse_example_basic.txt + * \include edge_collapse_example_basic.txt */ /** @} */ // end defgroup strong_collapse diff --git a/src/Collapse/example/edge_collapse_conserve_persistence.cpp b/src/Collapse/example/edge_collapse_conserve_persistence.cpp index b2c55e7a..19960597 100644 --- a/src/Collapse/example/edge_collapse_conserve_persistence.cpp +++ b/src/Collapse/example/edge_collapse_conserve_persistence.cpp @@ -103,7 +103,7 @@ int main(int argc, char* argv[]) { Gudhi::Euclidean_distance()); if (num_edges(proximity_graph) <= 0) { - std::cerr << "Total number of egdes are zero." << std::endl; + std::cerr << "Total number of edges is zero." << std::endl; exit(-1); } diff --git a/src/Collapse/include/gudhi/Flag_complex_edge_collapser.h b/src/Collapse/include/gudhi/Flag_complex_edge_collapser.h index 713c6608..d0b3fe4a 100644 --- a/src/Collapse/include/gudhi/Flag_complex_edge_collapser.h +++ b/src/Collapse/include/gudhi/Flag_complex_edge_collapser.h @@ -1,11 +1,12 @@ /* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. - * Author(s): Siddharth Pritam + * Author(s): Siddharth Pritam, Marc Glisse * * Copyright (C) 2020 Inria * * Modification(s): * - 2020/03 Vincent Rouvreau: integration to the gudhi library + * - 2021 Marc Glisse: complete rewrite * - YYYY/MM Author: Description of the modification */ @@ -14,367 +15,319 @@ #include <gudhi/Debug_utils.h> -#include <boost/functional/hash.hpp> -#include <boost/iterator/iterator_facade.hpp> - -#include <Eigen/Sparse> -#include <Eigen/src/Core/util/Macros.h> // for EIGEN_VERSION_AT_LEAST +#include <boost/container/flat_map.hpp> +#include <boost/container/flat_set.hpp> #ifdef GUDHI_USE_TBB #include <tbb/parallel_sort.h> #endif -#include <iostream> -#include <utility> // for std::pair +#include <utility> #include <vector> -#include <unordered_map> -#include <unordered_set> -#include <set> -#include <tuple> // for std::tie -#include <algorithm> // for std::includes -#include <iterator> // for std::inserter -#include <type_traits> // for std::decay - -// Make compilation fail - required for external projects - https://github.com/GUDHI/gudhi-devel/issues/10 -#if !EIGEN_VERSION_AT_LEAST(3,1,0) -# error Edge Collapse is only available for Eigen3 >= 3.1.0 -#endif +#include <tuple> +#include <algorithm> +#include <limits> namespace Gudhi { namespace collapse { /** \private - * - * \brief Flag complex sparse matrix data structure. * - * \details - * This class stores a <a target="_blank" href="https://en.wikipedia.org/wiki/Clique_complex">Flag complex</a> - * in an <a target="_blank" href="https://eigen.tuxfamily.org/dox/group__TutorialSparse.html">Eigen sparse matrix</a>. + * \brief Flag complex sparse matrix data structure. * - * \tparam Vertex type must be a signed integer type. It admits a total order <. - * \tparam Filtration type for the value of the filtration function. Must be comparable with <. + * \tparam Vertex type must be an integer type. + * \tparam Filtration type for the value of the filtration function. */ -template<typename Vertex, typename Filtration> -class Flag_complex_edge_collapser { - public: - /** \brief Re-define Vertex as Vertex_handle type to ease the interface with `Gudhi::Proximity_graph`. */ - using Vertex_handle = Vertex; - /** \brief Re-define Filtration as Filtration_value type to ease the interface with `Gudhi::Proximity_graph`. */ - using Filtration_value = Filtration; - - private: - // internal numbering of vertices and edges - using IVertex = std::size_t; - using Edge_index = std::size_t; - using IEdge = std::pair<IVertex, IVertex>; - - // The sparse matrix data type - // (Eigen::SparseMatrix<Edge_index, Eigen::RowMajor> has slow insertions) - using Sparse_vector = Eigen::SparseVector<Edge_index>; - using Sparse_row_matrix = std::vector<Sparse_vector>; - - // Range of neighbors of a vertex - template<bool closed> - struct Neighbours { - class iterator : public boost::iterator_facade<iterator, - IVertex, /* value_type */ - std::input_iterator_tag, // or boost::single_pass_traversal_tag - IVertex /* reference */ > - { - public: - iterator():ptr(nullptr){} - iterator(Neighbours const*p):ptr(p){find_valid();} - private: - friend class boost::iterator_core_access; - Neighbours const*ptr; - void increment(){ - ++ptr->it; - find_valid(); - } - void find_valid(){ - auto& it = ptr->it; - do { - if(!it) { ptr=nullptr; break; } - if(IVertex(it.index()) == ptr->u) { - if(closed) break; - else continue; - } - Edge_index e = it.value(); - if(e <= ptr->ec->current_backward || ptr->ec->critical_edge_indicator_[e]) break; - } while(++it, true); - } - bool equal(iterator const& other) const { return ptr == other.ptr; } - IVertex dereference() const { return ptr->it.index(); } - }; - typedef iterator const_iterator; - mutable typename Sparse_vector::InnerIterator it; - Flag_complex_edge_collapser const*ec; - IVertex u; - iterator begin() const { return this; } - iterator end() const { return {}; } - explicit Neighbours(Flag_complex_edge_collapser const*p,IVertex u):it(p->sparse_row_adjacency_matrix_[u]),ec(p),u(u){} - }; - - // A range of row indices - using IVertex_vector = std::vector<IVertex>; - - public: - /** \brief Filtered_edge is a type to store an edge with its filtration value. */ - using Filtered_edge = std::tuple<Vertex_handle, Vertex_handle, Filtration_value>; - - private: - // Map from row index to its vertex handle - std::vector<Vertex_handle> row_to_vertex_; - - // Index of the current edge in the backwards walk. Edges <= current_backward are part of the temporary graph, - // while edges > current_backward are removed unless critical_edge_indicator_. - Edge_index current_backward = -1; - - // Map from IEdge to its index - std::unordered_map<IEdge, Edge_index, boost::hash<IEdge>> iedge_to_index_map_; - - // Boolean vector to indicate if the edge is critical. - std::vector<bool> critical_edge_indicator_; - - // Map from vertex handle to its row index - std::unordered_map<Vertex_handle, IVertex> vertex_to_row_; - - // Stores the Sparse matrix of Filtration values representing the original graph. - // The matrix rows and columns are indexed by IVertex. - Sparse_row_matrix sparse_row_adjacency_matrix_; - - // The input, a vector of filtered edges. - std::vector<Filtered_edge> f_edge_vector_; - - // Edge is the actual edge (u,v), with Vertex_handle u and v, not IVertex. - bool edge_is_dominated(Vertex_handle u, Vertex_handle v) const - { - const IVertex rw_u = vertex_to_row_.at(u); - const IVertex rw_v = vertex_to_row_.at(v); -#ifdef DEBUG_TRACES - std::cout << "The edge {" << u << ", " << v << "} is going for domination check." << std::endl; -#endif // DEBUG_TRACES - auto common_neighbours = open_common_neighbours_row_index(rw_u, rw_v); -#ifdef DEBUG_TRACES - std::cout << "And its common neighbours are." << std::endl; - for (auto neighbour : common_neighbours) { - std::cout << row_to_vertex_[neighbour] << ", " ; - } - std::cout<< std::endl; -#endif // DEBUG_TRACES - if (common_neighbours.size() == 1) - return true; - else - for (auto rw_c : common_neighbours) { - auto neighbours_c = neighbours_row_index<true>(rw_c); - // If neighbours_c contains the common neighbours. - if (std::includes(neighbours_c.begin(), neighbours_c.end(), - common_neighbours.begin(), common_neighbours.end())) - return true; - } - return false; +template<typename Vertex, typename Filtration_value> +struct Flag_complex_edge_collapser { + using Filtered_edge = std::tuple<Vertex, Vertex, Filtration_value>; + typedef std::pair<Vertex,Vertex> Edge; + struct Cmpi { template<class T, class U> bool operator()(T const&a, U const&b)const{return b<a; } }; + typedef boost::container::flat_map<Vertex, Filtration_value> Ngb_list; + typedef std::vector<Ngb_list> Neighbors; + Neighbors neighbors; // closed neighborhood + std::size_t num_vertices; + std::vector<std::tuple<Vertex, Vertex, Filtration_value>> res; + +#ifdef GUDHI_COLLAPSE_USE_DENSE_ARRAY + // Minimal matrix interface + // Using this matrix generally helps performance, but the memory use may be excessive for a very sparse graph + // (and in extreme cases the constant initialization of the matrix may start to dominate the running time). + // Are there cases where the matrix is too big but a hash table would help? + std::vector<Filtration_value> neighbors_data; + void init_neighbors_dense(){ + neighbors_data.clear(); + neighbors_data.resize(num_vertices*num_vertices, std::numeric_limits<Filtration_value>::infinity()); } + Filtration_value& neighbors_dense(Vertex i, Vertex j){return neighbors_data[num_vertices*j+i];} +#endif - // Returns the edges connecting u and v (extremities of crit) to their common neighbors (not themselves) - std::set<Edge_index> three_clique_indices(Edge_index crit) { - std::set<Edge_index> edge_indices; - - Vertex_handle u = std::get<0>(f_edge_vector_[crit]); - Vertex_handle v = std::get<1>(f_edge_vector_[crit]); - -#ifdef DEBUG_TRACES - std::cout << "The current critical edge to re-check criticality with filt value is : f {" << u << "," << v - << "} = " << std::get<2>(f_edge_vector_[crit]) << std::endl; -#endif // DEBUG_TRACES - auto rw_u = vertex_to_row_[u]; - auto rw_v = vertex_to_row_[v]; - - IVertex_vector common_neighbours = open_common_neighbours_row_index(rw_u, rw_v); + // This does not touch the events list, only the adjacency matrix(es) + void delay_neighbor(Vertex u, Vertex v, Filtration_value f) { + neighbors[u][v]=f; + neighbors[v][u]=f; +#ifdef GUDHI_COLLAPSE_USE_DENSE_ARRAY + neighbors_dense(u,v)=f; + neighbors_dense(v,u)=f; +#endif + } + void remove_neighbor(Vertex u, Vertex v) { + neighbors[u].erase(v); + neighbors[v].erase(u); +#ifdef GUDHI_COLLAPSE_USE_DENSE_ARRAY + neighbors_dense(u,v)=std::numeric_limits<Filtration_value>::infinity(); + neighbors_dense(v,u)=std::numeric_limits<Filtration_value>::infinity(); +#endif + } - for (auto rw_c : common_neighbours) { - IEdge e_with_new_nbhr_v = std::minmax(rw_u, rw_c); - IEdge e_with_new_nbhr_u = std::minmax(rw_v, rw_c); - edge_indices.emplace(iedge_to_index_map_[e_with_new_nbhr_v]); - edge_indices.emplace(iedge_to_index_map_[e_with_new_nbhr_u]); + template<class FilteredEdgeRange> + void read_edges(FilteredEdgeRange const&r){ + neighbors.resize(num_vertices); +#ifdef GUDHI_COLLAPSE_USE_DENSE_ARRAY + init_neighbors_dense(); +#endif + // Use the raw sequence to avoid maintaining the order + std::vector<typename Ngb_list::sequence_type> neighbors_seq(num_vertices); + for(auto&&e : r){ + using std::get; + Vertex u = get<0>(e); + Vertex v = get<1>(e); + Filtration_value f = get<2>(e); + neighbors_seq[u].emplace_back(v, f); + neighbors_seq[v].emplace_back(u, f); +#ifdef GUDHI_COLLAPSE_USE_DENSE_ARRAY + neighbors_dense(u,v)=f; + neighbors_dense(v,u)=f; +#endif + } + for(std::size_t i=0;i<neighbors_seq.size();++i){ + neighbors_seq[i].emplace_back(i, -std::numeric_limits<Filtration_value>::infinity()); + neighbors[i].adopt_sequence(std::move(neighbors_seq[i])); // calls sort +#ifdef GUDHI_COLLAPSE_USE_DENSE_ARRAY + neighbors_dense(i,i)=-std::numeric_limits<Filtration_value>::infinity(); +#endif } - return edge_indices; } - // Detect and set all edges that are becoming critical - template<typename FilteredEdgeOutput> - void set_edge_critical(Edge_index indx, Filtration_value filt, FilteredEdgeOutput filtered_edge_output) { -#ifdef DEBUG_TRACES - std::cout << "The curent index with filtration value " << indx << ", " << filt << " is primary critical" << - std::endl; -#endif // DEBUG_TRACES - std::set<Edge_index> effected_indices = three_clique_indices(indx); - // Cannot use boost::adaptors::reverse in such dynamic cases apparently - for (auto it = effected_indices.rbegin(); it != effected_indices.rend(); ++it) { - current_backward = *it; - Vertex_handle u = std::get<0>(f_edge_vector_[current_backward]); - Vertex_handle v = std::get<1>(f_edge_vector_[current_backward]); - // If current_backward is not critical so it should be processed, otherwise it stays in the graph - if (!critical_edge_indicator_[current_backward]) { - if (!edge_is_dominated(u, v)) { -#ifdef DEBUG_TRACES - std::cout << "The curent index became critical " << current_backward << std::endl; -#endif // DEBUG_TRACES - critical_edge_indicator_[current_backward] = true; - filtered_edge_output(u, v, filt); - std::set<Edge_index> inner_effected_indcs = three_clique_indices(current_backward); - for (auto inr_idx : inner_effected_indcs) { - if(inr_idx < current_backward) // && !critical_edge_indicator_[inr_idx] - effected_indices.emplace(inr_idx); - } -#ifdef DEBUG_TRACES - std::cout << "The following edge is critical with filt value: {" << u << "," << v << "}; " - << filt << std::endl; -#endif // DEBUG_TRACES - } + // Open neighborhood + // At some point it helped gcc to add __attribute__((noinline)) here, otherwise we had +50% on the running time + // on one example. It looks ok now, or I forgot which example that was. + void common_neighbors(boost::container::flat_set<Vertex>& e_ngb, + std::vector<std::pair<Filtration_value, Vertex>>& e_ngb_later, + Vertex u, Vertex v, Filtration_value f_event){ + // Using neighbors_dense here seems to hurt, even if we loop on the smaller of nu and nv. + Ngb_list const&nu = neighbors[u]; + Ngb_list const&nv = neighbors[v]; + auto ui = nu.begin(); + auto ue = nu.end(); + auto vi = nv.begin(); + auto ve = nv.end(); + assert(ui != ue && vi != ve); + while(ui != ue && vi != ve){ + Vertex w = ui->first; + if(w < vi->first) { ++ui; continue; } + if(w > vi->first) { ++vi; continue; } + // nu and nv are closed, so we need to exclude e here. + if(w != u && w != v) { + Filtration_value f = std::max(ui->second, vi->second); + if(f > f_event) + e_ngb_later.emplace_back(f, w); + else + e_ngb.insert(e_ngb.end(), w); } + ++ui; ++vi; } - // Clear the implicit "removed from graph" data structure - current_backward = -1; } - // Returns list of neighbors of a particular vertex. - template<bool closed> - auto neighbours_row_index(IVertex rw_u) const - { - return Neighbours<closed>(this, rw_u); + // Test if the neighborhood of e is included in the closed neighborhood of c + template<class Ngb> + bool is_dominated_by(Ngb const& e_ngb, Vertex c, Filtration_value f){ + // The best strategy probably depends on the distribution, how sparse / dense the adjacency matrix is, + // how (un)balanced the sizes of e_ngb and nc are. + // Some efficient operations on sets work best with bitsets, although the need for a map complicates things. +#ifdef GUDHI_COLLAPSE_USE_DENSE_ARRAY + for(auto v : e_ngb) { + // if(v==c)continue; + if(neighbors_dense(v,c) > f) return false; + } + return true; +#else + auto&&nc = neighbors[c]; + // if few neighbors, use dichotomy? Seems slower. + // I tried storing a copy of neighbors as a vector<absl::flat_hash_map> and using it for nc, but it was + // a bit slower here. It did help with neighbors[dominator].find(w) in the main function though, + // sometimes enough, sometimes not. + auto ci = nc.begin(); + auto ce = nc.end(); + auto eni = e_ngb.begin(); + auto ene = e_ngb.end(); + assert(eni != ene); + assert(ci != ce); + // if(*eni == c && ++eni == ene) return true; + for(;;){ + Vertex ve = *eni; + Vertex vc = ci->first; + while(ve > vc) { + // try a gallop strategy (exponential search)? Seems slower + if(++ci == ce) return false; + vc = ci->first; + } + if(ve < vc) return false; + // ve == vc + if(ci->second > f) return false; + if(++eni == ene)return true; + // If we stored an open neighborhood of c (excluding c), we would need to test for c here and before the loop + // if(*eni == c && ++eni == ene)return true; + if(++ci == ce) return false; + } +#endif } - // Returns the list of open neighbours of the edge :{u,v}. - IVertex_vector open_common_neighbours_row_index(IVertex rw_u, IVertex rw_v) const - { - auto non_zero_indices_u = neighbours_row_index<false>(rw_u); - auto non_zero_indices_v = neighbours_row_index<false>(rw_v); - IVertex_vector common; - std::set_intersection(non_zero_indices_u.begin(), non_zero_indices_u.end(), non_zero_indices_v.begin(), - non_zero_indices_v.end(), std::back_inserter(common)); - - return common; - } + template<class FilteredEdgeRange, class Delay> + void process_edges(FilteredEdgeRange const& edges, Delay&& delay) { + { + Vertex maxi = 0, maxj = 0; + for(auto& fe : edges) { + Vertex i = std::get<0>(fe); + Vertex j = std::get<1>(fe); + if (i > maxi) maxi = i; + if (j > maxj) maxj = j; + } + num_vertices = std::max(maxi, maxj) + 1; + } - // Insert a vertex in the data structure - IVertex insert_vertex(Vertex_handle vertex) { - auto n = row_to_vertex_.size(); - auto result = vertex_to_row_.emplace(vertex, n); - // If it was not already inserted - Value won't be updated by emplace if it is already present - if (result.second) { - // Expand the matrix. The size of rows is irrelevant. - sparse_row_adjacency_matrix_.emplace_back((std::numeric_limits<Eigen::Index>::max)()); - // Initializing the diagonal element of the adjency matrix corresponding to rw_b. - sparse_row_adjacency_matrix_[n].insert(n) = -1; // not an edge - // Must be done after reading its size() - row_to_vertex_.push_back(vertex); + read_edges(edges); + + boost::container::flat_set<Vertex> e_ngb; + e_ngb.reserve(num_vertices); + std::vector<std::pair<Filtration_value, Vertex>> e_ngb_later; + for(auto&e:edges) { + { + Vertex u = std::get<0>(e); + Vertex v = std::get<1>(e); + Filtration_value input_time = std::get<2>(e); + auto time = delay(input_time); + auto start_time = time; + e_ngb.clear(); + e_ngb_later.clear(); + common_neighbors(e_ngb, e_ngb_later, u, v, time); + // If we identify a good candidate (the first common neighbor) for being a dominator of e until infinity, + // we could check that a bit more cheaply. It does not seem to help though. + auto cmp1=[](auto const&a, auto const&b){return a.first > b.first;}; + auto e_ngb_later_begin=e_ngb_later.begin(); + auto e_ngb_later_end=e_ngb_later.end(); + bool heapified = false; + + bool dead = false; + while(true) { + Vertex dominator = -1; + // special case for size 1 + // if(e_ngb.size()==1){dominator=*e_ngb.begin();}else + // It is tempting to test the dominators in increasing order of filtration value, which is likely to reduce + // the number of calls to is_dominated_by before finding a dominator, but sorting, even partially / lazily, + // is very expensive. + for(auto c : e_ngb){ + if(is_dominated_by(e_ngb, c, time)){ + dominator = c; + break; + } + } + if(dominator==-1) break; + // Push as long as dominator remains a dominator. + // Iterate on times where at least one neighbor appears. + for (bool still_dominated = true; still_dominated; ) { + if(e_ngb_later_begin == e_ngb_later_end) { + dead = true; goto end_move; + } + if(!heapified) { + // Eagerly sorting can be slow + std::make_heap(e_ngb_later_begin, e_ngb_later_end, cmp1); + heapified=true; + } + time = e_ngb_later_begin->first; // first place it may become critical + // Update the neighborhood for this new time, while checking if any of the new neighbors break domination. + while (e_ngb_later_begin != e_ngb_later_end && e_ngb_later_begin->first <= time) { + Vertex w = e_ngb_later_begin->second; +#ifdef GUDHI_COLLAPSE_USE_DENSE_ARRAY + if (neighbors_dense(dominator,w) > e_ngb_later_begin->first) + still_dominated = false; +#else + auto& ngb_dom = neighbors[dominator]; + auto wit = ngb_dom.find(w); // neighborhood may be open or closed, it does not matter + if (wit == ngb_dom.end() || wit->second > e_ngb_later_begin->first) + still_dominated = false; +#endif + e_ngb.insert(w); + std::pop_heap(e_ngb_later_begin, e_ngb_later_end--, cmp1); + } + } // this doesn't seem to help that much... + } +end_move: + if(dead) { + remove_neighbor(u, v); + } else if(start_time != time) { + delay_neighbor(u, v, time); + res.emplace_back(u, v, time); + } else { + res.emplace_back(u, v, input_time); + } + } } - return result.first->second; } - // Insert an edge in the data structure - // @exception std::invalid_argument In debug mode, if u == v - IEdge insert_new_edge(Vertex_handle u, Vertex_handle v, Edge_index idx) - { - GUDHI_CHECK((u != v), std::invalid_argument("Flag_complex_edge_collapser::insert_new_edge with u == v")); - // The edge must not be added before, it should be a new edge. - IVertex rw_u = insert_vertex(u); - IVertex rw_v = insert_vertex(v); -#ifdef DEBUG_TRACES - std::cout << "Inserting the edge " << u <<", " << v << std::endl; -#endif // DEBUG_TRACES - sparse_row_adjacency_matrix_[rw_u].insert(rw_v) = idx; - sparse_row_adjacency_matrix_[rw_v].insert(rw_u) = idx; - return std::minmax(rw_u, rw_v); + std::vector<Filtered_edge> output() { + return std::move(res); } - public: - /** \brief Flag_complex_edge_collapser constructor from a range of filtered edges. - * - * @param[in] edges Range of Filtered edges range.There is no need the range to be sorted, as it will be performed in - * `Flag_complex_edge_collapser::process_edges`. - * - * \tparam FilteredEdgeRange must be a range for which std::begin and std::end return iterators on a - * `Flag_complex_edge_collapser::Filtered_edge`. - */ - template<typename FilteredEdgeRange> - Flag_complex_edge_collapser(const FilteredEdgeRange& edges) - : f_edge_vector_(std::begin(edges), std::end(edges)) { } +}; - /** \brief Performs edge collapse in a increasing sequence of the filtration value. - * - * \tparam filtered_edge_output is a functor that is called on the output edges, in non-decreasing order of - * filtration, as filtered_edge_output(u, v, f) where u and v are Vertex_handle representing the extremities of the - * edge, and f is its new Filtration_value. - */ - template<typename FilteredEdgeOutput> - void process_edges(FilteredEdgeOutput filtered_edge_output) { - // Sort edges - auto sort_by_filtration = [](const Filtered_edge& edge_a, const Filtered_edge& edge_b) -> bool - { - return (std::get<2>(edge_a) < std::get<2>(edge_b)); - }; +template<class R> R to_range(R&& r) { return std::move(r); } +template<class R, class T> R to_range(T&& t) { R r; r.insert(r.end(), t.begin(), t.end()); return r; } +template<class FilteredEdgeRange, class Delay> +auto flag_complex_collapse_edges(FilteredEdgeRange&& edges, Delay&&delay) { + // Would it help to label the points according to some spatial sorting? + auto first_edge_itr = std::begin(edges); + using Vertex = std::decay_t<decltype(std::get<0>(*first_edge_itr))>; + using Filtration_value = std::decay_t<decltype(std::get<2>(*first_edge_itr))>; + using Edge_collapser = Flag_complex_edge_collapser<Vertex, Filtration_value>; + if (first_edge_itr != std::end(edges)) { + auto edges2 = to_range<std::vector<typename Edge_collapser::Filtered_edge>>(std::forward<FilteredEdgeRange>(edges)); #ifdef GUDHI_USE_TBB - tbb::parallel_sort(f_edge_vector_.begin(), f_edge_vector_.end(), sort_by_filtration); + // I think this sorting is always negligible compared to the collapse, but parallelizing it shouldn't hurt. + tbb::parallel_sort(edges2.begin(), edges2.end(), + [](auto const&a, auto const&b){return std::get<2>(a)>std::get<2>(b);}); #else - std::sort(f_edge_vector_.begin(), f_edge_vector_.end(), sort_by_filtration); + std::sort(edges2.begin(), edges2.end(), [](auto const&a, auto const&b){return std::get<2>(a)>std::get<2>(b);}); #endif - - for (Edge_index endIdx = 0; endIdx < f_edge_vector_.size(); endIdx++) { - Filtered_edge fec = f_edge_vector_[endIdx]; - Vertex_handle u = std::get<0>(fec); - Vertex_handle v = std::get<1>(fec); - Filtration_value filt = std::get<2>(fec); - - // Inserts the edge in the sparse matrix to update the graph (G_i) - IEdge ie = insert_new_edge(u, v, endIdx); - - iedge_to_index_map_.emplace(ie, endIdx); - critical_edge_indicator_.push_back(false); - - if (!edge_is_dominated(u, v)) { - critical_edge_indicator_[endIdx] = true; - filtered_edge_output(u, v, filt); - if (endIdx > 1) - set_edge_critical(endIdx, filt, filtered_edge_output); - } - } + Edge_collapser edge_collapser; + edge_collapser.process_edges(edges2, std::forward<Delay>(delay)); + return edge_collapser.output(); } - -}; + return std::vector<typename Edge_collapser::Filtered_edge>(); +} /** \brief Implicitly constructs a flag complex from edges as an input, collapses edges while preserving the persistent - * homology and returns the remaining edges as a range. + * homology and returns the remaining edges as a range. The filtration value of vertices is irrelevant to this function. * - * \param[in] edges Range of Filtered edges.There is no need the range to be sorted, as it will be performed. + * \param[in] edges Range of Filtered edges. There is no need for the range to be sorted, as it will be done internally. * - * \tparam FilteredEdgeRange furnishes `std::begin` and `std::end` methods and returns an iterator on a - * FilteredEdge of type `std::tuple<Vertex_handle, Vertex_handle, Filtration_value>` where `Vertex_handle` is the type - * of a vertex index and `Filtration_value` is the type of an edge filtration value. + * \tparam FilteredEdgeRange Range of `std::tuple<Vertex_handle, Vertex_handle, Filtration_value>` + * where `Vertex_handle` is the type of a vertex index. * * \return Remaining edges after collapse as a range of * `std::tuple<Vertex_handle, Vertex_handle, Filtration_value>`. - * + * * \ingroup edge_collapse - * + * + * \note + * Advanced: Defining the macro GUDHI_COLLAPSE_USE_DENSE_ARRAY tells gudhi to allocate a square table of size the + * maximum vertex index. This usually speeds up the computation for dense graphs. However, for sparse graphs, the memory + * use may be problematic and initializing this large table may be slow. */ template<class FilteredEdgeRange> auto flag_complex_collapse_edges(const FilteredEdgeRange& edges) { - auto first_edge_itr = std::begin(edges); - using Vertex_handle = std::decay_t<decltype(std::get<0>(*first_edge_itr))>; - using Filtration_value = std::decay_t<decltype(std::get<2>(*first_edge_itr))>; - using Edge_collapser = Flag_complex_edge_collapser<Vertex_handle, Filtration_value>; - std::vector<typename Edge_collapser::Filtered_edge> remaining_edges; - if (first_edge_itr != std::end(edges)) { - Edge_collapser edge_collapser(edges); - edge_collapser.process_edges( - [&remaining_edges](Vertex_handle u, Vertex_handle v, Filtration_value filtration) { - // insert the edge - remaining_edges.emplace_back(u, v, filtration); - }); - } - return remaining_edges; + return flag_complex_collapse_edges(edges, [](auto const&d){return d;}); } } // namespace collapse diff --git a/src/Collapse/test/collapse_unit_test.cpp b/src/Collapse/test/collapse_unit_test.cpp index b8876246..f41dbedd 100644 --- a/src/Collapse/test/collapse_unit_test.cpp +++ b/src/Collapse/test/collapse_unit_test.cpp @@ -98,8 +98,8 @@ BOOST_AUTO_TEST_CASE(collapse) { // o---o // 0 3 edges.emplace_back(0, 2, 2.); - edges.emplace_back(1, 3, 2.); - trace_and_check_collapse(edges, {{1, 3, 2.}}); + edges.emplace_back(1, 3, 2.1); + trace_and_check_collapse(edges, {{1, 3, 2.1}}); // 1 2 4 // o---o---o @@ -121,8 +121,8 @@ BOOST_AUTO_TEST_CASE(collapse) { // o---o---o // 0 3 5 edges.emplace_back(2, 5, 4.); - edges.emplace_back(4, 3, 4.); - trace_and_check_collapse(edges, {{1, 3, 2.}, {4, 3, 4.}}); + edges.emplace_back(4, 3, 4.1); + trace_and_check_collapse(edges, {{1, 3, 2.}, {4, 3, 4.1}}); // 1 2 4 // o---o---o @@ -132,8 +132,8 @@ BOOST_AUTO_TEST_CASE(collapse) { // o---o---o // 0 3 5 edges.emplace_back(1, 5, 5.); - edges.emplace_back(0, 4, 5.); - trace_and_check_collapse(edges, {{1, 3, 2.}, {4, 3, 4.}, {0, 4, 5.}}); + edges.emplace_back(0, 4, 5.1); + trace_and_check_collapse(edges, {{1, 3, 2.}, {4, 3, 4.}, {0, 4, 5.1}}); } BOOST_AUTO_TEST_CASE(collapse_from_array) { @@ -150,8 +150,8 @@ BOOST_AUTO_TEST_CASE(collapse_from_array) { {2, 3, 1.}, {3, 0, 1.}, {0, 2, 2.}, - {1, 3, 2.}}}; - trace_and_check_collapse(f_edge_array, {{1, 3, 2.}}); + {1, 3, 2.1}}}; + trace_and_check_collapse(f_edge_array, {{1, 3, 2.1}}); } BOOST_AUTO_TEST_CASE(collapse_from_proximity_graph) { diff --git a/src/Collapse/utilities/distance_matrix_edge_collapse_rips_persistence.cpp b/src/Collapse/utilities/distance_matrix_edge_collapse_rips_persistence.cpp index 11ee5871..70b489b5 100644 --- a/src/Collapse/utilities/distance_matrix_edge_collapse_rips_persistence.cpp +++ b/src/Collapse/utilities/distance_matrix_edge_collapse_rips_persistence.cpp @@ -45,7 +45,7 @@ int main(int argc, char* argv[]) { min_persistence); Distance_matrix distances = Gudhi::read_lower_triangular_matrix_from_csv_file<Filtration_value>(csv_matrix_file); - std::cout << "Read the distance matrix succesfully, of size: " << distances.size() << std::endl; + std::cout << "Read the distance matrix successfully, of size: " << distances.size() << std::endl; Proximity_graph proximity_graph = Gudhi::compute_proximity_graph<Simplex_tree>(boost::irange((size_t)0, distances.size()), @@ -111,7 +111,7 @@ void program_options(int argc, char* argv[], std::string& csv_matrix_file, std:: po::options_description visible("Allowed options", 100); visible.add_options()("help,h", "produce help message")( "output-file,o", po::value<std::string>(&filediag)->default_value(std::string()), - "Name of file in which the persistence diagram is written. Default print in std::cout")( + "Name of file in which the persistence diagram is written. Default print in standard output")( "max-edge-length,r", po::value<Filtration_value>(&threshold)->default_value(std::numeric_limits<Filtration_value>::infinity()), "Maximal length of an edge for the Rips complex construction.")( diff --git a/src/Collapse/utilities/point_cloud_edge_collapse_rips_persistence.cpp b/src/Collapse/utilities/point_cloud_edge_collapse_rips_persistence.cpp index 0eea742c..a8fd6f14 100644 --- a/src/Collapse/utilities/point_cloud_edge_collapse_rips_persistence.cpp +++ b/src/Collapse/utilities/point_cloud_edge_collapse_rips_persistence.cpp @@ -77,7 +77,7 @@ int main(int argc, char* argv[]) { Gudhi::Euclidean_distance()); if (num_edges(proximity_graph) <= 0) { - std::cerr << "Total number of egdes are zero." << std::endl; + std::cerr << "Total number of edges is zero." << std::endl; exit(-1); } @@ -140,7 +140,7 @@ void program_options(int argc, char* argv[], std::string& off_file_points, std:: po::options_description visible("Allowed options", 100); visible.add_options()("help,h", "produce help message")( "output-file,o", po::value<std::string>(&filediag)->default_value(std::string()), - "Name of file in which the persistence diagram is written. Default print in std::cout")( + "Name of file in which the persistence diagram is written. Default print in standard output")( "max-edge-length,r", po::value<Filtration_value>(&threshold)->default_value(std::numeric_limits<Filtration_value>::infinity()), "Maximal length of an edge for the Rips complex construction.")( diff --git a/src/Contraction/doc/so3.svg b/src/Contraction/doc/so3.svg index adea3f38..f10cab98 100644 --- a/src/Contraction/doc/so3.svg +++ b/src/Contraction/doc/so3.svg @@ -177,7 +177,7 @@ x="309.4176" y="300.58682" id="tspan4515-4" - style="text-align:center;text-anchor:middle">Rips complex built uppon these points</tspan><tspan + style="text-align:center;text-anchor:middle">Rips complex built upon these points</tspan><tspan sodipodi:role="line" x="309.4176" y="308.96704" diff --git a/src/Contraction/example/Garland_heckbert/Error_quadric.h b/src/Contraction/example/Garland_heckbert/Error_quadric.h index 49250d7a..ae46232c 100644 --- a/src/Contraction/example/Garland_heckbert/Error_quadric.h +++ b/src/Contraction/example/Garland_heckbert/Error_quadric.h @@ -29,7 +29,7 @@ template <typename Point> class Error_quadric { * Quadric corresponding to the L2 distance to the plane. * * According to the notation of Garland Heckbert, they - * denote a quadric symetric matrix as : + * denote a quadric symmetric matrix as : * Q = [ q11 q12 q13 q14] * [ q12 q22 q23 q24] * [ q13 q23 q33 q34] diff --git a/src/Contraction/example/Rips_contraction.cpp b/src/Contraction/example/Rips_contraction.cpp index 42dd0910..547c290e 100644 --- a/src/Contraction/example/Rips_contraction.cpp +++ b/src/Contraction/example/Rips_contraction.cpp @@ -39,7 +39,7 @@ void build_rips(ComplexType& complex, double offset) { int main(int argc, char *argv[]) { if (argc != 3) { std::cerr << "Usage " << argv[0] << " ../../../data/meshes/SO3_10000.off 0.3 to load the file " << - "../../data/SO3_10000.off and contract the Rips complex built with paremeter 0.3.\n"; + "../../data/SO3_10000.off and contract the Rips complex built with parameter 0.3.\n"; return -1; } diff --git a/src/Contraction/include/gudhi/Edge_contraction.h b/src/Contraction/include/gudhi/Edge_contraction.h index 6c0f4c78..dff6dc14 100644 --- a/src/Contraction/include/gudhi/Edge_contraction.h +++ b/src/Contraction/include/gudhi/Edge_contraction.h @@ -26,6 +26,7 @@ namespace contraction { /** \defgroup contr Edge contraction +@{ \author David Salinas @@ -45,9 +46,9 @@ the operations needed for edge contraction algorithms have polynomial complexity Therefore, the simplification can be done without enumerating the set of simplices that is often non tracktable in high-dimension and is then very efficient (sub-linear with regards to the number of simplices in practice). -A typical application of this package is homology group computation. It is illustrated in the next figure where a Rips complex is built uppon a set of high-dimensional points and +A typical application of this package is homology group computation. It is illustrated in the next figure where a Rips complex is built upon a set of high-dimensional points and simplified with edge contractions. -It has initially a big number of simplices (around 20 millions) but simplifying it to a much reduced form with only 15 vertices (and 714 simplices) takes only few seconds on a desktop machine (see the example bellow). +It has initially a big number of simplices (around 20 millions) but simplifying it to a much reduced form with only 15 vertices (and 714 simplices) takes only few seconds on a desktop machine (see the example below). One can then compute homology group with a simplicial complex having very few simplices instead of running the homology algorithm on the much bigger initial set of simplices which would take much more time and memory. @@ -64,7 +65,7 @@ This class design is policy based and heavily inspired from the similar edge col Four policies can be customized in this package: \li Cost_policy: specify how much cost an edge contraction of a given edge. The edge with lowest cost is iteratively picked and contracted if valid. -\li Valid_contraction_policy: specify if a given edge contraction is valid. For instance, this policy can check the link condition which ensures that the homotopy type is preserved afer the edge contraction. +\li Valid_contraction_policy: specify if a given edge contraction is valid. For instance, this policy can check the link condition which ensures that the homotopy type is preserved after the edge contraction. \li Placement_policy: every time an edge is contracted, its points are merge to one point specified by this policy. This may be the middle of the edge of some more sophisticated point such as the minimum of a cost as in \cite Garland. @@ -91,7 +92,7 @@ Despite this package is able to deal with \a arbitrary simplicial complexes (any it is still \a 65% times faster than the CGAL package which is focused on 2-manifold. The main reason is that few blockers appears during the simplification and hence, the algorithm only have to deal with the graph and not higher-dimensional simplices -(in this case triangles). However, we recall that higher-dimensional simplices are \a implicitely +(in this case triangles). However, we recall that higher-dimensional simplices are \a implicitly stored in the \ref skbl data-structure. Hence, one has to store simplices in an external map if some information needs to be associated with them (information that could be a filtration value or an orientation for instance). @@ -152,7 +153,7 @@ void build_rips(ComplexType& complex, double offset){ int main (int argc, char *argv[]) { if (argc!=3){ - std::cerr << "Usage "<<argv[0]<<" ../../data/SO3_10000.off 0.3 to load the file ../../data/SO3_10000.off and contract the Rips complex built with paremeter 0.3.\n"; + std::cerr << "Usage "<<argv[0]<<" ../../data/SO3_10000.off 0.3 to load the file ../../data/SO3_10000.off and contract the Rips complex built with parameter 0.3.\n"; return -1; } @@ -195,7 +196,6 @@ int main (int argc, char *argv[]) return EXIT_SUCCESS; } -} \endcode \verbatim diff --git a/src/Contraction/include/gudhi/Skeleton_blocker_contractor.h b/src/Contraction/include/gudhi/Skeleton_blocker_contractor.h index a0d9f2b2..6911ca2e 100644 --- a/src/Contraction/include/gudhi/Skeleton_blocker_contractor.h +++ b/src/Contraction/include/gudhi/Skeleton_blocker_contractor.h @@ -171,8 +171,13 @@ typename GeometricSimplifiableComplex::Vertex_handle> { Self const* algorithm_; }; +#if CGAL_VERSION_NR < 1050500000 typedef CGAL::Modifiable_priority_queue<Edge_handle, Compare_cost, Undirected_edge_id> PQ; - typedef typename PQ::handle pq_handle; +#else + typedef CGAL::Modifiable_priority_queue<Edge_handle, Compare_cost, Undirected_edge_id, CGAL::CGAL_BOOST_PENDING_RELAXED_HEAP> PQ; +#endif + + typedef bool pq_handle; // An Edge_data is associated with EVERY edge in the complex (collapsible or not). @@ -196,7 +201,7 @@ typename GeometricSimplifiableComplex::Vertex_handle> { } bool is_in_PQ() const { - return PQHandle_ != PQ::null_handle(); + return PQHandle_ != false; } void set_PQ_handle(pq_handle h) { @@ -204,7 +209,7 @@ typename GeometricSimplifiableComplex::Vertex_handle> { } void reset_PQ_handle() { - PQHandle_ = PQ::null_handle(); + PQHandle_ = false; } private: @@ -238,16 +243,22 @@ typename GeometricSimplifiableComplex::Vertex_handle> { } void insert_in_PQ(Edge_handle edge, Edge_data& data) { - data.set_PQ_handle(heap_PQ_->push(edge)); + heap_PQ_->push(edge); + data.set_PQ_handle(true); ++current_num_edges_heap_; } void update_in_PQ(Edge_handle edge, Edge_data& data) { +#if CGAL_VERSION_NR < 1050500000 data.set_PQ_handle(heap_PQ_->update(edge, data.PQ_handle())); +#else + heap_PQ_->update(edge); +#endif } void remove_from_PQ(Edge_handle edge, Edge_data& data) { - data.set_PQ_handle(heap_PQ_->erase(edge, data.PQ_handle())); + heap_PQ_->erase(edge); + data.set_PQ_handle(false); --current_num_edges_heap_; } @@ -280,7 +291,7 @@ typename GeometricSimplifiableComplex::Vertex_handle> { std::size_t id = 0; - // xxx do a parralel for + // xxx do a parallel for for (auto edge : complex_.edge_range()) { complex_[edge].index() = id++; Profile const& profile = create_profile(edge); @@ -474,7 +485,7 @@ typename GeometricSimplifiableComplex::Vertex_handle> { } void update_changed_edges() { - // xxx do a parralel for + // xxx do a parallel for DBG("update edges"); // sequential loop @@ -530,7 +541,7 @@ typename GeometricSimplifiableComplex::Vertex_handle> { // by definition of a blocker // todo uniqument utile pour la link condition - // laisser a l'utilisateur ? booleen update_heap_on_removed_blocker? + // laisser a l'utilisateur ? boolean update_heap_on_removed_blocker? Simplex blocker_copy(*blocker); for (auto x = blocker_copy.begin(); x != blocker_copy.end(); ++x) { for (auto y = x; ++y != blocker_copy.end();) { diff --git a/src/Coxeter_triangulation/concept/FunctionForImplicitManifold.h b/src/Coxeter_triangulation/concept/FunctionForImplicitManifold.h new file mode 100644 index 00000000..210d804e --- /dev/null +++ b/src/Coxeter_triangulation/concept/FunctionForImplicitManifold.h @@ -0,0 +1,46 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef CONCEPT_COXETER_TRIANGULATION_FUNCTION_FOR_IMPLICIT_MANIFOLD_H_ +#define CONCEPT_COXETER_TRIANGULATION_FUNCTION_FOR_IMPLICIT_MANIFOLD_H_ + +#include <cstdlib> // for std::size_t + +#include <Eigen/Dense> + +namespace Gudhi { + +namespace coxeter_triangulation { + +/** \brief The concept FunctionForImplicitManifold describes the requirements + * for a type to implement an implicit function class used for example in Manifold_tracing. + */ +struct FunctionForImplicitManifold { + /** \brief Value of the function at a specified point 'p'. + * @param[in] p The input point given by its Cartesian coordinates. + * Its size needs to be equal to amb_d(). + */ + Eigen::VectorXd operator()(const Eigen::VectorXd& p) const; + + /** \brief Returns the domain (ambient) dimension. */ + std::size_t amb_d() const; + + /** \brief Returns the codomain dimension. */ + std::size_t cod_d() const; + + /** \brief Returns a point on the zero-set of the function. */ + Eigen::VectorXd seed() const; +}; + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif diff --git a/src/Coxeter_triangulation/concept/IntersectionOracle.h b/src/Coxeter_triangulation/concept/IntersectionOracle.h new file mode 100644 index 00000000..e4e397fa --- /dev/null +++ b/src/Coxeter_triangulation/concept/IntersectionOracle.h @@ -0,0 +1,104 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef CONCEPT_COXETER_TRIANGULATION_INTERSECTION_ORACLE_H_ +#define CONCEPT_COXETER_TRIANGULATION_INTERSECTION_ORACLE_H_ + +#include <cstdlib> // for std::size_t + +#include <Eigen/Dense> + +namespace Gudhi { + +namespace coxeter_triangulation { + +/** \brief The concept IntersectionOracle describes the requirements + * for a type to implement an intersection oracle class used for example in Manifold_tracing. + * + */ +struct IntersectionOracle { + /** \brief Returns the domain (ambient) dimension of the underlying manifold. */ + std::size_t amb_d() const; + + /** \brief Returns the codomain dimension of the underlying manifold. */ + std::size_t cod_d() const; + + /** \brief Intersection query with the relative interior of the manifold. + * + * \details The returned structure Query_result contains the boolean value + * that is true only if the intersection point of the query simplex and + * the relative interior of the manifold exists, the intersection point + * and the face of the query simplex that contains + * the intersection point. + * + * \tparam Simplex_handle The class of the query simplex. + * Needs to be a model of the concept SimplexInCoxeterTriangulation. + * \tparam Triangulation The class of the triangulation. + * Needs to be a model of the concept TriangulationForManifoldTracing. + * + * @param[in] simplex The query simplex. The dimension of the simplex + * should be the same as the codimension of the manifold + * (the codomain dimension of the function). + * @param[in] triangulation The ambient triangulation. The dimension of + * the triangulation should be the same as the ambient dimension of the manifold + * (the domain dimension of the function). + */ + template <class Simplex_handle, class Triangulation> + Query_result<Simplex_handle> intersects(const Simplex_handle& simplex, const Triangulation& triangulation) const; + + /** \brief Intersection query with the boundary of the manifold. + * + * \details The returned structure Query_result contains the boolean value + * that is true only if the intersection point of the query simplex and + * the boundary of the manifold exists, the intersection point + * and the face of the query simplex that contains + * the intersection point. + * + * \tparam Simplex_handle The class of the query simplex. + * Needs to be a model of the concept SimplexInCoxeterTriangulation. + * \tparam Triangulation The class of the triangulation. + * Needs to be a model of the concept TriangulationForManifoldTracing. + * + * @param[in] simplex The query simplex. The dimension of the simplex + * should be the same as the codimension of the boundary of the manifold + * (the codomain dimension of the function + 1). + * @param[in] triangulation The ambient triangulation. The dimension of + * the triangulation should be the same as the ambient dimension of the manifold + * (the domain dimension of the function). + */ + template <class Simplex_handle, class Triangulation> + Query_result<Simplex_handle> intersects_boundary(const Simplex_handle& simplex, + const Triangulation& triangulation) const; + + /** \brief Returns true if the input point lies inside the piecewise-linear + * domain induced by the given ambient triangulation that defines the relative + * interior of the piecewise-linear approximation of the manifold. + * + * @param p The input point. Needs to have the same dimension as the ambient + * dimension of the manifold (the domain dimension of the function). + * @param triangulation The ambient triangulation. Needs to have the same + * dimension as the ambient dimension of the manifold + * (the domain dimension of the function). + */ + template <class Triangulation> + bool lies_in_domain(const Eigen::VectorXd& p, const Triangulation& triangulation) const { + Eigen::VectorXd pl_p = make_pl_approximation(domain_fun_, triangulation)(p); + return pl_p(0) < 0; + } + + /** \brief Returns the function that defines the interior of the manifold */ + const Function_& function() const; +}; + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif diff --git a/src/Coxeter_triangulation/concept/SimplexInCoxeterTriangulation.h b/src/Coxeter_triangulation/concept/SimplexInCoxeterTriangulation.h new file mode 100644 index 00000000..dac8e66d --- /dev/null +++ b/src/Coxeter_triangulation/concept/SimplexInCoxeterTriangulation.h @@ -0,0 +1,81 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef CONCEPT_COXETER_TRIANGULATION_SIMPLEX_IN_COXETER_TRIANGULATION_H_ +#define CONCEPT_COXETER_TRIANGULATION_SIMPLEX_IN_COXETER_TRIANGULATION_H_ + +#include <cstdlib> // for std::size_t + +#include <gudhi/Permutahedral_representation.h> + +namespace Gudhi { + +namespace coxeter_triangulation { + +/** \brief The concept SimplexInCoxeterTriangulation describes the requirements + * for a type to implement a representation of simplices in Freudenthal_triangulation + * or in Coxeter_triangulation. + */ +struct SimplexInCoxeterTriangulation { + /** \brief Type of the vertex. */ + typedef Vertex_ Vertex; + + /** \brief Type of the ordered partition. */ + typedef Ordered_set_partition_ OrderedSetPartition; + + /** \brief Dimension of the simplex. */ + unsigned dimension() const; + + /** \brief Type of a range of vertices, each of type Vertex. */ + typedef Vertex_range; + + /** \brief Returns a range of vertices of the simplex. + */ + Vertex_range vertex_range() const; + + /** \brief Type of a range of faces, each of type that + * is a model of the concept SimplexInCoxeterTriangulation. + */ + typedef Face_range; + + /** \brief Returns a range of permutahedral representations of k-dimensional faces + * of the simplex for some given integer parameter 'k'. + */ + Face_range face_range(std::size_t k) const; + + /** \brief Returns a range of permutahedral representations of facets of the simplex. + * The dimension of the simplex must be strictly positive. + */ + Face_range facet_range() const; + + /** \brief Type of a range of cofaces, each of type that + * is a model of the concept SimplexInCoxeterTriangulation. + */ + typedef Coface_range; + + /** \brief Returns a range of permutahedral representations of k-dimensional cofaces + * of the simplex for some given integer parameter 'k'. + */ + Coface_range coface_range(std::size_t k) const; + + /** \brief Returns a range of permutahedral representations of cofacets of the simplex. + * The dimension of the simplex must be strictly different from the ambient dimension. + */ + Coface_range cofacet_range() const; + + /** \brief Returns true, if the simplex is a face of other simplex. */ + bool is_face_of(const Permutahedral_representation& other) const; +}; + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif diff --git a/src/Coxeter_triangulation/concept/TriangulationForManifoldTracing.h b/src/Coxeter_triangulation/concept/TriangulationForManifoldTracing.h new file mode 100644 index 00000000..2b5d568c --- /dev/null +++ b/src/Coxeter_triangulation/concept/TriangulationForManifoldTracing.h @@ -0,0 +1,56 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef CONCEPT_COXETER_TRIANGULATION_TRIANGULATION_FOR_MANIFOLD_TRACING_H_ +#define CONCEPT_COXETER_TRIANGULATION_TRIANGULATION_FOR_MANIFOLD_TRACING_H_ + +#include <Eigen/Dense> + +namespace Gudhi { + +namespace coxeter_triangulation { + +/** \brief The concept TriangulationForManifoldTracing describes the requirements + * for a type to implement a triangulation class used for example in Manifold_tracing. + */ +struct TriangulationForManifoldTracing { + /** \brief Type of the simplices in the triangulation. + * Needs to be a model of the concept SimplexInCoxeterTriangulation. */ + typedef Simplex_handle; + + /** \brief Type of the vertices in the triangulation. + * Needs to be a random-access range of integer values. */ + typedef Vertex_handle; + + /** \brief Returns the permutahedral representation of the simplex in the + * triangulation that contains a given query point 'p'. + * \tparam Point_d A class that represents a point in d-dimensional Euclidean space. + * The coordinates should be random-accessible. Needs to provide the method size(). + * @param[in] point The query point. + */ + template <class Point_d> + Simplex_handle locate_point(const Point_d& point) const; + + /** \brief Returns the Cartesian coordinates of the given vertex 'v'. + * @param[in] v The input vertex. + */ + Eigen::VectorXd cartesian_coordinates(const Vertex_handle& v) const; + + /** \brief Returns the Cartesian coordinates of the barycenter of a given simplex 's'. + * @param[in] s The input simplex given by permutahedral representation. + */ + Eigen::VectorXd barycenter(const Simplex_handle& s) const; +}; + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif diff --git a/src/Coxeter_triangulation/doc/custom_function.png b/src/Coxeter_triangulation/doc/custom_function.png Binary files differnew file mode 100644 index 00000000..8bb8ba9a --- /dev/null +++ b/src/Coxeter_triangulation/doc/custom_function.png diff --git a/src/Coxeter_triangulation/doc/flat_torus_with_boundary.png b/src/Coxeter_triangulation/doc/flat_torus_with_boundary.png Binary files differnew file mode 100644 index 00000000..338b39fe --- /dev/null +++ b/src/Coxeter_triangulation/doc/flat_torus_with_boundary.png diff --git a/src/Coxeter_triangulation/doc/intro_coxeter_triangulation.h b/src/Coxeter_triangulation/doc/intro_coxeter_triangulation.h new file mode 100644 index 00000000..395996c9 --- /dev/null +++ b/src/Coxeter_triangulation/doc/intro_coxeter_triangulation.h @@ -0,0 +1,240 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef DOC_COXETER_TRIANGULATION_INTRO_COXETER_TRIANGULATION_H_ +#define DOC_COXETER_TRIANGULATION_INTRO_COXETER_TRIANGULATION_H_ + +// needs namespaces for Doxygen to link on classes +namespace Gudhi { +namespace coxeter_triangulation { + +/** \defgroup coxeter_triangulation Coxeter triangulation + +\author Siargey Kachanovich + +@{ + +\section overview Module overview + +Coxeter triangulation module is designed to provide tools for constructing a piecewise-linear approximation of an +\f$m\f$-dimensional smooth manifold embedded in \f$ \mathbb{R}^d \f$ using an ambient triangulation. +For a more detailed description of the module see \cite KachanovichThesis. + +\section manifoldtracing Manifold tracing algorithm +The central piece of the module is the manifold tracing algorithm represented by the class +\ref Gudhi::coxeter_triangulation::Manifold_tracing "Manifold_tracing". +The manifold tracing algorithm takes as input a manifold of some dimension \f$m\f$ embedded in \f$\mathbb{R}^d\f$ +represented by an intersection oracle (see Section \ref intersectionoracle "Intersection oracle"), a point on the +manifold and an ambient triangulation (see Section \ref ambienttriangulations "Ambient triangulations"). +The output consists of one map (or two maps in the case of manifolds with boundary) from the \f$(d-m)\f$-dimensional +(and \f$(d-m+1)\f$-dimensional in the case of manifolds with boundary) simplices in the ambient triangulation that +intersect the manifold to their intersection points. +From this output, it is possible to construct the cell complex of the piecewise-linear approximation of the input +manifold. + +There are two methods that execute the manifold tracing algorithm: the method +\ref Gudhi::coxeter_triangulation::Manifold_tracing::manifold_tracing_algorithm() "Manifold_tracing::manifold_tracing_algorithm(seed_points, triangulation, oracle, out_simplex_map)" +for manifolds without boundary and +\ref Gudhi::coxeter_triangulation::Manifold_tracing::manifold_tracing_algorithm() "Manifold_tracing::manifold_tracing_algorithm(seed_points, triangulation, oracle, interior_simplex_map,boundary_simplex_map)" +for manifolds with boundary. The algorithm functions as follows. It starts at the specified seed points and inserts a +\f$(d-m)\f$-dimensional simplices nearby each seed point that intersect the manifold into the output. Starting from +this simplex, the algorithm propagates the search for other \f$(d-m)\f$-dimensional simplices that intersect the +manifold by marching from a simplex to neighbouring simplices via their common cofaces. + +This class \ref Gudhi::coxeter_triangulation::Manifold_tracing "Manifold_tracing" has one template parameter +`Triangulation_` which specifies the ambient triangulation which is used by the algorithm. +The template type `Triangulation_` has to be a model of the concept +\ref Gudhi::coxeter_triangulation::TriangulationForManifoldTracing "TriangulationForManifoldTracing". + +The module also provides two static methods: +\ref Gudhi::coxeter_triangulation::manifold_tracing_algorithm() "manifold_tracing_algorithm(seed_points, triangulation, oracle, out_simplex_map)" +for manifolds without boundary and +\ref manifold_tracing_algorithm() "manifold_tracing_algorithm(seed_points, triangulation, oracle, interior_simplex_map, boundary_simplex_map)" +for manifolds with boundary. For these static methods it is not necessary to specify any template arguments. + +\section ambienttriangulations Ambient triangulations + +The ambient triangulations supported by the manifold tracing algorithm have to be models of the concept +\ref Gudhi::coxeter_triangulation::TriangulationForManifoldTracing "TriangulationForManifoldTracing". +This module offers two such models: the class +\ref Gudhi::coxeter_triangulation::Freudenthal_triangulation "Freudenthal_triangulation" and the derived class +\ref Gudhi::coxeter_triangulation::Coxeter_triangulation "Coxeter_triangulation". + +Both these classes encode affine transformations of the so-called Freudenthal-Kuhn triangulation of \f$\mathbb{R}^d\f$. +The Freudenthal-Kuhn triangulation of \f$\mathbb{R}^d\f$ is defined as the simplicial subdivision of the unit cubic +partition of \f$\mathbb{R}^d\f$. +Each simplex is encoded using the permutahedral representation, which consists of an integer-valued vector \f$y\f$ that +positions the simplex in a specific cube in the cubical partition and an ordered partition \f$\omega\f$ of the set +\f$\{1,\ldots,d+1\}\f$, which positions the simplex in the simplicial subdivision of the cube. +The default constructor +\ref Gudhi::coxeter_triangulation::Freudenthal_triangulation::Freudenthal_triangulation(std::size_t) +"Freudenthal_triangulation(d)" the Freudenthal-Kuhn triangulation of \f$\mathbb{R}^d\f$. The class +\ref Gudhi::coxeter_triangulation::Freudenthal_triangulation "Freudenthal_triangulation" can also encode any affine +transformation of the Freudenthal-Kuhn triangulation of \f$\mathbb{R}^d\f$ using an invertible matrix \f$\Lambda\f$ and +an offset vector \f$b\f$ that can be specified in the constructor and which can be changed using the methods +change_matrix and change_offset. The class +\ref Gudhi::coxeter_triangulation::Coxeter_triangulation "Coxeter_triangulation" is derived from +\ref Gudhi::coxeter_triangulation::Freudenthal_triangulation "Freudenthal_triangulation" and its default constructor +\ref Gudhi::coxeter_triangulation::Coxeter_triangulation::Coxeter_triangulation(std::size_t) "Coxeter_triangulation(d)" +builds a Coxeter triangulation of type \f$\tilde{A}_d\f$, which has the best simplex quality of all linear +transformations of the Freudenthal-Kuhn triangulation of \f$\mathbb{R}^d\f$. + +\image html two_triangulations.png "Coxeter (on the left) and Freudenthal-Kuhn triangulation (on the right)" + + +\section intersectionoracle Intersection oracle + +The input \f$m\f$-dimensional manifold in \f$\mathbb{R}^d\f$ needs to be given via the intersection oracle that answers +the following query: given a \f$(d-m)\f$-dimensional simplex, does it intersect the manifold? +The concept \ref Gudhi::coxeter_triangulation::IntersectionOracle "IntersectionOracle" describes all requirements for +an intersection oracle class to be compatible with the class +\ref Gudhi::coxeter_triangulation::Manifold_tracing "Manifold_tracing". +This module offers one model of the concept +\ref Gudhi::coxeter_triangulation::IntersectionOracle "IntersectionOracle", which is the class +\ref Gudhi::coxeter_triangulation::Implicit_manifold_intersection_oracle "Implicit_manifold_intersection_oracle". +This class represents a manifold given as the zero-set of a specified function +\f$F: \mathbb{R}^d \rightarrow \mathbb{R}^{d-m}\f$. +The function \f$F\f$ is given by a class which is a model of the concept +\ref Gudhi::coxeter_triangulation::FunctionForImplicitManifold "FunctionForImplicitManifold". +There are multiple function classes that are already implemented in this module. + +\li \ref Gudhi::coxeter_triangulation::Constant_function(std::size_t, std::size_t, Eigen::VectorXd) +"Constant_function(d,k,v)" defines a constant function \f$F\f$ such that for all \f$x \in \mathbb{R}^d\f$, we have + \f$F(x) = v \in \mathbb{R}^k\f$. + The class Constant_function does not define an implicit manifold, but is useful as the domain function when defining + boundaryless implicit manifolds. +\li \ref Gudhi::coxeter_triangulation::Function_affine_plane_in_Rd(N,b) "Function_affine_plane_in_Rd(N,b)" defines an + \f$m\f$-dimensional implicit affine plane in the \f$d\f$-dimensional Euclidean space given by a normal matrix \f$N\f$ + and an offset vector \f$b\f$. +\li \ref Gudhi::coxeter_triangulation::Function_Sm_in_Rd(r,m,d,center) "Function_Sm_in_Rd(r,m,d,center)" defines an + \f$m\f$-dimensional implicit sphere embedded in the \f$d\f$-dimensional Euclidean space of radius \f$r\f$ centered at + the point 'center'. +\li \ref Gudhi::coxeter_triangulation::Function_moment_curve_in_Rd(r,d) "Function_moment_curve(r,d)" defines the moment + curve in the \f$d\f$-dimensional Euclidean space of radius \f$r\f$ given as the parameterized curve (but implemented + as an implicit curve): + \f[ (r, rt, \ldots, rt^{d-1}) \in \mathbb{R}^d,\text{ for $t \in \mathbb{R}$.} \f] +\li \ref Gudhi::coxeter_triangulation::Function_torus_in_R3(R, r) "Function_torus_in_R3(R, r)" defines a torus in + \f$\mathbb{R}^3\f$ with the outer radius \f$R\f$ and the inner radius, given by the equation: + \f[ z^2 + (\sqrt{x^2 + y^2} - r)^2 - R^2 = 0. \f] +\li \ref Gudhi::coxeter_triangulation::Function_chair_in_R3(a, b, k) "Function_chair_in_R3(a, b, k)" defines the + \"Chair\" surface in \f$\mathbb{R}^3\f$ defined by the equation: + \f[ (x^2 + y^2 + z^2 - ak^2)^2 - b((z-k)^2 - 2x^2)((z+k)^2 - 2y^2) = 0. \f] +\li \ref Gudhi::coxeter_triangulation::Function_iron_in_R3() "Function_iron_in_R3()" defines the \"Iron\" surface in + \f$\mathbb{R}^3\f$ defined by the equation: + \f[ \frac{-x^6-y^6-z^6}{300} + \frac{xy^2z}{2.1} + y^2 + (z-2)^2 = 1. \f] +\li \ref Gudhi::coxeter_triangulation::Function_lemniscate_revolution_in_R3(a) "Function_lemniscate_revolution_in_R3(a)" + defines a revolution surface in \f$\mathbb{R}^3\f$ obtained from the lemniscate of Bernoulli defined by the equation: + \f[ (x^2 + y^2 + z^2)^2 - 2a^2(x^2 - y^2 - z^2) = 0. \f] +\li \ref Gudhi::coxeter_triangulation::Function_whitney_umbrella_in_R3() "Function_whitney_umbrella_in_R3()" defines + the Whitney umbrella surface in \f$\mathbb{R}^3\f$ defined by the equation: + \f[ x^2 - y^2z = 0. \f] + +The base function classes above can be composed or modified into new functions using the following classes and methods: + +\li \ref Gudhi::coxeter_triangulation::Cartesian_product "Cartesian_product(functions...)" expresses the Cartesian + product \f$F_1^{-1}(0) \times \ldots \times F_k^{-1}(0)\f$ of multiple implicit manifolds as an implicit manifold. + For convenience, a static function + \ref Gudhi::coxeter_triangulation::make_product_function() "make_product_function(functions...)" is provided that + takes a pack of function-typed objects as the argument. +\li \ref Gudhi::coxeter_triangulation::Embed_in_Rd "Embed_in_Rd(F, d)" expresses an implicit manifold given as the + zero-set of a function \f$F\f$ embedded in a higher-dimensional Euclidean space \f$\mathbb{R}^d\f$. + For convenience, a static function \ref Gudhi::coxeter_triangulation::make_embedding() "make_embedding(F, d)" is + provided. +\li \ref Gudhi::coxeter_triangulation::Linear_transformation "Linear_transformation(F, M)" applies a linear + transformation given by a matrix \f$M\f$ on an implicit manifold given as the zero-set of the function \f$F\f$. + For convenience, a static function + \ref Gudhi::coxeter_triangulation::make_linear_transformation() "make_linear_transformation(F, M)" is provided. +\li \ref Gudhi::coxeter_triangulation::Translate "Translate(F, v)" translates an implicit manifold given as the + zero-set of ththe function \f$F\f$ by a vector \f$v\f$. + For convenience, a static function \ref Gudhi::coxeter_triangulation::translate() "translate(F, v)" is provided. +\li \ref Gudhi::coxeter_triangulation::Negation() "Negation(F)" defines the negative of the given function \f$F\f$. + This class is useful to define the complementary of a given domain, when defining a manifold with boundary. + For convenience, a static function \ref Gudhi::coxeter_triangulation::negation() "negation(F)" is provided. +\li \ref Gudhi::coxeter_triangulation::PL_approximation "PL_approximation(F, T)" defines a piecewise-linear + approximation of a given function \f$F\f$ induced by an ambient triangulation \f$T\f$. + The purpose of this class is to define a piecewise-linear function that is compatible with the requirements for the + domain function \f$D\f$ when defining a manifold with boundary. + For convenience, a static function + \ref Gudhi::coxeter_triangulation::make_pl_approximation() "make_pl_approximation(F, T)" is provided. + The type of \f$T\f$ is required to be a model of the concept + \ref Gudhi::coxeter_triangulation::TriangulationForManifoldTracing "TriangulationForManifoldTracing". + +It is also possible to implement your own function as detailed in this \ref exampleswithcustomfunction. + +\section cellcomplex Cell complex construction + +The output of the manifold tracing algorithm can be transformed into the Hasse diagram of a cell complex that +approximates the input manifold using the class \ref Gudhi::coxeter_triangulation::Cell_complex "Cell_complex". +The type of the cells in the Hasse diagram is +\ref Gudhi::Hasse_diagram::Hasse_diagram_cell "Hasse_cell<int, double, bool>" provided by the module Hasse diagram. +The cells in the cell complex given by an object of the class +\ref Gudhi::coxeter_triangulation::Cell_complex "Cell_complex" are accessed through several maps that are accessed +through the following methods. + +\li The method +\ref Gudhi::coxeter_triangulation::Cell_complex::interior_simplex_cell_maps() "interior_simplex_cell_maps()" +returns a vector of maps from the cells of various dimensions in the interior of the cell complex to the permutahedral +representations of the corresponding simplices in the ambient triangulation. +Each individual map for cells of a specific dimension \f$l\f$ can be accessed using the method +\ref Gudhi::coxeter_triangulation::Cell_complex::interior_simplex_cell_map() "interior_simplex_cell_map(l)". +\li The method +\ref Gudhi::coxeter_triangulation::Cell_complex::boundary_simplex_cell_maps() "boundary_simplex_cell_maps()" +returns a vector of maps from the cells of various dimensions on the boundary of the cell complex to the permutahedral +representations of the corresponding simplices in the ambient triangulation. +Each individual map for cells of a specific dimension \f$l\f$ can be accessed using the method +\ref Gudhi::coxeter_triangulation::Cell_complex::boundary_simplex_cell_map() "boundary_simplex_cell_map(l)". +\li The method \ref Gudhi::coxeter_triangulation::Cell_complex::cell_simplex_map() "cell_simplex_map()" returns a map +from the cells in the cell complex to the permutahedral representations of the corresponding simplices in the ambient +triangulation. +\li The method \ref Gudhi::coxeter_triangulation::Cell_complex::cell_point_map() "cell_point_map()" returns a map from +the vertex cells in the cell complex to their Cartesian coordinates. + +The use and interfaces of this \ref Gudhi::coxeter_triangulation::Cell_complex "Cell_complex" is limited to the +Coxeter_triangulation implementation. + +\section example Examples + +\subsection examplewithoutboundaries Basic example without boundaries +\include cell_complex_from_basic_circle_manifold.cpp + +The program output is: + +\include cell_complex_from_basic_circle_manifold_for_doc.txt + +\subsection exampleswithboundaries Example with boundaries + +Here is an example of constructing a piecewise-linear approximation of a flat torus embedded in \f$\mathbb{R}^4\f$, +rotated by a random rotation in \f$\mathbb{R}^4\f$ and cut by a hyperplane. + +\include manifold_tracing_flat_torus_with_boundary.cpp + +The output in <a target="_blank" href="https://www.ljll.math.upmc.fr/frey/software.html">medit</a> is: + +\image html "flat_torus_with_boundary.png" "Output from the example of a flat torus with boundary" + +\subsection exampleswithcustomfunction Example with a custom function + +In the following more complex example, we define a custom function for the implicit manifold. + +\include manifold_tracing_custom_function.cpp + +The output in <a target="_blank" href="https://www.ljll.math.upmc.fr/frey/software.html">medit</a> looks as follows: + +\image html "custom_function.png" "Output from the example with a custom function" + + + */ +/** @} */ // end defgroup coxeter_triangulation + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif // DOC_COXETER_TRIANGULATION_INTRO_COXETER_TRIANGULATION_H_ diff --git a/src/Coxeter_triangulation/doc/manifold_tracing_on_custom_function_example.png b/src/Coxeter_triangulation/doc/manifold_tracing_on_custom_function_example.png Binary files differnew file mode 100644 index 00000000..04912729 --- /dev/null +++ b/src/Coxeter_triangulation/doc/manifold_tracing_on_custom_function_example.png diff --git a/src/Coxeter_triangulation/doc/two_triangulations.png b/src/Coxeter_triangulation/doc/two_triangulations.png Binary files differnew file mode 100644 index 00000000..055d93e7 --- /dev/null +++ b/src/Coxeter_triangulation/doc/two_triangulations.png diff --git a/src/Coxeter_triangulation/example/CMakeLists.txt b/src/Coxeter_triangulation/example/CMakeLists.txt new file mode 100644 index 00000000..7f81c599 --- /dev/null +++ b/src/Coxeter_triangulation/example/CMakeLists.txt @@ -0,0 +1,19 @@ +project(Coxeter_triangulation_example) + +if (NOT EIGEN3_VERSION VERSION_LESS 3.1.0) + # because of random_orthogonal_matrix inclusion + if (NOT CGAL_VERSION VERSION_LESS 4.11.0) + add_executable ( Coxeter_triangulation_manifold_tracing_flat_torus_with_boundary_example manifold_tracing_flat_torus_with_boundary.cpp ) + target_link_libraries(Coxeter_triangulation_manifold_tracing_flat_torus_with_boundary_example ${CGAL_LIBRARY}) + add_test(NAME Coxeter_triangulation_manifold_tracing_flat_torus_with_boundary_example + COMMAND $<TARGET_FILE:Coxeter_triangulation_manifold_tracing_flat_torus_with_boundary_example>) + endif() + + add_executable ( Coxeter_triangulation_manifold_tracing_custom_function_example manifold_tracing_custom_function.cpp ) + add_test(NAME Coxeter_triangulation_manifold_tracing_custom_function_example + COMMAND $<TARGET_FILE:Coxeter_triangulation_manifold_tracing_custom_function_example>) + + add_executable ( Coxeter_triangulation_cell_complex_from_basic_circle_manifold_example cell_complex_from_basic_circle_manifold.cpp ) + add_test(NAME Coxeter_triangulation_cell_complex_from_basic_circle_manifold_example + COMMAND $<TARGET_FILE:Coxeter_triangulation_cell_complex_from_basic_circle_manifold_example>) +endif()
\ No newline at end of file diff --git a/src/Coxeter_triangulation/example/cell_complex_from_basic_circle_manifold.cpp b/src/Coxeter_triangulation/example/cell_complex_from_basic_circle_manifold.cpp new file mode 100644 index 00000000..dfaaffa8 --- /dev/null +++ b/src/Coxeter_triangulation/example/cell_complex_from_basic_circle_manifold.cpp @@ -0,0 +1,55 @@ +#include <iostream> + +#include <gudhi/Coxeter_triangulation.h> +#include <gudhi/Implicit_manifold_intersection_oracle.h> // for Gudhi::coxeter_triangulation::make_oracle +#include <gudhi/Manifold_tracing.h> +#include <gudhi/Coxeter_triangulation/Cell_complex/Cell_complex.h> +#include <gudhi/Functions/Function_Sm_in_Rd.h> + +using namespace Gudhi::coxeter_triangulation; + +int main(int argc, char** argv) { + // Oracle is a circle of radius 1 + double radius = 1.; + auto oracle = make_oracle(Function_Sm_in_Rd(radius, 1)); + + // Define a Coxeter triangulation. + Coxeter_triangulation<> cox_tr(oracle.amb_d()); + // Theory forbids that a vertex of the triangulation lies exactly on the circle. + // Add some offset to avoid algorithm degeneracies. + cox_tr.change_offset(-Eigen::VectorXd::Random(oracle.amb_d())); + // For a better manifold approximation, one can change the circle radius value or change the linear transformation + // matrix. + // The number of points and edges will increase with a better resolution. + //cox_tr.change_matrix(0.5 * cox_tr.matrix()); + + // Manifold tracing algorithm + using Out_simplex_map = typename Manifold_tracing<Coxeter_triangulation<> >::Out_simplex_map; + + std::vector<Eigen::VectorXd> seed_points(1, oracle.seed()); + Out_simplex_map interior_simplex_map; + manifold_tracing_algorithm(seed_points, cox_tr, oracle, interior_simplex_map); + + // Constructing the cell complex + std::size_t intr_d = oracle.amb_d() - oracle.cod_d(); + Cell_complex<Out_simplex_map> cell_complex(intr_d); + cell_complex.construct_complex(interior_simplex_map); + + // List of Hasse_cell pointers to retrieve vertices values from edges + std::map<Cell_complex<Out_simplex_map>::Hasse_cell*, std::size_t> vi_map; + std::size_t index = 0; + + std::clog << "Vertices:" << std::endl; + for (const auto& cp_pair : cell_complex.cell_point_map()) { + std::clog << index << " : (" << cp_pair.second(0) << ", " << cp_pair.second(1) << ")" << std::endl; + vi_map.emplace(cp_pair.first, index++); + } + + std::clog << "Edges:" << std::endl; + for (const auto& sc_pair : cell_complex.interior_simplex_cell_map(1)) { + Cell_complex<Out_simplex_map>::Hasse_cell* edge_cell = sc_pair.second; + for (const auto& vi_pair : edge_cell->get_boundary()) std::clog << vi_map[vi_pair.first] << " "; + std::clog << std::endl; + } + return 0; +} diff --git a/src/Coxeter_triangulation/example/cell_complex_from_basic_circle_manifold_for_doc.txt b/src/Coxeter_triangulation/example/cell_complex_from_basic_circle_manifold_for_doc.txt new file mode 100644 index 00000000..b323cca3 --- /dev/null +++ b/src/Coxeter_triangulation/example/cell_complex_from_basic_circle_manifold_for_doc.txt @@ -0,0 +1,26 @@ +Vertices: +0 : (-0.680375, 0.523483) +1 : (0.147642, 0.887879) +2 : (-0.847996, 0.30801) +3 : (-0.881369, 0.0951903) +4 : (0.638494, -0.550215) +5 : (0.415344, 0.843848) +6 : (0.812453, -0.0815816) +7 : (0.319625, -0.7709) +8 : (0.319625, 0.889605) +9 : (0.579487, 0.638553) +10 : (-0.680375, -0.461325) +11 : (-0.364269, -0.760962) +Edges: +3 2 +3 10 +10 11 +11 7 +7 4 +2 0 +0 1 +6 9 +6 4 +1 8 +8 5 +5 9 diff --git a/src/Coxeter_triangulation/example/manifold_tracing_custom_function.cpp b/src/Coxeter_triangulation/example/manifold_tracing_custom_function.cpp new file mode 100644 index 00000000..fe2051bb --- /dev/null +++ b/src/Coxeter_triangulation/example/manifold_tracing_custom_function.cpp @@ -0,0 +1,87 @@ +#include <iostream> + +#include <gudhi/Coxeter_triangulation.h> +#include <gudhi/Functions/Function_Sm_in_Rd.h> +#include <gudhi/Implicit_manifold_intersection_oracle.h> +#include <gudhi/Manifold_tracing.h> +#include <gudhi/Coxeter_triangulation/Cell_complex/Cell_complex.h> +#include <gudhi/Functions/Linear_transformation.h> + +#include <gudhi/IO/build_mesh_from_cell_complex.h> +#include <gudhi/IO/output_meshes_to_medit.h> + +using namespace Gudhi::coxeter_triangulation; + +/* A definition of a function that defines a 2d surface embedded in R^4, but that normally + * lives on a complex projective plane. + * In terms of harmonic coordinates [x:y:z] of points on the complex projective plane, + * the equation of the manifold is x^3*y + y^3*z + z^3*x = 0. + * The embedding consists of restricting the manifold to the affine subspace z = 1. + */ +struct Function_surface_on_CP2_in_R4 { + Eigen::VectorXd operator()(const Eigen::VectorXd& p) const { + // The real and imaginary parts of the variables x and y + double xr = p(0), xi = p(1), yr = p(2), yi = p(3); + Eigen::VectorXd result(cod_d()); + + // Squares and cubes of real and imaginary parts used in the computations + double xr2 = xr * xr, xi2 = xi * xi, yr2 = yr * yr, yi2 = yi * yi, xr3 = xr2 * xr, xi3 = xi2 * xi, yr3 = yr2 * yr, + yi3 = yi2 * yi; + + // The first coordinate of the output is Re(x^3*y + y^3 + x) + result(0) = xr3 * yr - 3 * xr * xi2 * yr - 3 * xr2 * xi * yi + xi3 * yi + yr3 - 3 * yr * yi2 + xr; + // The second coordinate of the output is Im(x^3*y + y^3 + x) + result(1) = 3 * xr2 * xi * yr + xr3 * yi - 3 * xr * xi2 * yi - xi3 * yr + 3 * yr2 * yi - yi3 + xi; + return result; + } + + std::size_t amb_d() const { return 4; }; + std::size_t cod_d() const { return 2; }; + + Eigen::VectorXd seed() const { + Eigen::VectorXd result = Eigen::VectorXd::Zero(4); + return result; + } + + Function_surface_on_CP2_in_R4() {} +}; + +int main(int argc, char** argv) { + // The function for the (non-compact) manifold + Function_surface_on_CP2_in_R4 fun; + + // Seed of the function + Eigen::VectorXd seed = fun.seed(); + + // Creating the function that defines the boundary of a compact region on the manifold + double radius = 3.0; + Function_Sm_in_Rd fun_sph(radius, 3, seed); + + // Defining the intersection oracle + auto oracle = make_oracle(fun, fun_sph); + + // Define a Coxeter triangulation scaled by a factor lambda. + // The triangulation is translated by a random vector to avoid violating the genericity hypothesis. + double lambda = 0.2; + Coxeter_triangulation<> cox_tr(oracle.amb_d()); + cox_tr.change_offset(Eigen::VectorXd::Random(oracle.amb_d())); + cox_tr.change_matrix(lambda * cox_tr.matrix()); + + // Manifold tracing algorithm + using MT = Manifold_tracing<Coxeter_triangulation<> >; + using Out_simplex_map = typename MT::Out_simplex_map; + std::vector<Eigen::VectorXd> seed_points(1, seed); + Out_simplex_map interior_simplex_map, boundary_simplex_map; + manifold_tracing_algorithm(seed_points, cox_tr, oracle, interior_simplex_map, boundary_simplex_map); + + // Constructing the cell complex + std::size_t intr_d = oracle.amb_d() - oracle.cod_d(); + Cell_complex<Out_simplex_map> cell_complex(intr_d); + cell_complex.construct_complex(interior_simplex_map, boundary_simplex_map); + + // Output the cell complex to a file readable by medit + output_meshes_to_medit(3, "manifold_on_CP2_with_boundary", + build_mesh_from_cell_complex(cell_complex, Configuration(true, true, true, 1, 5, 3), + Configuration(true, true, true, 2, 13, 14))); + return 0; +} diff --git a/src/Coxeter_triangulation/example/manifold_tracing_flat_torus_with_boundary.cpp b/src/Coxeter_triangulation/example/manifold_tracing_flat_torus_with_boundary.cpp new file mode 100644 index 00000000..59fe2e2b --- /dev/null +++ b/src/Coxeter_triangulation/example/manifold_tracing_flat_torus_with_boundary.cpp @@ -0,0 +1,72 @@ +// workaround for the annoying boost message in boost 1.69 +#define BOOST_PENDING_INTEGER_LOG2_HPP +#include <boost/integer/integer_log2.hpp> +// end workaround + +#include <iostream> + +#include <gudhi/Coxeter_triangulation.h> +#include <gudhi/Functions/Function_affine_plane_in_Rd.h> +#include <gudhi/Functions/Function_Sm_in_Rd.h> +#include <gudhi/Functions/Cartesian_product.h> +#include <gudhi/Functions/Linear_transformation.h> +#include <gudhi/Implicit_manifold_intersection_oracle.h> +#include <gudhi/Manifold_tracing.h> +#include <gudhi/Coxeter_triangulation/Cell_complex/Cell_complex.h> +#include <gudhi/Functions/random_orthogonal_matrix.h> // requires CGAL + +#include <gudhi/IO/build_mesh_from_cell_complex.h> +#include <gudhi/IO/output_meshes_to_medit.h> + +using namespace Gudhi::coxeter_triangulation; + +int main(int argc, char** argv) { + // Creating a circle S1 in R2 of specified radius + double radius = 1.0; + Function_Sm_in_Rd fun_circle(radius, 1); + + // Creating a flat torus S1xS1 in R4 from two circle functions + auto fun_flat_torus = make_product_function(fun_circle, fun_circle); + + // Apply a random rotation in R4 + auto matrix = random_orthogonal_matrix(4); + auto fun_flat_torus_rotated = make_linear_transformation(fun_flat_torus, matrix); + + // Computing the seed of the function fun_flat_torus + Eigen::VectorXd seed = fun_flat_torus_rotated.seed(); + + // Defining a domain function that defines the boundary, which is a hyperplane passing by the origin and orthogonal to + // x. + Eigen::MatrixXd normal_matrix = Eigen::MatrixXd::Zero(4, 1); + for (std::size_t i = 0; i < 4; i++) normal_matrix(i, 0) = -seed(i); + Function_affine_plane_in_Rd fun_bound(normal_matrix, -seed / 2); + + // Defining the intersection oracle + auto oracle = make_oracle(fun_flat_torus_rotated, fun_bound); + + // Define a Coxeter triangulation scaled by a factor lambda. + // The triangulation is translated by a random vector to avoid violating the genericity hypothesis. + double lambda = 0.2; + Coxeter_triangulation<> cox_tr(oracle.amb_d()); + cox_tr.change_offset(Eigen::VectorXd::Random(oracle.amb_d())); + cox_tr.change_matrix(lambda * cox_tr.matrix()); + + // Manifold tracing algorithm + using MT = Manifold_tracing<Coxeter_triangulation<> >; + using Out_simplex_map = typename MT::Out_simplex_map; + std::vector<Eigen::VectorXd> seed_points(1, seed); + Out_simplex_map interior_simplex_map, boundary_simplex_map; + manifold_tracing_algorithm(seed_points, cox_tr, oracle, interior_simplex_map, boundary_simplex_map); + + // Constructing the cell complex + std::size_t intr_d = oracle.amb_d() - oracle.cod_d(); + Cell_complex<Out_simplex_map> cell_complex(intr_d); + cell_complex.construct_complex(interior_simplex_map, boundary_simplex_map); + + // Output the cell complex to a file readable by medit + output_meshes_to_medit(3, "flat_torus_with_boundary", + build_mesh_from_cell_complex(cell_complex, Configuration(true, true, true, 1, 5, 3), + Configuration(true, true, true, 2, 13, 14))); + + return 0; +} diff --git a/src/Coxeter_triangulation/include/gudhi/Coxeter_triangulation.h b/src/Coxeter_triangulation/include/gudhi/Coxeter_triangulation.h new file mode 100644 index 00000000..de68acb6 --- /dev/null +++ b/src/Coxeter_triangulation/include/gudhi/Coxeter_triangulation.h @@ -0,0 +1,77 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef COXETER_TRIANGULATION_H_ +#define COXETER_TRIANGULATION_H_ + +#include <vector> +#include <cmath> // for std::sqrt + +#include <boost/range/iterator_range.hpp> +#include <boost/graph/graph_traits.hpp> +#include <boost/graph/adjacency_list.hpp> + +#include <Eigen/Eigenvalues> +#include <Eigen/Sparse> +#include <Eigen/SVD> + +#include <gudhi/Freudenthal_triangulation.h> +#include <gudhi/Permutahedral_representation.h> + +namespace Gudhi { + +namespace coxeter_triangulation { + +/** + * \class Coxeter_triangulation + * \brief A class that stores Coxeter triangulation of type \f$\tilde{A}_d\f$. + * This triangulation has the greatest simplex quality out of all linear transformations + * of the Freudenthal-Kuhn triangulation. + * + * \ingroup coxeter_triangulation + * + * \tparam Permutahedral_representation_ Type of a simplex given by a permutahedral representation. + * Needs to be a model of SimplexInCoxeterTriangulation. + */ +template <class Permutahedral_representation_ = + Permutahedral_representation<std::vector<int>, std::vector<std::vector<std::size_t> > > > +class Coxeter_triangulation : public Freudenthal_triangulation<Permutahedral_representation_> { + using Matrix = Eigen::MatrixXd; + + Matrix root_matrix(unsigned d) { + Matrix cartan(Matrix::Identity(d, d)); + for (unsigned i = 1; i < d; i++) { + cartan(i - 1, i) = -0.5; + cartan(i, i - 1) = -0.5; + } + Eigen::SelfAdjointEigenSolver<Matrix> saes(cartan); + Eigen::VectorXd sqrt_diag(d); + for (unsigned i = 0; i < d; ++i) sqrt_diag(i) = std::sqrt(saes.eigenvalues()[i]); + + Matrix lower(Matrix::Ones(d, d)); + lower = lower.triangularView<Eigen::Lower>(); + + Matrix result = (lower * saes.eigenvectors() * sqrt_diag.asDiagonal()).inverse(); + return result; + } + + public: + /** \brief Constructor of Coxeter triangulation of a given dimension. + * @param[in] dimension The dimension of the triangulation. + */ + Coxeter_triangulation(std::size_t dimension) + : Freudenthal_triangulation<Permutahedral_representation_>(dimension, root_matrix(dimension)) {} +}; + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif diff --git a/src/Coxeter_triangulation/include/gudhi/Coxeter_triangulation/Cell_complex/Cell_complex.h b/src/Coxeter_triangulation/include/gudhi/Coxeter_triangulation/Cell_complex/Cell_complex.h new file mode 100644 index 00000000..de342ecc --- /dev/null +++ b/src/Coxeter_triangulation/include/gudhi/Coxeter_triangulation/Cell_complex/Cell_complex.h @@ -0,0 +1,340 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef CELL_COMPLEX_H_ +#define CELL_COMPLEX_H_ + +#include <Eigen/Dense> + +#include <vector> +#include <map> +#include <utility> // for std::make_pair + +#include <gudhi/IO/output_debug_traces_to_html.h> // for DEBUG_TRACES +#include <gudhi/Permutahedral_representation/Simplex_comparator.h> +#include <gudhi/Coxeter_triangulation/Cell_complex/Hasse_diagram_cell.h> // for Hasse_cell + +namespace Gudhi { + +namespace coxeter_triangulation { + +/** \class Cell_complex + * \brief A class that constructs the cell complex from the output provided by the class + * \ref Gudhi::coxeter_triangulation::Manifold_tracing. + * + * The use and interfaces of this cell complex is limited to the \ref coxeter_triangulation implementation. + * + * \tparam Out_simplex_map_ The type of a map from a simplex type that is a + * model of SimplexInCoxeterTriangulation to Eigen::VectorXd. + */ +template <class Out_simplex_map_> +class Cell_complex { + public: + /** \brief Type of a simplex in the ambient triangulation. + * Is a model of the concept SimplexInCoxeterTriangulation. + */ + using Simplex_handle = typename Out_simplex_map_::key_type; + /** \brief Type of a cell in the cell complex. + * Always is Gudhi::Hasse_cell from the Hasse diagram module. + * The additional information is the boolean that is true if and only if the cell lies + * on the boundary. + */ + using Hasse_cell = Gudhi::Hasse_diagram::Hasse_diagram_cell<int, double, bool>; + /** \brief Type of a map from permutahedral representations of simplices in the + * ambient triangulation to the corresponding cells in the cell complex of some + * specific dimension. + */ + using Simplex_cell_map = std::map<Simplex_handle, Hasse_cell*, Simplex_comparator<Simplex_handle> >; + /** \brief Type of a vector of maps from permutahedral representations of simplices in the + * ambient triangulation to the corresponding cells in the cell complex of various dimensions. + */ + using Simplex_cell_maps = std::vector<Simplex_cell_map>; + + /** \brief Type of a map from cells in the cell complex to the permutahedral representations + * of the corresponding simplices in the ambient triangulation. + */ + using Cell_simplex_map = std::map<Hasse_cell*, Simplex_handle>; + + /** \brief Type of a map from vertex cells in the cell complex to the permutahedral representations + * of their Cartesian coordinates. + */ + using Cell_point_map = std::map<Hasse_cell*, Eigen::VectorXd>; + + private: + Hasse_cell* insert_cell(const Simplex_handle& simplex, std::size_t cell_d, bool is_boundary) { + Simplex_cell_maps& simplex_cell_maps = (is_boundary ? boundary_simplex_cell_maps_ : interior_simplex_cell_maps_); +#ifdef DEBUG_TRACES + CC_detail_list& cc_detail_list = + (is_boundary ? cc_boundary_detail_lists[cell_d] : cc_interior_detail_lists[cell_d]); + cc_detail_list.emplace_back(simplex); +#endif + Simplex_cell_map& simplex_cell_map = simplex_cell_maps[cell_d]; + auto map_it = simplex_cell_map.find(simplex); + if (map_it == simplex_cell_map.end()) { + hasse_cells_.push_back(new Hasse_cell(is_boundary, cell_d)); + Hasse_cell* new_cell = hasse_cells_.back(); + simplex_cell_map.emplace(simplex, new_cell); + cell_simplex_map_.emplace(new_cell, simplex); +#ifdef DEBUG_TRACES + cc_detail_list.back().status_ = CC_detail_info::Result_type::inserted; +#endif + return new_cell; + } +#ifdef DEBUG_TRACES + CC_detail_info& cc_info = cc_detail_list.back(); + cc_info.trigger_ = to_string(map_it->first); + cc_info.status_ = CC_detail_info::Result_type::self; +#endif + return map_it->second; + } + + void expand_level(std::size_t cell_d) { + bool is_manifold_with_boundary = boundary_simplex_cell_maps_.size() > 0; + for (auto& sc_pair : interior_simplex_cell_maps_[cell_d - 1]) { + const Simplex_handle& simplex = sc_pair.first; + Hasse_cell* cell = sc_pair.second; + for (Simplex_handle coface : simplex.coface_range(cod_d_ + cell_d)) { + Hasse_cell* new_cell = insert_cell(coface, cell_d, false); + new_cell->get_boundary().emplace_back(cell, 1); + } + } + + if (is_manifold_with_boundary) { + for (auto& sc_pair : boundary_simplex_cell_maps_[cell_d - 1]) { + const Simplex_handle& simplex = sc_pair.first; + Hasse_cell* cell = sc_pair.second; + if (cell_d != intr_d_) + for (Simplex_handle coface : simplex.coface_range(cod_d_ + cell_d + 1)) { + Hasse_cell* new_cell = insert_cell(coface, cell_d, true); + new_cell->get_boundary().emplace_back(cell, 1); + } + auto map_it = interior_simplex_cell_maps_[cell_d].find(simplex); + if (map_it == interior_simplex_cell_maps_[cell_d].end()) + std::cerr << "Cell_complex::expand_level error: A boundary cell does not have an interior counterpart.\n"; + else { + Hasse_cell* i_cell = map_it->second; + i_cell->get_boundary().emplace_back(cell, 1); + } + } + } + } + + void construct_complex_(const Out_simplex_map_& out_simplex_map) { +#ifdef DEBUG_TRACES + cc_interior_summary_lists.resize(interior_simplex_cell_maps_.size()); + cc_interior_prejoin_lists.resize(interior_simplex_cell_maps_.size()); + cc_interior_detail_lists.resize(interior_simplex_cell_maps_.size()); +#endif + for (auto& os_pair : out_simplex_map) { + const Simplex_handle& simplex = os_pair.first; + const Eigen::VectorXd& point = os_pair.second; + Hasse_cell* new_cell = insert_cell(simplex, 0, false); + cell_point_map_.emplace(new_cell, point); + } + for (std::size_t cell_d = 1; + cell_d < interior_simplex_cell_maps_.size() && !interior_simplex_cell_maps_[cell_d - 1].empty(); ++cell_d) { + expand_level(cell_d); + } + } + + void construct_complex_(const Out_simplex_map_& interior_simplex_map, const Out_simplex_map_& boundary_simplex_map) { +#ifdef DEBUG_TRACES + cc_interior_summary_lists.resize(interior_simplex_cell_maps_.size()); + cc_interior_prejoin_lists.resize(interior_simplex_cell_maps_.size()); + cc_interior_detail_lists.resize(interior_simplex_cell_maps_.size()); + cc_boundary_summary_lists.resize(boundary_simplex_cell_maps_.size()); + cc_boundary_prejoin_lists.resize(boundary_simplex_cell_maps_.size()); + cc_boundary_detail_lists.resize(boundary_simplex_cell_maps_.size()); +#endif + for (auto& os_pair : boundary_simplex_map) { + const Simplex_handle& simplex = os_pair.first; + const Eigen::VectorXd& point = os_pair.second; + Hasse_cell* new_cell = insert_cell(simplex, 0, true); + cell_point_map_.emplace(new_cell, point); + } + for (auto& os_pair : interior_simplex_map) { + const Simplex_handle& simplex = os_pair.first; + const Eigen::VectorXd& point = os_pair.second; + Hasse_cell* new_cell = insert_cell(simplex, 0, false); + cell_point_map_.emplace(new_cell, point); + } +#ifdef DEBUG_TRACES + for (const auto& sc_pair : interior_simplex_cell_maps_[0]) + cc_interior_summary_lists[0].push_back(CC_summary_info(sc_pair)); + for (const auto& sc_pair : boundary_simplex_cell_maps_[0]) + cc_boundary_summary_lists[0].push_back(CC_summary_info(sc_pair)); +#endif + + for (std::size_t cell_d = 1; + cell_d < interior_simplex_cell_maps_.size() && !interior_simplex_cell_maps_[cell_d - 1].empty(); ++cell_d) { + expand_level(cell_d); + +#ifdef DEBUG_TRACES + for (const auto& sc_pair : interior_simplex_cell_maps_[cell_d]) + cc_interior_summary_lists[cell_d].push_back(CC_summary_info(sc_pair)); + if (cell_d < boundary_simplex_cell_maps_.size()) + for (const auto& sc_pair : boundary_simplex_cell_maps_[cell_d]) + cc_boundary_summary_lists[cell_d].push_back(CC_summary_info(sc_pair)); +#endif + } + } + + public: + /** + * \brief Constructs the the cell complex that approximates an \f$m\f$-dimensional manifold + * without boundary embedded in the \f$ d \f$-dimensional Euclidean space + * from the output of the class Gudhi::Manifold_tracing. + * + * \param[in] out_simplex_map A map from simplices of dimension \f$(d-m)\f$ + * in the ambient triangulation that intersect the relative interior of the manifold + * to the intersection points. + */ + void construct_complex(const Out_simplex_map_& out_simplex_map) { + interior_simplex_cell_maps_.resize(intr_d_ + 1); + if (!out_simplex_map.empty()) cod_d_ = out_simplex_map.begin()->first.dimension(); + construct_complex_(out_simplex_map); + } + + /** + * \brief Constructs the skeleton of the cell complex that approximates + * an \f$m\f$-dimensional manifold without boundary embedded + * in the \f$d\f$-dimensional Euclidean space + * up to a limit dimension from the output of the class Gudhi::Manifold_tracing. + * + * \param[in] out_simplex_map A map from simplices of dimension \f$(d-m)\f$ + * in the ambient triangulation that intersect the relative interior of the manifold + * to the intersection points. + * \param[in] limit_dimension The dimension of the constructed skeleton. + */ + void construct_complex(const Out_simplex_map_& out_simplex_map, std::size_t limit_dimension) { + interior_simplex_cell_maps_.resize(limit_dimension + 1); + if (!out_simplex_map.empty()) cod_d_ = out_simplex_map.begin()->first.dimension(); + construct_complex_(out_simplex_map); + } + + /** + * \brief Constructs the the cell complex that approximates an \f$m\f$-dimensional manifold + * with boundary embedded in the \f$ d \f$-dimensional Euclidean space + * from the output of the class Gudhi::Manifold_tracing. + * + * \param[in] interior_simplex_map A map from simplices of dimension \f$(d-m)\f$ + * in the ambient triangulation that intersect the relative interior of the manifold + * to the intersection points. + * \param[in] boundary_simplex_map A map from simplices of dimension \f$(d-m+1)\f$ + * in the ambient triangulation that intersect the boundary of the manifold + * to the intersection points. + */ + void construct_complex(const Out_simplex_map_& interior_simplex_map, const Out_simplex_map_& boundary_simplex_map) { + interior_simplex_cell_maps_.resize(intr_d_ + 1); + boundary_simplex_cell_maps_.resize(intr_d_); + if (!interior_simplex_map.empty()) cod_d_ = interior_simplex_map.begin()->first.dimension(); + construct_complex_(interior_simplex_map, boundary_simplex_map); + } + + /** + * \brief Constructs the skeleton of the cell complex that approximates + * an \f$m\f$-dimensional manifold with boundary embedded + * in the \f$d\f$-dimensional Euclidean space + * up to a limit dimension from the output of the class Gudhi::Manifold_tracing. + * + * \param[in] interior_simplex_map A map from simplices of dimension \f$(d-m)\f$ + * in the ambient triangulation that intersect the relative interior of the manifold + * to the intersection points. + * \param[in] boundary_simplex_map A map from simplices of dimension \f$(d-m+1)\f$ + * in the ambient triangulation that intersect the boundary of the manifold + * to the intersection points. + * \param[in] limit_dimension The dimension of the constructed skeleton. + */ + void construct_complex(const Out_simplex_map_& interior_simplex_map, const Out_simplex_map_& boundary_simplex_map, + std::size_t limit_dimension) { + interior_simplex_cell_maps_.resize(limit_dimension + 1); + boundary_simplex_cell_maps_.resize(limit_dimension); + if (!interior_simplex_map.empty()) cod_d_ = interior_simplex_map.begin()->first.dimension(); + construct_complex_(interior_simplex_map, boundary_simplex_map); + } + + /** + * \brief Returns the dimension of the cell complex. + */ + std::size_t intrinsic_dimension() const { return intr_d_; } + + /** + * \brief Returns a vector of maps from the cells of various dimensions in the interior + * of the cell complex of type Gudhi::Hasse_cell to the permutahedral representations + * of the corresponding simplices in the ambient triangulation. + */ + const Simplex_cell_maps& interior_simplex_cell_maps() const { return interior_simplex_cell_maps_; } + + /** + * \brief Returns a vector of maps from the cells of various dimensions on the boundary + * of the cell complex of type Gudhi::Hasse_cell to the permutahedral representations + * of the corresponding simplices in the ambient triangulation. + */ + const Simplex_cell_maps& boundary_simplex_cell_maps() const { return boundary_simplex_cell_maps_; } + + /** + * \brief Returns a map from the cells of a given dimension in the interior + * of the cell complex of type Gudhi::Hasse_cell to the permutahedral representations + * of the corresponding simplices in the ambient triangulation. + * + * \param[in] cell_d The dimension of the cells. + */ + const Simplex_cell_map& interior_simplex_cell_map(std::size_t cell_d) const { + return interior_simplex_cell_maps_[cell_d]; + } + + /** + * \brief Returns a map from the cells of a given dimension on the boundary + * of the cell complex of type Gudhi::Hasse_cell to the permutahedral representations + * of the corresponding simplices in the ambient triangulation. + * + * \param[in] cell_d The dimension of the cells. + */ + const Simplex_cell_map& boundary_simplex_cell_map(std::size_t cell_d) const { + return boundary_simplex_cell_maps_[cell_d]; + } + + /** + * \brief Returns a map from the cells in the cell complex of type Gudhi::Hasse_cell + * to the permutahedral representations of the corresponding simplices in the + * ambient triangulation. + */ + const Cell_simplex_map& cell_simplex_map() const { return cell_simplex_map_; } + + /** + * \brief Returns a map from the vertex cells in the cell complex of type Gudhi::Hasse_cell + * to their Cartesian coordinates. + */ + const Cell_point_map& cell_point_map() const { return cell_point_map_; } + + /** + * \brief Constructor for the class Cell_complex. + * + * \param[in] intrinsic_dimension The dimension of the cell complex. + */ + Cell_complex(std::size_t intrinsic_dimension) : intr_d_(intrinsic_dimension) {} + + ~Cell_complex() { + for (Hasse_cell* hs_ptr : hasse_cells_) delete hs_ptr; + } + + private: + std::size_t intr_d_, cod_d_; + Simplex_cell_maps interior_simplex_cell_maps_, boundary_simplex_cell_maps_; + Cell_simplex_map cell_simplex_map_; + Cell_point_map cell_point_map_; + std::vector<Hasse_cell*> hasse_cells_; +}; + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif diff --git a/src/Coxeter_triangulation/include/gudhi/Coxeter_triangulation/Cell_complex/Hasse_diagram_cell.h b/src/Coxeter_triangulation/include/gudhi/Coxeter_triangulation/Cell_complex/Hasse_diagram_cell.h new file mode 100644 index 00000000..9b57da3c --- /dev/null +++ b/src/Coxeter_triangulation/include/gudhi/Coxeter_triangulation/Cell_complex/Hasse_diagram_cell.h @@ -0,0 +1,285 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Pawel Dlotko + * + * Copyright (C) 2017 Swansea University UK + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef HASSE_DIAGRAM_CELL_H +#define HASSE_DIAGRAM_CELL_H + +#include <vector> +#include <utility> // for std::pair +#include <ostream> +#include <string> +#include <type_traits> // for std::is_same +#include <cstdlib> // for std::size_t + +namespace Gudhi { +namespace Hasse_diagram { + +template <typename Cell_type> +class Hasse_diagram; + +/** + * \class Hasse_diagram_cell + * \brief Data structure to store a cell in a Hasse diagram. + * + * \ingroup Hasse_diagram + * + * \details + * The use and interfaces of this Hasse diagram cell is limited to the \ref coxeter_triangulation implementation. + * + * This is a data structure to store a cell in a general Hasse diagram data structure. It stores the following + * information about the cell: References to boundary and coBoundary elements, dimension of a cell and its filtration. + * It also allow to store any additional information of a type Additional_information which is a template parameter of + * the class (set by default to void). + * + * The complex is a template class requiring the following parameters: + * Incidence_type_ - determine the type of incidence coefficients. Use integers in most general case. + * Filtration_type_ - type of filtration of cells. + * Additional_information_ (set by default to void) - allows to store any + * additional information in the cells of Hasse diagrams. + * + */ +template <typename Incidence_type_, typename Filtration_type_, typename Additional_information_ = void> +class Hasse_diagram_cell { + public: + typedef Incidence_type_ Incidence_type; + typedef Filtration_type_ Filtration_type; + typedef Additional_information_ Additional_information; + using Cell_range = std::vector<std::pair<Hasse_diagram_cell*, Incidence_type> >; + + /** + * Default constructor. + **/ + Hasse_diagram_cell() : dimension(0), position(0), deleted_(false) {} + + /** + * Constructor of a cell of dimension dim. + **/ + Hasse_diagram_cell(int dim) : dimension(dim), position(0), deleted_(false) {} + + /** + * Constructor of a cell of dimension dim. + **/ + Hasse_diagram_cell(int dim, Filtration_type filt_) + : dimension(dim), position(0), deleted_(false), filtration(filt_) {} + + /** + * Constructor of a cell of dimension dim with a given boundary. + **/ + Hasse_diagram_cell(const Cell_range& boundary_, int dim) + : dimension(dim), boundary(boundary_), position(0), deleted_(false) {} + + /** + * Constructor of a cell of dimension dim with a given boundary and coboundary. + **/ + Hasse_diagram_cell(const Cell_range& boundary_, const Cell_range& coboundary_, int dim) + : dimension(dim), boundary(boundary_), coBoundary(coboundary_), position(0), deleted_(false) {} + + /** + * Constructor of a cell of dimension dim with a given boundary, coboundary and + * additional information. + **/ + Hasse_diagram_cell(const Cell_range& boundary_, const Cell_range& coboundary_, const Additional_information& ai, + int dim) + : dimension(dim), + boundary(boundary_), + coBoundary(coboundary_), + additional_info(ai), + position(0), + deleted_(false) {} + + /** + * Constructor of a cell of dimension dim having given additional information. + **/ + Hasse_diagram_cell(Additional_information ai, int dim) + : dimension(dim), additional_info(ai), position(0), deleted_(false) {} + + /** + * Procedure to get the boundary of a fiven cell. The output format + * is a vector of pairs of pointers to boundary elements and incidence + * coefficients. + **/ + inline Cell_range& get_boundary() { return this->boundary; } + + /** + * Procedure to get the coboundary of a fiven cell. The output format + * is a vector of pairs of pointers to coboundary elements and incidence + * coefficients. + **/ + inline Cell_range& get_coBoundary() { return this->coBoundary; } + + /** + * Procedure to get the dimension of a cell. + **/ + inline int& get_dimension() { return this->dimension; } + + /** + * Procedure to get additional information about the cell.s + **/ + inline Additional_information& get_additional_information() { return this->additional_info; } + + /** + * Procedure to retrieve the position of the cell in the structure. It is used in + * the implementation of Hasse diagram and set by it. Note that removal of + * cell and subsequent call of clean_up_the_structure will change those + * positions. + **/ + inline unsigned& get_position() { return this->position; } + + /** + * Accessing the filtration of the cell. + **/ + inline Filtration_type& get_filtration() { + // std::cout << "Accessing the filtration of a cell : " << *this << std::endl; + return this->filtration; + } + + /** + * A procedure used to check if the cell is deleted. It is used by the + * subsequent implementation of Hasse diagram that is absed on lazy + * delete. + **/ + inline bool deleted() { return this->deleted_; } + + template <typename Cell_type> + friend class Hasse_diagram; + + template <typename Cell_type> + friend class is_before_in_filtration; + + template <typename Complex_type, typename Cell_type> + friend std::vector<Cell_type*> convert_to_vector_of_Cell_type(Complex_type& cmplx); + + /** + * Procedure to remove deleted boundary and coboundary elements from the + * vectors of boundary and coboundary elements of this cell. + **/ + void remove_deleted_elements_from_boundary_and_coboundary() { + Cell_range new_boundary; + new_boundary.reserve(this->boundary.size()); + for (std::size_t bd = 0; bd != this->boundary.size(); ++bd) { + if (!this->boundary[bd].first->deleted()) { + new_boundary.push_back(this->boundary[bd]); + } + } + this->boundary.swap(new_boundary); + + Cell_range new_coBoundary; + new_coBoundary.reserve(this->coBoundary.size()); + for (std::size_t cbd = 0; cbd != this->coBoundary.size(); ++cbd) { + if (!this->coBoundary[cbd].first->deleted()) { + new_coBoundary.push_back(this->coBoundary[cbd]); + } + } + this->coBoundary.swap(new_coBoundary); + } + + /** + * Writing to a stream operator. + **/ + friend std::ostream& operator<<( + std::ostream& out, const Hasse_diagram_cell<Incidence_type, Filtration_type, Additional_information>& c) { + // cout << "position : " << c.position << ", dimension : " << c.dimension << ", filtration: " << c.filtration << ", + // size of boundary : " << c.boundary.size() << "\n"; + out << c.position << " " << c.dimension << " " << c.filtration << std::endl; + for (std::size_t bd = 0; bd != c.boundary.size(); ++bd) { + // do not write out the cells that has been deleted + if (c.boundary[bd].first->deleted()) continue; + out << c.boundary[bd].first->position << " " << c.boundary[bd].second << " "; + } + out << std::endl; + return out; + } + + /** + * Procedure that return vector of pointers to boundary elements of a given cell. + **/ + inline std::vector<Hasse_diagram_cell*> get_list_of_boundary_elements() { + std::vector<Hasse_diagram_cell*> result; + std::size_t size_of_boundary = this->boundary.size(); + result.reserve(size_of_boundary); + for (std::size_t bd = 0; bd != size_of_boundary; ++bd) { + result.push_back(this->boundary[bd].first); + } + return result; + } + + /** + * Procedure that return vector of positios of boundary elements of a given cell. + **/ + inline std::vector<unsigned> get_list_of_positions_of_boundary_elements() { + std::vector<unsigned> result; + std::size_t size_of_boundary = this->boundary.size(); + result.reserve(size_of_boundary); + for (std::size_t bd = 0; bd != size_of_boundary; ++bd) { + result.push_back(this->boundary[bd].first->position); + } + return result; + } + + /** + * Function that display a string being a signature of a structure. + * Used mainly for debugging purposes. + **/ + std::string full_signature_of_the_structure() { + std::string result; + result += "dimension: "; + result += std::to_string(this->dimension); + result += " filtration: "; + result += std::to_string(this->filtration); + result += " position: "; + result += std::to_string(this->position); + result += " deleted_: "; + result += std::to_string(this->deleted_); + + // if the Additional_information is not void, add them to + // the signature as well. + if (std::is_same<Additional_information, void>::value) { + result += " Additional_information: "; + result += std::to_string(this->additional_info); + } + result += " boundary "; + for (std::size_t bd = 0; bd != this->boundary.size(); ++bd) { + result += "( " + std::to_string(this->boundary[bd].first->position); + result += " " + std::to_string(this->boundary[bd].second); + result += ") "; + } + + result += " coBoundary "; + for (std::size_t cbd = 0; cbd != this->coBoundary.size(); ++cbd) { + result += "( " + std::to_string(this->coBoundary[cbd].first->position); + result += " " + std::to_string(this->coBoundary[cbd].second); + result += ") "; + } + + return result; + } + + protected: + Cell_range boundary; + Cell_range coBoundary; + int dimension; + Additional_information additional_info; + unsigned position; + bool deleted_; + Filtration_type filtration; + + /** + * A procedure to delete a cell. It is a private function of the Hasse_diagram_cell + * class, since in the Hasse_diagram class I want to have a control + * of removal of cells. Therefore, to remove cell please use + * remove_cell in the Hasse_diagram structure. + **/ + void delete_cell() { this->deleted_ = true; } +}; // Hasse_diagram_cell + +} // namespace Hasse_diagram +} // namespace Gudhi + +#endif // CELL_H diff --git a/src/Coxeter_triangulation/include/gudhi/Coxeter_triangulation/Query_result.h b/src/Coxeter_triangulation/include/gudhi/Coxeter_triangulation/Query_result.h new file mode 100644 index 00000000..5543c2fb --- /dev/null +++ b/src/Coxeter_triangulation/include/gudhi/Coxeter_triangulation/Query_result.h @@ -0,0 +1,40 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef QUERY_RESULT_H_ +#define QUERY_RESULT_H_ + +namespace Gudhi { + +namespace coxeter_triangulation { + +/** \class Query_result + * \brief The result of a query by an oracle such as Implicit_manifold_intersection_oracle. + * + * \tparam Simplex_handle The class of the query simplex. + * + * \ingroup coxeter_triangulation + */ +template <class Simplex_handle> +struct Query_result { + /** \brief The potentially lower-dimensional face of the query simplex + * that contains the intersection point. OBSOLETE: as the snapping is removed. */ + // Simplex_handle face; + /** \brief The intersection point. */ + Eigen::VectorXd intersection; + /** \brief True if the query simplex intersects the manifold. */ + bool success; +}; + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif diff --git a/src/Coxeter_triangulation/include/gudhi/Freudenthal_triangulation.h b/src/Coxeter_triangulation/include/gudhi/Freudenthal_triangulation.h new file mode 100644 index 00000000..873c5c9b --- /dev/null +++ b/src/Coxeter_triangulation/include/gudhi/Freudenthal_triangulation.h @@ -0,0 +1,219 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef FREUDENTHAL_TRIANGULATION_H_ +#define FREUDENTHAL_TRIANGULATION_H_ + +#include <vector> +#include <algorithm> // for std::sort +#include <cmath> // for std::floor +#include <numeric> // for std::iota +#include <cstdlib> // for std::size_t + +#include <Eigen/Eigenvalues> +#include <Eigen/SVD> + +#include <gudhi/Permutahedral_representation.h> +#include <gudhi/Debug_utils.h> // for GUDHI_CHECK + +namespace Gudhi { + +namespace coxeter_triangulation { + +/** + * \class Freudenthal_triangulation + * \brief A class that stores any affine transformation of the Freudenthal-Kuhn + * triangulation. + * + * \ingroup coxeter_triangulation + * + * \details The data structure is a record that consists of a matrix + * that represents the linear transformation of the Freudenthal-Kuhn triangulation + * and a vector that represents the offset. + * + * \tparam Permutahedral_representation_ Type of a simplex given by a permutahedral representation. + * Needs to be a model of SimplexInCoxeterTriangulation. + */ +template <class Permutahedral_representation_ = + Permutahedral_representation<std::vector<int>, std::vector<std::vector<std::size_t> > > > +class Freudenthal_triangulation { + using Matrix = Eigen::MatrixXd; + using Vector = Eigen::VectorXd; + + public: + /** \brief Type of the simplices in the triangulation. */ + using Simplex_handle = Permutahedral_representation_; + + /** \brief Type of the vertices in the triangulation. */ + using Vertex_handle = typename Permutahedral_representation_::Vertex; + + /** \brief Constructor of the Freudenthal-Kuhn triangulation of a given dimension. + * @param[in] dimension The dimension of the triangulation. + */ + Freudenthal_triangulation(std::size_t dimension) + : Freudenthal_triangulation(dimension, Matrix::Identity(dimension, dimension), Vector::Zero(dimension)) { + is_freudenthal_ = true; + } + + /** \brief Constructor of the Freudenthal-Kuhn triangulation of a given dimension under + * a linear transformation by a given matrix. + * @param[in] dimension The dimension of the triangulation. + * @param[in] matrix The matrix that defines the linear transformation. + * Needs to be invertible. + */ + Freudenthal_triangulation(std::size_t dimension, const Matrix& matrix) + : Freudenthal_triangulation(dimension, matrix, Vector::Zero(dimension)) {} + + /** \brief Constructor of the Freudenthal-Kuhn triangulation of a given dimension under + * an affine transformation by a given matrix and a translation vector. + * @param[in] dimension The dimension of the triangulation. + * @param[in] matrix The matrix that defines the linear transformation. + * Needs to be invertible. + * @param[in] offset The offset vector. + * + * @exception std::invalid_argument In debug mode, if offset size is different from dimension. + */ + Freudenthal_triangulation(unsigned dimension, const Matrix& matrix, const Vector& offset) + : dimension_(dimension), + matrix_(matrix), + offset_(offset), + colpivhouseholderqr_(matrix_.colPivHouseholderQr()), + is_freudenthal_(false) { + GUDHI_CHECK(dimension == offset_.size(), std::invalid_argument("Offset must be of size 'dimension'")); + } + + /** \brief Dimension of the triangulation. */ + unsigned dimension() const { return dimension_; } + + /** \brief Matrix that defines the linear transformation of the triangulation. */ + const Matrix& matrix() const { return matrix_; } + + /** \brief Vector that defines the offset of the triangulation. */ + const Vector& offset() const { return offset_; } + + /** \brief Change the linear transformation matrix to a given value. + * @param[in] matrix New value of the linear transformation matrix. + */ + void change_matrix(const Eigen::MatrixXd& matrix) { + matrix_ = matrix; + colpivhouseholderqr_ = matrix.colPivHouseholderQr(); + is_freudenthal_ = false; + } + + /** \brief Change the offset vector to a given value. + * @param[in] offset New value of the offset vector. + */ + void change_offset(const Eigen::VectorXd& offset) { + offset_ = offset; + is_freudenthal_ = false; + } + + /** \brief Returns the permutahedral representation of the simplex in the + * triangulation that contains a given query point. + * \details Using the additional parameter scale, the search can be done in a + * triangulation that shares the origin, but is scaled by a given factor. + * This parameter can be useful to simulate the point location in a subdivided + * triangulation. + * The returned simplex is always minimal by inclusion. + * + * \tparam Point_d A class that represents a point in d-dimensional Euclidean space. + * The coordinates should be random-accessible. Needs to provide the method size(). + * + * @param[in] point The query point. + * @param[in] scale The scale of the triangulation. + * + * @exception std::invalid_argument In debug mode, if point dimension is different from triangulation one. + */ + template <class Point_d> + Simplex_handle locate_point(const Point_d& point, double scale = 1) const { + using Ordered_set_partition = typename Simplex_handle::OrderedSetPartition; + using Part = typename Ordered_set_partition::value_type; + unsigned d = point.size(); + GUDHI_CHECK(d == dimension_, + std::invalid_argument("The point must be of the same dimension as the triangulation")); + double error = 1e-9; + Simplex_handle output; + std::vector<double> z; + if (is_freudenthal_) { + for (std::size_t i = 0; i < d; i++) { + double x_i = scale * point[i]; + int y_i = std::floor(x_i); + output.vertex().push_back(y_i); + z.push_back(x_i - y_i); + } + } else { + Eigen::VectorXd p_vect(d); + for (std::size_t i = 0; i < d; i++) p_vect(i) = point[i]; + Eigen::VectorXd x_vect = colpivhouseholderqr_.solve(p_vect - offset_); + for (std::size_t i = 0; i < d; i++) { + double x_i = scale * x_vect(i); + int y_i = std::floor(x_i); + output.vertex().push_back(y_i); + z.push_back(x_i - y_i); + } + } + z.push_back(0); + Part indices(d + 1); + std::iota(indices.begin(), indices.end(), 0); + std::sort(indices.begin(), indices.end(), [&z](std::size_t i1, std::size_t i2) { return z[i1] > z[i2]; }); + + output.partition().push_back(Part(1, indices[0])); + for (std::size_t i = 1; i <= d; ++i) + if (z[indices[i - 1]] > z[indices[i]] + error) + output.partition().push_back(Part(1, indices[i])); + else + output.partition().back().push_back(indices[i]); + return output; + } + + /** \brief Returns the Cartesian coordinates of the given vertex. + * \details Using the additional parameter scale, the search can be done in a + * triangulation that shares the origin, but is scaled by a given factor. + * This parameter can be useful to simulate the computation of Cartesian coordinates + * of a vertex in a subdivided triangulation. + * @param[in] vertex The query vertex. + * @param[in] scale The scale of the triangulation. + */ + Eigen::VectorXd cartesian_coordinates(const Vertex_handle& vertex, double scale = 1) const { + Eigen::VectorXd v_vect(dimension_); + for (std::size_t j = 0; j < dimension_; j++) v_vect(j) = vertex[j] / scale; + return matrix_ * v_vect + offset_; + } + + /** \brief Returns the Cartesian coordinates of the barycenter of a given simplex. + * \details Using the additional parameter scale, the search can be done in a + * triangulation that shares the origin, but is scaled by a given factor. + * This parameter can be useful to simulate the computation of Cartesian coordinates + * of the barycenter of a simplex in a subdivided triangulation. + * @param[in] simplex The query simplex. + * @param[in] scale The scale of the triangulation. + */ + Eigen::VectorXd barycenter(const Simplex_handle& simplex, double scale = 1) const { + Eigen::VectorXd res_vector(dimension_); + res_vector.setZero(dimension_, 1); + for (auto v : simplex.vertex_range()) { + res_vector += cartesian_coordinates(v, scale); + } + return (1. / (simplex.dimension() + 1)) * res_vector; + } + + protected: + unsigned dimension_; + Matrix matrix_; + Vector offset_; + Eigen::ColPivHouseholderQR<Matrix> colpivhouseholderqr_; + bool is_freudenthal_; +}; + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif diff --git a/src/Coxeter_triangulation/include/gudhi/Functions/Cartesian_product.h b/src/Coxeter_triangulation/include/gudhi/Functions/Cartesian_product.h new file mode 100644 index 00000000..0533bb83 --- /dev/null +++ b/src/Coxeter_triangulation/include/gudhi/Functions/Cartesian_product.h @@ -0,0 +1,157 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef FUNCTIONS_CARTESIAN_PRODUCT_H_ +#define FUNCTIONS_CARTESIAN_PRODUCT_H_ + +#include <cstdlib> +#include <tuple> +#include <type_traits> // for std::enable_if +#include <cstdlib> // for std::size_t + +#include <Eigen/Dense> + +namespace Gudhi { + +namespace coxeter_triangulation { + +/* Get the domain dimension of the tuple of functions. + */ +template <std::size_t I = 0, typename... T> +inline typename std::enable_if<I == sizeof...(T), std::size_t>::type get_amb_d(const std::tuple<T...>& tuple) { + return 0; +} + +template <std::size_t I = 0, typename... T> +inline typename std::enable_if<I != sizeof...(T), std::size_t>::type get_amb_d(const std::tuple<T...>& tuple) { + return std::get<I>(tuple).amb_d() + get_amb_d<I + 1, T...>(tuple); +} + +/* Get the codomain dimension of the tuple of functions. + */ +template <std::size_t I = 0, typename... T> +inline typename std::enable_if<I == sizeof...(T), std::size_t>::type get_cod_d(const std::tuple<T...>& tuple) { + return 0; +} + +template <std::size_t I = 0, typename... T> +inline typename std::enable_if<I != sizeof...(T), std::size_t>::type get_cod_d(const std::tuple<T...>& tuple) { + return std::get<I>(tuple).cod_d() + get_cod_d<I + 1, T...>(tuple); +} + +/* Get the seed of the tuple of functions. + */ +template <std::size_t I = 0, typename... T> +inline typename std::enable_if<I == sizeof...(T), void>::type get_seed(const std::tuple<T...>& tuple, + Eigen::VectorXd& point, std::size_t i = 0) {} + +template <std::size_t I = 0, typename... T> +inline typename std::enable_if<I != sizeof...(T), void>::type get_seed(const std::tuple<T...>& tuple, + Eigen::VectorXd& point, std::size_t i = 0) { + const auto& f = std::get<I>(tuple); + std::size_t n = f.amb_d(); + Eigen::VectorXd seed = f.seed(); + for (std::size_t j = 0; j < n; ++j) point(i + j) = seed(j); + get_seed<I + 1, T...>(tuple, point, i + n); +} + +/* Get the seed of the tuple of functions. + */ +template <std::size_t I = 0, typename... T> +inline typename std::enable_if<I == sizeof...(T), void>::type get_value(const std::tuple<T...>& tuple, + const Eigen::VectorXd& x, + Eigen::VectorXd& point, std::size_t i = 0, + std::size_t j = 0) {} + +template <std::size_t I = 0, typename... T> +inline typename std::enable_if<I != sizeof...(T), void>::type get_value(const std::tuple<T...>& tuple, + const Eigen::VectorXd& x, + Eigen::VectorXd& point, std::size_t i = 0, + std::size_t j = 0) { + const auto& f = std::get<I>(tuple); + std::size_t n = f.amb_d(); + std::size_t k = f.cod_d(); + Eigen::VectorXd x_i(n); + for (std::size_t l = 0; l < n; ++l) x_i(l) = x(i + l); + Eigen::VectorXd res = f(x_i); + for (std::size_t l = 0; l < k; ++l) point(j + l) = res(l); + get_value<I + 1, T...>(tuple, x, point, i + n, j + k); +} + +/** + * \class Cartesian_product + * \brief Constructs the function the zero-set of which is the Cartesian product + * of the zero-sets of some given functions. + * + * \tparam Functions A pack template parameter for functions. All functions should be models of + * the concept FunctionForImplicitManifold. + */ +template <class... Functions> +struct Cartesian_product { + /** + * \brief Value of the function at a specified point. + * @param[in] p The input point. The dimension needs to coincide with the ambient dimension. + */ + Eigen::VectorXd operator()(const Eigen::VectorXd& p) const { + Eigen::VectorXd result(cod_d_); + get_value(function_tuple_, p, result, 0, 0); + return result; + } + + /** \brief Returns the domain (ambient) dimension. */ + std::size_t amb_d() const { return amb_d_; } + + /** \brief Returns the codomain dimension. */ + std::size_t cod_d() const { return cod_d_; } + + /** \brief Returns a point on the zero-set. */ + Eigen::VectorXd seed() const { + Eigen::VectorXd result(amb_d_); + get_seed(function_tuple_, result, 0); + return result; + } + + /** + * \brief Constructor of the Cartesian product function. + * + * @param[in] functions The functions the zero-sets of which are factors in the + * Cartesian product of the resulting function. + */ + Cartesian_product(const Functions&... functions) : function_tuple_(std::make_tuple(functions...)) { + amb_d_ = get_amb_d(function_tuple_); + cod_d_ = get_cod_d(function_tuple_); + } + + private: + std::tuple<Functions...> function_tuple_; + std::size_t amb_d_, cod_d_; +}; + +/** + * \brief Static constructor of a Cartesian product function. + * + * @param[in] functions The functions the zero-sets of which are factors in the + * Cartesian product of the resulting function. + * + * \tparam Functions A pack template parameter for functions. All functions should be models of + * the concept FunctionForImplicitManifold. + * + * \ingroup coxeter_triangulation + */ +template <typename... Functions> +Cartesian_product<Functions...> make_product_function(const Functions&... functions) { + return Cartesian_product<Functions...>(functions...); +} + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif diff --git a/src/Coxeter_triangulation/include/gudhi/Functions/Constant_function.h b/src/Coxeter_triangulation/include/gudhi/Functions/Constant_function.h new file mode 100644 index 00000000..0603afd8 --- /dev/null +++ b/src/Coxeter_triangulation/include/gudhi/Functions/Constant_function.h @@ -0,0 +1,64 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef FUNCTIONS_CONSTANT_FUNCTION_H_ +#define FUNCTIONS_CONSTANT_FUNCTION_H_ + +#include <cstdlib> // for std::size_t + +#include <Eigen/Dense> + +namespace Gudhi { + +namespace coxeter_triangulation { + +/** + * \class Constant_function + * \brief A class that encodes a constant function from R^d to R^k. + * This class does not have any implicit manifold in correspondence. + */ +struct Constant_function { + /** \brief Value of the function at a specified point. The value is constant. + * @param[in] p The input point. The dimension needs to coincide with the ambient dimension. + */ + Eigen::VectorXd operator()(const Eigen::VectorXd& p) const { + return value_; + } + + /** \brief Returns the domain dimension. Same as the ambient dimension of the sphere. */ + std::size_t amb_d() const { return d_; }; + + /** \brief Returns the codomain dimension. Same as the codimension of the sphere. */ + std::size_t cod_d() const { return k_; }; + + /** \brief No seed point is available. Throws an exception on evocation. */ + Eigen::VectorXd seed() const { throw "Seed invoked on a constant function.\n"; } + + Constant_function() {} + + /** + * \brief Constructor of a constant function from R^d to R^m. + * + * @param[in] d The domain dimension. + * @param[in] k The codomain dimension. + * @param[in] value The constant value of the function. + */ + Constant_function(std::size_t d, std::size_t k, const Eigen::VectorXd& value) : d_(d), k_(k), value_(value) {} + + private: + std::size_t d_, k_; + Eigen::VectorXd value_; +}; + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif diff --git a/src/Coxeter_triangulation/include/gudhi/Functions/Embed_in_Rd.h b/src/Coxeter_triangulation/include/gudhi/Functions/Embed_in_Rd.h new file mode 100644 index 00000000..e1fe868f --- /dev/null +++ b/src/Coxeter_triangulation/include/gudhi/Functions/Embed_in_Rd.h @@ -0,0 +1,93 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef FUNCTIONS_EMBED_IN_RD_H_ +#define FUNCTIONS_EMBED_IN_RD_H_ + +#include <cstdlib> // for std::size_t + +#include <Eigen/Dense> + +namespace Gudhi { + +namespace coxeter_triangulation { + +/** + * \class Embed_in_Rd + * \brief Embedding of an implicit manifold in a higher dimension. + * + * \tparam Function_ The function template parameter. Should be a model of + * the concept FunctionForImplicitManifold. + */ +template <class Function_> +struct Embed_in_Rd { + /** + * \brief Value of the function at a specified point. + * @param[in] p The input point. The dimension needs to coincide with the ambient dimension. + */ + Eigen::VectorXd operator()(const Eigen::VectorXd& p) const { + Eigen::VectorXd x = p; + Eigen::VectorXd x_k(fun_.amb_d()), x_rest(d_ - fun_.amb_d()); + for (std::size_t i = 0; i < fun_.amb_d(); ++i) x_k(i) = x(i); + for (std::size_t i = fun_.amb_d(); i < d_; ++i) x_rest(i - fun_.amb_d()) = x(i); + Eigen::VectorXd result = fun_(x_k); + result.conservativeResize(this->cod_d()); + for (std::size_t i = fun_.cod_d(); i < this->cod_d(); ++i) result(i) = x_rest(i - fun_.cod_d()); + return result; + } + + /** \brief Returns the domain (ambient) dimension. */ + std::size_t amb_d() const { return d_; } + + /** \brief Returns the codomain dimension. */ + std::size_t cod_d() const { return d_ - (fun_.amb_d() - fun_.cod_d()); } + + /** \brief Returns a point on the zero-set of the embedded function. */ + Eigen::VectorXd seed() const { + Eigen::VectorXd result = fun_.seed(); + result.conservativeResize(d_); + for (std::size_t l = fun_.amb_d(); l < d_; ++l) result(l) = 0; + return result; + } + + /** + * \brief Constructor of the embedding function. + * + * @param[in] function The function to be embedded in higher dimension. + * @param[in] d Embedding dimension. + */ + Embed_in_Rd(const Function_& function, std::size_t d) : fun_(function), d_(d) {} + + private: + Function_ fun_; + std::size_t d_; +}; + +/** + * \brief Static constructor of an embedding function. + * + * @param[in] function The function to be embedded in higher dimension. + * @param[in] d Embedding dimension. + * + * \tparam Function_ The function template parameter. Should be a model of + * the concept FunctionForImplicitManifold. + * + * \ingroup coxeter_triangulation + */ +template <class Function_> +Embed_in_Rd<Function_> make_embedding(const Function_& function, std::size_t d) { + return Embed_in_Rd<Function_>(function, d); +} + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif diff --git a/src/Coxeter_triangulation/include/gudhi/Functions/Function_Sm_in_Rd.h b/src/Coxeter_triangulation/include/gudhi/Functions/Function_Sm_in_Rd.h new file mode 100644 index 00000000..8911f990 --- /dev/null +++ b/src/Coxeter_triangulation/include/gudhi/Functions/Function_Sm_in_Rd.h @@ -0,0 +1,110 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef FUNCTIONS_FUNCTION_SM_IN_RD_H_ +#define FUNCTIONS_FUNCTION_SM_IN_RD_H_ + +#include <cstdlib> // for std::size_t + +#include <Eigen/Dense> + +namespace Gudhi { + +namespace coxeter_triangulation { + +/** + * \class Function_Sm_in_Rd + * \brief A class for the function that defines an m-dimensional implicit sphere embedded + * in the d-dimensional Euclidean space. + */ +struct Function_Sm_in_Rd { + /** \brief Value of the function at a specified point. + * @param[in] p The input point. The dimension needs to coincide with the ambient dimension. + */ + Eigen::VectorXd operator()(const Eigen::VectorXd& p) const { + Eigen::VectorXd x = p; + for (std::size_t i = 0; i < d_; ++i) x(i) -= center_[i]; + Eigen::VectorXd result = Eigen::VectorXd::Zero(k_); + for (std::size_t i = 0; i < m_ + 1; ++i) result(0) += x(i) * x(i); + result(0) -= r_ * r_; + for (std::size_t j = 1; j < k_; ++j) result(j) = x(m_ + j); + return result; + } + + /** \brief Returns the domain dimension. Same as the ambient dimension of the sphere. */ + std::size_t amb_d() const { return d_; }; + + /** \brief Returns the codomain dimension. Same as the codimension of the sphere. */ + std::size_t cod_d() const { return k_; }; + + /** \brief Returns a point on the sphere. */ + Eigen::VectorXd seed() const { + Eigen::VectorXd result = Eigen::VectorXd::Zero(d_); + result(0) += r_; + for (std::size_t i = 0; i < d_; ++i) result(i) += center_[i]; + return result; + } + + /** + * \brief Constructor of the function that defines an m-dimensional implicit sphere embedded + * in the d-dimensional Euclidean space. + * + * @param[in] r The radius of the sphere. + * @param[in] m The dimension of the sphere. + * @param[in] d The ambient dimension of the sphere. + * @param[in] center The center of the sphere. + */ + Function_Sm_in_Rd(double r, std::size_t m, std::size_t d, Eigen::VectorXd center) + : m_(m), k_(d - m), d_(d), r_(r), center_(center) {} + + /** + * \brief Constructor of the function that defines an m-dimensional implicit sphere embedded + * in the d-dimensional Euclidean space centered at the origin. + * + * @param[in] r The radius of the sphere. + * @param[in] m The dimension of the sphere. + * @param[in] d The ambient dimension of the sphere. + */ + Function_Sm_in_Rd(double r, std::size_t m, std::size_t d) + : m_(m), k_(d - m), d_(d), r_(r), center_(Eigen::VectorXd::Zero(d_)) {} + + /** + * \brief Constructor of the function that defines an m-dimensional implicit sphere embedded + * in the (m+1)-dimensional Euclidean space. + * + * @param[in] r The radius of the sphere. + * @param[in] m The dimension of the sphere. + * @param[in] center The center of the sphere. + */ + Function_Sm_in_Rd(double r, std::size_t m, Eigen::VectorXd center) + : m_(m), k_(1), d_(m_ + 1), r_(r), center_(center) {} + + /** + * \brief Constructor of the function that defines an m-dimensional implicit sphere embedded + * in the (m+1)-dimensional Euclidean space centered at the origin. + * + * @param[in] r The radius of the sphere. + * @param[in] m The dimension of the sphere. + */ + Function_Sm_in_Rd(double r, std::size_t m) : m_(m), k_(1), d_(m_ + 1), r_(r), center_(Eigen::VectorXd::Zero(d_)) {} + + Function_Sm_in_Rd(const Function_Sm_in_Rd& rhs) : Function_Sm_in_Rd(rhs.r_, rhs.m_, rhs.d_, rhs.center_) {} + + private: + std::size_t m_, k_, d_; + double r_; + Eigen::VectorXd center_; +}; + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif diff --git a/src/Coxeter_triangulation/include/gudhi/Functions/Function_affine_plane_in_Rd.h b/src/Coxeter_triangulation/include/gudhi/Functions/Function_affine_plane_in_Rd.h new file mode 100644 index 00000000..a9e2d507 --- /dev/null +++ b/src/Coxeter_triangulation/include/gudhi/Functions/Function_affine_plane_in_Rd.h @@ -0,0 +1,90 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef FUNCTIONS_FUNCTION_AFFINE_PLANE_IN_RD_H_ +#define FUNCTIONS_FUNCTION_AFFINE_PLANE_IN_RD_H_ + +#include <cstdlib> // for std::size_t + +#include <Eigen/Dense> + +namespace Gudhi { + +namespace coxeter_triangulation { + +/** + * \class Function_affine_plane_in_Rd + * \brief A class for the function that defines an m-dimensional implicit affine plane + * embedded in d-dimensional Euclidean space. + */ +struct Function_affine_plane_in_Rd { + /** + * \brief Value of the function at a specified point. + * @param[in] p The input point. The dimension needs to coincide with the ambient dimension. + */ + Eigen::VectorXd operator()(const Eigen::VectorXd& p) const { + Eigen::VectorXd result = normal_matrix_.transpose() * (p - off_); + return result; + } + + /** \brief Returns the domain dimension. Same as the ambient dimension of the sphere. */ + std::size_t amb_d() const { return d_; }; + + /** \brief Returns the codomain dimension. Same as the codimension of the sphere. */ + std::size_t cod_d() const { return k_; }; + + /** \brief Returns a point on the affine plane. */ + Eigen::VectorXd seed() const { + Eigen::VectorXd result = off_; + return result; + } + + /** + * \brief Constructor of the function that defines an m-dimensional implicit affine + * plane in the d-dimensional Euclidean space. + * + * @param[in] normal_matrix A normal matrix of the affine plane. The number of rows should + * correspond to the ambient dimension, the number of columns should correspond to + * the size of the normal basis (codimension). + * @param[in] offset The offset vector of the affine plane. + * The dimension of the vector should be the ambient dimension of the manifold. + */ + Function_affine_plane_in_Rd(const Eigen::MatrixXd& normal_matrix, const Eigen::VectorXd& offset) + : normal_matrix_(normal_matrix), d_(normal_matrix.rows()), k_(normal_matrix.cols()), off_(offset) { + normal_matrix_.colwise().normalize(); + } + + /** + * \brief Constructor of the function that defines an m-dimensional implicit affine + * plane in the d-dimensional Euclidean space that passes through origin. + * + * @param[in] normal_matrix A normal matrix of the affine plane. The number of rows should + * correspond to the ambient dimension, the number of columns should correspond to + * the size of the normal basis (codimension). + */ + Function_affine_plane_in_Rd(const Eigen::MatrixXd& normal_matrix) + : normal_matrix_(normal_matrix), + d_(normal_matrix.rows()), + k_(normal_matrix.cols()), + off_(Eigen::VectorXd::Zero(d_)) { + normal_matrix_.colwise().normalize(); + } + + private: + Eigen::MatrixXd normal_matrix_; + std::size_t d_, k_; + Eigen::VectorXd off_; +}; + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif diff --git a/src/Coxeter_triangulation/include/gudhi/Functions/Function_chair_in_R3.h b/src/Coxeter_triangulation/include/gudhi/Functions/Function_chair_in_R3.h new file mode 100644 index 00000000..620446da --- /dev/null +++ b/src/Coxeter_triangulation/include/gudhi/Functions/Function_chair_in_R3.h @@ -0,0 +1,80 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef FUNCTIONS_FUNCTION_CHAIR_IN_R3_H_ +#define FUNCTIONS_FUNCTION_CHAIR_IN_R3_H_ + +#include <cstdlib> // for std::size_t +#include <cmath> // for std::pow + +#include <Eigen/Dense> + +namespace Gudhi { + +namespace coxeter_triangulation { + +/** + * \class Function_chair_in_R3 + * \brief A class that encodes the function, the zero-set of which is a so-called + * "chair" surface embedded in R^3. + */ +struct Function_chair_in_R3 { + /** + * \brief Value of the function at a specified point. + * @param[in] p The input point. The dimension needs to coincide with the ambient dimension. + */ + Eigen::VectorXd operator()(const Eigen::VectorXd& p) const { + double x = p(0) - off_[0], y = p(1) - off_[1], z = p(2) - off_[2]; + Eigen::VectorXd result(cod_d()); + result(0) = std::pow(x * x + y * y + z * z - a_ * k_ * k_, 2) - + b_ * ((z - k_) * (z - k_) - 2 * x * x) * ((z + k_) * (z + k_) - 2 * y * y); + return result; + } + + /** \brief Returns the domain (ambient) dimension. */ + std::size_t amb_d() const { return 3; } + + /** \brief Returns the codomain dimension. */ + std::size_t cod_d() const { return 1; } + + /** \brief Returns a point on the surface. */ + Eigen::VectorXd seed() const { + double t1 = a_ - b_; + double discr = t1 * t1 - (1.0 - b_) * (a_ * a_ - b_); + double z0 = k_ * std::sqrt((t1 + std::sqrt(discr)) / (1 - b_)); + Eigen::Vector3d result(off_[0], off_[1], z0 + off_[2]); + return result; + } + + /** + * \brief Constructor of the function that defines the 'chair' surface + * embedded in R^3. + * + * @param[in] a A numerical parameter. + * @param[in] b A numerical parameter. + * @param[in] k A numerical parameter. + * @param[in] off Offset vector. + */ + Function_chair_in_R3(double a = 0.8, double b = 0.4, double k = 1.0, Eigen::Vector3d off = Eigen::Vector3d::Zero()) + : a_(a), b_(b), k_(k), off_(off) {} + + protected: + double a_, b_, k_; + Eigen::Vector3d off_; +}; + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif + +// (x^2 + y^2 + z^2 - a*k^2)^2 - b*((z-k)^2 - 2*x^2)*((z+k)^2 - 2*y^2) +// sqrt(k/(1-b))*sqrt(a-b + sqrt((a-b)^2 - (1-b)*(a^2 - b)*k^2)) diff --git a/src/Coxeter_triangulation/include/gudhi/Functions/Function_iron_in_R3.h b/src/Coxeter_triangulation/include/gudhi/Functions/Function_iron_in_R3.h new file mode 100644 index 00000000..f73c4280 --- /dev/null +++ b/src/Coxeter_triangulation/include/gudhi/Functions/Function_iron_in_R3.h @@ -0,0 +1,69 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef FUNCTIONS_FUNCTION_IRON_IN_R3_H_ +#define FUNCTIONS_FUNCTION_IRON_IN_R3_H_ + +#include <cstdlib> // for std::size_t +#include <cmath> // for std::pow + +#include <Eigen/Dense> + +namespace Gudhi { + +namespace coxeter_triangulation { + +/** + * \class Function_iron_in_R3 + * \brief A class that encodes the function, the zero-set of which is a surface + * embedded in R^3 that ressembles an iron. + */ +struct Function_iron_in_R3 { + /** + * \brief Value of the function at a specified point. + * @param[in] p The input point. The dimension needs to coincide with the ambient dimension. + */ + Eigen::VectorXd operator()(const Eigen::VectorXd& p) const { + double x = p(0), y = p(1), z = p(2); + Eigen::VectorXd result(cod_d()); + result(0) = -std::pow(x, 6) / 300. - std::pow(y, 6) / 300. - std::pow(z, 6) / 300. + x * y * y * z / 2.1 + y * y + + std::pow(z - 2, 4) - 1; + return result; + } + + /** \brief Returns the domain (ambient) dimension. */ + std::size_t amb_d() const { return 3; }; + + /** \brief Returns the codomain dimension. */ + std::size_t cod_d() const { return 1; }; + + /** \brief Returns a point on the surface. */ + Eigen::VectorXd seed() const { + Eigen::Vector3d result(std::pow(4500, 1. / 6), 0, 0); + return result; + } + + /** + * \brief Constructor of the function that defines a surface embedded in R^3 + * that ressembles an iron. + * + * @param[in] off Offset vector. + */ + Function_iron_in_R3(Eigen::Vector3d off = Eigen::Vector3d::Zero()) : off_(off) {} + + private: + Eigen::Vector3d off_; +}; + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif diff --git a/src/Coxeter_triangulation/include/gudhi/Functions/Function_lemniscate_revolution_in_R3.h b/src/Coxeter_triangulation/include/gudhi/Functions/Function_lemniscate_revolution_in_R3.h new file mode 100644 index 00000000..beb41e00 --- /dev/null +++ b/src/Coxeter_triangulation/include/gudhi/Functions/Function_lemniscate_revolution_in_R3.h @@ -0,0 +1,85 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef FUNCTIONS_FUNCTION_LEMNISCATE_REVOLUTION_IN_R3_H_ +#define FUNCTIONS_FUNCTION_LEMNISCATE_REVOLUTION_IN_R3_H_ + +#include <cstdlib> // for std::size_t +#include <cmath> // for std::sqrt + +#include <Eigen/Dense> + +namespace Gudhi { + +namespace coxeter_triangulation { + +/** + * \class Function_lemniscate_revolution_in_R3 + * \brief A class that encodes the function, the zero-set of which is a surface of revolution + * around the x axis based on the lemniscate of Bernoulli embedded in R^3. + */ +struct Function_lemniscate_revolution_in_R3 { + /** + * \brief Value of the function at a specified point. + * @param[in] p The input point. The dimension needs to coincide with the ambient dimension. + */ + Eigen::VectorXd operator()(const Eigen::VectorXd& p) const { + double x = p(0) - off_[0], y = p(1) - off_[1], z = p(2) - off_[2]; + Eigen::VectorXd result(cod_d()); + double x2 = x * x, y2 = y * y, z2 = z * z, a2 = a_ * a_; + double t1 = x2 + y2 + z2; + result(0) = t1 * t1 - 2 * a2 * (x2 - y2 - z2); + return result; + } + + /** \brief Returns the (ambient) domain dimension.*/ + std::size_t amb_d() const { return 3; }; + + /** \brief Returns the codomain dimension. */ + std::size_t cod_d() const { return 1; }; + + /** \brief Returns a point on the surface. This seed point is only one of + * two necessary seed points for the manifold tracing algorithm. + * See the method seed2() for the other point. + */ + Eigen::VectorXd seed() const { + Eigen::Vector3d result(std::sqrt(2 * a_) + off_[0], off_[1], off_[2]); + return result; + } + + /** \brief Returns a point on the surface. This seed point is only one of + * two necessary seed points for the manifold tracing algorithm. + * See the method seed() for the other point. + */ + Eigen::VectorXd seed2() const { + Eigen::Vector3d result(-std::sqrt(2 * a_) + off_[0], off_[1], off_[2]); + return result; + } + + /** + * \brief Constructor of the function that defines a surface of revolution + * around the x axis based on the lemniscate of Bernoulli embedded in R^3. + * + * @param[in] a A numerical parameter. + * @param[in] off Offset vector. + */ + Function_lemniscate_revolution_in_R3(double a = 1, Eigen::Vector3d off = Eigen::Vector3d::Zero()) + : a_(a), off_(off) {} + + private: + double a_; + Eigen::Vector3d off_; +}; + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif diff --git a/src/Coxeter_triangulation/include/gudhi/Functions/Function_moment_curve_in_Rd.h b/src/Coxeter_triangulation/include/gudhi/Functions/Function_moment_curve_in_Rd.h new file mode 100644 index 00000000..f315d794 --- /dev/null +++ b/src/Coxeter_triangulation/include/gudhi/Functions/Function_moment_curve_in_Rd.h @@ -0,0 +1,84 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef FUNCTIONS_FUNCTION_MOMENT_CURVE_IN_RD_H_ +#define FUNCTIONS_FUNCTION_MOMENT_CURVE_IN_RD_H_ + +#include <cstdlib> // for std::size_t + +#include <Eigen/Dense> + +namespace Gudhi { + +namespace coxeter_triangulation { + +/** + * \class Function_moment_curve_in_Rd + * \brief A class for the function that defines an implicit moment curve + * in the d-dimensional Euclidean space. + */ +struct Function_moment_curve_in_Rd { + /** \brief Value of the function at a specified point. + * @param[in] p The input point. The dimension needs to coincide with the ambient dimension. + */ + Eigen::VectorXd operator()(const Eigen::VectorXd& p) const { + Eigen::VectorXd result(k_); + for (std::size_t i = 1; i < d_; ++i) result(i - 1) = p(i) - p(0) * p(i - 1); + return result; + } + + /** \brief Returns the domain (ambient) dimension.. */ + std::size_t amb_d() const { return d_; }; + + /** \brief Returns the codomain dimension. */ + std::size_t cod_d() const { return k_; }; + + /** \brief Returns a point on the moment curve. */ + Eigen::VectorXd seed() const { + Eigen::VectorXd result = Eigen::VectorXd::Zero(d_); + return result; + } + + /** @brief Returns the radius of the moment curve. */ + double get_radius() const{ + return r_; + } + + /** + * \brief Constructor of the function that defines an implicit moment curve + * in the d-dimensional Euclidean space. + * + * @param[in] r Numerical parameter. + * @param[in] d The ambient dimension. + */ + Function_moment_curve_in_Rd(double r, std::size_t d) : k_(d - 1), d_(d), r_(r) {} + + /** + * \brief Constructor of the function that defines an implicit moment curve + * in the d-dimensional Euclidean space. + * + * @param[in] r Numerical parameter. + * @param[in] d The ambient dimension. + * @param[in] offset The offset of the moment curve. + */ + Function_moment_curve_in_Rd(double r, std::size_t d, Eigen::VectorXd& offset) + : k_(d - 1), d_(d), r_(r), off_(offset) {} + + private: + std::size_t k_, d_; + double r_; + Eigen::VectorXd off_; +}; + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif diff --git a/src/Coxeter_triangulation/include/gudhi/Functions/Function_torus_in_R3.h b/src/Coxeter_triangulation/include/gudhi/Functions/Function_torus_in_R3.h new file mode 100644 index 00000000..b54d3c74 --- /dev/null +++ b/src/Coxeter_triangulation/include/gudhi/Functions/Function_torus_in_R3.h @@ -0,0 +1,71 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef FUNCTIONS_FUNCTION_TORUS_IN_R3_H_ +#define FUNCTIONS_FUNCTION_TORUS_IN_R3_H_ + +#include <cstdlib> // for std::size_t +#include <cmath> // for std::sqrt + +#include <Eigen/Dense> + +namespace Gudhi { + +namespace coxeter_triangulation { + +/** + * \class Function_torus_in_R3 + * \brief A class that encodes the function, the zero-set of which is a torus + * surface embedded in R^3. + */ +struct Function_torus_in_R3 { + /** + * \brief Value of the function at a specified point. + * @param[in] p The input point. The dimension needs to coincide with the ambient dimension. + */ + Eigen::VectorXd operator()(const Eigen::VectorXd& p) const { + double x = p(0) - off_[0], y = p(1) - off_[1], z = p(2) - off_[2]; + Eigen::VectorXd result(cod_d()); + result(0) = (z * z + (std::sqrt(x * x + y * y) - r_) * (std::sqrt(x * x + y * y) - r_) - R_ * R_); + return result; + } + + /** \brief Returns the domain (ambient) dimension. */ + std::size_t amb_d() const { return 3; }; + + /** \brief Returns the codomain dimension. */ + std::size_t cod_d() const { return 1; }; + + /** \brief Returns a point on the surface. */ + Eigen::VectorXd seed() const { + Eigen::Vector3d result(R_ + r_ + off_[0], off_[1], off_[2]); + return result; + } + + /** + * \brief Constructor of the function that defines a torus embedded in R^3. + * + * @param[in] R The outer radius of the torus. + * @param[in] r The inner radius of the torus. + * @param[in] off Offset vector. + */ + Function_torus_in_R3(double R = 1, double r = 0.5, Eigen::Vector3d off = Eigen::Vector3d::Zero()) + : R_(R), r_(r), off_(off) {} + + private: + double R_, r_; + Eigen::Vector3d off_; +}; + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif diff --git a/src/Coxeter_triangulation/include/gudhi/Functions/Function_whitney_umbrella_in_R3.h b/src/Coxeter_triangulation/include/gudhi/Functions/Function_whitney_umbrella_in_R3.h new file mode 100644 index 00000000..df1f1eec --- /dev/null +++ b/src/Coxeter_triangulation/include/gudhi/Functions/Function_whitney_umbrella_in_R3.h @@ -0,0 +1,78 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef FUNCTIONS_FUNCTION_WHITNEY_UMBRELLA_IN_R3_H_ +#define FUNCTIONS_FUNCTION_WHITNEY_UMBRELLA_IN_R3_H_ + +#include <cstdlib> // for std::size_t + +#include <Eigen/Dense> + +namespace Gudhi { + +namespace coxeter_triangulation { + +/** + * \class Function_whitney_umbrella_in_R3 + * \brief A class that encodes the function, the zero-set of which is the Whitney umbrella + * surface embedded in R^3. + */ +struct Function_whitney_umbrella_in_R3 { + /** + * \brief Value of the function at a specified point. + * @param[in] p The input point. The dimension needs to coincide with the ambient dimension. + */ + Eigen::VectorXd operator()(const Eigen::VectorXd& p) const { + double x = p(0) - off_[0], y = p(1) - off_[1], z = p(2) - off_[2]; + Eigen::VectorXd result(cod_d()); + result(0) = x * x - y * y * z; + return result; + } + + /** \brief Returns the (ambient) domain dimension.*/ + std::size_t amb_d() const { return 3; }; + + /** \brief Returns the codomain dimension. */ + std::size_t cod_d() const { return 1; }; + + /** \brief Returns a point on the surface. This seed point is only one of + * two necessary seed points for the manifold tracing algorithm. + * See the method seed2() for the other point. + */ + Eigen::VectorXd seed() const { + Eigen::Vector3d result(1 + off_[0], 1 + off_[1], 1 + off_[2]); + return result; + } + + /** \brief Returns a point on the surface. This seed point is only one of + * two necessary seed points for the manifold tracing algorithm. + * See the method seed() for the other point. + */ + Eigen::VectorXd seed2() const { + Eigen::Vector3d result(-1 + off_[0], -1 + off_[1], 1 + off_[2]); + return result; + } + + /** + * \brief Constructor of the function that defines the Whitney umbrella in R^3. + * + * @param[in] off Offset vector. + */ + Function_whitney_umbrella_in_R3(Eigen::Vector3d off = Eigen::Vector3d::Zero()) : off_(off) {} + + private: + Eigen::Vector3d off_; +}; + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif diff --git a/src/Coxeter_triangulation/include/gudhi/Functions/Linear_transformation.h b/src/Coxeter_triangulation/include/gudhi/Functions/Linear_transformation.h new file mode 100644 index 00000000..82e25bb9 --- /dev/null +++ b/src/Coxeter_triangulation/include/gudhi/Functions/Linear_transformation.h @@ -0,0 +1,88 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef FUNCTIONS_LINEAR_TRANSFORMATION_H_ +#define FUNCTIONS_LINEAR_TRANSFORMATION_H_ + +#include <cstdlib> // for std::size_t + +#include <Eigen/Dense> + +namespace Gudhi { + +namespace coxeter_triangulation { + +/** \class Linear_transformation + * \brief Transforms the zero-set of the function by a given linear transformation. + * The underlying function corresponds to f(M*x), where M is the transformation matrix. + * + * \tparam Function_ The function template parameter. Should be a model of + * the concept FunctionForImplicitManifold. + */ +template <class Function_> +struct Linear_transformation { + /** + * \brief Value of the function at a specified point. + * @param[in] p The input point. The dimension needs to coincide with the ambient dimension. + */ + Eigen::VectorXd operator()(const Eigen::VectorXd& p) const { + Eigen::VectorXd result = fun_(matrix_.householderQr().solve(p)); + return result; + } + + /** \brief Returns the domain (ambient) dimension. */ + std::size_t amb_d() const { return fun_.amb_d(); } + + /** \brief Returns the codomain dimension. */ + std::size_t cod_d() const { return fun_.cod_d(); } + + /** \brief Returns a point on the zero-set. */ + Eigen::VectorXd seed() const { + Eigen::VectorXd result = fun_.seed(); + result = matrix_ * result; + return result; + } + + /** + * \brief Constructor of a linearly transformed function. + * + * @param[in] function The function to be linearly transformed. + * @param[in] matrix The transformation matrix. Its dimension should be d*d, + * where d is the domain (ambient) dimension of 'function'. + */ + Linear_transformation(const Function_& function, const Eigen::MatrixXd& matrix) : fun_(function), matrix_(matrix) {} + + private: + Function_ fun_; + Eigen::MatrixXd matrix_; +}; + +/** + * \brief Static constructor of a linearly transformed function. + * + * @param[in] function The function to be linearly transformed. + * @param[in] matrix The transformation matrix. Its dimension should be d*d, + * where d is the domain (ambient) dimension of 'function'. + * + * \tparam Function_ The function template parameter. Should be a model of + * the concept FunctionForImplicitManifold. + * + * \ingroup coxeter_triangulation + */ +template <class Function_> +Linear_transformation<Function_> make_linear_transformation(const Function_& function, const Eigen::MatrixXd& matrix) { + return Linear_transformation<Function_>(function, matrix); +} + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif diff --git a/src/Coxeter_triangulation/include/gudhi/Functions/Negation.h b/src/Coxeter_triangulation/include/gudhi/Functions/Negation.h new file mode 100644 index 00000000..fdf07f27 --- /dev/null +++ b/src/Coxeter_triangulation/include/gudhi/Functions/Negation.h @@ -0,0 +1,84 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef FUNCTIONS_NEGATION_H_ +#define FUNCTIONS_NEGATION_H_ + +#include <cstdlib> // for std::size_t + +#include <Eigen/Dense> + +namespace Gudhi { + +namespace coxeter_triangulation { + +/** + *\class Negation + * \brief Constructs the "minus" function. The zero-set is the same, but + * the values at other points are the negative of their original value. + * + * \tparam Function_ The function template parameter. Should be a model of + * the concept FunctionForImplicitManifold. + */ +template <class Function_> +struct Negation { + /** + * \brief Value of the function at a specified point. + * @param[in] p The input point. The dimension needs to coincide with the ambient dimension. + */ + Eigen::VectorXd operator()(const Eigen::VectorXd& p) const { + Eigen::VectorXd result = -fun_(p); + return result; + } + + /** \brief Returns the domain (ambient) dimension. */ + std::size_t amb_d() const { return fun_.amb_d(); } + + /** \brief Returns the codomain dimension. */ + std::size_t cod_d() const { return fun_.cod_d(); } + + /** \brief Returns a point on the zero-set. */ + Eigen::VectorXd seed() const { + Eigen::VectorXd result = fun_.seed(); + return result; + } + + /** + * \brief Constructor of the negative function. + * + * @param[in] function The function to be negated. + */ + Negation(const Function_& function) : fun_(function) {} + + private: + Function_ fun_; +}; + +/** + * \brief Static constructor of the negative function. + * + * @param[in] function The function to be translated. + * domain (ambient) dimension of 'function'. + * + * \tparam Function_ The function template parameter. Should be a model of + * the concept FunctionForImplicitManifold. + * + * \ingroup coxeter_triangulation + */ +template <class Function_> +Negation<Function_> negation(const Function_& function) { + return Negation<Function_>(function); +} + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif diff --git a/src/Coxeter_triangulation/include/gudhi/Functions/PL_approximation.h b/src/Coxeter_triangulation/include/gudhi/Functions/PL_approximation.h new file mode 100644 index 00000000..22071d6d --- /dev/null +++ b/src/Coxeter_triangulation/include/gudhi/Functions/PL_approximation.h @@ -0,0 +1,111 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef FUNCTIONS_PL_APPROXIMATION_H_ +#define FUNCTIONS_PL_APPROXIMATION_H_ + +#include <cstdlib> // for std::size_t + +#include <Eigen/Dense> + +namespace Gudhi { + +namespace coxeter_triangulation { + +/** + * \class PL_approximation + * \brief Constructs a piecewise-linear approximation of a function induced by + * an ambient triangulation. + * + * \tparam Function_ The function template parameter. Should be a model of + * the concept FunctionForImplicitManifold. + * \tparam Triangulation The triangulation template parameter. Should be a model of + * the concept TriangulationForManifoldTracing. + */ +template <class Function_, class Triangulation_> +struct PL_approximation { + /** + * \brief Value of the function at a specified point. + * @param[in] p The input point. The dimension needs to coincide with the ambient dimension. + */ + Eigen::VectorXd operator()(const Eigen::VectorXd& p) const { + std::size_t cod_d = this->cod_d(); + std::size_t amb_d = this->amb_d(); + auto s = tr_.locate_point(p); + Eigen::MatrixXd matrix(cod_d, s.dimension() + 1); + Eigen::MatrixXd vertex_matrix(amb_d + 1, s.dimension() + 1); + for (std::size_t i = 0; i < s.dimension() + 1; ++i) vertex_matrix(0, i) = 1; + std::size_t j = 0; + for (auto v : s.vertex_range()) { + Eigen::VectorXd pt_v = tr_.cartesian_coordinates(v); + Eigen::VectorXd fun_v = fun_(pt_v); + for (std::size_t i = 1; i < amb_d + 1; ++i) vertex_matrix(i, j) = pt_v(i - 1); + for (std::size_t i = 0; i < cod_d; ++i) matrix(i, j) = fun_v(i); + j++; + } + assert(j == s.dimension() + 1); + Eigen::VectorXd z(amb_d + 1); + z(0) = 1; + for (std::size_t i = 1; i < amb_d + 1; ++i) z(i) = p(i - 1); + Eigen::VectorXd lambda = vertex_matrix.colPivHouseholderQr().solve(z); + Eigen::VectorXd result = matrix * lambda; + return result; + } + + /** \brief Returns the domain (ambient) dimension. */ + std::size_t amb_d() const { return fun_.amb_d(); } + + /** \brief Returns the codomain dimension. */ + std::size_t cod_d() const { return fun_.cod_d(); } + + /** \brief Returns a point on the zero-set. */ + Eigen::VectorXd seed() const { + // TODO: not finished. Should use an oracle. + return Eigen::VectorXd(amb_d()); + } + + /** + * \brief Constructor of the piecewise-linear approximation of a function + * induced by an ambient triangulation. + * + * @param[in] function The function. + * @param[in] triangulation The ambient triangulation. + */ + PL_approximation(const Function_& function, const Triangulation_& triangulation) + : fun_(function), tr_(triangulation) {} + + private: + Function_ fun_; + Triangulation_ tr_; +}; + +/** + * \brief Static constructor of the piecewise-linear approximation of a function + * induced by an ambient triangulation. + * + * @param[in] function The function. + * @param[in] triangulation The ambient triangulation. + * + * \tparam Function_ The function template parameter. Should be a model of + * the concept FunctionForImplicitManifold. + * + * \ingroup coxeter_triangulation + */ +template <class Function_, class Triangulation_> +PL_approximation<Function_, Triangulation_> make_pl_approximation(const Function_& function, + const Triangulation_& triangulation) { + return PL_approximation<Function_, Triangulation_>(function, triangulation); +} + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif diff --git a/src/Coxeter_triangulation/include/gudhi/Functions/Translate.h b/src/Coxeter_triangulation/include/gudhi/Functions/Translate.h new file mode 100644 index 00000000..cbe65abe --- /dev/null +++ b/src/Coxeter_triangulation/include/gudhi/Functions/Translate.h @@ -0,0 +1,89 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef FUNCTIONS_TRANSLATE_H_ +#define FUNCTIONS_TRANSLATE_H_ + +#include <cstdlib> // for std::size_t + +#include <Eigen/Dense> + +namespace Gudhi { + +namespace coxeter_triangulation { + +/** + * \class Translate + * \brief Translates the zero-set of the function by a vector. + * The underlying function corresponds to f(x-off), where off is the offset vector. + * + * \tparam Function_ The function template parameter. Should be a model of + * the concept FunctionForImplicitManifold. + */ +template <class Function_> +struct Translate { + /** + * \brief Value of the function at a specified point. + * @param[in] p The input point. The dimension needs to coincide with the ambient dimension. + */ + Eigen::VectorXd operator()(const Eigen::VectorXd& p) const { + Eigen::VectorXd result = fun_(p - off_); + return result; + } + + /** \brief Returns the domain (ambient) dimension. */ + std::size_t amb_d() const { return fun_.amb_d(); } + + /** \brief Returns the codomain dimension. */ + std::size_t cod_d() const { return fun_.cod_d(); } + + /** \brief Returns a point on the zero-set. */ + Eigen::VectorXd seed() const { + Eigen::VectorXd result = fun_.seed(); + result += off_; + return result; + } + + /** + * \brief Constructor of the translated function. + * + * @param[in] function The function to be translated. + * @param[in] off The offset vector. The dimension should correspond to the + * domain (ambient) dimension of 'function'. + */ + Translate(const Function_& function, const Eigen::VectorXd& off) : fun_(function), off_(off) {} + + private: + Function_ fun_; + Eigen::VectorXd off_; +}; + +/** + * \brief Static constructor of a translated function. + * + * @param[in] function The function to be translated. + * @param[in] off The offset vector. The dimension should correspond to the + * domain (ambient) dimension of 'function'. + * + * \tparam Function_ The function template parameter. Should be a model of + * the concept FunctionForImplicitManifold. + * + * \ingroup coxeter_triangulation + */ +template <class Function_> +Translate<Function_> translate(const Function_& function, Eigen::VectorXd off) { + return Translate<Function_>(function, off); +} + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif diff --git a/src/Coxeter_triangulation/include/gudhi/Functions/random_orthogonal_matrix.h b/src/Coxeter_triangulation/include/gudhi/Functions/random_orthogonal_matrix.h new file mode 100644 index 00000000..6a896e94 --- /dev/null +++ b/src/Coxeter_triangulation/include/gudhi/Functions/random_orthogonal_matrix.h @@ -0,0 +1,72 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef FUNCTIONS_RANDOM_ORTHOGONAL_MATRIX_H_ +#define FUNCTIONS_RANDOM_ORTHOGONAL_MATRIX_H_ + +#include <cstdlib> // for std::size_t +#include <cmath> // for std::cos, std::sin +#include <random> // for std::uniform_real_distribution, std::random_device + +#include <Eigen/Dense> +#include <Eigen/Sparse> +#include <Eigen/SVD> + +#include <CGAL/Epick_d.h> +#include <CGAL/point_generators_d.h> + +#include <boost/math/constants/constants.hpp> // for PI value + +namespace Gudhi { + +namespace coxeter_triangulation { + +/** \brief Generates a uniform random orthogonal matrix using the "subgroup algorithm" by + * Diaconis & Shashahani. + * \details Taken from https://en.wikipedia.org/wiki/Rotation_matrix#Uniform_random_rotation_matrices. + * The idea: take a random rotation matrix of dimension d-1, embed it + * as a d*d matrix M with the last column (0,...,0,1). + * Pick a random vector v on a sphere S^d. rotate the matrix M so that its last column is v. + * The determinant of the matrix can be either 1 or -1 + */ +// Note: the householderQR operation at the end seems to take a lot of time at compilation. +// The CGAL headers are another source of long compilation time. +Eigen::MatrixXd random_orthogonal_matrix(std::size_t d) { + typedef CGAL::Epick_d<CGAL::Dynamic_dimension_tag> Kernel; + typedef typename Kernel::Point_d Point_d; + if (d == 1) return Eigen::VectorXd::Constant(1, 1.0); + if (d == 2) { + // 0. < alpha < 2 Pi + std::uniform_real_distribution<double> unif(0., 2 * boost::math::constants::pi<double>()); + std::random_device rand_dev; + std::mt19937 rand_engine(rand_dev()); + double alpha = unif(rand_engine); + + Eigen::Matrix2d rot; + rot << std::cos(alpha), -std::sin(alpha), std::sin(alpha), cos(alpha); + return rot; + } + Eigen::MatrixXd low_dim_rot = random_orthogonal_matrix(d - 1); + Eigen::MatrixXd rot(d, d); + Point_d v = *CGAL::Random_points_on_sphere_d<Point_d>(d, 1); + for (std::size_t i = 0; i < d; ++i) rot(i, 0) = v[i]; + for (std::size_t i = 0; i < d - 1; ++i) + for (std::size_t j = 1; j < d - 1; ++j) rot(i, j) = low_dim_rot(i, j - 1); + for (std::size_t j = 1; j < d; ++j) rot(d - 1, j) = 0; + rot = rot.householderQr() + .householderQ(); // a way to do Gram-Schmidt, see https://forum.kde.org/viewtopic.php?f=74&t=118568#p297246 + return rot; +} + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif diff --git a/src/Coxeter_triangulation/include/gudhi/IO/Mesh_medit.h b/src/Coxeter_triangulation/include/gudhi/IO/Mesh_medit.h new file mode 100644 index 00000000..ca08f629 --- /dev/null +++ b/src/Coxeter_triangulation/include/gudhi/IO/Mesh_medit.h @@ -0,0 +1,60 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef IO_MESH_MEDIT_H_ +#define IO_MESH_MEDIT_H_ + +#include <Eigen/Dense> + +#include <vector> +#include <utility> // for std::pair + +namespace Gudhi { + +namespace coxeter_triangulation { + +/** \class Mesh_medit + * \brief Structure to store a mesh that can be output in Medit .mesh file format + * using the output_meshes_to_medit method. + * + * \ingroup coxeter_triangulation + */ +struct Mesh_medit { + /** \brief Type of a range of vertices. */ + typedef std::vector<Eigen::VectorXd> Vertex_points; + /** \brief Type of a mesh element. + * A pair consisting of a vector of vertex indices of type std::size_t + * and of an integer that represents the common reference number for + * the mesh elements of this type. */ + typedef std::pair<std::vector<std::size_t>, std::size_t> Mesh_element; + /** \brief Type of a range of mesh elements. */ + typedef std::vector<Mesh_element> Mesh_elements; + /** \brief Type of a range of scalar field . */ + typedef std::vector<double> Scalar_field_range; + + /** \brief Range of vertices of type Eigen::VectorXd to output. */ + Vertex_points vertex_points; + /** \brief Range of edges. */ + Mesh_elements edges; + /** \brief Range of triangles. */ + Mesh_elements triangles; + /** \brief Range of tetrahedra. */ + Mesh_elements tetrahedra; + /** \brief Range of scalar values over triangles. */ + Scalar_field_range triangles_scalar_range; + /** \brief Range of scalar values over tetrahedra. */ + Scalar_field_range tetrahedra_scalar_range; +}; + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif diff --git a/src/Coxeter_triangulation/include/gudhi/IO/build_mesh_from_cell_complex.h b/src/Coxeter_triangulation/include/gudhi/IO/build_mesh_from_cell_complex.h new file mode 100644 index 00000000..9750f366 --- /dev/null +++ b/src/Coxeter_triangulation/include/gudhi/IO/build_mesh_from_cell_complex.h @@ -0,0 +1,171 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef IO_BUILD_MESH_FROM_CELL_COMPLEX_H_ +#define IO_BUILD_MESH_FROM_CELL_COMPLEX_H_ + +#include <gudhi/IO/output_debug_traces_to_html.h> // for DEBUG_TRACES +#include <gudhi/IO/Mesh_medit.h> + +#include <Eigen/Dense> + +#include <cstdlib> // for std::size_t +#include <map> +#include <set> +#include <string> +#include <utility> // for std::make_pair +#include <algorithm> // for std::min + +namespace Gudhi { + +namespace coxeter_triangulation { + +struct Configuration { + Configuration(bool t_edges, bool t_triangles, bool t_tetrahedra, std::size_t r_edges, std::size_t r_triangles, + std::size_t r_tetrahedra) + : toggle_edges(t_edges), + toggle_triangles(t_triangles), + toggle_tetrahedra(t_tetrahedra), + ref_edges(r_edges), + ref_triangles(r_triangles), + ref_tetrahedra(r_tetrahedra) {} + + Configuration() {} + + bool toggle_edges = true, toggle_triangles = true, toggle_tetrahedra = true; + std::size_t ref_edges = 1, ref_triangles = 1, ref_tetrahedra = 1; +}; + +template <class Hasse_cell, class Simplex_cell_map> +void populate_mesh(Mesh_medit& output, Simplex_cell_map& sc_map, Configuration configuration, std::size_t amb_d, + std::map<Hasse_cell*, std::size_t> vi_map) { + using Mesh_element_vertices = Mesh_medit::Mesh_elements::value_type::first_type; + std::map<Hasse_cell*, std::size_t> ci_map; + std::size_t index = vi_map.size() + 1; // current size of output.vertex_points + if (sc_map.size() >= 3) + for (const auto& sc_pair : sc_map[2]) { + Eigen::VectorXd barycenter = Eigen::VectorXd::Zero(amb_d); + std::set<std::size_t> vertex_indices; + Hasse_cell* cell = sc_pair.second; + for (const auto& ei_pair : cell->get_boundary()) + for (const auto& vi_pair : ei_pair.first->get_boundary()) vertex_indices.emplace(vi_map[vi_pair.first]); + for (const std::size_t& v : vertex_indices) barycenter += output.vertex_points[v - 1]; + ci_map.emplace(cell, index++); + output.vertex_points.emplace_back((1. / vertex_indices.size()) * barycenter); +#ifdef DEBUG_TRACES + std::string vlist = " (" + std::to_string(index - 1) + ")"; + for (const std::size_t& v : vertex_indices) vlist += " " + std::to_string(v); + cell_vlist_map.emplace(to_string(cell), vlist); +#endif + } + + if (configuration.toggle_edges && sc_map.size() >= 2) + for (const auto& sc_pair : sc_map[1]) { + Hasse_cell* edge_cell = sc_pair.second; + Mesh_element_vertices edge; + for (const auto& vi_pair : edge_cell->get_boundary()) edge.push_back(vi_map[vi_pair.first]); + output.edges.emplace_back(edge, configuration.ref_edges); +#ifdef DEBUG_TRACES + std::string vlist; + for (const std::size_t& v : edge) vlist += " " + std::to_string(v); + cell_vlist_map.emplace(to_string(edge_cell), vlist); +#endif + } + + if (configuration.toggle_triangles && sc_map.size() >= 3) + for (const auto& sc_pair : sc_map[2]) { + for (const auto& ei_pair : sc_pair.second->get_boundary()) { + Mesh_element_vertices triangle(1, ci_map[sc_pair.second]); + for (const auto& vi_pair : ei_pair.first->get_boundary()) triangle.push_back(vi_map[vi_pair.first]); + output.triangles.emplace_back(triangle, configuration.ref_triangles); + } + } + + if (configuration.toggle_tetrahedra && sc_map.size() >= 4) + for (const auto& sc_pair : sc_map[3]) { + Eigen::VectorXd barycenter = Eigen::VectorXd::Zero(amb_d); + std::set<std::size_t> vertex_indices; + Hasse_cell* cell = sc_pair.second; + for (const auto& ci_pair : cell->get_boundary()) + for (const auto& ei_pair : ci_pair.first->get_boundary()) + for (const auto& vi_pair : ei_pair.first->get_boundary()) vertex_indices.emplace(vi_map[vi_pair.first]); + for (const std::size_t& v : vertex_indices) barycenter += output.vertex_points[v - 1]; + output.vertex_points.emplace_back((1. / vertex_indices.size()) * barycenter); +#ifdef DEBUG_TRACES + std::string vlist = " (" + std::to_string(index) + ")"; + for (const std::size_t& v : vertex_indices) vlist += " " + std::to_string(v); + cell_vlist_map.emplace(to_string(cell), vlist); +#endif + + for (const auto& ci_pair : cell->get_boundary()) + for (const auto& ei_pair : ci_pair.first->get_boundary()) { + Mesh_element_vertices tetrahedron = {index, ci_map[sc_pair.second]}; + for (const auto& vi_pair : ei_pair.first->get_boundary()) tetrahedron.push_back(vi_map[vi_pair.first]); + output.tetrahedra.emplace_back(tetrahedron, configuration.ref_tetrahedra); + } + index++; + } +} + +/** @brief Builds a Gudhi::coxeter_triangulation::Mesh_medit from a Gudhi::coxeter_triangulation::Cell_complex + * + * @ingroup coxeter_triangulation + */ +template <class Cell_complex> +Mesh_medit build_mesh_from_cell_complex(const Cell_complex& cell_complex, + Configuration i_configuration = Configuration(), + Configuration b_configuration = Configuration()) { + using Hasse_cell = typename Cell_complex::Hasse_cell; + Mesh_medit output; + std::map<Hasse_cell*, std::size_t> vi_map; // one for vertices, other for 2d-cells + std::size_t index = 1; // current size of output.vertex_points + + if (cell_complex.cell_point_map().empty()) return output; + std::size_t amb_d = std::min((int)cell_complex.cell_point_map().begin()->second.size(), 3); + + for (const auto& cp_pair : cell_complex.cell_point_map()) { +#ifdef DEBUG_TRACES + std::string vlist; + vlist += " " + std::to_string(index); + cell_vlist_map.emplace(to_string(cp_pair.first), vlist); +#endif + vi_map.emplace(cp_pair.first, index++); + output.vertex_points.push_back(cp_pair.second); + output.vertex_points.back().conservativeResize(amb_d); + } + + populate_mesh(output, cell_complex.interior_simplex_cell_maps(), i_configuration, amb_d, vi_map); +#ifdef DEBUG_TRACES + for (const auto& sc_map : cell_complex.interior_simplex_cell_maps()) + for (const auto& sc_pair : sc_map) { + std::string simplex = "I" + to_string(sc_pair.first); + std::string cell = to_string(sc_pair.second); + std::string vlist = cell_vlist_map.at(cell).substr(1); + simplex_vlist_map.emplace(simplex, vlist); + } +#endif + populate_mesh(output, cell_complex.boundary_simplex_cell_maps(), b_configuration, amb_d, vi_map); +#ifdef DEBUG_TRACES + for (const auto& sc_map : cell_complex.boundary_simplex_cell_maps()) + for (const auto& sc_pair : sc_map) { + std::string simplex = "B" + to_string(sc_pair.first); + std::string cell = to_string(sc_pair.second); + std::string vlist = cell_vlist_map.at(cell).substr(1); + simplex_vlist_map.emplace(simplex, vlist); + } +#endif + return output; +} + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif diff --git a/src/Coxeter_triangulation/include/gudhi/IO/output_debug_traces_to_html.h b/src/Coxeter_triangulation/include/gudhi/IO/output_debug_traces_to_html.h new file mode 100644 index 00000000..a2995738 --- /dev/null +++ b/src/Coxeter_triangulation/include/gudhi/IO/output_debug_traces_to_html.h @@ -0,0 +1,550 @@ +#ifndef IO_OUTPUT_DEBUG_TRACES_TO_HTML_H_ +#define IO_OUTPUT_DEBUG_TRACES_TO_HTML_H_ + +#ifdef DEBUG_TRACES // All this part of code can be skipped if DEBUG_TRACES are not ON - cmake -DDEBUG_TRACES=ON . + +#include <sstream> +#include <fstream> +#include <vector> +#include <list> +#include <string> +#include <regex> + +#include <Eigen/Dense> + +namespace Gudhi { + +namespace coxeter_triangulation { + +template <class T> +std::ostream& operator<<(std::ostream& os, const std::vector<T>& vector) { + os << "("; + if (vector.empty()) { + os << ")"; + return os; + } + auto v_it = vector.begin(); + os << *v_it++; + for (; v_it != vector.end(); ++v_it) os << ", " << *v_it; + os << ")"; + return os; +} + +/* A class to make the vector horizontal instead of vertical */ +struct Straighten { + Straighten(const Eigen::VectorXd& vector) : vector_(vector) {} + const Eigen::VectorXd& vector_; +}; + +std::ostream& operator<<(std::ostream& os, const Straighten& str) { + std::size_t size = str.vector_.size(); + os << "(" << str.vector_(0); + if (size == 0) { + os << ")"; + return os; + } + for (std::size_t i = 1; i < size; ++i) os << ", " << str.vector_(i); + os << ")"; + return os; +} + +std::string id_from_simplex(const std::string& simplex) { + std::regex r("\\s+"), r2("\\(|\\)|\\{|\\}"), r3(","), r4("\\["), r5("\\]"); + std::string output = std::regex_replace(simplex, r, ""); + output = std::regex_replace(output, r2, ":"); + output = std::regex_replace(output, r3, "."); + output = std::regex_replace(output, r4, "_"); + output = std::regex_replace(output, r5, ""); + return output; +} + +template <typename T> +std::string to_string(const T& t) { + std::ostringstream oss; + oss << t; + return oss.str(); +} + +struct MT_inserted_info { + std::string qr_face_, init_face_, qr_intersection_; + bool qr_success_, is_boundary_; + template <class Query_result, class Simplex_handle> + MT_inserted_info(const Query_result& qr, const Simplex_handle& face, bool is_boundary) + : qr_face_(to_string(face)), + init_face_(to_string(face)), + qr_intersection_(to_string(qr.intersection)), + qr_success_(qr.success), + is_boundary_(is_boundary) {} +}; +std::list<MT_inserted_info> mt_seed_inserted_list, mt_inserted_list; + +struct CC_summary_info { + std::string face_, cell_; + template <class SC_pair> + CC_summary_info(const SC_pair& sc_pair) : face_(to_string(sc_pair.first)), cell_(to_string(sc_pair.second)) {} +}; +using CC_summary_list = std::list<CC_summary_info>; +std::vector<CC_summary_list> cc_interior_summary_lists, cc_boundary_summary_lists; + +struct CC_detail_info { + enum class Result_type { self, face, coface, inserted, join_single, join_is_face }; + std::string simplex_, trigger_, init_simplex_; + Result_type status_; + bool join_trigger_ = false; + std::list<std::string> faces_, post_faces_, cofaces_; + template <class Simplex_handle> + CC_detail_info(const Simplex_handle& simplex) : simplex_(to_string(simplex)) {} +}; +using CC_detail_list = std::list<CC_detail_info>; +std::vector<CC_detail_list> cc_interior_detail_lists, cc_boundary_detail_lists; +std::vector<CC_detail_list> cc_interior_insert_detail_lists, cc_boundary_insert_detail_lists; + +struct CC_prejoin_info { + enum class Result_type { join_single, join_is_face, join_different, join_same }; + std::string simplex_, join_; + std::vector<std::string> faces_; + std::size_t dimension_; + Result_type status_; + template <class Simplex_handle> + CC_prejoin_info(const Simplex_handle& simplex) : simplex_(to_string(simplex)), dimension_(simplex.dimension()) {} +}; +using CC_prejoin_list = std::list<CC_prejoin_info>; +std::vector<CC_prejoin_list> cc_interior_prejoin_lists, cc_boundary_prejoin_lists; + +struct CC_join_info { + enum class Result_type { self, face, coface, inserted, join_single, join_is_face }; + std::string simplex_, join_, trigger_; + Result_type status_; + std::list<std::string> boundary_faces_; + std::list<std::string> faces_, post_faces_, cofaces_; + template <class Simplex_handle> + CC_join_info(const Simplex_handle& simplex) : simplex_(to_string(simplex)) {} +}; +bool join_switch = false; +std::vector<CC_detail_list> cc_interior_join_detail_lists, cc_boundary_join_detail_lists; + +std::map<std::string, std::string> cell_vlist_map; +std::map<std::string, std::string> simplex_vlist_map; + +std::ostringstream mt_ostream, vis_ostream; +std::vector<std::ostringstream> cc_summary_ostream, cc_traces_ostream; + +std::string simplex_format(const std::string& simplex, bool is_boundary) { + std::string b_simplex = (is_boundary ? "B" : "I") + simplex; + std::string tooltiptext; + auto it = simplex_vlist_map.find(b_simplex); + if (it == simplex_vlist_map.end()) + tooltiptext = "deleted"; + else + tooltiptext = simplex_vlist_map.at(b_simplex); + return (std::string) "<a class=\"" + (is_boundary ? "boundary" : "interior") + "\" href=\"#" + + id_from_simplex(b_simplex) + "\">" + b_simplex + "<span class=\"tooltiptext\">" + tooltiptext + "</span></a>"; +} + +std::string simplex_format(const std::string& b_simplex) { + bool is_boundary = b_simplex[0] == 'B'; + std::string tooltiptext; + auto it = simplex_vlist_map.find(b_simplex); + if (it == simplex_vlist_map.end()) + tooltiptext = "deleted"; + else + tooltiptext = simplex_vlist_map.at(b_simplex); + return (std::string) "<a class=\"" + (is_boundary ? "boundary" : "interior") + "\" href=\"#" + + id_from_simplex(b_simplex) + "\">" + b_simplex + "<span class=\"tooltiptext\">" + tooltiptext + "</span></a>"; +} + +void write_head(std::ofstream& ofs) { + ofs << " <head>\n" + << " <title>Cell complex debug trace</title>\n" + << " <style>\n" + << " a.boundary {\n" + << " position: relative;\n" + << " display: inline-block;\n" + << " color: darkred;\n" + << " background-color: lightgreen\n" + << " }\n" + << " a.interior {\n" + << " position: relative;\n" + << " display: inline-block;\n" + << " color: navy;\n" + << " background-color: yellow\n" + << " }\n" + << " .tooltiptext {\n" + << " visibility: hidden;\n" + << " width: 120px;\n" + << " background-color: #555;\n" + << " color: #fff;\n" + << " text-align: center;\n" + << " padding: 5px 0;\n" + << " border-radius: 6px;\n" + << " position: absolute;\n" + << " z-index: 1;\n" + << " bottom: 125%;\n" + << " left: 50%;\n" + << " margin-left: -60px;\n" + << " opacity: 0;\n" + << " transition: opacity 0.3s;\n" + << " }\n" + << " .boundary .tooltiptext::after {\n" + << " content: \"\";\n" + << " position: absolute;\n" + << " top: 100%;\n" + << " left: 50%;\n" + << " margin-left: -5px;\n" + << " border-width: 5px;\n" + << " border-style: solid;\n" + << " border-color: #555 transparent transparent transparent;\n" + << " }\n" + << " .interior .tooltiptext::after {\n" + << " content: \"\";\n" + << " position: absolute;\n" + << " top: 100%;\n" + << " left: 50%;\n" + << " margin-left: -5px;\n" + << " border-width: 5px;\n" + << " border-style: solid;\n" + << " border-color: #555 transparent transparent transparent;\n" + << " }\n" + << " .boundary:hover .tooltiptext {\n" + << " visibility: visible;\n" + << " opacity: 1;\n" + << " }\n" + << " .interior:hover .tooltiptext {\n" + << " visibility: visible;\n" + << " opacity: 1;\n" + << " }\n" + << " ul.nav {\n" + << " list-style-type: none;\n" + << " margin: 0;\n" + << " padding: 0;\n" + << " overflow: auto;\n" + << " background-color: #333;\n" + << " position: fixed;\n" + << " height: 100%;\n" + << " width: 15%;\n" + << " }\n" + << " ul.nav li a {\n" + << " display: block;\n" + << " color: white;\n" + << " text-align: left;\n" + << " padding: 14px 16px;\n" + << " text-decoration: none;\n" + << " }\n" + << " .active {\n" + << " background-color: #4CAF50;\n" + << " }\n" + << " div {\n" + << " margin-left: 15%;\n" + << " padding: 1px 16px\n" + << " }\n" + << " div.navi {\n" + << " margin-left: 0%;\n" + << " padding: 0px 0px\n" + << " }\n" + << " h1 {\n" + << " margin-left: 15%;\n" + << " padding: 1px 16px\n" + << " }\n" + << " </style>\n" + << " </head>\n"; +} + +void write_nav(std::ofstream& ofs) { + ofs << " <div class=\"navi\" style=\"margin-top:30px;background-color:#1abc9c;\">\n" + << " <ul class=\"nav\">\n" + << " <li><a href=\"#mant\">Manifold tracing</a></li>\n" + << " <li><a href=\"#cell\">Cell complex</a>\n" + << " <ul>\n"; + for (std::size_t i = 0; i < cc_interior_summary_lists.size(); ++i) { + ofs << " <li><a href=\"#dim" << i << "\">Dimension " << i << "</a>\n"; + ofs << " <ul>\n"; + ofs << " <li><a href=\"#dim" << i << "i\">Interior</a></li>\n"; + if (i < cc_boundary_summary_lists.size()) { + ofs << " <li><a href=\"#dim" << i << "b\">Boundary</a></li>\n"; + } + ofs << " </ul>\n"; + ofs << " </li>\n"; + } + ofs << " </ul>\n" + << " </li>\n" + << " <li><a href=\"#visu\">Visualization details</a></li>\n" + << " </ul>\n" + << " </div>\n"; +} + +void write_mt(std::ofstream& ofs) { + ofs << " <div id=\"mant\">\n"; + ofs << " <h2> Manifold debug trace </h2>\n"; + ofs << " <h3> Simplices inserted during the seed phase </h3>\n"; + ofs << " <ul>\n"; + for (const MT_inserted_info& mt_info : mt_seed_inserted_list) { + if (mt_info.qr_success_) { + ofs << " <li>Inserted " << simplex_format(mt_info.qr_face_, mt_info.is_boundary_); + if (mt_info.qr_face_ != mt_info.init_face_) + ofs << " (initially " << simplex_format(mt_info.init_face_, mt_info.is_boundary_) << ")"; + ofs << " intersection point is " << mt_info.qr_intersection_ << "</li>\n"; + } else + ofs << " <li>Failed to insert " << mt_info.init_face_ << "</li>\n"; + } + ofs << " </ul>\n"; + ofs << " <h3> Simplices inserted during the while loop phase </h3>\n"; + ofs << " <ul>\n"; + for (const MT_inserted_info& mt_info : mt_inserted_list) { + if (mt_info.qr_success_) { + ofs << " <li>Inserted " << simplex_format(mt_info.qr_face_, mt_info.is_boundary_); + if (mt_info.qr_face_ != mt_info.init_face_) + ofs << " (initially " << simplex_format(mt_info.init_face_, mt_info.is_boundary_) << ")"; + ofs << " intersection point is " << mt_info.qr_intersection_ << "</li>\n"; + } else + ofs << " <li>Failed to insert " << mt_info.init_face_ << ")</li>\n"; + } + ofs << " </ul>\n"; + ofs << " </div>\n"; +} + +void write_cc(std::ofstream& ofs) { + ofs << " <div id=\"cell\">\n" + << " <h2> Cell complex debug trace </h2>\n" + << " <p>Go to:</p>\n" + << " <ul>\n"; + for (std::size_t i = 0; i < cc_interior_summary_lists.size(); ++i) { + ofs << " <li><a href=\"#dim" << i << "\">Dimension " << i << "</a></li>\n"; + } + ofs << " </ul>\n"; + for (std::size_t i = 0; i < cc_interior_summary_lists.size(); ++i) { + ofs << " <h3 id=\"dim" << i << "\"> Dimension " << i << "</h3>\n"; + ofs << " <h4 id=\"dim" << i << "i\"> Summary for interior simplices</h4>\n"; + if (i < cc_boundary_summary_lists.size()) ofs << " <p><a href=\"#dim" << i << "b\">Go to boundary</a></p>\n"; + ofs << " <ul>\n"; + for (const CC_summary_info& cc_info : cc_interior_summary_lists[i]) + ofs << " <li id = \"" << id_from_simplex("I" + cc_info.face_) << "\">" + << simplex_format(cc_info.face_, false) << " cell =" << cc_info.cell_ << "</li>\n"; + ofs << " </ul>\n"; + ofs << " <h4> Prejoin state of the interior cells of dimension " << i << "</h4>\n"; + auto prejoin_it = cc_interior_prejoin_lists[i].begin(); + while (prejoin_it != cc_interior_prejoin_lists[i].end()) { + std::size_t j = prejoin_it->dimension_; + ofs << " <h5>" << j << "-dimensional ambient simplices</h5>\n"; + ofs << " <ul>\n"; + for (; prejoin_it->dimension_ == j; ++prejoin_it) { + ofs << " <li>" << simplex_format(prejoin_it->simplex_, false) + << " join = " << simplex_format(prejoin_it->join_, false) << " boundary:\n" + << " <ul>\n"; + for (const auto& face : prejoin_it->faces_) ofs << " <li>" << simplex_format(face) << "</li>"; + ofs << " </ul>\n"; + switch (prejoin_it->status_) { + case (CC_prejoin_info::Result_type::join_single): + ofs << " <p style=\"color: red\">Deleted " << simplex_format(prejoin_it->simplex_, false) + << " as it has a single face.</p>"; + break; + case (CC_prejoin_info::Result_type::join_is_face): + ofs << " <p style=\"color: red\">Deleted " << simplex_format(prejoin_it->simplex_, false) + << " as its join " << simplex_format(prejoin_it->join_, false) << " is one of the faces.</p>"; + break; + case (CC_prejoin_info::Result_type::join_different): + ofs << " <p style=\"color: magenta\">Deleted " << simplex_format(prejoin_it->simplex_, false) + << " and replaced by its join " << simplex_format(prejoin_it->join_, false) << ".</p>"; + break; + case (CC_prejoin_info::Result_type::join_same): + ofs << " <p style=\"color: green\">Kept " << simplex_format(prejoin_it->simplex_, false) + << ".</p>"; + } + ofs << " </li>"; + } + ofs << " </ul>\n"; + } + ofs << " <h4> Details for interior simplices</h4>\n"; + ofs << " <ul>\n"; + for (const CC_detail_info& cc_info : cc_interior_detail_lists[i]) { + if (cc_info.status_ == CC_detail_info::Result_type::join_single) { + ofs << " <li style=\"color:magenta\" id = \"" << id_from_simplex("I" + cc_info.simplex_) + << "\"> Simplex " << simplex_format(cc_info.simplex_, false) << " has only one face (" + << simplex_format(cc_info.trigger_, false) << ") and is deleted."; + continue; + } + if (cc_info.status_ == CC_detail_info::Result_type::join_single) { + ofs << " <li style=\"color:darkmagenta\" id = \"" << id_from_simplex("I" + cc_info.simplex_) + << "\"> The join of the simplex " << simplex_format(cc_info.simplex_, false) << " is one of its faces (" + << simplex_format(cc_info.trigger_, false) << "), hence it is is deleted."; + continue; + } + ofs << " <li> Insert_cell called for " << simplex_format(cc_info.simplex_, false) << "\n"; + ofs << " <ul>\n"; + // for (const std::string& cof: cc_info.faces_) + // ofs << " <li>Checking if " << simplex_format(cc_info.simplex_, false) + // << " is a face of " << simplex_format(cof, false) << "\n"; + ofs << " </ul>\n"; + ofs << " <ul>\n"; + if (cc_info.status_ == CC_detail_info::Result_type::self) { + ofs << " <p><span style=\"color:blue\">The simplex " << simplex_format(cc_info.simplex_, false) + << " already exists in the cell complex!</span></p>\n"; + } + if (cc_info.status_ == CC_detail_info::Result_type::face) { + ofs << " <p><span style=\"color:red\">The simplex " << simplex_format(cc_info.simplex_, false) + << " is a face of the simplex " << simplex_format(cc_info.trigger_, false) << "!</span><br>\n"; + ofs << " <ul>\n"; + for (const std::string post_face : cc_info.post_faces_) + ofs << " <li id = \"" << id_from_simplex("I" + post_face) << "\">" + << "Post deleting " << simplex_format(post_face, false) << "</li>\n"; + ofs << " </ul>\n"; + ofs << " </p>\n"; + ofs << " <p id = \"" << id_from_simplex("I" + cc_info.trigger_) << "\">" + << "Deleting " << simplex_format(cc_info.trigger_, false) << "</p>\n"; + } + // for (const std::string& fac: cc_info.cofaces_) + // ofs << " <li>Checking if " << simplex_format(cc_info.simplex_, false) + // << " is a coface of " << simplex_format(fac, false) << "\n"; + if (cc_info.status_ == CC_detail_info::Result_type::coface) { + ofs << " <p><span style=\"color:darkorange\">The simplex " << simplex_format(cc_info.simplex_, false) + << " is a coface of the simplex " << simplex_format(cc_info.trigger_, false) << "!</span><p>\n"; + } + if (cc_info.status_ == CC_detail_info::Result_type::inserted) { + ofs << " <p><span style=\"color:green\">Successfully inserted " + << simplex_format(cc_info.simplex_, false) << "!</span><p>\n"; + } + ofs << " </ul>\n"; + ofs << " </li>\n"; + } + ofs << " </ul>\n"; + + if (i < cc_boundary_summary_lists.size()) { + ofs << " <h4 id=\"dim" << i << "b\"> Summary for boundary simplices</h4>\n"; + ofs << " <p><a href=\"#dim" << i << "i\">Go to interior</a></p>\n"; + ofs << " <ul>\n"; + for (const CC_summary_info& cc_info : cc_boundary_summary_lists[i]) + ofs << " <li id = \"" << id_from_simplex("B" + cc_info.face_) << "\">" + << simplex_format(cc_info.face_, true) << " cell =" << cc_info.cell_ << "</li>\n"; + ofs << " </ul>\n"; + ofs << " <h4> Prejoin state of the boundary cells of dimension " << i << "</h4>\n"; + auto prejoin_it = cc_boundary_prejoin_lists[i].begin(); + while (prejoin_it != cc_boundary_prejoin_lists[i].end()) { + std::size_t j = prejoin_it->dimension_; + ofs << " <h5>" << j << "-dimensional ambient simplices</h5>\n"; + ofs << " <ul>\n"; + for (; prejoin_it->dimension_ == j; ++prejoin_it) { + ofs << " <li>" << simplex_format(prejoin_it->simplex_, true) + << " join = " << simplex_format(prejoin_it->join_, true) << " boundary:\n" + << " <ul>\n"; + for (const auto& face : prejoin_it->faces_) ofs << " <li>" << simplex_format(face) << "</li>"; + ofs << " </ul>\n"; + switch (prejoin_it->status_) { + case (CC_prejoin_info::Result_type::join_single): + ofs << " <p style=\"color: red\">Deleted " << simplex_format(prejoin_it->simplex_, true) + << " as it has a single face.</p>"; + break; + case (CC_prejoin_info::Result_type::join_is_face): + ofs << " <p style=\"color: red\">Deleted " << simplex_format(prejoin_it->simplex_, true) + << " as its join " << simplex_format(prejoin_it->join_, true) << " is one of the faces.</p>"; + break; + case (CC_prejoin_info::Result_type::join_different): + ofs << " <p style=\"color: magenta\">Deleted " << simplex_format(prejoin_it->simplex_, true) + << " and replaced by its join " << simplex_format(prejoin_it->join_, true) << ".</p>"; + break; + case (CC_prejoin_info::Result_type::join_same): + ofs << " <p style=\"color: green\">Kept " << simplex_format(prejoin_it->simplex_, true) + << ".</p>"; + } + ofs << " </li>"; + } + ofs << " </ul>\n"; + } + } + if (i < cc_boundary_detail_lists.size()) { + ofs << " <h4> Details for boundary simplices</h4>\n" + << " <ul>\n"; + for (const CC_detail_info& cc_info : cc_boundary_detail_lists[i]) { + if (cc_info.status_ == CC_detail_info::Result_type::join_single) { + ofs << " <li style=\"color:magenta\" id = \"" << id_from_simplex("B" + cc_info.simplex_) + << "\"> Simplex " << simplex_format(cc_info.simplex_, true) << " has only one face (" + << simplex_format(cc_info.trigger_, true) << ") and is deleted."; + continue; + } + if (cc_info.status_ == CC_detail_info::Result_type::join_single) { + ofs << " <li style=\"color:darkmagenta\" id = \"" << id_from_simplex("B" + cc_info.simplex_) + << "\"> The join of the simplex " << simplex_format(cc_info.simplex_, true) << " is one of its faces (" + << simplex_format(cc_info.trigger_, true) << "), hence it is is deleted."; + continue; + } + ofs << " <li> Insert_simplex called on " << simplex_format(cc_info.simplex_, true); + ofs << " <ul>\n"; + // for (const std::string& cof: cc_info.faces_) + // ofs << " <li>Checking if " << simplex_format(cc_info.simplex_, true) + // << " is a face of " << simplex_format(cof, true) << "\n"; + ofs << " </ul>\n"; + ofs << " <ul>\n"; + if (cc_info.status_ == CC_detail_info::Result_type::self) { + ofs << " <p><span style=\"color:blue\">The simplex " << simplex_format(cc_info.simplex_, true) + << " already exists in the cell complex!</span></p>\n"; + } + if (cc_info.status_ == CC_detail_info::Result_type::face) { + ofs << " <p><span style=\"color:red\">The simplex " << simplex_format(cc_info.simplex_, true) + << " is a face of the simplex " << simplex_format(cc_info.trigger_, true) << "!</span><br>\n"; + ofs << " <ul>\n"; + for (const std::string post_face : cc_info.post_faces_) + ofs << " <li id=\"" << id_from_simplex("B" + post_face) << "\">Post deleting " + << simplex_format(post_face, true) << "</li>\n"; + ofs << " </ul>\n"; + ofs << " </p>\n"; + ofs << " <p id=\"" << id_from_simplex(cc_info.trigger_) << "\">Deleting " + << simplex_format(cc_info.trigger_, true) << "</p>\n"; + } + // for (const std::string& fac: cc_info.cofaces_) + // ofs << " <li>Checking if " << simplex_format(cc_info.simplex_, true) + // << " is a coface of " << simplex_format(fac, true) << "\n"; + ofs << " </ul>\n"; + ofs << " </li>\n"; + if (cc_info.status_ == CC_detail_info::Result_type::coface) { + ofs << " <p><span style=\"color:darkorange\">The simplex " + << simplex_format(cc_info.simplex_, true) << " is a coface of the simplex " + << simplex_format(cc_info.trigger_, true) << "!</span><p>\n"; + } + if (cc_info.status_ == CC_detail_info::Result_type::inserted) { + ofs << " <p><span style=\"color:green\">Successfully inserted " + << simplex_format(cc_info.simplex_, true) << "!</span><p>\n"; + } + } + ofs << " </ul>\n"; + } + } + ofs << " </div>\n"; +} + +void write_visu(std::ofstream& ofs) { + ofs << " <div id=\"visu\">\n" + << " <h2> Visualization details debug trace </h2>\n"; + // std::vector<std::map<std::string, std::string> > vs_maps(cc_interior_summary_lists.size()); + std::map<std::string, std::string> vs_map; + for (const auto& sv_pair : simplex_vlist_map) vs_map.emplace(sv_pair.second, sv_pair.first); + ofs << " <ul>\n"; + for (const auto& vs_pair : vs_map) { + std::string w_simplex = vs_pair.second.substr(1); + bool is_boundary = vs_pair.second[0] == 'B'; + ofs << " <li><b>" << vs_pair.first << "</b>: " << simplex_format(w_simplex, is_boundary) << "</li>\n"; + } + ofs << " </ul>\n"; + ofs << " </div>\n"; +} + +void write_to_html(std::string file_name) { + std::ofstream ofs(file_name + ".html", std::ofstream::out); + ofs << "<!DOCTYPE html>\n" + << "<html>\n"; + write_head(ofs); + ofs << " <body>\n"; + write_nav(ofs); + ofs << " <h1> Debug traces for " << file_name << " </h1>\n"; + write_mt(ofs); + write_cc(ofs); + write_visu(ofs); + ofs << " </body>\n"; + ofs << "</html>\n"; + + ofs.close(); +} + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif // DEBUG_TRACES +#endif // IO_OUTPUT_DEBUG_TRACES_TO_HTML_H_ diff --git a/src/Coxeter_triangulation/include/gudhi/IO/output_meshes_to_medit.h b/src/Coxeter_triangulation/include/gudhi/IO/output_meshes_to_medit.h new file mode 100644 index 00000000..f69d8b29 --- /dev/null +++ b/src/Coxeter_triangulation/include/gudhi/IO/output_meshes_to_medit.h @@ -0,0 +1,154 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef IO_OUTPUT_MESHES_TO_MEDIT_H_ +#define IO_OUTPUT_MESHES_TO_MEDIT_H_ + +#include <gudhi/IO/Mesh_medit.h> + +#include <Eigen/Dense> + +#include <cstdlib> // for std::size_t +#include <fstream> // for std::ofstream +#include <vector> +#include <type_traits> // for std::enable_if +#include <tuple> // for std::get +#include <utility> // for std::make_pair + +namespace Gudhi { + +namespace coxeter_triangulation { + +using Vertex_points = Mesh_medit::Vertex_points; +using Mesh_elements = Mesh_medit::Mesh_elements; +using Scalar_field_range = Mesh_medit::Scalar_field_range; + +template <std::size_t I = 0, typename... Meshes> +typename std::enable_if<I == sizeof...(Meshes), void>::type fill_meshes(Vertex_points& vertex_points, + Mesh_elements& edges, Mesh_elements& triangles, + Mesh_elements& tetrahedra, + Scalar_field_range& triangles_scalar_range, + Scalar_field_range& tetrahedra_scalar_range, + std::size_t index, const Meshes&... meshes) {} + +template <std::size_t I = 0, typename... Meshes> +typename std::enable_if<I != sizeof...(Meshes), void>::type fill_meshes(Vertex_points& vertex_points, + Mesh_elements& edges, Mesh_elements& triangles, + Mesh_elements& tetrahedra, + Scalar_field_range& triangles_scalar_range, + Scalar_field_range& tetrahedra_scalar_range, + std::size_t index, const Meshes&... meshes) { + auto mesh = std::get<I>(std::forward_as_tuple(meshes...)); + for (const auto& v : mesh.vertex_points) vertex_points.push_back(v); + for (const auto& e : mesh.edges) { + std::vector<std::size_t> edge; + for (const auto& v_i : e.first) edge.push_back(v_i + index); + edges.emplace_back(edge, e.second); + } + for (const auto& t : mesh.triangles) { + std::vector<std::size_t> triangle; + for (const auto& v_i : t.first) triangle.push_back(v_i + index); + triangles.emplace_back(triangle, t.second); + } + for (const auto& t : mesh.tetrahedra) { + std::vector<std::size_t> tetrahedron; + for (const auto& v_i : t.first) tetrahedron.push_back(v_i + index); + tetrahedra.emplace_back(tetrahedron, t.second); + } + for (const auto& b : mesh.triangles_scalar_range) triangles_scalar_range.push_back(b); + for (const auto& b : mesh.tetrahedra_scalar_range) tetrahedra_scalar_range.push_back(b); + fill_meshes<I + 1, Meshes...>(vertex_points, edges, triangles, tetrahedra, triangles_scalar_range, + tetrahedra_scalar_range, index + mesh.vertex_points.size(), meshes...); +} + +/** \brief Outputs a text file with specified meshes that can be visualized in + * <a target="_blank" href="https://www.ljll.math.upmc.fr/frey/software.html">Medit</a>. + * + * @param[in] amb_d Ambient dimension. Can be 2 or 3. + * @param[in] file_name The name of the output file. + * @param[in] meshes A pack of meshes to be specified separated by commas. + * + * @ingroup coxeter_triangulation + */ +template <typename... Meshes> +void output_meshes_to_medit(std::size_t amb_d, std::string file_name, const Meshes&... meshes) { + Vertex_points vertex_points; + Mesh_elements edges, triangles, tetrahedra; + Scalar_field_range triangles_scalar_range, tetrahedra_scalar_range; + fill_meshes(vertex_points, edges, triangles, tetrahedra, triangles_scalar_range, tetrahedra_scalar_range, 0, + meshes...); + + std::ofstream ofs(file_name + ".mesh", std::ofstream::out); + std::ofstream ofs_bb(file_name + ".bb", std::ofstream::out); + + if (amb_d == 2) { + ofs << "MeshVersionFormatted 1\nDimension 2\n"; + ofs_bb << "2 1 "; + ofs << "Vertices\n" << vertex_points.size() << "\n"; + for (auto p : vertex_points) { + ofs << p[0] << " " << p[1] << " 2\n"; + } + ofs << "Edges " << edges.size() << "\n"; + for (auto e : edges) { + for (auto v : e.first) ofs << v << " "; + ofs << e.second << std::endl; + } + ofs << "Triangles " << triangles.size() << "\n"; + for (auto s : triangles) { + for (auto v : s.first) { + ofs << v << " "; + } + ofs << s.second << std::endl; + } + + ofs_bb << triangles_scalar_range.size() << " 1\n"; + for (auto& b : triangles_scalar_range) ofs_bb << b << "\n"; + + } else { + ofs << "MeshVersionFormatted 1\nDimension 3\n"; + ofs_bb << "3 1 "; + ofs << "Vertices\n" << vertex_points.size() << "\n"; + for (auto p : vertex_points) { + ofs << p[0] << " " << p[1] << " " << p[2] << " 2\n"; + } + ofs << "Edges " << edges.size() << "\n"; + for (auto e : edges) { + for (auto v : e.first) ofs << v << " "; + ofs << e.second << std::endl; + } + ofs << "Triangles " << triangles.size() << "\n"; + for (auto s : triangles) { + for (auto v : s.first) { + ofs << v << " "; + } + ofs << s.second << std::endl; + } + ofs << "Tetrahedra " << tetrahedra.size() << "\n"; + for (auto s : tetrahedra) { + for (auto v : s.first) { + ofs << v << " "; + } + ofs << s.second << std::endl; + } + + ofs_bb << triangles_scalar_range.size() + tetrahedra_scalar_range.size() << " 1\n"; + for (auto& b : triangles_scalar_range) ofs_bb << b << "\n"; + for (auto& b : tetrahedra_scalar_range) ofs_bb << b << "\n"; + } + + ofs.close(); + ofs_bb.close(); +} + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif diff --git a/src/Coxeter_triangulation/include/gudhi/Implicit_manifold_intersection_oracle.h b/src/Coxeter_triangulation/include/gudhi/Implicit_manifold_intersection_oracle.h new file mode 100644 index 00000000..277f8b6c --- /dev/null +++ b/src/Coxeter_triangulation/include/gudhi/Implicit_manifold_intersection_oracle.h @@ -0,0 +1,261 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef IMPLICIT_MANIFOLD_INTERSECTION_ORACLE_H_ +#define IMPLICIT_MANIFOLD_INTERSECTION_ORACLE_H_ + +#include <Eigen/Dense> + +#include <gudhi/Permutahedral_representation/face_from_indices.h> +#include <gudhi/Functions/Constant_function.h> +#include <gudhi/Functions/PL_approximation.h> +#include <gudhi/Coxeter_triangulation/Query_result.h> +#include <gudhi/Debug_utils.h> // for GUDHI_CHECK + +#include <vector> +#include <limits> // for std::numeric_limits<> +#include <cmath> // for std::fabs + +namespace Gudhi { + +namespace coxeter_triangulation { + +/** \class Implicit_manifold_intersection_oracle + * \brief An oracle that supports the intersection query on an implicit manifold. + * + * \tparam Function_ The function template parameter. Should be a model of + * the concept FunctionForImplicitManifold. + * \tparam Domain_function_ The domain function template parameter. Should be a model of + * the concept FunctionForImplicitManifold. + * + * \ingroup coxeter_triangulation + */ +template <class Function_, class Domain_function_ = Constant_function> +class Implicit_manifold_intersection_oracle { + /* Computes the affine coordinates of the intersection point of the implicit manifold + * and the affine hull of the simplex. */ + template <class Simplex_handle, class Triangulation> + Eigen::VectorXd compute_lambda(const Simplex_handle& simplex, const Triangulation& triangulation) const { + std::size_t cod_d = this->cod_d(); + Eigen::MatrixXd matrix(cod_d + 1, cod_d + 1); + for (std::size_t i = 0; i < cod_d + 1; ++i) matrix(0, i) = 1; + std::size_t j = 0; + for (auto v : simplex.vertex_range()) { + Eigen::VectorXd v_coords = fun_(triangulation.cartesian_coordinates(v)); + for (std::size_t i = 1; i < cod_d + 1; ++i) matrix(i, j) = v_coords(i - 1); + j++; + } + Eigen::VectorXd z(cod_d + 1); + z(0) = 1; + for (std::size_t i = 1; i < cod_d + 1; ++i) z(i) = 0; + Eigen::VectorXd lambda = matrix.colPivHouseholderQr().solve(z); + if (!z.isApprox(matrix*lambda)) { + // NaN non valid results + for (std::size_t i = 0; i < (std::size_t)lambda.size(); ++i) lambda(i) = + std::numeric_limits<double>::quiet_NaN(); + } + return lambda; + } + + /* Computes the affine coordinates of the intersection point of the boundary + * of the implicit manifold and the affine hull of the simplex. */ + template <class Simplex_handle, class Triangulation> + Eigen::VectorXd compute_boundary_lambda(const Simplex_handle& simplex, const Triangulation& triangulation) const { + std::size_t cod_d = this->cod_d(); + Eigen::MatrixXd matrix(cod_d + 2, cod_d + 2); + for (std::size_t i = 0; i < cod_d + 2; ++i) matrix(0, i) = 1; + std::size_t j = 0; + for (auto v : simplex.vertex_range()) { + Eigen::VectorXd v_coords = fun_(triangulation.cartesian_coordinates(v)); + for (std::size_t i = 1; i < cod_d + 1; ++i) matrix(i, j) = v_coords(i - 1); + Eigen::VectorXd bv_coords = domain_fun_(triangulation.cartesian_coordinates(v)); + matrix(cod_d + 1, j) = bv_coords(0); + j++; + } + Eigen::VectorXd z(cod_d + 2); + z(0) = 1; + for (std::size_t i = 1; i < cod_d + 2; ++i) z(i) = 0; + Eigen::VectorXd lambda = matrix.colPivHouseholderQr().solve(z); + if (!z.isApprox(matrix*lambda)) { + // NaN non valid results + for (std::size_t i = 0; i < (std::size_t)lambda.size(); ++i) lambda(i) = + std::numeric_limits<double>::quiet_NaN(); + } + return lambda; + } + + /* Computes the intersection result for a given simplex in a triangulation. */ + template <class Simplex_handle, class Triangulation> + Query_result<Simplex_handle> intersection_result(const Eigen::VectorXd& lambda, const Simplex_handle& simplex, + const Triangulation& triangulation) const { + using QR = Query_result<Simplex_handle>; + std::size_t amb_d = triangulation.dimension(); + std::size_t cod_d = simplex.dimension(); + for (std::size_t i = 0; i < (std::size_t)lambda.size(); ++i) { + if (std::isnan(lambda(i))) return QR({Eigen::VectorXd(), false}); + GUDHI_CHECK((std::fabs(lambda(i) - 1.) > std::numeric_limits<double>::epsilon() && + std::fabs(lambda(i) - 0.) > std::numeric_limits<double>::epsilon()), + std::invalid_argument("A vertex of the triangulation lies exactly on the manifold")); + if (lambda(i) < 0. || lambda(i) > 1.) return QR({Eigen::VectorXd(), false}); + } + Eigen::MatrixXd vertex_matrix(cod_d + 1, amb_d); + auto v_range = simplex.vertex_range(); + auto v_it = v_range.begin(); + for (std::size_t i = 0; i < cod_d + 1 && v_it != v_range.end(); ++v_it, ++i) { + Eigen::VectorXd v_coords = triangulation.cartesian_coordinates(*v_it); + for (std::size_t j = 0; j < amb_d; ++j) vertex_matrix(i, j) = v_coords(j); + } + Eigen::VectorXd intersection = lambda.transpose() * vertex_matrix; + return QR({intersection, true}); + } + + public: + /** \brief Ambient dimension of the implicit manifold. */ + std::size_t amb_d() const { return fun_.amb_d(); } + + /** \brief Codimension of the implicit manifold. */ + std::size_t cod_d() const { return fun_.cod_d(); } + + /** \brief The seed point of the implicit manifold. */ + Eigen::VectorXd seed() const { return fun_.seed(); } + + /** \brief Intersection query with the relative interior of the manifold. + * + * \details The returned structure Query_result contains the boolean value + * that is true only if the intersection point of the query simplex and + * the relative interior of the manifold exists, the intersection point + * and the face of the query simplex that contains + * the intersection point. + * + * \tparam Simplex_handle The class of the query simplex. + * Needs to be a model of the concept SimplexInCoxeterTriangulation. + * \tparam Triangulation The class of the triangulation. + * Needs to be a model of the concept TriangulationForManifoldTracing. + * + * @param[in] simplex The query simplex. The dimension of the simplex + * should be the same as the codimension of the manifold + * (the codomain dimension of the function). + * @param[in] triangulation The ambient triangulation. The dimension of + * the triangulation should be the same as the ambient dimension of the manifold + * (the domain dimension of the function). + */ + template <class Simplex_handle, class Triangulation> + Query_result<Simplex_handle> intersects(const Simplex_handle& simplex, const Triangulation& triangulation) const { + Eigen::VectorXd lambda = compute_lambda(simplex, triangulation); + return intersection_result(lambda, simplex, triangulation); + } + + /** \brief Intersection query with the boundary of the manifold. + * + * \details The returned structure Query_result contains the boolean value + * that is true only if the intersection point of the query simplex and + * the boundary of the manifold exists, the intersection point + * and the face of the query simplex that contains + * the intersection point. + * + * \tparam Simplex_handle The class of the query simplex. + * Needs to be a model of the concept SimplexInCoxeterTriangulation. + * \tparam Triangulation The class of the triangulation. + * Needs to be a model of the concept TriangulationForManifoldTracing. + * + * @param[in] simplex The query simplex. The dimension of the simplex + * should be the same as the codimension of the boundary of the manifold + * (the codomain dimension of the function + 1). + * @param[in] triangulation The ambient triangulation. The dimension of + * the triangulation should be the same as the ambient dimension of the manifold + * (the domain dimension of the function). + */ + template <class Simplex_handle, class Triangulation> + Query_result<Simplex_handle> intersects_boundary(const Simplex_handle& simplex, + const Triangulation& triangulation) const { + //std::cout << "intersects_boundary" << std::endl; + Eigen::VectorXd lambda = compute_boundary_lambda(simplex, triangulation); + return intersection_result(lambda, simplex, triangulation); + } + + /** \brief Returns true if the input point lies inside the piecewise-linear + * domain induced by the given ambient triangulation that defines the relative + * interior of the piecewise-linear approximation of the manifold. + * + * @param p The input point. Needs to have the same dimension as the ambient + * dimension of the manifold (the domain dimension of the function). + * @param triangulation The ambient triangulation. Needs to have the same + * dimension as the ambient dimension of the manifold + * (the domain dimension of the function). + */ + template <class Triangulation> + bool lies_in_domain(const Eigen::VectorXd& p, const Triangulation& triangulation) const { + Eigen::VectorXd pl_p = make_pl_approximation(domain_fun_, triangulation)(p); + return pl_p(0) < 0; + } + + /** \brief Returns the function that defines the interior of the manifold */ + const Function_& function() const { return fun_; } + + /** \brief Constructs an intersection oracle for an implicit manifold potentially + * with boundary from given function and domain. + * + * @param function The input function that represents the implicit manifold + * before the restriction with the domain. + * @param domain_function The input domain function that can be used to define an implicit + * manifold with boundary. + */ + Implicit_manifold_intersection_oracle(const Function_& function, const Domain_function_& domain_function) + : fun_(function), domain_fun_(domain_function) {} + + /** \brief Constructs an intersection oracle for an implicit manifold + * without boundary from a given function. + * + * \details To use this constructor, the template Domain_function_ needs to be left + * at its default value (Gudhi::coxeter_triangulation::Constant_function). + * + * @param function The input function that represents the implicit manifold + * without boundary. + */ + Implicit_manifold_intersection_oracle(const Function_& function) + : fun_(function), domain_fun_(function.amb_d(), 1, Eigen::VectorXd::Constant(1, -1)) {} + + private: + Function_ fun_; + Domain_function_ domain_fun_; +}; + +/** \brief Static constructor of an intersection oracle from a function with a domain. + * + * @param function The input function that represents the implicit manifold + * before the restriction with the domain. + * @param domain_function The input domain function that can be used to define an implicit + * manifold with boundary. + * + * \ingroup coxeter_triangulation + */ +template <class Function_, class Domain_function_> +Implicit_manifold_intersection_oracle<Function_, Domain_function_> make_oracle( + const Function_& function, const Domain_function_& domain_function) { + return Implicit_manifold_intersection_oracle<Function_, Domain_function_>(function, domain_function); +} + +/** \brief Static constructor of an intersection oracle from a function without a domain. + * + * @param function The input function that represents the implicit manifold + * without boundary. + * + * \ingroup coxeter_triangulation + */ +template <class Function_> +Implicit_manifold_intersection_oracle<Function_> make_oracle(const Function_& function) { + return Implicit_manifold_intersection_oracle<Function_>(function); +} + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif diff --git a/src/Coxeter_triangulation/include/gudhi/Manifold_tracing.h b/src/Coxeter_triangulation/include/gudhi/Manifold_tracing.h new file mode 100644 index 00000000..d61bbed7 --- /dev/null +++ b/src/Coxeter_triangulation/include/gudhi/Manifold_tracing.h @@ -0,0 +1,270 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef MANIFOLD_TRACING_H_ +#define MANIFOLD_TRACING_H_ + +#include <gudhi/IO/output_debug_traces_to_html.h> // for DEBUG_TRACES +#include <gudhi/Coxeter_triangulation/Query_result.h> + +#include <boost/functional/hash.hpp> + +#include <Eigen/Dense> + +#include <queue> +#include <unordered_map> + +namespace Gudhi { + +namespace coxeter_triangulation { + +/** + * \ingroup coxeter_triangulation + */ + +/** \class Manifold_tracing + * \brief A class that assembles methods for manifold tracing algorithm. + * + * \tparam Triangulation_ The type of the ambient triangulation. + * Needs to be a model of the concept TriangulationForManifoldTracing. + */ +template <class Triangulation_> +class Manifold_tracing { + public: + using Simplex_handle = typename Triangulation_::Simplex_handle; + + struct Simplex_hash { + typedef Simplex_handle argument_type; + typedef std::size_t result_type; + result_type operator()(const argument_type& s) const noexcept { + return boost::hash<typename Simplex_handle::Vertex>()(s.vertex()); + } + }; + + public: + /** \brief Type of the output simplex map with keys of type Triangulation_::Simplex_handle + * and values of type Eigen::VectorXd. + * This type should be used for the output in the method manifold_tracing_algorithm. + */ + typedef std::unordered_map<Simplex_handle, Eigen::VectorXd, Simplex_hash> Out_simplex_map; + + /** + * \brief Computes the set of k-simplices that intersect + * a boundaryless implicit manifold given by an intersection oracle, where k + * is the codimension of the manifold. + * The computation is based on the seed propagation --- it starts at the + * given seed points and then propagates along the manifold. + * + * \tparam Point_range Range of points of type Eigen::VectorXd. + * \tparam Intersection_oracle Intersection oracle that represents the manifold. + * Needs to be a model of the concept IntersectionOracle. + * + * \param[in] seed_points The range of points on the manifold from which + * the computation begins. + * \param[in] triangulation The ambient triangulation. + * \param[in] oracle The intersection oracle for the manifold. + * The ambient dimension needs to match the dimension of the + * triangulation. + * \param[out] out_simplex_map The output map, where the keys are k-simplices in + * the input triangulation that intersect the input manifold and the mapped values + * are the intersection points. + */ + template <class Point_range, class Intersection_oracle> + void manifold_tracing_algorithm(const Point_range& seed_points, const Triangulation_& triangulation, + const Intersection_oracle& oracle, Out_simplex_map& out_simplex_map) { + std::size_t cod_d = oracle.cod_d(); + std::queue<Simplex_handle> queue; + + for (const auto& p : seed_points) { + Simplex_handle full_simplex = triangulation.locate_point(p); + for (Simplex_handle face : full_simplex.face_range(cod_d)) { + Query_result<Simplex_handle> qr = oracle.intersects(face, triangulation); + if (qr.success && out_simplex_map.emplace(face, qr.intersection).second) { +#ifdef DEBUG_TRACES + mt_seed_inserted_list.push_back(MT_inserted_info(qr, face, false)); +#endif + queue.emplace(face); + break; + } + } + } + + while (!queue.empty()) { + Simplex_handle s = queue.front(); + queue.pop(); + for (auto cof : s.coface_range(cod_d + 1)) { + for (auto face : cof.face_range(cod_d)) { + Query_result<Simplex_handle> qr = oracle.intersects(face, triangulation); + if (qr.success && out_simplex_map.emplace(face, qr.intersection).second) queue.emplace(face); + } + } + } + } + + /** + * \brief Computes the set of k-simplices that intersect + * the dimensional manifold given by an intersection oracle, where k + * is the codimension of the manifold. + * The computation is based on the seed propagation --- it starts at the + * given seed points and then propagates along the manifold. + * + * \tparam Point_range Range of points of type Eigen::VectorXd. + * \tparam Intersection_oracle Intersection oracle that represents the manifold. + * Needs to be a model of the concept IntersectionOracle. + * + * \param[in] seed_points The range of points on the manifold from which + * the computation begins. + * \param[in] triangulation The ambient triangulation. + * \param[in] oracle The intersection oracle for the manifold. + * The ambient dimension needs to match the dimension of the + * triangulation. + * \param[out] interior_simplex_map The output map, where the keys are k-simplices in + * the input triangulation that intersect the relative interior of the input manifold + * and the mapped values are the intersection points. + * \param[out] boundary_simplex_map The output map, where the keys are k-simplices in + * the input triangulation that intersect the boundary of the input manifold + * and the mapped values are the intersection points. + */ + template <class Point_range, class Intersection_oracle> + void manifold_tracing_algorithm(const Point_range& seed_points, const Triangulation_& triangulation, + const Intersection_oracle& oracle, Out_simplex_map& interior_simplex_map, + Out_simplex_map& boundary_simplex_map) { + std::size_t cod_d = oracle.cod_d(); + std::queue<Simplex_handle> queue; + + for (const auto& p : seed_points) { + Simplex_handle full_simplex = triangulation.locate_point(p); + for (Simplex_handle face : full_simplex.face_range(cod_d)) { + auto qr = oracle.intersects(face, triangulation); +#ifdef DEBUG_TRACES + mt_seed_inserted_list.push_back(MT_inserted_info(qr, face, false)); +#endif + if (qr.success) { + if (oracle.lies_in_domain(qr.intersection, triangulation)) { + if (interior_simplex_map.emplace(face, qr.intersection).second) queue.emplace(face); + } else { + for (Simplex_handle cof : face.coface_range(cod_d + 1)) { + auto qrb = oracle.intersects_boundary(cof, triangulation); +#ifdef DEBUG_TRACES + mt_seed_inserted_list.push_back(MT_inserted_info(qrb, cof, true)); +#endif + if (qrb.success) boundary_simplex_map.emplace(cof, qrb.intersection); + } + } + // break; + } + } + } + + while (!queue.empty()) { + Simplex_handle s = queue.front(); + queue.pop(); + for (auto cof : s.coface_range(cod_d + 1)) { + for (auto face : cof.face_range(cod_d)) { + auto qr = oracle.intersects(face, triangulation); +#ifdef DEBUG_TRACES + mt_inserted_list.push_back(MT_inserted_info(qr, face, false)); +#endif + if (qr.success) { + if (oracle.lies_in_domain(qr.intersection, triangulation)) { + if (interior_simplex_map.emplace(face, qr.intersection).second) queue.emplace(face); + } else { + auto qrb = oracle.intersects_boundary(cof, triangulation); +#ifdef DEBUG_TRACES + mt_inserted_list.push_back(MT_inserted_info(qrb, cof, true)); +#endif + if (qrb.success) boundary_simplex_map.emplace(cof, qrb.intersection); + } + } + } + } + } + } + + /** \brief Empty constructor */ + Manifold_tracing() {} +}; + +/** + * \brief Static method for Manifold_tracing<Triangulation_>::manifold_tracing_algorithm + * that computes the set of k-simplices that intersect + * a boundaryless implicit manifold given by an intersection oracle, where k + * is the codimension of the manifold. + * The computation is based on the seed propagation --- it starts at the + * given seed points and then propagates along the manifold. + * + * \tparam Point_range Range of points of type Eigen::VectorXd. + * \tparam Triangulation_ The type of the ambient triangulation. + * Needs to be a model of the concept TriangulationForManifoldTracing. + * \tparam Intersection_oracle Intersection oracle that represents the manifold. + * Needs to be a model of the concept IntersectionOracle. + * \tparam Out_simplex_map Needs to be Manifold_tracing<Triangulation_>::Out_simplex_map. + * + * \param[in] seed_points The range of points on the manifold from which + * the computation begins. + * \param[in] triangulation The ambient triangulation. + * \param[in] oracle The intersection oracle for the manifold. + * The ambient dimension needs to match the dimension of the + * triangulation. + * \param[out] out_simplex_map The output map, where the keys are k-simplices in + * the input triangulation that intersect the input manifold and the mapped values + * are the intersection points. + * + * \ingroup coxeter_triangulation + */ +template <class Point_range, class Triangulation, class Intersection_oracle, class Out_simplex_map> +void manifold_tracing_algorithm(const Point_range& seed_points, const Triangulation& triangulation, + const Intersection_oracle& oracle, Out_simplex_map& out_simplex_map) { + Manifold_tracing<Triangulation> mt; + mt.manifold_tracing_algorithm(seed_points, triangulation, oracle, out_simplex_map); +} + +/** + * \brief Static method for Manifold_tracing<Triangulation_>::manifold_tracing_algorithm + * the dimensional manifold given by an intersection oracle, where k + * is the codimension of the manifold. + * The computation is based on the seed propagation --- it starts at the + * given seed points and then propagates along the manifold. + * + * \tparam Point_range Range of points of type Eigen::VectorXd. + * \tparam Triangulation_ The type of the ambient triangulation. + * Needs to be a model of the concept TriangulationForManifoldTracing. + * \tparam Intersection_oracle Intersection oracle that represents the manifold. + * Needs to be a model of the concept IntersectionOracle. + * \tparam Out_simplex_map Needs to be Manifold_tracing<Triangulation_>::Out_simplex_map. + * + * \param[in] seed_points The range of points on the manifold from which + * the computation begins. + * \param[in] triangulation The ambient triangulation. + * \param[in] oracle The intersection oracle for the manifold. + * The ambient dimension needs to match the dimension of the + * triangulation. + * \param[out] interior_simplex_map The output map, where the keys are k-simplices in + * the input triangulation that intersect the relative interior of the input manifold + * and the mapped values are the intersection points. + * \param[out] boundary_simplex_map The output map, where the keys are k-simplices in + * the input triangulation that intersect the boundary of the input manifold + * and the mapped values are the intersection points. + * + * \ingroup coxeter_triangulation + */ +template <class Point_range, class Triangulation, class Intersection_oracle, class Out_simplex_map> +void manifold_tracing_algorithm(const Point_range& seed_points, const Triangulation& triangulation, + const Intersection_oracle& oracle, Out_simplex_map& interior_simplex_map, + Out_simplex_map& boundary_simplex_map) { + Manifold_tracing<Triangulation> mt; + mt.manifold_tracing_algorithm(seed_points, triangulation, oracle, interior_simplex_map, boundary_simplex_map); +} + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif diff --git a/src/Coxeter_triangulation/include/gudhi/Permutahedral_representation.h b/src/Coxeter_triangulation/include/gudhi/Permutahedral_representation.h new file mode 100644 index 00000000..76438c91 --- /dev/null +++ b/src/Coxeter_triangulation/include/gudhi/Permutahedral_representation.h @@ -0,0 +1,216 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef PERMUTAHEDRAL_REPRESENTATION_H_ +#define PERMUTAHEDRAL_REPRESENTATION_H_ + +#include <gudhi/Permutahedral_representation/Permutahedral_representation_iterators.h> + +#include <utility> // for std::make_pair + +namespace Gudhi { + +namespace coxeter_triangulation { + +/** + * \class Permutahedral_representation + * \brief A class that stores the permutahedral representation of a simplex + * in a Coxeter triangulation or a Freudenthal-Kuhn triangulation. + * + * \ingroup coxeter_triangulation + * + * \details The data structure is a record consisting of a range that + * represents the vertex and a range that represents the ordered set + * partition, both of which identify the simplex in the triangulation. + * + * \tparam Vertex_ needs to be a random-access range. + * \tparam Ordered_set_partition_ needs to be a a random-access range that consists of + * random-access ranges. + */ +template <class Vertex_, class Ordered_set_partition_> +class Permutahedral_representation { + typedef Permutahedral_representation<Vertex_, Ordered_set_partition_> Self; + + public: + /** \brief Type of the vertex. */ + typedef Vertex_ Vertex; + + /** \brief Type of the ordered partition. */ + typedef Ordered_set_partition_ OrderedSetPartition; + + /** \brief Permutahedral_representation constructor from a vertex and an ordered set partition. + * + * @param[in] vertex Vertex. + * @param[in] partition Ordered set partition. + * + * \details If the size of vertex is d, the ranges in partition must consist + * of the integers 0,...,d without repetition or collision between the ranges. + */ + Permutahedral_representation(const Vertex& vertex, const OrderedSetPartition& partition) + : vertex_(vertex), partition_(partition) {} + + /** \brief Constructor for an empty permutahedral representation that does not correspond + * to any simplex. + */ + Permutahedral_representation() {} + + /** \brief Dimension of the simplex. */ + std::size_t dimension() const { return partition_.size() - 1; } + + /** \brief Lexicographically-minimal vertex. */ + Vertex& vertex() { return vertex_; } + + /** \brief Lexicographically-minimal vertex. */ + const Vertex& vertex() const { return vertex_; } + + /** \brief Ordered set partition. */ + OrderedSetPartition& partition() { return partition_; } + + /** \brief Identifying vertex. */ + const OrderedSetPartition& partition() const { return partition_; } + + /** \brief Equality operator. + * Returns true if an only if both vertex and the ordered set partition coincide. + */ + bool operator==(const Permutahedral_representation& other) const { + if (dimension() != other.dimension()) return false; + if (vertex_ != other.vertex_) return false; + for (std::size_t k = 0; k < partition_.size(); ++k) + if (partition_[k] != other.partition_[k]) return false; + return true; + } + + /** \brief Inequality operator. + * Returns true if an only if either vertex or the ordered set partition are different. + */ + bool operator!=(const Permutahedral_representation& other) const { return !(*this == other); } + + typedef Gudhi::coxeter_triangulation::Vertex_iterator<Self> Vertex_iterator; + typedef boost::iterator_range<Vertex_iterator> Vertex_range; + /** \brief Returns a range of vertices of the simplex. + * The type of vertices is Vertex. + */ + Vertex_range vertex_range() const { return Vertex_range(Vertex_iterator(*this), Vertex_iterator()); } + + typedef Gudhi::coxeter_triangulation::Face_iterator<Self> Face_iterator; + typedef boost::iterator_range<Face_iterator> Face_range; + /** \brief Returns a range of permutahedral representations of faces of the simplex. + * @param[in] value_dim The dimension of the faces. Must be between 0 and the dimension of the simplex. + */ + Face_range face_range(std::size_t value_dim) const { + return Face_range(Face_iterator(*this, value_dim), Face_iterator()); + } + + /** \brief Returns a range of permutahedral representations of facets of the simplex. + * The dimension of the simplex must be strictly positive. + */ + Face_range facet_range() const { return Face_range(Face_iterator(*this, dimension() - 1), Face_iterator()); } + + typedef Gudhi::coxeter_triangulation::Coface_iterator<Self> Coface_iterator; + typedef boost::iterator_range<Coface_iterator> Coface_range; + /** \brief Returns a range of permutahedral representations of cofaces of the simplex. + * @param[in] value_dim The dimension of the cofaces. Must be between the dimension of the simplex and the ambient + * dimension (the size of the vertex). + */ + Coface_range coface_range(std::size_t value_dim) const { + return Coface_range(Coface_iterator(*this, value_dim), Coface_iterator()); + } + + /** \brief Returns a range of permutahedral representations of cofacets of the simplex. + * The dimension of the simplex must be strictly different from the ambient dimension (the size of the vertex). + */ + Coface_range cofacet_range() const { + return Coface_range(Coface_iterator(*this, dimension() + 1), Coface_iterator()); + } + + /** \brief Returns true, if the simplex is a face of other simplex. + * + * @param[in] other A simplex that is potential a coface of the current simplex. + */ + bool is_face_of(const Permutahedral_representation& other) const { + using Part = typename OrderedSetPartition::value_type; + + if (other.dimension() < dimension()) return false; + if (other.vertex_.size() != vertex_.size()) + std::cerr << "Error: Permutahedral_representation::is_face_of: incompatible ambient dimensions.\n"; + + Vertex v_self = vertex_, v_other = other.vertex_; + auto self_partition_it = partition_.begin(); + auto other_partition_it = other.partition_.begin(); + while (self_partition_it != partition_.end()) { + while (other_partition_it != other.partition_.end() && v_self != v_other) { + const Part& other_part = *other_partition_it++; + if (other_partition_it == other.partition_.end()) return false; + for (const auto& k : other_part) v_other[k]++; + } + if (other_partition_it == other.partition_.end()) return false; + const Part& self_part = *self_partition_it++; + if (self_partition_it == partition_.end()) return true; + for (const auto& k : self_part) v_self[k]++; + } + return true; + } + + private: + Vertex vertex_; + OrderedSetPartition partition_; +}; + +/** \brief Print a permutahedral representation to a stream. + * \ingroup coxeter_triangulation + * + * @param[in] os The output stream. + * @param[in] simplex A simplex represented by its permutahedral representation. + */ +template <class Vertex, class OrderedSetPartition> +std::ostream& operator<<(std::ostream& os, const Permutahedral_representation<Vertex, OrderedSetPartition>& simplex) { + // vertex part + os << "("; + if (simplex.vertex().empty()) { + os << ")"; + return os; + } + auto v_it = simplex.vertex().begin(); + os << *v_it++; + for (; v_it != simplex.vertex().end(); ++v_it) os << ", " << *v_it; + os << ")"; + + // ordered partition part + using Part = typename OrderedSetPartition::value_type; + auto print_part = [&os](const Part& p) { + os << "{"; + if (p.empty()) { + os << "}"; + } + auto p_it = p.begin(); + os << *p_it++; + for (; p_it != p.end(); ++p_it) os << ", " << *p_it; + os << "}"; + }; + os << " ["; + if (simplex.partition().empty()) { + os << "]"; + return os; + } + auto o_it = simplex.partition().begin(); + print_part(*o_it++); + for (; o_it != simplex.partition().end(); ++o_it) { + os << ", "; + print_part(*o_it); + } + os << "]"; + return os; +} + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif // PERMUTAHEDRAL_REPRESENTATION_H_ diff --git a/src/Coxeter_triangulation/include/gudhi/Permutahedral_representation/Combination_iterator.h b/src/Coxeter_triangulation/include/gudhi/Permutahedral_representation/Combination_iterator.h new file mode 100644 index 00000000..5f382e31 --- /dev/null +++ b/src/Coxeter_triangulation/include/gudhi/Permutahedral_representation/Combination_iterator.h @@ -0,0 +1,83 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef PERMUTAHEDRAL_REPRESENTATION_COMBINATION_ITERATOR_H_ +#define PERMUTAHEDRAL_REPRESENTATION_COMBINATION_ITERATOR_H_ + +#include <vector> +#include <boost/range/iterator_range.hpp> + +namespace Gudhi { + +namespace coxeter_triangulation { + +typedef unsigned uint; + +/** \brief Class that allows the user to generate combinations of + * k elements in a set of n elements. + * Based on the algorithm by Mifsud. + */ +class Combination_iterator + : public boost::iterator_facade<Combination_iterator, std::vector<uint> const, boost::forward_traversal_tag> { + typedef std::vector<uint> value_t; + + protected: + friend class boost::iterator_core_access; + + bool equal(Combination_iterator const& other) const { return (is_end_ && other.is_end_); } + + value_t const& dereference() const { return value_; } + + void increment() { + if (value_[0] == n_ - k_) { + is_end_ = true; + return; + } + uint j = k_ - 1; + if (value_[j] < n_ - 1) { + value_[j]++; + return; + } + for (; j > 0; --j) + if (value_[j - 1] < n_ - k_ + j - 1) { + value_[j - 1]++; + for (uint s = j; s < k_; s++) value_[s] = value_[j - 1] + s - (j - 1); + return; + } + } + + public: + Combination_iterator(const uint& n, const uint& k) : value_(k), is_end_(n == 0), n_(n), k_(k) { + for (uint i = 0; i < k; ++i) value_[i] = i; + } + + // Used for the creating an end iterator + Combination_iterator() : is_end_(true), n_(0), k_(0) {} + + void reinitialize() { + if (n_ > 0) { + is_end_ = false; + for (uint i = 0; i < n_; ++i) value_[i] = i; + } + } + + private: + value_t value_; // the dereference value + bool is_end_; // is true when the current permutation is the final one + + uint n_; + uint k_; +}; + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif diff --git a/src/Coxeter_triangulation/include/gudhi/Permutahedral_representation/Integer_combination_iterator.h b/src/Coxeter_triangulation/include/gudhi/Permutahedral_representation/Integer_combination_iterator.h new file mode 100644 index 00000000..594b6fbf --- /dev/null +++ b/src/Coxeter_triangulation/include/gudhi/Permutahedral_representation/Integer_combination_iterator.h @@ -0,0 +1,113 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef PERMUTAHEDRAL_REPRESENTATION_INTEGER_COMBINATION_ITERATOR_H_ +#define PERMUTAHEDRAL_REPRESENTATION_INTEGER_COMBINATION_ITERATOR_H_ + +#include <vector> +#include <boost/range/iterator_range.hpp> + +namespace Gudhi { + +namespace coxeter_triangulation { + +typedef unsigned uint; + +/** \brief Class that allows the user to generate combinations of + * k elements in a set of n elements. + * Based on the algorithm by Mifsud. + */ +class Integer_combination_iterator + : public boost::iterator_facade<Integer_combination_iterator, std::vector<uint> const, + boost::forward_traversal_tag> { + using value_t = std::vector<uint>; + + private: + friend class boost::iterator_core_access; + + bool equal(Integer_combination_iterator const& other) const { return (is_end_ && other.is_end_); } + + value_t const& dereference() const { return value_; } + + void increment() { + uint j1 = 0; + uint s = 0; + while (value_[j1] == 0 && j1 < k_) j1++; + uint j2 = j1 + 1; + while (value_[j2] == bounds_[j2]) { + if (bounds_[j2] != 0) { + s += value_[j1]; + value_[j1] = 0; + j1 = j2; + } + j2++; + } + if (j2 >= k_) { + is_end_ = true; + return; + } + s += value_[j1] - 1; + value_[j1] = 0; + value_[j2]++; + uint i = 0; + while (s >= bounds_[i]) { + value_[i] = bounds_[i]; + s -= bounds_[i]; + i++; + } + value_[i++] = s; + } + + public: + template <class Bound_range> + Integer_combination_iterator(const uint& n, const uint& k, const Bound_range& bounds) + : value_(k + 2), is_end_(n == 0 || k == 0), k_(k) { + bounds_.reserve(k + 2); + uint sum_radices = 0; + for (auto b : bounds) { + bounds_.push_back(b); + sum_radices += b; + } + bounds_.push_back(2); + bounds_.push_back(1); + if (n > sum_radices) { + is_end_ = true; + return; + } + uint i = 0; + uint s = n; + while (s >= bounds_[i]) { + value_[i] = bounds_[i]; + s -= bounds_[i]; + i++; + } + value_[i++] = s; + + while (i < k_) value_[i++] = 0; + value_[k] = 1; + value_[k + 1] = 0; + } + + // Used for the creating an end iterator + Integer_combination_iterator() : is_end_(true), k_(0) {} + + private: + value_t value_; // the dereference value + bool is_end_; // is true when the current integer combination is the final one + + uint k_; + std::vector<uint> bounds_; +}; + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif diff --git a/src/Coxeter_triangulation/include/gudhi/Permutahedral_representation/Ordered_set_partition_iterator.h b/src/Coxeter_triangulation/include/gudhi/Permutahedral_representation/Ordered_set_partition_iterator.h new file mode 100644 index 00000000..866079fa --- /dev/null +++ b/src/Coxeter_triangulation/include/gudhi/Permutahedral_representation/Ordered_set_partition_iterator.h @@ -0,0 +1,93 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef PERMUTAHEDRAL_REPRESENTATION_ORDERED_SET_PARTITION_ITERATOR_H_ +#define PERMUTAHEDRAL_REPRESENTATION_ORDERED_SET_PARTITION_ITERATOR_H_ + +#include <vector> +#include <limits> + +#include <gudhi/Permutahedral_representation/Permutation_iterator.h> +#include <gudhi/Permutahedral_representation/Set_partition_iterator.h> + +#include <boost/range/iterator_range.hpp> + +namespace Gudhi { + +namespace coxeter_triangulation { + +typedef unsigned uint; + +/** \brief Class that represents an ordered set partition of a set {0,...,n-1} in k parts as + * a pair of an unordered set partition given in lexicographic order and + * a permutation of the parts. + */ +struct Ordered_set_partition { + Set_partition_iterator s_it_; + Permutation_iterator p_it_; + + // Ordered_set_partition(const Set_partition_iterator& s_it, const Permutation_iterator& p_it) + // : s_it_(s_it), p_it_(p_it) {} + + const std::vector<uint> operator[](const uint& i) const { return (*s_it_)[(*p_it_)[i]]; } + + std::size_t size() const { return s_it_->size(); } +}; + +/** \brief Class that allows the user to generate set partitions of a set {0,...,n-1} in k parts. + * + */ +class Ordered_set_partition_iterator + : public boost::iterator_facade<Ordered_set_partition_iterator, Ordered_set_partition const, + boost::forward_traversal_tag> { + using value_t = Ordered_set_partition; + + private: + friend class boost::iterator_core_access; + + bool equal(Ordered_set_partition_iterator const& other) const { return (is_end_ && other.is_end_); } + + value_t const& dereference() const { return value_; } + + void increment() { + if (++value_.p_it_ == p_end_) { + if (++value_.s_it_ == s_end_) { + is_end_ = true; + return; + } else + value_.p_it_.reinitialize(); + } + } + + public: + Ordered_set_partition_iterator(const uint& n, const uint& k) + : value_({Set_partition_iterator(n, k), Permutation_iterator(k)}), is_end_(n == 0) {} + + // Used for the creating an end iterator + Ordered_set_partition_iterator() : is_end_(true) {} + + void reinitialize() { + is_end_ = false; + value_.p_it_.reinitialize(); + value_.s_it_.reinitialize(); + } + + private: + Set_partition_iterator s_end_; // Set partition iterator and the corresponding end iterator + Permutation_iterator p_end_; // Permutation iterator and the corresponding end iterator + value_t value_; // the dereference value + bool is_end_; // is true when the current permutation is the final one +}; + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif diff --git a/src/Coxeter_triangulation/include/gudhi/Permutahedral_representation/Permutahedral_representation_iterators.h b/src/Coxeter_triangulation/include/gudhi/Permutahedral_representation/Permutahedral_representation_iterators.h new file mode 100644 index 00000000..1a63d2f7 --- /dev/null +++ b/src/Coxeter_triangulation/include/gudhi/Permutahedral_representation/Permutahedral_representation_iterators.h @@ -0,0 +1,256 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef PERMUTAHEDRAL_REPRESENTATION_PERMUTAHEDRAL_REPRESENTATION_ITERATORS_H_ +#define PERMUTAHEDRAL_REPRESENTATION_PERMUTAHEDRAL_REPRESENTATION_ITERATORS_H_ + +#include <gudhi/Permutahedral_representation/Size_range.h> +#include <gudhi/Permutahedral_representation/Ordered_set_partition_iterator.h> +#include <gudhi/Permutahedral_representation/Integer_combination_iterator.h> +#include <gudhi/Permutahedral_representation/Combination_iterator.h> +#include <gudhi/Permutahedral_representation/face_from_indices.h> +#include <boost/iterator/iterator_facade.hpp> + +#include <vector> +#include <iostream> +#include <algorithm> // for std::find + +namespace Gudhi { + +namespace coxeter_triangulation { + +/** \addtogroup coxeter_triangulation + * Iterator types for Permutahedral_representation + * @{ + */ + +/** \brief Iterator over the vertices of a simplex + * represented by its permutahedral representation. + * + * Forward iterator, 'value_type' is Permutahedral_representation::Vertex.*/ +template <class Permutahedral_representation> +class Vertex_iterator + : public boost::iterator_facade<Vertex_iterator<Permutahedral_representation>, + typename Permutahedral_representation::Vertex const, boost::forward_traversal_tag> { + private: + friend class boost::iterator_core_access; + + using Vertex = typename Permutahedral_representation::Vertex; + using Ordered_partition = typename Permutahedral_representation::OrderedSetPartition; + + using value_t = Vertex; + + bool equal(Vertex_iterator const& other) const { return (is_end_ && other.is_end_); } + + value_t const& dereference() const { return value_; } + + void update_value() { + std::size_t d = value_.size(); + for (auto i : *o_it_) + if (i != d) + value_[i]++; + else + for (std::size_t j = 0; j < d; j++) value_[j]--; + } + + void increment() { + if (is_end_) return; + update_value(); + if (++o_it_ == o_end_) is_end_ = true; + } + + public: + Vertex_iterator(const Permutahedral_representation& simplex) + : o_it_(simplex.partition().begin()), + o_end_(simplex.partition().end()), + value_(simplex.vertex()), + is_end_(o_it_ == o_end_) {} + + Vertex_iterator() : is_end_(true) {} + + private: + typename Ordered_partition::const_iterator o_it_, o_end_; + value_t value_; + bool is_end_; + +}; // Vertex_iterator + +/*---------------------------------------------------------------------------*/ +/** \brief Iterator over the k-faces of a simplex + * given by its permutahedral representation. + * + * Forward iterator, value_type is Permutahedral_representation. */ +template <class Permutahedral_representation> +class Face_iterator : public boost::iterator_facade<Face_iterator<Permutahedral_representation>, + Permutahedral_representation const, boost::forward_traversal_tag> { + using value_t = Permutahedral_representation; + + private: + friend class boost::iterator_core_access; + + using Vertex = typename Permutahedral_representation::Vertex; + using Ordered_partition = typename Permutahedral_representation::OrderedSetPartition; + + bool equal(Face_iterator const& other) const { return (is_end_ && other.is_end_); } + + value_t const& dereference() const { return value_; } + + void increment() { + if (++c_it_ == c_end_) { + is_end_ = true; + return; + } + update_value(); + } + + void update_value() { + // Combination *c_it_ is supposed to be sorted in increasing order + value_ = face_from_indices<Permutahedral_representation>(simplex_, *c_it_); + } + + public: + Face_iterator(const Permutahedral_representation& simplex, const uint& k) + : simplex_(simplex), + k_(k), + l_(simplex.dimension()), + c_it_(l_ + 1, k_ + 1), + is_end_(k_ > l_), + value_({Vertex(simplex.vertex().size()), Ordered_partition(k + 1)}) { + update_value(); + } + + // Used for the creating an end iterator + Face_iterator() : is_end_(true) {} + + private: + Permutahedral_representation simplex_; // Input simplex + uint k_; + uint l_; // Dimension of the input simplex + Combination_iterator c_it_, c_end_; // indicates the vertices in the current face + + bool is_end_; // is true when the current permutation is the final one + value_t value_; // the dereference value + +}; // Face_iterator + +/*---------------------------------------------------------------------------*/ +/** \brief Iterator over the k-cofaces of a simplex + * given by its permutahedral representation. + * + * Forward iterator, value_type is Permutahedral_representation. */ +template <class Permutahedral_representation> +class Coface_iterator + : public boost::iterator_facade<Coface_iterator<Permutahedral_representation>, Permutahedral_representation const, + boost::forward_traversal_tag> { + using value_t = Permutahedral_representation; + + private: + friend class boost::iterator_core_access; + + using Vertex = typename Permutahedral_representation::Vertex; + using Ordered_partition = typename Permutahedral_representation::OrderedSetPartition; + + bool equal(Coface_iterator const& other) const { return (is_end_ && other.is_end_); } + + value_t const& dereference() const { return value_; } + + void increment() { + uint i = 0; + for (; i < k_ + 1; i++) { + if (++(o_its_[i]) != o_end_) break; + } + if (i == k_ + 1) { + if (++i_it_ == i_end_) { + is_end_ = true; + return; + } + o_its_.clear(); + for (uint j = 0; j < k_ + 1; j++) + o_its_.emplace_back(simplex_.partition()[j].size(), (*i_it_)[j] + 1); + } else + for (uint j = 0; j < i; j++) o_its_[j].reinitialize(); + update_value(); + } + + void update_value() { + value_.vertex() = simplex_.vertex(); + for (auto& p : value_.partition()) p.clear(); + uint u_ = 0; // the part in o_its_[k_] that contains t_ + for (; u_ <= (*i_it_)[k_]; u_++) { + auto range = (*o_its_[k_])[u_]; + if (std::find(range.begin(), range.end(), t_) != range.end()) break; + } + uint i = 0; + for (uint j = u_ + 1; j <= (*i_it_)[k_]; j++, i++) + for (uint b : (*o_its_[k_])[j]) { + uint c = simplex_.partition()[k_][b]; + value_.partition()[i].push_back(c); + value_.vertex()[c]--; + } + for (uint h = 0; h < k_; h++) + for (uint j = 0; j <= (*i_it_)[h]; j++, i++) { + for (uint b : (*o_its_[h])[j]) value_.partition()[i].push_back(simplex_.partition()[h][b]); + } + for (uint j = 0; j <= u_; j++, i++) + for (uint b : (*o_its_[k_])[j]) value_.partition()[i].push_back(simplex_.partition()[k_][b]); + // sort the values in each part (probably not needed) + for (auto& part : value_.partition()) std::sort(part.begin(), part.end()); + } + + public: + Coface_iterator(const Permutahedral_representation& simplex, const uint& l) + : simplex_(simplex), + d_(simplex.vertex().size()), + l_(l), + k_(simplex.dimension()), + i_it_(l_ - k_, k_ + 1, Size_range<Ordered_partition>(simplex.partition())), + is_end_(k_ > l_), + value_({Vertex(d_), Ordered_partition(l_ + 1)}) { + uint j = 0; + for (; j < simplex_.partition()[k_].size(); j++) + if (simplex_.partition()[k_][j] == d_) { + t_ = j; + break; + } + if (j == simplex_.partition()[k_].size()) { + std::cerr << "Coface iterator: the argument simplex is not a permutahedral representation\n"; + is_end_ = true; + return; + } + for (uint i = 0; i < k_ + 1; i++) + o_its_.emplace_back(simplex_.partition()[i].size(), (*i_it_)[i] + 1); + update_value(); + } + + // Used for the creating an end iterator + Coface_iterator() : is_end_(true) {} + + private: + Permutahedral_representation simplex_; // Input simplex + uint d_; // Ambient dimension + uint l_; // Dimension of the coface + uint k_; // Dimension of the input simplex + uint t_; // The position of d in simplex_.partition()[k_] + Integer_combination_iterator i_it_, i_end_; // indicates in how many parts each simplex_[i] is subdivided + std::vector<Ordered_set_partition_iterator> o_its_; // indicates subdivision for each simplex_[i] + Ordered_set_partition_iterator o_end_; // one end for all o_its_ + + bool is_end_; // is true when the current permutation is the final one + value_t value_; // the dereference value + +}; // Coface_iterator + +/** @} */ + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif diff --git a/src/Coxeter_triangulation/include/gudhi/Permutahedral_representation/Permutation_iterator.h b/src/Coxeter_triangulation/include/gudhi/Permutahedral_representation/Permutation_iterator.h new file mode 100644 index 00000000..0f91d41c --- /dev/null +++ b/src/Coxeter_triangulation/include/gudhi/Permutahedral_representation/Permutation_iterator.h @@ -0,0 +1,120 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef PERMUTAHEDRAL_REPRESENTATION_PERMUTATION_ITERATOR_H_ +#define PERMUTAHEDRAL_REPRESENTATION_PERMUTATION_ITERATOR_H_ + +#include <cstdlib> // for std::size_t +#include <vector> + +#include <boost/range/iterator_range.hpp> + +namespace Gudhi { + +namespace coxeter_triangulation { + +typedef unsigned uint; + +/** \brief Class that allows the user to generate permutations. + * Based on the optimization of the Heap's algorithm by Sedgewick. + */ +class Permutation_iterator + : public boost::iterator_facade<Permutation_iterator, std::vector<uint> const, boost::forward_traversal_tag> { + using value_t = std::vector<uint>; + + private: + friend class boost::iterator_core_access; + + bool equal(Permutation_iterator const& other) const { return (is_end_ && other.is_end_); } + + value_t const& dereference() const { return value_; } + + void swap_two_indices(std::size_t i, std::size_t j) { + uint t = value_[i]; + value_[i] = value_[j]; + value_[j] = t; + } + + void elementary_increment() { + uint j = 0; + while (d_[j] == j + 1) { + d_[j] = 0; + ++j; + } + if (j == n_ - 1) { + is_end_ = true; + return; + } + uint k = j + 1; + uint x = (k % 2 ? d_[j] : 0); + swap_two_indices(k, x); + ++d_[j]; + } + + void elementary_increment_optim_3() { + if (ct_ != 0) { + --ct_; + swap_two_indices(1 + (ct_ % 2), 0); + } else { + ct_ = 5; + uint j = 2; + while (d_[j] == j + 1) { + d_[j] = 0; + ++j; + } + if (j == n_ - 1) { + is_end_ = true; + return; + } + uint k = j + 1; + uint x = (k % 2 ? d_[j] : 0); + swap_two_indices(k, x); + ++d_[j]; + } + } + + void increment() { + if (optim_3_) + elementary_increment_optim_3(); + else + elementary_increment(); + } + + public: + Permutation_iterator(const uint& n) : value_(n), is_end_(n == 0), optim_3_(n >= 3), n_(n), d_(n), ct_(5) { + for (uint i = 0; i < n; ++i) { + value_[i] = i; + d_[i] = 0; + } + if (n > 0) d_[n - 1] = -1; + } + + // Used for the creating an end iterator + Permutation_iterator() : is_end_(true), n_(0) {} + + void reinitialize() { + if (n_ > 0) is_end_ = false; + } + + private: + value_t value_; // the dereference value + bool is_end_; // is true when the current permutation is the final one + bool optim_3_; // true if n>=3. for n >= 3, the algorithm is optimized + + uint n_; + std::vector<uint> d_; // mix radix digits with radix [2 3 4 ... n-1 (sentinel=-1)] + uint ct_; // counter with values in {0,...,5} used in the n>=3 optimization. +}; + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif diff --git a/src/Coxeter_triangulation/include/gudhi/Permutahedral_representation/Set_partition_iterator.h b/src/Coxeter_triangulation/include/gudhi/Permutahedral_representation/Set_partition_iterator.h new file mode 100644 index 00000000..94ac10c2 --- /dev/null +++ b/src/Coxeter_triangulation/include/gudhi/Permutahedral_representation/Set_partition_iterator.h @@ -0,0 +1,111 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef PERMUTAHEDRAL_REPRESENTATION_SET_PARTITION_ITERATOR_H_ +#define PERMUTAHEDRAL_REPRESENTATION_SET_PARTITION_ITERATOR_H_ + +#include <vector> +#include <limits> +#include <boost/range/iterator_range.hpp> + +namespace Gudhi { + +namespace coxeter_triangulation { + +typedef unsigned uint; + +/** \brief Class that allows the user to generate set partitions of a set {0,...,n-1} in k parts. + * + */ +class Set_partition_iterator + : public boost::iterator_facade<Set_partition_iterator, std::vector<std::vector<uint>> const, + boost::forward_traversal_tag> { + using value_t = std::vector<std::vector<uint>>; + + private: + friend class boost::iterator_core_access; + + bool equal(Set_partition_iterator const& other) const { return (is_end_ && other.is_end_); } + + value_t const& dereference() const { return value_; } + + void update_value() { + for (uint i = 0; i < k_; i++) value_[i].clear(); + for (uint i = 0; i < n_; i++) value_[rgs_[i]].push_back(i); + } + + void increment() { + if (k_ <= 1) { + is_end_ = true; + return; + } + uint i = n_ - 1; + while (rgs_[i] + 1 > max_[i] || rgs_[i] + 1 >= k_) i--; + if (i == 0) { + is_end_ = true; + return; + } + rgs_[i]++; + uint mm = max_[i]; + mm += (rgs_[i] >= mm); + max_[i + 1] = mm; + while (++i < n_) { + rgs_[i] = 0; + max_[i + 1] = mm; + } + uint p = k_; + if (mm < p) do { + max_[i] = p; + --i; + --p; + rgs_[i] = p; + } while (max_[i] < p); + update_value(); + } + + public: + Set_partition_iterator(const uint& n, const uint& k) + : value_(k), rgs_(n, 0), max_(n + 1), is_end_(n == 0), n_(n), k_(k) { + max_[0] = std::numeric_limits<uint>::max(); + for (uint i = 0; i <= n - k; ++i) value_[0].push_back(i); + for (uint i = n - k + 1, j = 1; i < n; ++i, ++j) { + rgs_[i] = j; + value_[j].push_back(i); + } + for (uint i = 1; i <= n; i++) max_[i] = rgs_[i - 1] + 1; + update_value(); + } + + // Used for creating an end iterator + Set_partition_iterator() : is_end_(true), n_(0), k_(0) {} + + void reinitialize() { + if (n_ > 0) is_end_ = false; + for (uint i = 0; i <= n_ - k_; ++i) rgs_[i] = 0; + for (uint i = n_ - k_ + 1, j = 1; i < n_; ++i, ++j) rgs_[i] = j; + for (uint i = 1; i <= n_; i++) max_[i] = rgs_[i - 1] + 1; + update_value(); + } + + private: + value_t value_; // the dereference value + std::vector<uint> rgs_; // restricted growth string + std::vector<uint> max_; // max_[i] = max(rgs_[0],...,rgs[i-1]) + 1 + bool is_end_; // is true when the current permutation is the final one + + uint n_; + uint k_; +}; + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif diff --git a/src/Coxeter_triangulation/include/gudhi/Permutahedral_representation/Simplex_comparator.h b/src/Coxeter_triangulation/include/gudhi/Permutahedral_representation/Simplex_comparator.h new file mode 100644 index 00000000..905d68d5 --- /dev/null +++ b/src/Coxeter_triangulation/include/gudhi/Permutahedral_representation/Simplex_comparator.h @@ -0,0 +1,54 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef PERMUTAHEDRAL_REPRESENTATION_SIMPLEX_COMPARATOR_H_ +#define PERMUTAHEDRAL_REPRESENTATION_SIMPLEX_COMPARATOR_H_ + +namespace Gudhi { + +namespace coxeter_triangulation { + +/** \class Simplex_comparator + * \brief A comparator class for Permutahedral_representation. + * The comparison is in lexicographic order first on + * vertices and then on ordered partitions with sorted parts. + * The lexicographic order forces that any face is larger than + * a coface. + * + * \tparam Permutahdral_representation_ Needs to be + * Permutahedral_representation<Vertex_, Ordered_set_partition_> + * + * \ingroup coxeter_triangulation + */ +template <class Permutahedral_representation_> +struct Simplex_comparator { + /** \brief Comparison between two permutahedral representations. + * Both permutahedral representations need to be valid and + * the vertices of both permutahedral representations need to be of the same size. + */ + bool operator()(const Permutahedral_representation_& lhs, const Permutahedral_representation_& rhs) const { + if (lhs.vertex() < rhs.vertex()) return true; + if (lhs.vertex() > rhs.vertex()) return false; + + if (lhs.partition().size() > rhs.partition().size()) return true; + if (lhs.partition().size() < rhs.partition().size()) return false; + + if (lhs.partition() < rhs.partition()) return true; + if (lhs.partition() > rhs.partition()) return false; + + return false; + } +}; + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif diff --git a/src/Coxeter_triangulation/include/gudhi/Permutahedral_representation/Size_range.h b/src/Coxeter_triangulation/include/gudhi/Permutahedral_representation/Size_range.h new file mode 100644 index 00000000..6b137744 --- /dev/null +++ b/src/Coxeter_triangulation/include/gudhi/Permutahedral_representation/Size_range.h @@ -0,0 +1,73 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef PERMUTAHEDRAL_REPRESENTATION_SIZE_RANGE_H_ +#define PERMUTAHEDRAL_REPRESENTATION_SIZE_RANGE_H_ + +#include <cstdlib> // for std::size_t + +#include <boost/range/iterator_range.hpp> + +namespace Gudhi { + +namespace coxeter_triangulation { + +/** \brief Auxiliary iterator class for sizes of parts in an ordered set partition. + */ +template <class T_it> +class Size_iterator + : public boost::iterator_facade<Size_iterator<T_it>, std::size_t const, boost::forward_traversal_tag> { + friend class boost::iterator_core_access; + + private: + bool equal(Size_iterator const& other) const { return (is_end_ && other.is_end_); } + + std::size_t const& dereference() const { return value_; } + + void increment() { + if (++t_it_ == t_end_) { + is_end_ = true; + return; + } + value_ = t_it_->size() - 1; + } + + public: + Size_iterator(const T_it& t_begin, const T_it& t_end) : t_it_(t_begin), t_end_(t_end), is_end_(t_begin == t_end) { + if (!is_end_) value_ = t_it_->size() - 1; + } + + private: + T_it t_it_, t_end_; + bool is_end_; + std::size_t value_; +}; + +template <class T> +class Size_range { + const T& t_; + + public: + typedef Size_iterator<typename T::const_iterator> iterator; + + Size_range(const T& t) : t_(t) {} + + std::size_t operator[](std::size_t i) const { return t_[i].size() - 1; } + + iterator begin() const { return iterator(t_.begin(), t_.end()); } + + iterator end() const { return iterator(t_.end(), t_.end()); } +}; + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif diff --git a/src/Coxeter_triangulation/include/gudhi/Permutahedral_representation/face_from_indices.h b/src/Coxeter_triangulation/include/gudhi/Permutahedral_representation/face_from_indices.h new file mode 100644 index 00000000..47120689 --- /dev/null +++ b/src/Coxeter_triangulation/include/gudhi/Permutahedral_representation/face_from_indices.h @@ -0,0 +1,66 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#ifndef PERMUTAHEDRAL_REPRESENTATION_FACE_FROM_INDICES_H_ +#define PERMUTAHEDRAL_REPRESENTATION_FACE_FROM_INDICES_H_ + +#include <cstdlib> // for std::size_t +#include <algorithm> + +namespace Gudhi { + +namespace coxeter_triangulation { + +/** \brief Computes the permutahedral representation of a face of a given simplex + * and a range of the vertex indices that compose the face. + * + * \tparam Permutahedral_representation has to be Permutahedral_representation + * \tparam Index_range is a range of unsigned integers taking values in 0,...,k, + * where k is the dimension of the simplex simplex. + * + * @param[in] simplex Input simplex. + * @param[in] indices Input range of indices. + */ +template <class Permutahedral_representation, class Index_range> +Permutahedral_representation face_from_indices(const Permutahedral_representation& simplex, + const Index_range& indices) { + using range_index = typename Index_range::value_type; + using Ordered_set_partition = typename Permutahedral_representation::OrderedSetPartition; + using Part = typename Ordered_set_partition::value_type; + using part_index = typename Part::value_type; + Permutahedral_representation value; + std::size_t d = simplex.vertex().size(); + value.vertex() = simplex.vertex(); + std::size_t k = indices.size() - 1; + value.partition().resize(k + 1); + std::size_t l = simplex.partition().size() - 1; + for (std::size_t h = 1; h < k + 1; h++) + for (range_index i = indices[h - 1]; i < indices[h]; i++) + for (part_index j : simplex.partition()[i]) value.partition()[h - 1].push_back(j); + for (range_index i = indices[k]; i < l + 1; i++) + for (part_index j : simplex.partition()[i]) value.partition()[k].push_back(j); + for (range_index i = 0; i < indices[0]; i++) + for (part_index j : simplex.partition()[i]) { + if (j != d) + value.vertex()[j]++; + else + for (std::size_t l = 0; l < d; l++) value.vertex()[l]--; + value.partition()[k].push_back(j); + } + // sort the values in each part (probably not needed) + for (auto& part : value.partition()) std::sort(part.begin(), part.end()); + return value; +} + +} // namespace coxeter_triangulation + +} // namespace Gudhi + +#endif diff --git a/src/Coxeter_triangulation/test/CMakeLists.txt b/src/Coxeter_triangulation/test/CMakeLists.txt new file mode 100644 index 00000000..74ded91e --- /dev/null +++ b/src/Coxeter_triangulation/test/CMakeLists.txt @@ -0,0 +1,30 @@ +project(Coxeter_triangulation_test) + +include(GUDHI_boost_test) + +if (NOT EIGEN3_VERSION VERSION_LESS 3.1.0) + add_executable ( Coxeter_triangulation_permutahedral_representation_test perm_rep_test.cpp ) + gudhi_add_boost_test(Coxeter_triangulation_permutahedral_representation_test) + + add_executable ( Coxeter_triangulation_freudenthal_triangulation_test freud_triang_test.cpp ) + gudhi_add_boost_test(Coxeter_triangulation_freudenthal_triangulation_test) + + add_executable ( Coxeter_triangulation_functions_test function_test.cpp ) + gudhi_add_boost_test(Coxeter_triangulation_functions_test) + + # because of random_orthogonal_matrix inclusion + if (NOT CGAL_VERSION VERSION_LESS 4.11.0) + add_executable ( Coxeter_triangulation_random_orthogonal_matrix_function_test random_orthogonal_matrix_function_test.cpp ) + target_link_libraries(Coxeter_triangulation_random_orthogonal_matrix_function_test ${CGAL_LIBRARY}) + gudhi_add_boost_test(Coxeter_triangulation_random_orthogonal_matrix_function_test) + endif() + + add_executable ( Coxeter_triangulation_oracle_test oracle_test.cpp ) + gudhi_add_boost_test(Coxeter_triangulation_oracle_test) + + add_executable ( Coxeter_triangulation_manifold_tracing_test manifold_tracing_test.cpp ) + gudhi_add_boost_test(Coxeter_triangulation_manifold_tracing_test) + + add_executable ( Coxeter_triangulation_cell_complex_test cell_complex_test.cpp ) + gudhi_add_boost_test(Coxeter_triangulation_cell_complex_test) +endif()
\ No newline at end of file diff --git a/src/Coxeter_triangulation/test/cell_complex_test.cpp b/src/Coxeter_triangulation/test/cell_complex_test.cpp new file mode 100644 index 00000000..4f7f3ec5 --- /dev/null +++ b/src/Coxeter_triangulation/test/cell_complex_test.cpp @@ -0,0 +1,59 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#define BOOST_TEST_DYN_LINK +#define BOOST_TEST_MODULE "cell_complex" +#include <boost/test/unit_test.hpp> +#include <gudhi/Unitary_tests_utils.h> + +#include <gudhi/Debug_utils.h> +#include <gudhi/IO/output_debug_traces_to_html.h> +#include <iostream> + +#include <gudhi/Coxeter_triangulation.h> +#include <gudhi/Functions/Function_Sm_in_Rd.h> +#include <gudhi/Functions/Function_torus_in_R3.h> +#include <gudhi/Implicit_manifold_intersection_oracle.h> +#include <gudhi/Manifold_tracing.h> +#include <gudhi/Coxeter_triangulation/Cell_complex/Cell_complex.h> + +using namespace Gudhi::coxeter_triangulation; + +BOOST_AUTO_TEST_CASE(cell_complex) { + double radius = 1.1111; + Function_torus_in_R3 fun_torus(radius, 3 * radius); + Eigen::VectorXd seed = fun_torus.seed(); + Function_Sm_in_Rd fun_bound(2.5 * radius, 2, seed); + + auto oracle = make_oracle(fun_torus, fun_bound); + double lambda = 0.2; + Coxeter_triangulation<> cox_tr(oracle.amb_d()); + cox_tr.change_offset(Eigen::VectorXd::Random(oracle.amb_d())); + cox_tr.change_matrix(lambda * cox_tr.matrix()); + + using MT = Manifold_tracing<Coxeter_triangulation<> >; + using Out_simplex_map = typename MT::Out_simplex_map; + std::vector<Eigen::VectorXd> seed_points(1, seed); + Out_simplex_map interior_simplex_map, boundary_simplex_map; + manifold_tracing_algorithm(seed_points, cox_tr, oracle, interior_simplex_map, boundary_simplex_map); + + std::size_t intr_d = oracle.amb_d() - oracle.cod_d(); + Cell_complex<Out_simplex_map> cell_complex(intr_d); + cell_complex.construct_complex(interior_simplex_map, boundary_simplex_map); + + std::size_t interior_sc_map_size0 = cell_complex.interior_simplex_cell_map(0).size(); + std::size_t interior_sc_map_size1 = cell_complex.interior_simplex_cell_map(1).size(); + std::size_t interior_sc_map_size2 = cell_complex.interior_simplex_cell_map(2).size(); + std::size_t boundary_sc_map_size0 = cell_complex.boundary_simplex_cell_map(0).size(); + std::size_t boundary_sc_map_size1 = cell_complex.boundary_simplex_cell_map(1).size(); + BOOST_CHECK(interior_simplex_map.size() == interior_sc_map_size0); + BOOST_CHECK(boundary_sc_map_size0 - boundary_sc_map_size1 == 0); + BOOST_CHECK(interior_sc_map_size0 - interior_sc_map_size1 + interior_sc_map_size2 == 0); +} diff --git a/src/Coxeter_triangulation/test/freud_triang_test.cpp b/src/Coxeter_triangulation/test/freud_triang_test.cpp new file mode 100644 index 00000000..2cf8f00e --- /dev/null +++ b/src/Coxeter_triangulation/test/freud_triang_test.cpp @@ -0,0 +1,114 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#define BOOST_TEST_DYN_LINK +#define BOOST_TEST_MODULE "freudenthal_triangulation" +#include <boost/test/unit_test.hpp> + +#include <gudhi/Unitary_tests_utils.h> +#include <gudhi/Freudenthal_triangulation.h> +#include <gudhi/Coxeter_triangulation.h> + +BOOST_AUTO_TEST_CASE(freudenthal_triangulation) { + // Point location check + typedef std::vector<double> Point; + typedef Gudhi::coxeter_triangulation::Freudenthal_triangulation<> FK_triangulation; + typedef typename FK_triangulation::Simplex_handle Simplex_handle; + typedef typename FK_triangulation::Vertex_handle Vertex_handle; + typedef typename Simplex_handle::OrderedSetPartition Ordered_set_partition; + typedef typename Ordered_set_partition::value_type Part; + + FK_triangulation tr(3); + + // Point location check + { + Point point({3, -1, 0}); + Simplex_handle s = tr.locate_point(point); + BOOST_CHECK(s.vertex() == Vertex_handle({3, -1, 0})); + BOOST_CHECK(s.partition() == Ordered_set_partition({Part({0, 1, 2, 3})})); + } + + { + Point point({3.5, -1.5, 0.5}); + Simplex_handle s = tr.locate_point(point); + BOOST_CHECK(s.vertex() == Vertex_handle({3, -2, 0})); + BOOST_CHECK(s.partition() == Ordered_set_partition({Part({0, 1, 2}), Part({3})})); + } + + { + Point point({3.5, -1.8, 0.5}); + Simplex_handle s = tr.locate_point(point); + BOOST_CHECK(s.vertex() == Vertex_handle({3, -2, 0})); + BOOST_CHECK(s.partition() == Ordered_set_partition({Part({0, 2}), Part({1}), Part({3})})); + } + + { + Point point({3.5, -1.8, 0.3}); + Simplex_handle s = tr.locate_point(point); + BOOST_CHECK(s.vertex() == Vertex_handle({3, -2, 0})); + BOOST_CHECK(s.partition() == Ordered_set_partition({Part({0}), Part({2}), Part({1}), Part({3})})); + } + + // Dimension check + BOOST_CHECK(tr.dimension() == 3); + // Matrix check + Eigen::MatrixXd default_matrix = Eigen::MatrixXd::Identity(3, 3); + BOOST_CHECK(tr.matrix() == default_matrix); + // Vector check + Eigen::MatrixXd default_offset = Eigen::VectorXd::Zero(3); + BOOST_CHECK(tr.offset() == default_offset); + + // Barycenter check + Point point({3.5, -1.8, 0.3}); + Simplex_handle s = tr.locate_point(point); + Eigen::Vector3d barycenter_cart = Eigen::Vector3d::Zero(); + for (auto v : s.vertex_range()) + for (std::size_t i = 0; i < v.size(); i++) barycenter_cart(i) += v[i]; + barycenter_cart /= 4.; // simplex is three-dimensional + Eigen::Vector3d barycenter = tr.barycenter(s); + for (std::size_t i = 0; (long int)i < barycenter.size(); i++) + GUDHI_TEST_FLOAT_EQUALITY_CHECK(barycenter(i), barycenter_cart(i), 1e-7); + + // Barycenter check for twice the scale + s = tr.locate_point(point, 2); + barycenter_cart = Eigen::Vector3d::Zero(); + for (auto v : s.vertex_range()) + for (std::size_t i = 0; i < v.size(); i++) barycenter_cart(i) += v[i]; + barycenter_cart /= 3.; // simplex is now a two-dimensional face + barycenter_cart /= 2.; // scale + barycenter = tr.barycenter(s, 2); + for (std::size_t i = 0; (long int)i < barycenter.size(); i++) + GUDHI_TEST_FLOAT_EQUALITY_CHECK(barycenter(i), barycenter_cart(i), 1e-7); + + // Matrix and offset change check + Eigen::MatrixXd new_matrix(3, 3); + new_matrix << 1, 0, 0, -1, 1, 0, -1, 0, 1; + Eigen::Vector3d new_offset(1.5, 1, 0.5); + tr.change_matrix(new_matrix); + tr.change_offset(new_offset); + + BOOST_CHECK(tr.matrix() == new_matrix); + BOOST_CHECK(tr.offset() == new_offset); +} + +#ifdef GUDHI_DEBUG +BOOST_AUTO_TEST_CASE(freudenthal_triangulation_exceptions_in_debug_mode) { + // Point location check + typedef Gudhi::coxeter_triangulation::Freudenthal_triangulation<> FK_triangulation; + + BOOST_CHECK_THROW (FK_triangulation tr(3, Eigen::MatrixXd::Identity(3, 3), Eigen::VectorXd::Zero(4)), + std::invalid_argument); + + FK_triangulation tr(3); + // Point of dimension 4 + std::vector<double> point({3.5, -1.8, 0.3, 4.1}); + BOOST_CHECK_THROW (tr.locate_point(point), std::invalid_argument); +} +#endif diff --git a/src/Coxeter_triangulation/test/function_test.cpp b/src/Coxeter_triangulation/test/function_test.cpp new file mode 100644 index 00000000..43dbcb75 --- /dev/null +++ b/src/Coxeter_triangulation/test/function_test.cpp @@ -0,0 +1,158 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +// workaround for the annoying boost message in boost 1.69 +#define BOOST_PENDING_INTEGER_LOG2_HPP +#include <boost/integer/integer_log2.hpp> +// end workaround + +#define BOOST_TEST_DYN_LINK +#define BOOST_TEST_MODULE "function" +#include <boost/test/unit_test.hpp> +#include <gudhi/Unitary_tests_utils.h> + +#include <gudhi/Functions/Function_Sm_in_Rd.h> +#include <gudhi/Functions/Function_affine_plane_in_Rd.h> +#include <gudhi/Functions/Constant_function.h> +#include <gudhi/Functions/Function_chair_in_R3.h> +#include <gudhi/Functions/Function_torus_in_R3.h> +#include <gudhi/Functions/Function_whitney_umbrella_in_R3.h> +#include <gudhi/Functions/Function_lemniscate_revolution_in_R3.h> +#include <gudhi/Functions/Function_iron_in_R3.h> +#include <gudhi/Functions/Function_moment_curve_in_Rd.h> +#include <gudhi/Functions/Embed_in_Rd.h> +#include <gudhi/Functions/Translate.h> +#include <gudhi/Functions/Linear_transformation.h> +#include <gudhi/Functions/Negation.h> +#include <gudhi/Functions/Cartesian_product.h> +#include <gudhi/Functions/PL_approximation.h> + +#include <gudhi/Coxeter_triangulation.h> + +#include <string> + +#include <random> +#include <cstdlib> + +using namespace Gudhi::coxeter_triangulation; + +template <class Function> +void test_function(const Function& fun) { + Eigen::VectorXd seed = fun.seed(); + Eigen::VectorXd res_seed = fun(fun.seed()); + BOOST_CHECK(seed.size() == (long int)fun.amb_d()); + BOOST_CHECK(res_seed.size() == (long int)fun.cod_d()); + for (std::size_t i = 0; i < fun.cod_d(); i++) GUDHI_TEST_FLOAT_EQUALITY_CHECK(res_seed(i), 0., 1e-10); +} + +BOOST_AUTO_TEST_CASE(function) { + { + // the sphere testing part + std::size_t m = 3, d = 5; + Eigen::VectorXd center(d); + center << 2, 1.5, -0.5, 4.5, -1; + double radius = 5; + typedef Function_Sm_in_Rd Function_sphere; + Function_sphere fun_sphere(radius, m, d, center); + test_function(fun_sphere); + } + { + // the affine plane testing part + std::size_t m = 0, d = 5; + Eigen::MatrixXd normal_matrix = Eigen::MatrixXd::Zero(d, d - m); + for (std::size_t i = 0; i < d - m; ++i) normal_matrix(i, i) = 1; + typedef Function_affine_plane_in_Rd Function_plane; + Function_plane fun_plane(normal_matrix); + test_function(fun_plane); + } + { + // the constant function testing part + std::size_t k = 2, d = 5; + auto x = Eigen::VectorXd::Constant(k, 1); + Constant_function fun_const(d, k, x); + Eigen::VectorXd res_zero = fun_const(Eigen::VectorXd::Zero(d)); + for (std::size_t i = 0; i < k; ++i) GUDHI_TEST_FLOAT_EQUALITY_CHECK(res_zero(i), x(i), 1e-10); + } + { + // the chair function + Function_chair_in_R3 fun_chair; + test_function(fun_chair); + } + { + // the torus function + Function_torus_in_R3 fun_torus; + test_function(fun_torus); + } + { + // the whitney umbrella function + Function_whitney_umbrella_in_R3 fun_umbrella; + test_function(fun_umbrella); + } + { + // the lemniscate revolution function + Function_lemniscate_revolution_in_R3 fun_lemniscate; + test_function(fun_lemniscate); + } + { + // the iron function + Function_iron_in_R3 fun_iron; + test_function(fun_iron); + } + { + Function_moment_curve_in_Rd fun_moment_curve(3, 5); + test_function(fun_moment_curve); + } + { + // function embedding + Function_iron_in_R3 fun_iron; + auto fun_embed = make_embedding(fun_iron, 5); + test_function(fun_iron); + + // function translation + Eigen::VectorXd off = Eigen::VectorXd::Random(5); + auto fun_trans = translate(fun_embed, off); + test_function(fun_trans); + + // function linear transformation + Eigen::MatrixXd matrix = Eigen::MatrixXd::Random(5, 5); + BOOST_CHECK(matrix.determinant() != 0.); + auto fun_lin = make_linear_transformation(fun_trans, matrix); + test_function(fun_lin); + + // function negative + auto fun_neg = negation(fun_lin); + test_function(fun_neg); + + // function product + typedef Function_Sm_in_Rd Function_sphere; + Function_sphere fun_sphere(1, 1); + auto fun_prod = make_product_function(fun_sphere, fun_sphere, fun_sphere); + test_function(fun_prod); + + // function PL approximation + Coxeter_triangulation<> cox_tr(6); + typedef Coxeter_triangulation<>::Vertex_handle Vertex_handle; + auto fun_pl = make_pl_approximation(fun_prod, cox_tr); + Vertex_handle v0 = Vertex_handle(cox_tr.dimension(), 0); + Eigen::VectorXd x0 = cox_tr.cartesian_coordinates(v0); + Eigen::VectorXd value0 = fun_prod(x0); + Eigen::VectorXd pl_value0 = fun_pl(x0); + for (std::size_t i = 0; i < fun_pl.cod_d(); i++) GUDHI_TEST_FLOAT_EQUALITY_CHECK(value0(i), pl_value0(i), 1e-10); + Vertex_handle v1 = v0; + v1[0] += 1; + Eigen::VectorXd x1 = cox_tr.cartesian_coordinates(v1); + Eigen::VectorXd value1 = fun_prod(x1); + Eigen::VectorXd pl_value1 = fun_pl(x1); + for (std::size_t i = 0; i < fun_pl.cod_d(); i++) GUDHI_TEST_FLOAT_EQUALITY_CHECK(value1(i), pl_value1(i), 1e-10); + Eigen::VectorXd pl_value_mid = fun_pl(0.5 * x0 + 0.5 * x1); + for (std::size_t i = 0; i < fun_pl.cod_d(); i++) + GUDHI_TEST_FLOAT_EQUALITY_CHECK(0.5 * value0(i) + 0.5 * value1(i), pl_value_mid(i), 1e-10); + } +} diff --git a/src/Coxeter_triangulation/test/manifold_tracing_test.cpp b/src/Coxeter_triangulation/test/manifold_tracing_test.cpp new file mode 100644 index 00000000..63497f5a --- /dev/null +++ b/src/Coxeter_triangulation/test/manifold_tracing_test.cpp @@ -0,0 +1,62 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#define BOOST_TEST_DYN_LINK +#define BOOST_TEST_MODULE "manifold_tracing" +#include <boost/test/unit_test.hpp> +#include <gudhi/Unitary_tests_utils.h> + +#include <iostream> + +#include <gudhi/Coxeter_triangulation.h> +#include <gudhi/Functions/Function_Sm_in_Rd.h> +#include <gudhi/Implicit_manifold_intersection_oracle.h> +#include <gudhi/Manifold_tracing.h> + +using namespace Gudhi::coxeter_triangulation; + +BOOST_AUTO_TEST_CASE(manifold_tracing) { + // manifold without boundary + Function_Sm_in_Rd fun_sph(5.1111, 2); + auto oracle = make_oracle(fun_sph); + Coxeter_triangulation<> cox_tr(oracle.amb_d()); + // cox_tr.change_offset(Eigen::VectorXd::Random(oracle.amb_d())); + + using MT = Manifold_tracing<Coxeter_triangulation<> >; + Eigen::VectorXd seed = fun_sph.seed(); + std::vector<Eigen::VectorXd> seed_points(1, seed); + typename MT::Out_simplex_map out_simplex_map; + manifold_tracing_algorithm(seed_points, cox_tr, oracle, out_simplex_map); + + for (auto si_pair : out_simplex_map) { + BOOST_CHECK(si_pair.first.dimension() == oracle.function().cod_d()); + BOOST_CHECK(si_pair.second.size() == (long int)oracle.function().amb_d()); + } + std::clog << "out_simplex_map.size() = " << out_simplex_map.size() << "\n"; + BOOST_CHECK(out_simplex_map.size() == 1118); + + // manifold with boundary + Function_Sm_in_Rd fun_boundary(3.0, 2, fun_sph.seed()); + auto oracle_with_boundary = make_oracle(fun_sph, fun_boundary); + typename MT::Out_simplex_map interior_simplex_map, boundary_simplex_map; + manifold_tracing_algorithm(seed_points, cox_tr, oracle_with_boundary, interior_simplex_map, boundary_simplex_map); + for (auto si_pair : interior_simplex_map) { + BOOST_CHECK(si_pair.first.dimension() == oracle.function().cod_d()); + BOOST_CHECK(si_pair.second.size() == (long int)oracle.function().amb_d()); + } + std::clog << "interior_simplex_map.size() = " << interior_simplex_map.size() << "\n"; + BOOST_CHECK(interior_simplex_map.size() == 96); + for (auto si_pair : boundary_simplex_map) { + BOOST_CHECK(si_pair.first.dimension() == oracle.function().cod_d() + 1); + BOOST_CHECK(si_pair.second.size() == (long int)oracle.function().amb_d()); + } + std::clog << "boundary_simplex_map.size() = " << boundary_simplex_map.size() << "\n"; + BOOST_CHECK(boundary_simplex_map.size() == 54); +} diff --git a/src/Coxeter_triangulation/test/oracle_test.cpp b/src/Coxeter_triangulation/test/oracle_test.cpp new file mode 100644 index 00000000..ed2042f5 --- /dev/null +++ b/src/Coxeter_triangulation/test/oracle_test.cpp @@ -0,0 +1,56 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#define BOOST_TEST_DYN_LINK +#define BOOST_TEST_MODULE "oracle" +#include <boost/test/unit_test.hpp> +#include <gudhi/Unitary_tests_utils.h> + +#include <string> + +#include <gudhi/Implicit_manifold_intersection_oracle.h> + +#include <gudhi/Functions/Function_Sm_in_Rd.h> +#include <gudhi/Functions/Cartesian_product.h> + +#include <gudhi/Coxeter_triangulation.h> + +#include <random> +#include <cstdlib> + +using namespace Gudhi::coxeter_triangulation; + +BOOST_AUTO_TEST_CASE(oracle) { + Function_Sm_in_Rd fun_sph(5.1111, 2); + auto oracle = make_oracle(fun_sph); + Coxeter_triangulation<> cox_tr(oracle.amb_d()); + // cox_tr.change_offset(Eigen::VectorXd::Random(oracle.amb_d())); + + Eigen::VectorXd seed = fun_sph.seed(); + auto s = cox_tr.locate_point(seed); + + std::size_t num_intersected_edges = 0; + for (auto f : s.face_range(oracle.cod_d())) { + auto qr = oracle.intersects(f, cox_tr); + if (qr.success) num_intersected_edges++; + auto vertex_it = f.vertex_range().begin(); + Eigen::Vector3d p1 = cox_tr.cartesian_coordinates(*vertex_it++); + Eigen::Vector3d p2 = cox_tr.cartesian_coordinates(*vertex_it++); + BOOST_CHECK(vertex_it == f.vertex_range().end()); + Eigen::MatrixXd m(3, 3); + if (qr.success) { + m.col(0) = qr.intersection; + m.col(1) = p1; + m.col(2) = p2; + GUDHI_TEST_FLOAT_EQUALITY_CHECK(m.determinant(), 0.0, 1e-10); + } + } + BOOST_CHECK(num_intersected_edges == 3 || num_intersected_edges == 4); +} diff --git a/src/Coxeter_triangulation/test/perm_rep_test.cpp b/src/Coxeter_triangulation/test/perm_rep_test.cpp new file mode 100644 index 00000000..a668fc66 --- /dev/null +++ b/src/Coxeter_triangulation/test/perm_rep_test.cpp @@ -0,0 +1,61 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#define BOOST_TEST_DYN_LINK +#define BOOST_TEST_MODULE "permutahedral_representation" +#include <boost/test/unit_test.hpp> + +#include <gudhi/Permutahedral_representation.h> + +BOOST_AUTO_TEST_CASE(permutahedral_representation) { + typedef std::vector<int> Vertex; + typedef std::vector<std::size_t> Part; + typedef std::vector<Part> Partition; + typedef Gudhi::coxeter_triangulation::Permutahedral_representation<Vertex, Partition> Simplex_handle; + Vertex v0(10, 0); + Partition omega = {Part({5}), Part({2}), Part({3, 7}), Part({4, 9}), Part({0, 6, 8}), Part({1, 10})}; + Simplex_handle s(v0, omega); + + // Dimension check + BOOST_CHECK(s.dimension() == 5); + + // Vertex number check + std::vector<Vertex> vertices; + for (auto& v : s.vertex_range()) vertices.push_back(v); + BOOST_CHECK(vertices.size() == 6); + + // Facet number check + std::vector<Simplex_handle> facets; + for (auto& f : s.facet_range()) facets.push_back(f); + BOOST_CHECK(facets.size() == 6); + + // Face of dim 3 number check + std::vector<Simplex_handle> faces3; + for (auto& f : s.face_range(3)) faces3.push_back(f); + BOOST_CHECK(faces3.size() == 15); + + // Cofacet number check + std::vector<Simplex_handle> cofacets; + for (auto& f : s.cofacet_range()) cofacets.push_back(f); + BOOST_CHECK(cofacets.size() == 12); + + // Is face check + Vertex v1(10, 0); + Partition omega1 = {Part({5}), Part({0, 1, 2, 3, 4, 6, 7, 8, 9, 10})}; + Simplex_handle s1(v1, omega1); + Vertex v2(10, 0); + v2[1] = -1; + Partition omega2 = {Part({1}), Part({5}), Part({2}), Part({3, 7}), Part({4, 9}), Part({0, 6, 8}), Part({10})}; + Simplex_handle s2(v2, omega2); + BOOST_CHECK(s.is_face_of(s)); + BOOST_CHECK(s1.is_face_of(s)); + BOOST_CHECK(!s2.is_face_of(s)); + BOOST_CHECK(s.is_face_of(s2)); +} diff --git a/src/Coxeter_triangulation/test/random_orthogonal_matrix_function_test.cpp b/src/Coxeter_triangulation/test/random_orthogonal_matrix_function_test.cpp new file mode 100644 index 00000000..84178741 --- /dev/null +++ b/src/Coxeter_triangulation/test/random_orthogonal_matrix_function_test.cpp @@ -0,0 +1,36 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Siargey Kachanovich + * + * Copyright (C) 2019 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#define BOOST_TEST_DYN_LINK +#define BOOST_TEST_MODULE "random_orthogonal_matrix_function" +#include <boost/test/unit_test.hpp> +#include <gudhi/Unitary_tests_utils.h> + +#include <gudhi/Functions/random_orthogonal_matrix.h> + +#include <string> + +#include <random> +#include <cstdlib> + +using namespace Gudhi::coxeter_triangulation; + +// this test is separated as it requires CGAL +BOOST_AUTO_TEST_CASE(random_orthogonal_matrix_function) { + // random orthogonal matrix + Eigen::MatrixXd matrix = random_orthogonal_matrix(5); + Eigen::MatrixXd id_matrix = matrix.transpose() * matrix; + for (std::size_t i = 0; i < 5; ++i) + for (std::size_t j = 0; j < 5; ++j) + if (i == j) + GUDHI_TEST_FLOAT_EQUALITY_CHECK(id_matrix(i, j), 1.0, 1e-10); + else + GUDHI_TEST_FLOAT_EQUALITY_CHECK(id_matrix(i, j), 0.0, 1e-10); +} diff --git a/src/Doxyfile.in b/src/Doxyfile.in index 49e781bd..d5664a49 100644 --- a/src/Doxyfile.in +++ b/src/Doxyfile.in @@ -1,4 +1,4 @@ -# Doxyfile 1.8.6 +# Doxyfile 1.8.13 # This file describes the settings to be used by the documentation system # doxygen (www.doxygen.org) for a project. @@ -32,7 +32,7 @@ DOXYFILE_ENCODING = UTF-8 # title of most generated pages and in a few other places. # The default value is: My Project. -PROJECT_NAME = "GUDHI" +PROJECT_NAME = "@CMAKE_PROJECT_NAME@" # The PROJECT_NUMBER tag can be used to enter a project or revision number. This # could be handy for archiving the generated documentation or if some version @@ -46,10 +46,10 @@ PROJECT_NUMBER = "@GUDHI_VERSION@" PROJECT_BRIEF = "C++ library for Topological Data Analysis (TDA) and Higher Dimensional Geometry Understanding." -# With the PROJECT_LOGO tag one can specify an logo or icon that is included in -# the documentation. The maximum height of the logo should not exceed 55 pixels -# and the maximum width should not exceed 200 pixels. Doxygen will copy the logo -# to the output directory. +# With the PROJECT_LOGO tag one can specify a logo or an icon that is included +# in the documentation. The maximum height of the logo should not exceed 55 +# pixels and the maximum width should not exceed 200 pixels. Doxygen will copy +# the logo to the output directory. PROJECT_LOGO = @@ -58,9 +58,9 @@ PROJECT_LOGO = # entered, it will be relative to the location where doxygen was started. If # left blank the current directory will be used. -OUTPUT_DIRECTORY = "doc/" +OUTPUT_DIRECTORY = -# If the CREATE_SUBDIRS tag is set to YES, then doxygen will create 4096 sub- +# If the CREATE_SUBDIRS tag is set to YES then doxygen will create 4096 sub- # directories (in 2 levels) under the output directory of each output format and # will distribute the generated files over these directories. Enabling this # option can be useful when feeding doxygen a huge amount of source files, where @@ -70,6 +70,14 @@ OUTPUT_DIRECTORY = "doc/" CREATE_SUBDIRS = NO +# If the ALLOW_UNICODE_NAMES tag is set to YES, doxygen will allow non-ASCII +# characters to appear in the names of generated files. If set to NO, non-ASCII +# characters will be escaped, for example _xE3_x81_x84 will be used for Unicode +# U+3044. +# The default value is: NO. + +ALLOW_UNICODE_NAMES = NO + # The OUTPUT_LANGUAGE tag is used to specify the language in which all # documentation generated by doxygen is written. Doxygen will use this # information to generate all constant output in the proper language. @@ -85,14 +93,14 @@ CREATE_SUBDIRS = NO OUTPUT_LANGUAGE = English -# If the BRIEF_MEMBER_DESC tag is set to YES doxygen will include brief member +# If the BRIEF_MEMBER_DESC tag is set to YES, doxygen will include brief member # descriptions after the members that are listed in the file and class # documentation (similar to Javadoc). Set to NO to disable this. # The default value is: YES. BRIEF_MEMBER_DESC = YES -# If the REPEAT_BRIEF tag is set to YES doxygen will prepend the brief +# If the REPEAT_BRIEF tag is set to YES, doxygen will prepend the brief # description of a member or function before the detailed description # # Note: If both HIDE_UNDOC_MEMBERS and BRIEF_MEMBER_DESC are set to NO, the @@ -127,7 +135,7 @@ ALWAYS_DETAILED_SEC = NO INLINE_INHERITED_MEMB = NO -# If the FULL_PATH_NAMES tag is set to YES doxygen will prepend the full path +# If the FULL_PATH_NAMES tag is set to YES, doxygen will prepend the full path # before files name in the file list and in the header files. If set to NO the # shortest path that makes the file name unique will be used # The default value is: YES. @@ -144,7 +152,7 @@ FULL_PATH_NAMES = YES # will be relative from the directory where doxygen is started. # This tag requires that the tag FULL_PATH_NAMES is set to YES. -STRIP_FROM_PATH = +STRIP_FROM_PATH = @CMAKE_SOURCE_DIR@ # The STRIP_FROM_INC_PATH tag can be used to strip a user-defined part of the # path mentioned in the documentation of a class, which tells the reader which @@ -153,7 +161,9 @@ STRIP_FROM_PATH = # specify the list of include paths that are normally passed to the compiler # using the -I flag. -STRIP_FROM_INC_PATH = include concept +STRIP_FROM_INC_PATH = include \ + concept \ + @CMAKE_SOURCE_DIR@ # If the SHORT_NAMES tag is set to YES, doxygen will generate much shorter (but # less readable) file names. This can be useful is your file systems doesn't @@ -197,9 +207,9 @@ MULTILINE_CPP_IS_BRIEF = NO INHERIT_DOCS = YES -# If the SEPARATE_MEMBER_PAGES tag is set to YES, then doxygen will produce a -# new page for each member. If set to NO, the documentation of a member will be -# part of the file/class/namespace that contains it. +# If the SEPARATE_MEMBER_PAGES tag is set to YES then doxygen will produce a new +# page for each member. If set to NO, the documentation of a member will be part +# of the file/class/namespace that contains it. # The default value is: NO. SEPARATE_MEMBER_PAGES = NO @@ -220,13 +230,7 @@ TAB_SIZE = 2 # "Side Effects:". You can put \n's in the value part of an alias to insert # newlines. -ALIASES = - -# This tag can be used to specify a number of word-keyword mappings (TCL only). -# A mapping has the form "name=value". For example adding "class=itcl::class" -# will allow you to use the command class in the itcl::class meaning. - -TCL_SUBST = +ALIASES = gudhi_example_link{2}="@ref \2 \"\1/\2\"" # Set the OPTIMIZE_OUTPUT_FOR_C tag to YES if your project consists of C sources # only. Doxygen will then generate output that is more tailored for C. For @@ -261,11 +265,14 @@ OPTIMIZE_OUTPUT_VHDL = NO # extension. Doxygen has a built-in mapping, but you can override or extend it # using this tag. The format is ext=language, where ext is a file extension, and # language is one of the parsers supported by doxygen: IDL, Java, Javascript, -# C#, C, C++, D, PHP, Objective-C, Python, Fortran, VHDL. For instance to make -# doxygen treat .inc files as Fortran files (default is PHP), and .f files as C -# (default is Fortran), use: inc=Fortran f=C. +# C#, C, C++, D, PHP, Objective-C, Python, Fortran (fixed format Fortran: +# FortranFixed, free formatted Fortran: FortranFree, unknown formatted Fortran: +# Fortran. In the later case the parser tries to guess whether the code is fixed +# or free formatted code, this is the default for Fortran type files), VHDL. For +# instance to make doxygen treat .inc files as Fortran files (default is PHP), +# and .f files as C (default is Fortran), use: inc=Fortran f=C. # -# Note For files without extension you can use no_extension as a placeholder. +# Note: For files without extension you can use no_extension as a placeholder. # # Note that for custom extensions you also need to set FILE_PATTERNS otherwise # the files are not read by doxygen. @@ -282,10 +289,19 @@ EXTENSION_MAPPING = MARKDOWN_SUPPORT = YES +# When the TOC_INCLUDE_HEADINGS tag is set to a non-zero value, all headings up +# to that level are automatically included in the table of contents, even if +# they do not have an id attribute. +# Note: This feature currently applies only to Markdown headings. +# Minimum value: 0, maximum value: 99, default value: 0. +# This tag requires that the tag MARKDOWN_SUPPORT is set to YES. + +TOC_INCLUDE_HEADINGS = 0 + # When enabled doxygen tries to link words that correspond to documented # classes, or namespaces to their corresponding documentation. Such a link can -# be prevented in individual cases by by putting a % sign in front of the word -# or globally by setting AUTOLINK_SUPPORT to NO. +# be prevented in individual cases by putting a % sign in front of the word or +# globally by setting AUTOLINK_SUPPORT to NO. # The default value is: YES. AUTOLINK_SUPPORT = YES @@ -325,13 +341,20 @@ SIP_SUPPORT = NO IDL_PROPERTY_SUPPORT = YES # If member grouping is used in the documentation and the DISTRIBUTE_GROUP_DOC -# tag is set to YES, then doxygen will reuse the documentation of the first +# tag is set to YES then doxygen will reuse the documentation of the first # member in the group (if any) for the other members of the group. By default # all members of a group must be documented explicitly. # The default value is: NO. DISTRIBUTE_GROUP_DOC = NO +# If one adds a struct or class to a group and this option is enabled, then also +# any nested class or struct is added to the same group. By default this option +# is disabled and one has to add nested compounds explicitly via \ingroup. +# The default value is: NO. + +GROUP_NESTED_COMPOUNDS = NO + # Set the SUBGROUPING tag to YES to allow class member groups of the same type # (for instance a group of public functions) to be put as a subgroup of that # type (e.g. under the Public Functions section). Set it to NO to prevent @@ -390,7 +413,7 @@ LOOKUP_CACHE_SIZE = 0 # Build related configuration options #--------------------------------------------------------------------------- -# If the EXTRACT_ALL tag is set to YES doxygen will assume all entities in +# If the EXTRACT_ALL tag is set to YES, doxygen will assume all entities in # documentation are documented, even if no documentation was available. Private # class members and static file members will be hidden unless the # EXTRACT_PRIVATE respectively EXTRACT_STATIC tags are set to YES. @@ -400,35 +423,35 @@ LOOKUP_CACHE_SIZE = 0 EXTRACT_ALL = NO -# If the EXTRACT_PRIVATE tag is set to YES all private members of a class will +# If the EXTRACT_PRIVATE tag is set to YES, all private members of a class will # be included in the documentation. # The default value is: NO. EXTRACT_PRIVATE = NO -# If the EXTRACT_PACKAGE tag is set to YES all members with package or internal +# If the EXTRACT_PACKAGE tag is set to YES, all members with package or internal # scope will be included in the documentation. # The default value is: NO. EXTRACT_PACKAGE = NO -# If the EXTRACT_STATIC tag is set to YES all static members of a file will be +# If the EXTRACT_STATIC tag is set to YES, all static members of a file will be # included in the documentation. # The default value is: NO. EXTRACT_STATIC = NO -# If the EXTRACT_LOCAL_CLASSES tag is set to YES classes (and structs) defined -# locally in source files will be included in the documentation. If set to NO +# If the EXTRACT_LOCAL_CLASSES tag is set to YES, classes (and structs) defined +# locally in source files will be included in the documentation. If set to NO, # only classes defined in header files are included. Does not have any effect # for Java sources. # The default value is: YES. EXTRACT_LOCAL_CLASSES = NO -# This flag is only useful for Objective-C code. When set to YES local methods, +# This flag is only useful for Objective-C code. If set to YES, local methods, # which are defined in the implementation section but not in the interface are -# included in the documentation. If set to NO only methods in the interface are +# included in the documentation. If set to NO, only methods in the interface are # included. # The default value is: NO. @@ -453,21 +476,21 @@ HIDE_UNDOC_MEMBERS = YES # If the HIDE_UNDOC_CLASSES tag is set to YES, doxygen will hide all # undocumented classes that are normally visible in the class hierarchy. If set -# to NO these classes will be included in the various overviews. This option has -# no effect if EXTRACT_ALL is enabled. +# to NO, these classes will be included in the various overviews. This option +# has no effect if EXTRACT_ALL is enabled. # The default value is: NO. HIDE_UNDOC_CLASSES = YES # If the HIDE_FRIEND_COMPOUNDS tag is set to YES, doxygen will hide all friend -# (class|struct|union) declarations. If set to NO these declarations will be +# (class|struct|union) declarations. If set to NO, these declarations will be # included in the documentation. # The default value is: NO. HIDE_FRIEND_COMPOUNDS = NO # If the HIDE_IN_BODY_DOCS tag is set to YES, doxygen will hide any -# documentation blocks found inside the body of a function. If set to NO these +# documentation blocks found inside the body of a function. If set to NO, these # blocks will be appended to the function's detailed documentation block. # The default value is: NO. @@ -481,7 +504,7 @@ HIDE_IN_BODY_DOCS = NO INTERNAL_DOCS = NO # If the CASE_SENSE_NAMES tag is set to NO then doxygen will only generate file -# names in lower-case letters. If set to YES upper-case letters are also +# names in lower-case letters. If set to YES, upper-case letters are also # allowed. This is useful if you have classes or files whose names only differ # in case and if your file system supports case sensitive file names. Windows # and Mac users are advised to set this option to NO. @@ -490,12 +513,19 @@ INTERNAL_DOCS = NO CASE_SENSE_NAMES = NO # If the HIDE_SCOPE_NAMES tag is set to NO then doxygen will show members with -# their full class and namespace scopes in the documentation. If set to YES the +# their full class and namespace scopes in the documentation. If set to YES, the # scope will be hidden. # The default value is: NO. HIDE_SCOPE_NAMES = NO +# If the HIDE_COMPOUND_REFERENCE tag is set to NO (default) then doxygen will +# append additional text to a page's title, such as Class Reference. If set to +# YES the compound reference will be hidden. +# The default value is: NO. + +HIDE_COMPOUND_REFERENCE= NO + # If the SHOW_INCLUDE_FILES tag is set to YES then doxygen will put a list of # the files that are included by a file in the documentation of that file. # The default value is: YES. @@ -523,14 +553,14 @@ INLINE_INFO = YES # If the SORT_MEMBER_DOCS tag is set to YES then doxygen will sort the # (detailed) documentation of file and class members alphabetically by member -# name. If set to NO the members will appear in declaration order. +# name. If set to NO, the members will appear in declaration order. # The default value is: YES. SORT_MEMBER_DOCS = YES # If the SORT_BRIEF_DOCS tag is set to YES then doxygen will sort the brief # descriptions of file, namespace and class members alphabetically by member -# name. If set to NO the members will appear in declaration order. Note that +# name. If set to NO, the members will appear in declaration order. Note that # this will also influence the order of the classes in the class list. # The default value is: NO. @@ -575,27 +605,25 @@ SORT_BY_SCOPE_NAME = NO STRICT_PROTO_MATCHING = NO -# The GENERATE_TODOLIST tag can be used to enable ( YES) or disable ( NO) the -# todo list. This list is created by putting \todo commands in the -# documentation. +# The GENERATE_TODOLIST tag can be used to enable (YES) or disable (NO) the todo +# list. This list is created by putting \todo commands in the documentation. # The default value is: YES. GENERATE_TODOLIST = NO -# The GENERATE_TESTLIST tag can be used to enable ( YES) or disable ( NO) the -# test list. This list is created by putting \test commands in the -# documentation. +# The GENERATE_TESTLIST tag can be used to enable (YES) or disable (NO) the test +# list. This list is created by putting \test commands in the documentation. # The default value is: YES. GENERATE_TESTLIST = NO -# The GENERATE_BUGLIST tag can be used to enable ( YES) or disable ( NO) the bug +# The GENERATE_BUGLIST tag can be used to enable (YES) or disable (NO) the bug # list. This list is created by putting \bug commands in the documentation. # The default value is: YES. GENERATE_BUGLIST = NO -# The GENERATE_DEPRECATEDLIST tag can be used to enable ( YES) or disable ( NO) +# The GENERATE_DEPRECATEDLIST tag can be used to enable (YES) or disable (NO) # the deprecated list. This list is created by putting \deprecated commands in # the documentation. # The default value is: YES. @@ -620,8 +648,8 @@ ENABLED_SECTIONS = MAX_INITIALIZER_LINES = 30 # Set the SHOW_USED_FILES tag to NO to disable the list of files generated at -# the bottom of the documentation of classes and structs. If set to YES the list -# will mention the files that were used to generate the documentation. +# the bottom of the documentation of classes and structs. If set to YES, the +# list will mention the files that were used to generate the documentation. # The default value is: YES. SHOW_USED_FILES = YES @@ -669,12 +697,10 @@ LAYOUT_FILE = # to be installed. See also http://en.wikipedia.org/wiki/BibTeX for more info. # For LaTeX the style of the bibliography can be controlled using # LATEX_BIB_STYLE. To use this feature you need bibtex and perl available in the -# search path. Do not use file names with spaces, bibtex cannot handle them. See -# also \cite for info how to create references. +# search path. See also \cite for info how to create references. -CITE_BIB_FILES = biblio/bibliography.bib \ - biblio/how_to_cite_cgal.bib \ - biblio/how_to_cite_gudhi.bib +CITE_BIB_FILES = @CMAKE_SOURCE_DIR@/biblio/bibliography.bib \ + @CMAKE_SOURCE_DIR@/biblio/how_to_cite_gudhi.bib #--------------------------------------------------------------------------- # Configuration options related to warning and progress messages @@ -685,10 +711,10 @@ CITE_BIB_FILES = biblio/bibliography.bib \ # messages are off. # The default value is: NO. -QUIET = NO +QUIET = YES # The WARNINGS tag can be used to turn on/off the warning messages that are -# generated to standard error ( stderr) by doxygen. If WARNINGS is set to YES +# generated to standard error (stderr) by doxygen. If WARNINGS is set to YES # this implies that the warnings are on. # # Tip: Turn warnings on while writing the documentation. @@ -696,7 +722,7 @@ QUIET = NO WARNINGS = YES -# If the WARN_IF_UNDOCUMENTED tag is set to YES, then doxygen will generate +# If the WARN_IF_UNDOCUMENTED tag is set to YES then doxygen will generate # warnings for undocumented members. If EXTRACT_ALL is set to YES then this flag # will automatically be disabled. # The default value is: YES. @@ -713,12 +739,18 @@ WARN_IF_DOC_ERROR = YES # This WARN_NO_PARAMDOC option can be enabled to get warnings for functions that # are documented, but have no documentation for their parameters or return -# value. If set to NO doxygen will only warn about wrong or incomplete parameter -# documentation, but not about the absence of documentation. +# value. If set to NO, doxygen will only warn about wrong or incomplete +# parameter documentation, but not about the absence of documentation. # The default value is: NO. WARN_NO_PARAMDOC = NO +# If the WARN_AS_ERROR tag is set to YES then doxygen will immediately stop when +# a warning is encountered. +# The default value is: NO. + +WARN_AS_ERROR = NO + # The WARN_FORMAT tag determines the format of the warning messages that doxygen # can produce. The string should contain the $file, $line, and $text tags, which # will be replaced by the file and line number from which the warning originated @@ -733,7 +765,7 @@ WARN_FORMAT = "$file:$line: $text" # messages should be written. If left blank the output is written to standard # error (stderr). -WARN_LOGFILE = +WARN_LOGFILE = doxygen.log #--------------------------------------------------------------------------- # Configuration options related to the input files @@ -742,10 +774,10 @@ WARN_LOGFILE = # The INPUT tag is used to specify the files and/or directories that contain # documented source files. You may enter file names like myfile.cpp or # directories like /usr/src/myproject. Separate the files or directories with -# spaces. +# spaces. See also FILE_PATTERNS and EXTENSION_MAPPING # Note: If this tag is empty the current directory is searched. -INPUT = +INPUT = @CMAKE_SOURCE_DIR@ # This tag can be used to specify the character encoding of the source files # that doxygen parses. Internally doxygen uses the UTF-8 encoding. Doxygen uses @@ -758,14 +790,30 @@ INPUT_ENCODING = UTF-8 # If the value of the INPUT tag contains directories, you can use the # FILE_PATTERNS tag to specify one or more wildcard patterns (like *.cpp and -# *.h) to filter out the source-files in the directories. If left blank the -# following patterns are tested:*.c, *.cc, *.cxx, *.cpp, *.c++, *.java, *.ii, -# *.ixx, *.ipp, *.i++, *.inl, *.idl, *.ddl, *.odl, *.h, *.hh, *.hxx, *.hpp, -# *.h++, *.cs, *.d, *.php, *.php4, *.php5, *.phtml, *.inc, *.m, *.markdown, -# *.md, *.mm, *.dox, *.py, *.f90, *.f, *.for, *.tcl, *.vhd, *.vhdl, *.ucf, -# *.qsf, *.as and *.js. - -#FILE_PATTERNS = +# *.h) to filter out the source-files in the directories. +# +# Note that for custom extensions or not directly supported extensions you also +# need to set EXTENSION_MAPPING for the extension otherwise the files are not +# read by doxygen. +# +# If left blank the following patterns are tested:*.c, *.cc, *.cxx, *.cpp, +# *.c++, *.java, *.ii, *.ixx, *.ipp, *.i++, *.inl, *.idl, *.ddl, *.odl, *.h, +# *.hh, *.hxx, *.hpp, *.h++, *.cs, *.d, *.php, *.php4, *.php5, *.phtml, *.inc, +# *.m, *.markdown, *.md, *.mm, *.dox, *.py, *.pyw, *.f90, *.f95, *.f03, *.f08, +# *.f, *.for, *.tcl, *.vhd, *.vhdl, *.ucf and *.qsf. + +FILE_PATTERNS = *.c \ + *.cc \ + *.cxx \ + *.cpp \ + *.c++ \ + *.h \ + *.hh \ + *.hxx \ + *.hpp \ + *.h++ \ + *.md \ + *.mm \ # The RECURSIVE tag can be used to specify whether or not subdirectories should # be searched for input files as well. @@ -780,13 +828,14 @@ RECURSIVE = YES # Note that relative paths are relative to the directory from which doxygen is # run. -EXCLUDE = data/ \ - example/ \ - GudhUI/ \ - cmake/ \ - python/ \ - ext/ \ - README.md +EXCLUDE = @CMAKE_SOURCE_DIR@/data/ \ + @CMAKE_SOURCE_DIR@/ext/ \ + @CMAKE_SOURCE_DIR@/README.md \ + @CMAKE_SOURCE_DIR@/.github \ + @CMAKE_CURRENT_BINARY_DIR@ \ + @GUDHI_DOXYGEN_SOURCE_PREFIX@/GudhUI/ \ + @GUDHI_DOXYGEN_SOURCE_PREFIX@/cmake/ \ + @GUDHI_DOXYGEN_SOURCE_PREFIX@/python/ # The EXCLUDE_SYMLINKS tag can be used to select whether or not files or # directories that are symbolic links (a Unix file system feature) are excluded @@ -802,7 +851,7 @@ EXCLUDE_SYMLINKS = NO # Note that the wildcards are matched against the file with absolute path, so to # exclude all test directories for example use the pattern */test/* -EXCLUDE_PATTERNS = */utilities/*/*.md +EXCLUDE_PATTERNS = @GUDHI_DOXYGEN_SOURCE_PREFIX@/@GUDHI_DOXYGEN_UTILS_PATH@/*.md # The EXCLUDE_SYMBOLS tag can be used to specify one or more symbol names # (namespaces, classes, functions, etc.) that should be excluded from the @@ -819,17 +868,16 @@ EXCLUDE_SYMBOLS = # that contain example code fragments that are included (see the \include # command). -EXAMPLE_PATH = biblio/ \ - example/ \ - utilities/ \ - data/ +EXAMPLE_PATH = @CMAKE_SOURCE_DIR@ \ + @CMAKE_SOURCE_DIR@/data/ \ + @GUDHI_DOXYGEN_EXAMPLE_PATH@ # If the value of the EXAMPLE_PATH tag contains directories, you can use the # EXAMPLE_PATTERNS tag to specify one or more wildcard pattern (like *.cpp and # *.h) to filter out the source-files in the directories. If left blank all # files are included. -EXAMPLE_PATTERNS = +EXAMPLE_PATTERNS = # If the EXAMPLE_RECURSIVE tag is set to YES then subdirectories will be # searched for input files to be used with the \include or \dontinclude commands @@ -858,6 +906,10 @@ IMAGE_PATH = @GUDHI_DOXYGEN_IMAGE_PATH@ # Note that the filter must not add or remove lines; it is applied before the # code is scanned, but not when the output code is generated. If lines are added # or removed, the anchors will not be placed correctly. +# +# Note that for custom extensions or not directly supported extensions you also +# need to set EXTENSION_MAPPING for the extension otherwise the files are not +# properly processed by doxygen. INPUT_FILTER = @@ -867,11 +919,15 @@ INPUT_FILTER = # (like *.cpp=my_cpp_filter). See INPUT_FILTER for further information on how # filters are used. If the FILTER_PATTERNS tag is empty or if none of the # patterns match the file name, INPUT_FILTER is applied. +# +# Note that for custom extensions or not directly supported extensions you also +# need to set EXTENSION_MAPPING for the extension otherwise the files are not +# properly processed by doxygen. FILTER_PATTERNS = # If the FILTER_SOURCE_FILES tag is set to YES, the input filter (if set using -# INPUT_FILTER ) will also be used to filter the input files that are used for +# INPUT_FILTER) will also be used to filter the input files that are used for # producing the source files to browse (i.e. when SOURCE_BROWSER is set to YES). # The default value is: NO. @@ -890,7 +946,7 @@ FILTER_SOURCE_PATTERNS = # (index.html). This can be useful if you have a project on for instance GitHub # and want to reuse the introduction page also for the doxygen output. -USE_MDFILE_AS_MAINPAGE = doc/common/main_page.md +USE_MDFILE_AS_MAINPAGE = @GUDHI_DOXYGEN_COMMON_DOC_PATH@/main_page.md #--------------------------------------------------------------------------- # Configuration options related to source browsing @@ -931,7 +987,7 @@ REFERENCED_BY_RELATION = NO REFERENCES_RELATION = NO # If the REFERENCES_LINK_SOURCE tag is set to YES and SOURCE_BROWSER tag is set -# to YES, then the hyperlinks from functions in REFERENCES_RELATION and +# to YES then the hyperlinks from functions in REFERENCES_RELATION and # REFERENCED_BY_RELATION lists will link to the source code. Otherwise they will # link to the documentation. # The default value is: YES. @@ -989,13 +1045,6 @@ VERBATIM_HEADERS = YES ALPHABETICAL_INDEX = YES -# The COLS_IN_ALPHA_INDEX tag can be used to specify the number of columns in -# which the alphabetical index list will be split. -# Minimum value: 1, maximum value: 20, default value: 5. -# This tag requires that the tag ALPHABETICAL_INDEX is set to YES. - -COLS_IN_ALPHA_INDEX = 5 - # In case all classes in a project start with a common prefix, all classes will # be put under the same header in the alphabetical index. The IGNORE_PREFIX tag # can be used to specify a prefix (or a list of prefixes) that should be ignored @@ -1008,7 +1057,7 @@ IGNORE_PREFIX = # Configuration options related to the HTML output #--------------------------------------------------------------------------- -# If the GENERATE_HTML tag is set to YES doxygen will generate HTML output +# If the GENERATE_HTML tag is set to YES, doxygen will generate HTML output # The default value is: YES. GENERATE_HTML = YES @@ -1046,7 +1095,7 @@ HTML_FILE_EXTENSION = .html # of the possible markers and block names see the documentation. # This tag requires that the tag GENERATE_HTML is set to YES. -HTML_HEADER = doc/common/header.html +HTML_HEADER = @GUDHI_DOXYGEN_COMMON_DOC_PATH@/header.html # The HTML_FOOTER tag can be used to specify a user-defined HTML footer for each # generated HTML page. If the tag is left blank doxygen will generate a standard @@ -1056,7 +1105,7 @@ HTML_HEADER = doc/common/header.html # that doxygen normally uses. # This tag requires that the tag GENERATE_HTML is set to YES. -HTML_FOOTER = doc/common/footer.html +HTML_FOOTER = @GUDHI_DOXYGEN_COMMON_DOC_PATH@/footer.html # The HTML_STYLESHEET tag can be used to specify a user-defined cascading style # sheet that is used by each HTML page. It can be used to fine-tune the look of @@ -1068,18 +1117,20 @@ HTML_FOOTER = doc/common/footer.html # obsolete. # This tag requires that the tag GENERATE_HTML is set to YES. -HTML_STYLESHEET = doc/common/stylesheet.css +HTML_STYLESHEET = -# The HTML_EXTRA_STYLESHEET tag can be used to specify an additional user- -# defined cascading style sheet that is included after the standard style sheets +# The HTML_EXTRA_STYLESHEET tag can be used to specify additional user-defined +# cascading style sheets that are included after the standard style sheets # created by doxygen. Using this option one can overrule certain style aspects. # This is preferred over using HTML_STYLESHEET since it does not replace the -# standard style sheet and is therefor more robust against future updates. -# Doxygen will copy the style sheet file to the output directory. For an example -# see the documentation. +# standard style sheet and is therefore more robust against future updates. +# Doxygen will copy the style sheet files to the output directory. +# Note: The order of the extra style sheet files is of importance (e.g. the last +# style sheet in the list overrules the setting of the previous ones in the +# list). For an example see the documentation. # This tag requires that the tag GENERATE_HTML is set to YES. -HTML_EXTRA_STYLESHEET = +HTML_EXTRA_STYLESHEET = @GUDHI_DOXYGEN_COMMON_DOC_PATH@/stylesheet.css # The HTML_EXTRA_FILES tag can be used to specify one or more extra images or # other source files which should be copied to the HTML output directory. Note @@ -1091,8 +1142,13 @@ HTML_EXTRA_STYLESHEET = HTML_EXTRA_FILES = +# Default here is AUTO_LIGHT which means "Automatically set the mode according +# to the user preference, use light mode if no preference is set". +# Force it to LIGHT (white), as the rest of the documentation is white. +HTML_COLORSTYLE = LIGHT + # The HTML_COLORSTYLE_HUE tag controls the color of the HTML output. Doxygen -# will adjust the colors in the stylesheet and background images according to +# will adjust the colors in the style sheet and background images according to # this color. Hue is specified as an angle on a colorwheel, see # http://en.wikipedia.org/wiki/Hue for more information. For instance the value # 0 represents red, 60 is yellow, 120 is green, 180 is cyan, 240 is blue, 300 @@ -1123,8 +1179,9 @@ HTML_COLORSTYLE_GAMMA = 80 # If the HTML_TIMESTAMP tag is set to YES then the footer of each generated HTML # page will contain the date and time when the page was generated. Setting this -# to NO can help when comparing the output of multiple runs. -# The default value is: YES. +# to YES can help to show when doxygen was last run and thus if the +# documentation is up to date. +# The default value is: NO. # This tag requires that the tag GENERATE_HTML is set to YES. HTML_TIMESTAMP = YES @@ -1220,28 +1277,29 @@ GENERATE_HTMLHELP = NO CHM_FILE = # The HHC_LOCATION tag can be used to specify the location (absolute path -# including file name) of the HTML help compiler ( hhc.exe). If non-empty +# including file name) of the HTML help compiler (hhc.exe). If non-empty, # doxygen will try to run the HTML help compiler on the generated index.hhp. # The file has to be specified with full path. # This tag requires that the tag GENERATE_HTMLHELP is set to YES. HHC_LOCATION = -# The GENERATE_CHI flag controls if a separate .chi index file is generated ( -# YES) or that it should be included in the master .chm file ( NO). +# The GENERATE_CHI flag controls if a separate .chi index file is generated +# (YES) or that it should be included in the master .chm file (NO). # The default value is: NO. # This tag requires that the tag GENERATE_HTMLHELP is set to YES. GENERATE_CHI = NO -# The CHM_INDEX_ENCODING is used to encode HtmlHelp index ( hhk), content ( hhc) +# The CHM_INDEX_ENCODING is used to encode HtmlHelp index (hhk), content (hhc) # and project file content. # This tag requires that the tag GENERATE_HTMLHELP is set to YES. CHM_INDEX_ENCODING = -# The BINARY_TOC flag controls whether a binary table of contents is generated ( -# YES) or a normal table of contents ( NO) in the .chm file. +# The BINARY_TOC flag controls whether a binary table of contents is generated +# (YES) or a normal table of contents (NO) in the .chm file. Furthermore it +# enables the Previous and Next buttons. # The default value is: NO. # This tag requires that the tag GENERATE_HTMLHELP is set to YES. @@ -1354,7 +1412,7 @@ DISABLE_INDEX = YES # index structure (just like the one that is generated for HTML Help). For this # to work a browser that supports JavaScript, DHTML, CSS and frames is required # (i.e. any modern browser). Windows users are probably better off using the -# HTML help feature. Via custom stylesheets (see HTML_EXTRA_STYLESHEET) one can +# HTML help feature. Via custom style sheets (see HTML_EXTRA_STYLESHEET) one can # further fine-tune the look of the index. As an example, the default style # sheet generated by doxygen has an example that shows how to put an image at # the root of the tree instead of the PROJECT_NAME. Since the tree basically has @@ -1382,7 +1440,7 @@ ENUM_VALUES_PER_LINE = 4 TREEVIEW_WIDTH = 250 -# When the EXT_LINKS_IN_WINDOW option is set to YES doxygen will open links to +# If the EXT_LINKS_IN_WINDOW option is set to YES, doxygen will open links to # external symbols imported via tag files in a separate window. # The default value is: NO. # This tag requires that the tag GENERATE_HTML is set to YES. @@ -1398,20 +1456,9 @@ EXT_LINKS_IN_WINDOW = NO FORMULA_FONTSIZE = 10 -# Use the FORMULA_TRANPARENT tag to determine whether or not the images -# generated for formulas are transparent PNGs. Transparent PNGs are not -# supported properly for IE 6.0, but are supported on all modern browsers. -# -# Note that when changing this option you need to delete any form_*.png files in -# the HTML output directory before the changes have effect. -# The default value is: YES. -# This tag requires that the tag GENERATE_HTML is set to YES. - -FORMULA_TRANSPARENT = YES - # Enable the USE_MATHJAX option to render LaTeX formulas using MathJax (see # http://www.mathjax.org) which uses client side Javascript for the rendering -# instead of using prerendered bitmaps. Use this if you do not have LaTeX +# instead of using pre-rendered bitmaps. Use this if you do not have LaTeX # installed or if you want to formulas look prettier in the HTML output. When # enabled you may also need to install MathJax separately and configure the path # to it using the MATHJAX_RELPATH option. @@ -1420,6 +1467,17 @@ FORMULA_TRANSPARENT = YES USE_MATHJAX = YES +# With MATHJAX_VERSION it is possible to specify the MathJax version to be used. +# Note that the different versions of MathJax have different requirements with +# regards to the different settings, so it is possible that also other MathJax +# settings have to be changed when switching between the different MathJax +# versions. +# Possible values are: MathJax_2 and MathJax_3. +# The default value is: MathJax_2. +# This tag requires that the tag USE_MATHJAX is set to YES. + +@GUDHI_DOXYGEN_MATHJAX_VERSION@ + # When MathJax is enabled you can set the default output format to be used for # the MathJax output. See the MathJax site (see: # http://docs.mathjax.org/en/latest/output.html) for more details. @@ -1441,14 +1499,14 @@ MATHJAX_FORMAT = HTML-CSS # The default value is: http://cdn.mathjax.org/mathjax/latest. # This tag requires that the tag USE_MATHJAX is set to YES. -MATHJAX_RELPATH = https://cdnjs.cloudflare.com/ajax/libs/mathjax/2.7.2 +MATHJAX_RELPATH = # The MATHJAX_EXTENSIONS tag can be used to specify one or more MathJax # extension names that should be enabled during MathJax rendering. For example # MATHJAX_EXTENSIONS = TeX/AMSmath TeX/AMSsymbols # This tag requires that the tag USE_MATHJAX is set to YES. -MATHJAX_EXTENSIONS = TeX/AMSmath TeX/AMSsymbols +MATHJAX_EXTENSIONS = @GUDHI_DOXYGEN_MATHJAX_EXTENSIONS@ # The MATHJAX_CODEFILE tag can be used to specify a file with javascript pieces # of code that will be used on startup of the MathJax code. See the MathJax site @@ -1481,11 +1539,11 @@ SEARCHENGINE = YES # When the SERVER_BASED_SEARCH tag is enabled the search engine will be # implemented using a web server instead of a web client using Javascript. There -# are two flavours of web server based searching depending on the -# EXTERNAL_SEARCH setting. When disabled, doxygen will generate a PHP script for -# searching and an index file used by the script. When EXTERNAL_SEARCH is -# enabled the indexing and searching needs to be provided by external tools. See -# the section "External Indexing and Searching" for details. +# are two flavors of web server based searching depending on the EXTERNAL_SEARCH +# setting. When disabled, doxygen will generate a PHP script for searching and +# an index file used by the script. When EXTERNAL_SEARCH is enabled the indexing +# and searching needs to be provided by external tools. See the section +# "External Indexing and Searching" for details. # The default value is: NO. # This tag requires that the tag SEARCHENGINE is set to YES. @@ -1497,7 +1555,7 @@ SERVER_BASED_SEARCH = NO # external search engine pointed to by the SEARCHENGINE_URL option to obtain the # search results. # -# Doxygen ships with an example indexer ( doxyindexer) and search engine +# Doxygen ships with an example indexer (doxyindexer) and search engine # (doxysearch.cgi) which are based on the open source search engine library # Xapian (see: http://xapian.org/). # @@ -1510,7 +1568,7 @@ EXTERNAL_SEARCH = NO # The SEARCHENGINE_URL should point to a search engine hosted by a web server # which will return the search results when EXTERNAL_SEARCH is enabled. # -# Doxygen ships with an example indexer ( doxyindexer) and search engine +# Doxygen ships with an example indexer (doxyindexer) and search engine # (doxysearch.cgi) which are based on the open source search engine library # Xapian (see: http://xapian.org/). See the section "External Indexing and # Searching" for details. @@ -1548,7 +1606,7 @@ EXTRA_SEARCH_MAPPINGS = # Configuration options related to the LaTeX output #--------------------------------------------------------------------------- -# If the GENERATE_LATEX tag is set to YES doxygen will generate LaTeX output. +# If the GENERATE_LATEX tag is set to YES, doxygen will generate LaTeX output. # The default value is: YES. GENERATE_LATEX = NO @@ -1579,7 +1637,7 @@ LATEX_CMD_NAME = latex MAKEINDEX_CMD_NAME = makeindex -# If the COMPACT_LATEX tag is set to YES doxygen generates more compact LaTeX +# If the COMPACT_LATEX tag is set to YES, doxygen generates more compact LaTeX # documents. This may be useful for small projects and may help to save some # trees in general. # The default value is: NO. @@ -1597,13 +1655,18 @@ COMPACT_LATEX = NO PAPER_TYPE = a4 # The EXTRA_PACKAGES tag can be used to specify one or more LaTeX package names -# that should be included in the LaTeX output. To get the times font for -# instance you can specify -# EXTRA_PACKAGES=times +# that should be included in the LaTeX output. The package can be specified just +# by its name or with the correct syntax as to be used with the LaTeX +# \usepackage command. To get the times font for instance you can specify : +# EXTRA_PACKAGES=times or EXTRA_PACKAGES={times} +# To use the option intlimits with the amsmath package you can specify: +# EXTRA_PACKAGES=[intlimits]{amsmath} # If left blank no extra packages will be included. # This tag requires that the tag GENERATE_LATEX is set to YES. -EXTRA_PACKAGES = amsfonts amsmath amssymb +EXTRA_PACKAGES = amsfonts \ + amsmath \ + amssymb # The LATEX_HEADER tag can be used to specify a personal LaTeX header for the # generated LaTeX document. The header should contain everything until the first @@ -1613,23 +1676,36 @@ EXTRA_PACKAGES = amsfonts amsmath amssymb # # Note: Only use a user-defined header if you know what you are doing! The # following commands have a special meaning inside the header: $title, -# $datetime, $date, $doxygenversion, $projectname, $projectnumber. Doxygen will -# replace them by respectively the title of the page, the current date and time, -# only the current date, the version number of doxygen, the project name (see -# PROJECT_NAME), or the project number (see PROJECT_NUMBER). +# $datetime, $date, $doxygenversion, $projectname, $projectnumber, +# $projectbrief, $projectlogo. Doxygen will replace $title with the empty +# string, for the replacement values of the other commands the user is referred +# to HTML_HEADER. # This tag requires that the tag GENERATE_LATEX is set to YES. LATEX_HEADER = # The LATEX_FOOTER tag can be used to specify a personal LaTeX footer for the # generated LaTeX document. The footer should contain everything after the last -# chapter. If it is left blank doxygen will generate a standard footer. +# chapter. If it is left blank doxygen will generate a standard footer. See +# LATEX_HEADER for more information on how to generate a default footer and what +# special commands can be used inside the footer. # # Note: Only use a user-defined footer if you know what you are doing! # This tag requires that the tag GENERATE_LATEX is set to YES. LATEX_FOOTER = +# The LATEX_EXTRA_STYLESHEET tag can be used to specify additional user-defined +# LaTeX style sheets that are included after the standard style sheets created +# by doxygen. Using this option one can overrule certain style aspects. Doxygen +# will copy the style sheet files to the output directory. +# Note: The order of the extra style sheet files is of importance (e.g. the last +# style sheet in the list overrules the setting of the previous ones in the +# list). +# This tag requires that the tag GENERATE_LATEX is set to YES. + +LATEX_EXTRA_STYLESHEET = + # The LATEX_EXTRA_FILES tag can be used to specify one or more extra images or # other source files which should be copied to the LATEX_OUTPUT output # directory. Note that the files will be copied as-is; there are no commands or @@ -1647,8 +1723,8 @@ LATEX_EXTRA_FILES = PDF_HYPERLINKS = YES -# If the LATEX_PDFLATEX tag is set to YES, doxygen will use pdflatex to generate -# the PDF file directly from the LaTeX files. Set this option to YES to get a +# If the USE_PDFLATEX tag is set to YES, doxygen will use pdflatex to generate +# the PDF file directly from the LaTeX files. Set this option to YES, to get a # higher quality PDF documentation. # The default value is: YES. # This tag requires that the tag GENERATE_LATEX is set to YES. @@ -1671,16 +1747,6 @@ LATEX_BATCHMODE = NO LATEX_HIDE_INDICES = NO -# If the LATEX_SOURCE_CODE tag is set to YES then doxygen will include source -# code with syntax highlighting in the LaTeX output. -# -# Note that which sources are shown also depends on other settings such as -# SOURCE_BROWSER. -# The default value is: NO. -# This tag requires that the tag GENERATE_LATEX is set to YES. - -LATEX_SOURCE_CODE = NO - # The LATEX_BIB_STYLE tag can be used to specify the style to use for the # bibliography, e.g. plainnat, or ieeetr. See # http://en.wikipedia.org/wiki/BibTeX and \cite for more info. @@ -1689,11 +1755,19 @@ LATEX_SOURCE_CODE = NO LATEX_BIB_STYLE = plain +# If the LATEX_TIMESTAMP tag is set to YES then the footer of each generated +# page will contain the date and time when the page was generated. Setting this +# to NO can help when comparing the output of multiple runs. +# The default value is: NO. +# This tag requires that the tag GENERATE_LATEX is set to YES. + +LATEX_TIMESTAMP = NO + #--------------------------------------------------------------------------- # Configuration options related to the RTF output #--------------------------------------------------------------------------- -# If the GENERATE_RTF tag is set to YES doxygen will generate RTF output. The +# If the GENERATE_RTF tag is set to YES, doxygen will generate RTF output. The # RTF output is optimized for Word 97 and may not look too pretty with other RTF # readers/editors. # The default value is: NO. @@ -1708,7 +1782,7 @@ GENERATE_RTF = NO RTF_OUTPUT = rtf -# If the COMPACT_RTF tag is set to YES doxygen generates more compact RTF +# If the COMPACT_RTF tag is set to YES, doxygen generates more compact RTF # documents. This may be useful for small projects and may help to save some # trees in general. # The default value is: NO. @@ -1749,7 +1823,7 @@ RTF_EXTENSIONS_FILE = # Configuration options related to the man page output #--------------------------------------------------------------------------- -# If the GENERATE_MAN tag is set to YES doxygen will generate man pages for +# If the GENERATE_MAN tag is set to YES, doxygen will generate man pages for # classes and files. # The default value is: NO. @@ -1773,6 +1847,13 @@ MAN_OUTPUT = man MAN_EXTENSION = .3 +# The MAN_SUBDIR tag determines the name of the directory created within +# MAN_OUTPUT in which the man pages are placed. If defaults to man followed by +# MAN_EXTENSION with the initial . removed. +# This tag requires that the tag GENERATE_MAN is set to YES. + +MAN_SUBDIR = + # If the MAN_LINKS tag is set to YES and doxygen generates man output, then it # will generate one additional man file for each entity documented in the real # man page(s). These additional files only source the real man page, but without @@ -1786,7 +1867,7 @@ MAN_LINKS = NO # Configuration options related to the XML output #--------------------------------------------------------------------------- -# If the GENERATE_XML tag is set to YES doxygen will generate an XML file that +# If the GENERATE_XML tag is set to YES, doxygen will generate an XML file that # captures the structure of the code including all documentation. # The default value is: NO. @@ -1800,7 +1881,7 @@ GENERATE_XML = NO XML_OUTPUT = xml -# If the XML_PROGRAMLISTING tag is set to YES doxygen will dump the program +# If the XML_PROGRAMLISTING tag is set to YES, doxygen will dump the program # listings (including syntax highlighting and cross-referencing information) to # the XML output. Note that enabling this will significantly increase the size # of the XML output. @@ -1813,7 +1894,7 @@ XML_PROGRAMLISTING = YES # Configuration options related to the DOCBOOK output #--------------------------------------------------------------------------- -# If the GENERATE_DOCBOOK tag is set to YES doxygen will generate Docbook files +# If the GENERATE_DOCBOOK tag is set to YES, doxygen will generate Docbook files # that can be used to generate PDF. # The default value is: NO. @@ -1831,10 +1912,10 @@ DOCBOOK_OUTPUT = docbook # Configuration options for the AutoGen Definitions output #--------------------------------------------------------------------------- -# If the GENERATE_AUTOGEN_DEF tag is set to YES doxygen will generate an AutoGen -# Definitions (see http://autogen.sf.net) file that captures the structure of -# the code including all documentation. Note that this feature is still -# experimental and incomplete at the moment. +# If the GENERATE_AUTOGEN_DEF tag is set to YES, doxygen will generate an +# AutoGen Definitions (see http://autogen.sf.net) file that captures the +# structure of the code including all documentation. Note that this feature is +# still experimental and incomplete at the moment. # The default value is: NO. GENERATE_AUTOGEN_DEF = NO @@ -1843,7 +1924,7 @@ GENERATE_AUTOGEN_DEF = NO # Configuration options related to the Perl module output #--------------------------------------------------------------------------- -# If the GENERATE_PERLMOD tag is set to YES doxygen will generate a Perl module +# If the GENERATE_PERLMOD tag is set to YES, doxygen will generate a Perl module # file that captures the structure of the code including all documentation. # # Note that this feature is still experimental and incomplete at the moment. @@ -1851,7 +1932,7 @@ GENERATE_AUTOGEN_DEF = NO GENERATE_PERLMOD = NO -# If the PERLMOD_LATEX tag is set to YES doxygen will generate the necessary +# If the PERLMOD_LATEX tag is set to YES, doxygen will generate the necessary # Makefile rules, Perl scripts and LaTeX code to be able to generate PDF and DVI # output from the Perl module output. # The default value is: NO. @@ -1859,9 +1940,9 @@ GENERATE_PERLMOD = NO PERLMOD_LATEX = NO -# If the PERLMOD_PRETTY tag is set to YES the Perl module output will be nicely +# If the PERLMOD_PRETTY tag is set to YES, the Perl module output will be nicely # formatted so it can be parsed by a human reader. This is useful if you want to -# understand what is going on. On the other hand, if this tag is set to NO the +# understand what is going on. On the other hand, if this tag is set to NO, the # size of the Perl module output will be much smaller and Perl will parse it # just the same. # The default value is: YES. @@ -1881,14 +1962,14 @@ PERLMOD_MAKEVAR_PREFIX = # Configuration options related to the preprocessor #--------------------------------------------------------------------------- -# If the ENABLE_PREPROCESSING tag is set to YES doxygen will evaluate all +# If the ENABLE_PREPROCESSING tag is set to YES, doxygen will evaluate all # C-preprocessor directives found in the sources and include files. # The default value is: YES. ENABLE_PREPROCESSING = YES -# If the MACRO_EXPANSION tag is set to YES doxygen will expand all macro names -# in the source code. If set to NO only conditional compilation will be +# If the MACRO_EXPANSION tag is set to YES, doxygen will expand all macro names +# in the source code. If set to NO, only conditional compilation will be # performed. Macro expansion can be done in a controlled way by setting # EXPAND_ONLY_PREDEF to YES. # The default value is: NO. @@ -1904,7 +1985,7 @@ MACRO_EXPANSION = YES EXPAND_ONLY_PREDEF = YES -# If the SEARCH_INCLUDES tag is set to YES the includes files in the +# If the SEARCH_INCLUDES tag is set to YES, the include files in the # INCLUDE_PATH will be searched if a #include is found. # The default value is: YES. # This tag requires that the tag ENABLE_PREPROCESSING is set to YES. @@ -1946,9 +2027,9 @@ PREDEFINED = protected=private EXPAND_AS_DEFINED = # If the SKIP_FUNCTION_MACROS tag is set to YES then doxygen's preprocessor will -# remove all refrences to function-like macros that are alone on a line, have an -# all uppercase name, and do not end with a semicolon. Such function macros are -# typically used for boiler-plate code, and will confuse the parser if not +# remove all references to function-like macros that are alone on a line, have +# an all uppercase name, and do not end with a semicolon. Such function macros +# are typically used for boiler-plate code, and will confuse the parser if not # removed. # The default value is: YES. # This tag requires that the tag ENABLE_PREPROCESSING is set to YES. @@ -1968,7 +2049,7 @@ SKIP_FUNCTION_MACROS = YES # where loc1 and loc2 can be relative or absolute paths or URLs. See the # section "Linking to external documentation" for more information about the use # of tag files. -# Note: Each tag file must have an unique name (where the name does NOT include +# Note: Each tag file must have a unique name (where the name does NOT include # the path). If a tag file is not located in the directory in which doxygen is # run, you must also specify the path to the tagfile here. @@ -1980,53 +2061,32 @@ TAGFILES = GENERATE_TAGFILE = -# If the ALLEXTERNALS tag is set to YES all external class will be listed in the -# class index. If set to NO only the inherited external classes will be listed. +# If the ALLEXTERNALS tag is set to YES, all external class will be listed in +# the class index. If set to NO, only the inherited external classes will be +# listed. # The default value is: NO. ALLEXTERNALS = NO -# If the EXTERNAL_GROUPS tag is set to YES all external groups will be listed in -# the modules index. If set to NO, only the current project's groups will be +# If the EXTERNAL_GROUPS tag is set to YES, all external groups will be listed +# in the modules index. If set to NO, only the current project's groups will be # listed. # The default value is: YES. EXTERNAL_GROUPS = YES -# If the EXTERNAL_PAGES tag is set to YES all external pages will be listed in +# If the EXTERNAL_PAGES tag is set to YES, all external pages will be listed in # the related pages index. If set to NO, only the current project's pages will # be listed. # The default value is: YES. EXTERNAL_PAGES = YES -# The PERL_PATH should be the absolute path and name of the perl script -# interpreter (i.e. the result of 'which perl'). -# The default file (with absolute path) is: /usr/bin/perl. - -PERL_PATH = /usr/bin/perl - #--------------------------------------------------------------------------- # Configuration options related to the dot tool #--------------------------------------------------------------------------- -# If the CLASS_DIAGRAMS tag is set to YES doxygen will generate a class diagram -# (in HTML and LaTeX) for classes with base or super classes. Setting the tag to -# NO turns the diagrams off. Note that this option also works with HAVE_DOT -# disabled, but it is recommended to install and use dot, since it yields more -# powerful graphs. -# The default value is: YES. - -CLASS_DIAGRAMS = NO - -# You can define message sequence charts within doxygen comments using the \msc -# command. Doxygen will then run the mscgen tool (see: -# http://www.mcternan.me.uk/mscgen/)) to produce the chart and insert it in the -# documentation. The MSCGEN_PATH tag allows you to specify the directory where -# the mscgen tool resides. If left empty the tool is assumed to be found in the -# default search path. - -MSCGEN_PATH = +@GUDHI_DOXYGEN_CLASS_DIAGRAMS@ # You can include diagrams made with dia in doxygen documentation. Doxygen will # then run dia to produce the diagram and insert it in the documentation. The @@ -2035,7 +2095,7 @@ MSCGEN_PATH = DIA_PATH = -# If set to YES, the inheritance and collaboration graphs will hide inheritance +# If set to YES the inheritance and collaboration graphs will hide inheritance # and usage relations if the target is undocumented or is not a class. # The default value is: YES. @@ -2046,7 +2106,7 @@ HIDE_UNDOC_RELATIONS = YES # http://www.graphviz.org/), a graph visualization toolkit from AT&T and Lucent # Bell Labs. The other options in this section have no effect if this option is # set to NO -# The default value is: NO. +# The default value is: YES. HAVE_DOT = YES @@ -2060,26 +2120,38 @@ HAVE_DOT = YES DOT_NUM_THREADS = 0 -# When you want a differently looking font n the dot files that doxygen -# generates you can specify the font name using DOT_FONTNAME. You need to make -# sure dot is able to find the font, which can be done by putting it in a -# standard location or by setting the DOTFONTPATH environment variable or by -# setting DOT_FONTPATH to the directory containing the font. -# The default value is: Helvetica. +# DOT_COMMON_ATTR is common attributes for nodes, edges and labels of +# subgraphs. When you want a differently looking font in the dot files that +# doxygen generates you can specify fontname, fontcolor and fontsize attributes. +# For details please see <a href=https://graphviz.org/doc/info/attrs.html>Node, +# Edge and Graph Attributes specification</a> You need to make sure dot is able +# to find the font, which can be done by putting it in a standard location or by +# setting the DOTFONTPATH environment variable or by setting DOT_FONTPATH to the +# directory containing the font. Default graphviz fontsize is 14. +# The default value is: fontname=Helvetica,fontsize=10. # This tag requires that the tag HAVE_DOT is set to YES. -DOT_FONTNAME = Helvetica +DOT_COMMON_ATTR = "fontname=Helvetica,fontsize=10" -# The DOT_FONTSIZE tag can be used to set the size (in points) of the font of -# dot graphs. -# Minimum value: 4, maximum value: 24, default value: 10. +# DOT_EDGE_ATTR is concatenated with DOT_COMMON_ATTR. For elegant style you can +# add 'arrowhead=open, arrowtail=open, arrowsize=0.5'. <a +# href=https://graphviz.org/doc/info/arrows.html>Complete documentation about +# arrows shapes.</a> +# The default value is: labelfontname=Helvetica,labelfontsize=10. # This tag requires that the tag HAVE_DOT is set to YES. -DOT_FONTSIZE = 10 +DOT_EDGE_ATTR = "labelfontname=Helvetica,labelfontsize=10" -# By default doxygen will tell dot to use the default font as specified with -# DOT_FONTNAME. If you specify a different font using DOT_FONTNAME you can set -# the path where dot can find it using this tag. +# DOT_NODE_ATTR is concatenated with DOT_COMMON_ATTR. For view without boxes +# around nodes set 'shape=plain' or 'shape=plaintext' <a +# href=https://www.graphviz.org/doc/info/shapes.html>Shapes specification</a> +# The default value is: shape=box,height=0.2,width=0.4. +# This tag requires that the tag HAVE_DOT is set to YES. + +DOT_NODE_ATTR = "shape=box,height=0.2,width=0.4" + +# You can set the path where dot can find font specified with fontname in +# DOT_COMMON_ATTR and others dot attributes. # This tag requires that the tag HAVE_DOT is set to YES. DOT_FONTPATH = @@ -2108,7 +2180,7 @@ COLLABORATION_GRAPH = NO GROUP_GRAPHS = YES -# If the UML_LOOK tag is set to YES doxygen will generate inheritance and +# If the UML_LOOK tag is set to YES, doxygen will generate inheritance and # collaboration diagrams in a style similar to the OMG's Unified Modeling # Language. # The default value is: NO. @@ -2160,7 +2232,8 @@ INCLUDED_BY_GRAPH = NO # # Note that enabling this option will significantly increase the time of a run. # So in most cases it will be better to enable call graphs for selected -# functions only using the \callgraph command. +# functions only using the \callgraph command. Disabling a call graph can be +# accomplished by means of the command \hidecallgraph. # The default value is: NO. # This tag requires that the tag HAVE_DOT is set to YES. @@ -2171,7 +2244,8 @@ CALL_GRAPH = NO # # Note that enabling this option will significantly increase the time of a run. # So in most cases it will be better to enable caller graphs for selected -# functions only using the \callergraph command. +# functions only using the \callergraph command. Disabling a caller graph can be +# accomplished by means of the command \hidecallergraph. # The default value is: NO. # This tag requires that the tag HAVE_DOT is set to YES. @@ -2194,11 +2268,17 @@ GRAPHICAL_HIERARCHY = YES DIRECTORY_GRAPH = YES # The DOT_IMAGE_FORMAT tag can be used to set the image format of the images -# generated by dot. +# generated by dot. For an explanation of the image formats see the section +# output formats in the documentation of the dot tool (Graphviz (see: +# http://www.graphviz.org/)). # Note: If you choose svg you need to set HTML_FILE_EXTENSION to xhtml in order # to make the SVG files visible in IE 9+ (other browsers do not have this # requirement). -# Possible values are: png, jpg, gif and svg. +# Possible values are: png, png:cairo, png:cairo:cairo, png:cairo:gd, png:gd, +# png:gd:gd, jpg, jpg:cairo, jpg:cairo:gd, jpg:gd, jpg:gd:gd, gif, gif:cairo, +# gif:cairo:gd, gif:gd, gif:gd:gd, svg, png:gd, png:gd:gd, png:cairo, +# png:cairo:gd, png:cairo:cairo, png:cairo:gdiplus, png:gdiplus and +# png:gdiplus:gdiplus. # The default value is: png. # This tag requires that the tag HAVE_DOT is set to YES. @@ -2241,6 +2321,24 @@ MSCFILE_DIRS = DIAFILE_DIRS = +# When using plantuml, the PLANTUML_JAR_PATH tag should be used to specify the +# path where java can find the plantuml.jar file. If left blank, it is assumed +# PlantUML is not used or called during a preprocessing step. Doxygen will +# generate a warning when it encounters a \startuml command in this case and +# will not generate output for the diagram. + +PLANTUML_JAR_PATH = + +# When using plantuml, the PLANTUML_CFG_FILE tag can be used to specify a +# configuration file for plantuml. + +PLANTUML_CFG_FILE = + +# When using plantuml, the specified paths are searched for files specified by +# the !include statement in a plantuml block. + +PLANTUML_INCLUDE_PATH = + # The DOT_GRAPH_MAX_NODES tag can be used to set the maximum number of nodes # that will be shown in the graph. If the number of nodes in a graph becomes # larger than this value, doxygen will truncate the graph, which is visualized @@ -2265,19 +2363,7 @@ DOT_GRAPH_MAX_NODES = 50 MAX_DOT_GRAPH_DEPTH = 0 -# Set the DOT_TRANSPARENT tag to YES to generate images with a transparent -# background. This is disabled by default, because dot on Windows does not seem -# to support this out of the box. -# -# Warning: Depending on the platform used, enabling this option may lead to -# badly anti-aliased labels on the edges of a graph (i.e. they become hard to -# read). -# The default value is: NO. -# This tag requires that the tag HAVE_DOT is set to YES. - -DOT_TRANSPARENT = NO - -# Set the DOT_MULTI_TARGETS tag to YES allow dot to generate multiple output +# Set the DOT_MULTI_TARGETS tag to YES to allow dot to generate multiple output # files in one run (i.e. multiple -o and -T options on the command line). This # makes dot run faster, but since only newer versions of dot (>1.8.10) support # this, this feature is disabled by default. @@ -2294,7 +2380,7 @@ DOT_MULTI_TARGETS = YES GENERATE_LEGEND = YES -# If the DOT_CLEANUP tag is set to YES doxygen will remove the intermediate dot +# If the DOT_CLEANUP tag is set to YES, doxygen will remove the intermediate dot # files that are used to generate the various graphs. # The default value is: YES. # This tag requires that the tag HAVE_DOT is set to YES. diff --git a/src/GudhUI/todo.txt b/src/GudhUI/todo.txt index 19d99a77..e59d06d4 100644 --- a/src/GudhUI/todo.txt +++ b/src/GudhUI/todo.txt @@ -18,5 +18,5 @@ x faire le lien MainWindow - Model -- bug -x bug ordre contraction -> just that first vertex placement dont work great +x bug ordre contraction -> just that first vertex placement doesn't work great x pb construction rips diff --git a/src/GudhUI/utils/Critical_points.h b/src/GudhUI/utils/Critical_points.h index 97e58737..65695434 100644 --- a/src/GudhUI/utils/Critical_points.h +++ b/src/GudhUI/utils/Critical_points.h @@ -103,7 +103,7 @@ template<typename SkBlComplex> class Critical_points { // reduced to one point -> contractible return 1; else - // we dont know + // we don't know return 2; } diff --git a/src/GudhUI/utils/Edge_contractor.h b/src/GudhUI/utils/Edge_contractor.h index 0707b186..a71d0742 100644 --- a/src/GudhUI/utils/Edge_contractor.h +++ b/src/GudhUI/utils/Edge_contractor.h @@ -65,7 +65,7 @@ template<typename SkBlComplex> class Edge_contractor { /** * @brief Modify complex to be the expansion of the k-nearest neighbor - * symetric graph. + * symmetric graph. */ Edge_contractor(SkBlComplex& complex, unsigned num_contractions) : complex_(complex), num_contractions_(num_contractions) { diff --git a/src/GudhUI/utils/Furthest_point_epsilon_net.h b/src/GudhUI/utils/Furthest_point_epsilon_net.h index 6eb71071..195d0014 100644 --- a/src/GudhUI/utils/Furthest_point_epsilon_net.h +++ b/src/GudhUI/utils/Furthest_point_epsilon_net.h @@ -27,7 +27,7 @@ template<typename SkBlComplex> class Furthest_point_epsilon_net { /** * Let V be the set of vertices. - * Initially v0 is one arbitrarly vertex and the set V0 is {v0}. + * Initially v0 is one, arbitrary, vertex and the set V0 is {v0}. * Then Vk is computed as follows. * First we compute the vertex pk that is the furthest from Vk * then Vk = Vk \cup pk. @@ -54,7 +54,7 @@ template<typename SkBlComplex> class Furthest_point_epsilon_net { /** * @brief Modify complex to be the expansion of the k-nearest neighbor - * symetric graph. + * symmetric graph. */ Furthest_point_epsilon_net(SkBlComplex& complex) : complex_(complex) { diff --git a/src/GudhUI/utils/K_nearest_builder.h b/src/GudhUI/utils/K_nearest_builder.h index 34483e58..454b2587 100644 --- a/src/GudhUI/utils/K_nearest_builder.h +++ b/src/GudhUI/utils/K_nearest_builder.h @@ -41,7 +41,7 @@ template<typename SkBlComplex> class K_nearest_builder { public: /** * @brief Modify complex to be the expansion of the k-nearest neighbor - * symetric graph. + * symmetric graph. */ K_nearest_builder(SkBlComplex& complex, unsigned k) : complex_(complex) { complex.keep_only_vertices(); diff --git a/src/GudhUI/utils/Lloyd_builder.h b/src/GudhUI/utils/Lloyd_builder.h index c042564f..57e3dc0f 100644 --- a/src/GudhUI/utils/Lloyd_builder.h +++ b/src/GudhUI/utils/Lloyd_builder.h @@ -27,7 +27,7 @@ template<typename SkBlComplex> class Lloyd_builder { /** * @brief Modify complex to be the expansion of the k-nearest neighbor - * symetric graph. + * symmetric graph. */ Lloyd_builder(SkBlComplex& complex, unsigned num_iterations) : complex_(complex), dim(-1) { if (!complex_.empty()) { diff --git a/src/GudhUI/utils/Vertex_collapsor.h b/src/GudhUI/utils/Vertex_collapsor.h index 030e4bb0..b1c48efd 100644 --- a/src/GudhUI/utils/Vertex_collapsor.h +++ b/src/GudhUI/utils/Vertex_collapsor.h @@ -31,7 +31,7 @@ template<typename SkBlComplex> class Vertex_collapsor { /** * @brief Modify complex to be the expansion of the k-nearest neighbor - * symetric graph. + * symmetric graph. */ Vertex_collapsor(SkBlComplex& complex, size_t num_collapses) : complex_(complex), num_collapses_(num_collapses) { diff --git a/src/GudhUI/view/Viewer.cpp b/src/GudhUI/view/Viewer.cpp index 6b17c833..2c00f86f 100644 --- a/src/GudhUI/view/Viewer.cpp +++ b/src/GudhUI/view/Viewer.cpp @@ -31,7 +31,11 @@ void Viewer::set_bounding_box(const Point_3 & lower_left, const Point_3 & upper_ } void Viewer::update_GL() { +#if QGLVIEWER_VERSION >= 0x020700 + this->update(); +#else this->updateGL(); +#endif } void Viewer::init_scene() { diff --git a/src/GudhUI/view/Viewer_instructor.h b/src/GudhUI/view/Viewer_instructor.h index 58cbcd31..09ed102f 100644 --- a/src/GudhUI/view/Viewer_instructor.h +++ b/src/GudhUI/view/Viewer_instructor.h @@ -11,7 +11,7 @@ #ifndef VIEW_VIEWER_INSTRUCTOR_H_ #define VIEW_VIEWER_INSTRUCTOR_H_ -// todo do a viewer instructor that have directely a pointer to a QGLviewer and buffer ot not triangles +// todo do a viewer instructor that has directly a pointer to a QGLviewer and buffer ot not triangles #include <QFileDialog> #include <QKeyEvent> diff --git a/src/Nerve_GIC/doc/Intro_graph_induced_complex.h b/src/Nerve_GIC/doc/Intro_graph_induced_complex.h index f9441b24..e1ab7cb3 100644 --- a/src/Nerve_GIC/doc/Intro_graph_induced_complex.h +++ b/src/Nerve_GIC/doc/Intro_graph_induced_complex.h @@ -24,7 +24,7 @@ namespace cover_complex { * Visualizations of the simplicial complexes can be done with either * neato (from <a target="_blank" href="http://www.graphviz.org/">graphviz</a>), * <a target="_blank" href="http://www.geomview.org/">geomview</a>, - * <a target="_blank" href="https://github.com/MLWave/kepler-mapper">KeplerMapper</a>. + * <a target="_blank" href="https://github.com/scikit-tda/kepler-mapper">KeplerMapper</a>. * Input point clouds are assumed to be \ref FileFormatsOFF "OFF files" * * \section covers Covers @@ -53,7 +53,7 @@ namespace cover_complex { * covering the height function (coordinate 2), * which are then refined into their connected components using the triangulation of the .OFF file. * - * \include Nerve_GIC/Nerve.cpp + * \include Nerve.cpp * * When launching: * @@ -62,7 +62,7 @@ namespace cover_complex { * * the program output is: * - * \include Nerve_GIC/Nerve.txt + * \include Nerve.txt * * The program also writes a file ../../data/points/human_sc.txt. The first three lines in this file are the location * of the input point cloud and the function used to compute the cover. @@ -96,7 +96,7 @@ namespace cover_complex { * comes from the triangulation of the human shape. Note that the resulting simplicial complex is in dimension 3 * in this example. * - * \include Nerve_GIC/VoronoiGIC.cpp + * \include VoronoiGIC.cpp * * When launching: * @@ -129,7 +129,7 @@ namespace cover_complex { * with automatic resolution and gain. Note that automatic threshold, resolution and gain * can be computed as well for the Nerve. * - * \include Nerve_GIC/CoordGIC.cpp + * \include CoordGIC.cpp * * When launching: * @@ -152,7 +152,7 @@ namespace cover_complex { * The function is now the first eigenfunction given by PCA, whose values * are written in a file (lucky_cat_PCA1). Threshold, resolution and gain are automatically selected as before. * - * \include Nerve_GIC/FuncGIC.cpp + * \include FuncGIC.cpp * * When launching: * diff --git a/src/Nerve_GIC/example/CMakeLists.txt b/src/Nerve_GIC/example/CMakeLists.txt index 4b0f4677..9faf1f3b 100644 --- a/src/Nerve_GIC/example/CMakeLists.txt +++ b/src/Nerve_GIC/example/CMakeLists.txt @@ -1,25 +1,21 @@ project(Nerve_GIC_examples) -if (NOT CGAL_VERSION VERSION_LESS 4.11.0) +add_executable ( CoordGIC CoordGIC.cpp ) +add_executable ( FuncGIC FuncGIC.cpp ) - add_executable ( CoordGIC CoordGIC.cpp ) - add_executable ( FuncGIC FuncGIC.cpp ) +if (TBB_FOUND) + target_link_libraries(CoordGIC ${TBB_LIBRARIES}) + target_link_libraries(FuncGIC ${TBB_LIBRARIES}) +endif() - if (TBB_FOUND) - target_link_libraries(CoordGIC ${TBB_LIBRARIES}) - target_link_libraries(FuncGIC ${TBB_LIBRARIES}) - endif() +# Copy files for not to pollute sources when testing +file(COPY "${CMAKE_SOURCE_DIR}/data/points/tore3D_1307.off" DESTINATION ${CMAKE_CURRENT_BINARY_DIR}/) +file(COPY "${CMAKE_SOURCE_DIR}/data/points/COIL_database/lucky_cat.off" DESTINATION ${CMAKE_CURRENT_BINARY_DIR}/) +file(COPY "${CMAKE_SOURCE_DIR}/data/points/COIL_database/lucky_cat_PCA1" DESTINATION ${CMAKE_CURRENT_BINARY_DIR}/) - # Copy files for not to pollute sources when testing - file(COPY "${CMAKE_SOURCE_DIR}/data/points/tore3D_1307.off" DESTINATION ${CMAKE_CURRENT_BINARY_DIR}/) - file(COPY "${CMAKE_SOURCE_DIR}/data/points/COIL_database/lucky_cat.off" DESTINATION ${CMAKE_CURRENT_BINARY_DIR}/) - file(COPY "${CMAKE_SOURCE_DIR}/data/points/COIL_database/lucky_cat_PCA1" DESTINATION ${CMAKE_CURRENT_BINARY_DIR}/) +add_test(NAME Nerve_GIC_example_CoordGIC COMMAND $<TARGET_FILE:CoordGIC> + "${CMAKE_CURRENT_BINARY_DIR}/tore3D_1307.off" "0") - add_test(NAME Nerve_GIC_example_CoordGIC COMMAND $<TARGET_FILE:CoordGIC> - "${CMAKE_CURRENT_BINARY_DIR}/tore3D_1307.off" "0") - - add_test(NAME Nerve_GIC_example_FuncGIC COMMAND $<TARGET_FILE:FuncGIC> - "${CMAKE_CURRENT_BINARY_DIR}/lucky_cat.off" - "${CMAKE_CURRENT_BINARY_DIR}/lucky_cat_PCA1") - -endif (NOT CGAL_VERSION VERSION_LESS 4.11.0) +add_test(NAME Nerve_GIC_example_FuncGIC COMMAND $<TARGET_FILE:FuncGIC> + "${CMAKE_CURRENT_BINARY_DIR}/lucky_cat.off" + "${CMAKE_CURRENT_BINARY_DIR}/lucky_cat_PCA1") diff --git a/src/Nerve_GIC/include/gudhi/GIC.h b/src/Nerve_GIC/include/gudhi/GIC.h index 1b1f9323..047fba61 100644 --- a/src/Nerve_GIC/include/gudhi/GIC.h +++ b/src/Nerve_GIC/include/gudhi/GIC.h @@ -17,6 +17,14 @@ #include <mutex> #endif +#if __has_include(<CGAL/version.h>) +# define GUDHI_GIC_USE_CGAL 1 +# include <gudhi/Bottleneck.h> +#elif __has_include(<hera/bottleneck.h>) +# define GUDHI_GIC_USE_HERA 1 +# include <hera/bottleneck.h> +#endif + #include <gudhi/Debug_utils.h> #include <gudhi/graph_simplicial_complex.h> #include <gudhi/reader_utils.h> @@ -25,7 +33,6 @@ #include <gudhi/Points_off_io.h> #include <gudhi/distance_functions.h> #include <gudhi/Persistent_cohomology.h> -#include <gudhi/Bottleneck.h> #include <boost/config.hpp> #include <boost/graph/graph_traits.hpp> @@ -35,8 +42,6 @@ #include <boost/graph/subgraph.hpp> #include <boost/graph/graph_utility.hpp> -#include <CGAL/version.h> // for CGAL_VERSION_NR - #include <iostream> #include <vector> #include <map> @@ -1228,7 +1233,14 @@ class Cover_complex { Cboot.set_cover_from_function(); Cboot.find_simplices(); Cboot.compute_PD(); +#ifdef GUDHI_GIC_USE_CGAL double db = Gudhi::persistence_diagram::bottleneck_distance(this->PD, Cboot.PD); +#elif defined GUDHI_GIC_USE_HERA + double db = hera::bottleneckDistExact(this->PD, Cboot.PD); +#else + double db; + throw std::logic_error("This function requires CGAL or Hera for the bottleneck distance."); +#endif if (verbose) std::clog << db << std::endl; distribution.push_back(db); } diff --git a/src/Nerve_GIC/test/CMakeLists.txt b/src/Nerve_GIC/test/CMakeLists.txt index 567bf43f..e012a178 100644 --- a/src/Nerve_GIC/test/CMakeLists.txt +++ b/src/Nerve_GIC/test/CMakeLists.txt @@ -1,15 +1,12 @@ project(Graph_induced_complex_tests) -if (NOT CGAL_VERSION VERSION_LESS 4.11.0) - include(GUDHI_boost_test) +include(GUDHI_boost_test) - add_executable ( Nerve_GIC_test_unit test_GIC.cpp ) - if (TBB_FOUND) - target_link_libraries(Nerve_GIC_test_unit ${TBB_LIBRARIES}) - endif() +add_executable ( Nerve_GIC_test_unit test_GIC.cpp ) +if (TBB_FOUND) + target_link_libraries(Nerve_GIC_test_unit ${TBB_LIBRARIES}) +endif() - file(COPY data DESTINATION ${CMAKE_CURRENT_BINARY_DIR}/) +file(COPY data DESTINATION ${CMAKE_CURRENT_BINARY_DIR}/) - gudhi_add_boost_test(Nerve_GIC_test_unit) - -endif (NOT CGAL_VERSION VERSION_LESS 4.11.0) +gudhi_add_boost_test(Nerve_GIC_test_unit) diff --git a/src/Nerve_GIC/utilities/CMakeLists.txt b/src/Nerve_GIC/utilities/CMakeLists.txt index 65a08d9a..4521a992 100644 --- a/src/Nerve_GIC/utilities/CMakeLists.txt +++ b/src/Nerve_GIC/utilities/CMakeLists.txt @@ -1,27 +1,23 @@ project(Nerve_GIC_examples) -if (NOT CGAL_VERSION VERSION_LESS 4.11.0) +add_executable ( Nerve Nerve.cpp ) +add_executable ( VoronoiGIC VoronoiGIC.cpp ) - add_executable ( Nerve Nerve.cpp ) - add_executable ( VoronoiGIC VoronoiGIC.cpp ) +if (TBB_FOUND) + target_link_libraries(Nerve ${TBB_LIBRARIES}) + target_link_libraries(VoronoiGIC ${TBB_LIBRARIES}) +endif() - if (TBB_FOUND) - target_link_libraries(Nerve ${TBB_LIBRARIES}) - target_link_libraries(VoronoiGIC ${TBB_LIBRARIES}) - endif() +file(COPY KeplerMapperVisuFromTxtFile.py km.py DESTINATION ${CMAKE_CURRENT_BINARY_DIR}/) +# Copy files for not to pollute sources when testing +file(COPY "${CMAKE_SOURCE_DIR}/data/points/human.off" DESTINATION ${CMAKE_CURRENT_BINARY_DIR}/) - file(COPY KeplerMapperVisuFromTxtFile.py km.py DESTINATION ${CMAKE_CURRENT_BINARY_DIR}/) - # Copy files for not to pollute sources when testing - file(COPY "${CMAKE_SOURCE_DIR}/data/points/human.off" DESTINATION ${CMAKE_CURRENT_BINARY_DIR}/) +add_test(NAME Nerve_GIC_utilities_nerve COMMAND $<TARGET_FILE:Nerve> + "human.off" "2" "10" "0.3") - add_test(NAME Nerve_GIC_utilities_nerve COMMAND $<TARGET_FILE:Nerve> - "human.off" "2" "10" "0.3") +add_test(NAME Nerve_GIC_utilities_VoronoiGIC COMMAND $<TARGET_FILE:VoronoiGIC> + "human.off" "100") - add_test(NAME Nerve_GIC_utilities_VoronoiGIC COMMAND $<TARGET_FILE:VoronoiGIC> - "human.off" "100") - - install(TARGETS Nerve DESTINATION bin) - install(TARGETS VoronoiGIC DESTINATION bin) - install(FILES KeplerMapperVisuFromTxtFile.py km.py km.py.COPYRIGHT DESTINATION bin) - -endif (NOT CGAL_VERSION VERSION_LESS 4.11.0) +install(TARGETS Nerve DESTINATION bin) +install(TARGETS VoronoiGIC DESTINATION bin) +install(FILES KeplerMapperVisuFromTxtFile.py km.py km.py.COPYRIGHT DESTINATION bin) diff --git a/src/Nerve_GIC/utilities/km.py.COPYRIGHT b/src/Nerve_GIC/utilities/km.py.COPYRIGHT index bef7b121..5358d287 100644 --- a/src/Nerve_GIC/utilities/km.py.COPYRIGHT +++ b/src/Nerve_GIC/utilities/km.py.COPYRIGHT @@ -1,7 +1,7 @@ km.py is a fork of https://github.com/MLWave/kepler-mapper. Only the visualization part has been kept (Mapper part has been removed). -This file has te following Copyright : +This file has the following Copyright : The MIT License (MIT) diff --git a/src/Persistence_representations/include/gudhi/Persistence_intervals.h b/src/Persistence_representations/include/gudhi/Persistence_intervals.h index a6c1d6f0..f4324cb2 100644 --- a/src/Persistence_representations/include/gudhi/Persistence_intervals.h +++ b/src/Persistence_representations/include/gudhi/Persistence_intervals.h @@ -109,7 +109,7 @@ class Persistence_intervals { std::vector<size_t> cumulative_histogram_of_lengths(size_t number_of_bins = 10) const; /** - * In this procedure we assume that each barcode is a characteristic function of a hight equal to its length. The + * In this procedure we assume that each barcode is a characteristic function of a height equal to its length. The *persistence diagram is a sum of such a functions. The procedure below construct a function being a * sum of the characteristic functions of persistence intervals. The first two parameters are the range in which the *function is to be computed and the last parameter is the number of bins in @@ -207,7 +207,7 @@ class Persistence_intervals { /** * This is a simple function projecting the persistence intervals to a real number. The function we use here is a sum *of squared lengths of intervals. It can be naturally interpreted as - * sum of step function, where the step hight it equal to the length of the interval. + * sum of step function, where the step height it equal to the length of the interval. * At the moment this function is not tested, since it is quite likely to be changed in the future. Given this, when *using it, keep in mind that it * will be most likely changed in the next versions. diff --git a/src/Persistence_representations/test/persistence_heat_maps_test.cpp b/src/Persistence_representations/test/persistence_heat_maps_test.cpp index b3240758..bf531773 100644 --- a/src/Persistence_representations/test/persistence_heat_maps_test.cpp +++ b/src/Persistence_representations/test/persistence_heat_maps_test.cpp @@ -78,7 +78,7 @@ BOOST_AUTO_TEST_CASE(check_compute_percentage_of_active_of_heat_maps) { to_compute_percentage_of_active.push_back(&q); to_compute_percentage_of_active.push_back(&r); Persistence_heat_maps<constant_scaling_function> percentage_of_active; - percentage_of_active.compute_percentage_of_active(to_compute_percentage_of_active, 0.1); + percentage_of_active.compute_percentage_of_active(to_compute_percentage_of_active, 0); Persistence_heat_maps<constant_scaling_function> template_percentage_of_active; template_percentage_of_active.load_from_file("data/template_percentage_of_active_of_heat_maps"); diff --git a/src/Persistence_representations/test/persistence_lanscapes_test.cpp b/src/Persistence_representations/test/persistence_lanscapes_test.cpp index 21ef18a0..59924f16 100644 --- a/src/Persistence_representations/test/persistence_lanscapes_test.cpp +++ b/src/Persistence_representations/test/persistence_lanscapes_test.cpp @@ -238,7 +238,7 @@ if ( argc != 2 ) double integral = p.compute_integral_of_landscape(); cout << "integral : " << integral <<endl; - //compute integral for each level separatelly + //compute integral for each level separately for ( size_t level = 0 ; level != p.size() ; ++level ) { cout << p.compute_integral_of_landscape( level ) << endl; diff --git a/src/Persistent_cohomology/benchmark/performance_rips_persistence.cpp b/src/Persistent_cohomology/benchmark/performance_rips_persistence.cpp index 030b072a..3bec8830 100644 --- a/src/Persistent_cohomology/benchmark/performance_rips_persistence.cpp +++ b/src/Persistent_cohomology/benchmark/performance_rips_persistence.cpp @@ -49,7 +49,7 @@ void timing_persistence(FilteredComplex & cpx * with a Hasse diagram. The Hasse diagram represents explicitly all * codimension 1 incidence relations in the complex, and hence leads to * a faster computation of persistence because boundaries are precomputed. - * Hovewer, the simplex tree may be constructed directly from a point cloud and + * However, the simplex tree may be constructed directly from a point cloud and * is more compact. * We compute persistent homology with coefficient fields Z/2Z and Z/1223Z. * We present also timings for the computation of multi-field persistent diff --git a/src/Persistent_cohomology/concept/FilteredComplex.h b/src/Persistent_cohomology/concept/FilteredComplex.h index 26ac7ac8..59ce25e3 100644 --- a/src/Persistent_cohomology/concept/FilteredComplex.h +++ b/src/Persistent_cohomology/concept/FilteredComplex.h @@ -103,7 +103,7 @@ Filtration_simplex_range filtration_simplex_range(); /** @} */ -/* \brief Iterator over the simplices of the complex, +/** \brief Iterator over the simplices of the complex, * in an arbitrary order. * * 'value_type' must be 'Simplex_handle'.*/ diff --git a/src/Persistent_cohomology/doc/Intro_persistent_cohomology.h b/src/Persistent_cohomology/doc/Intro_persistent_cohomology.h index b4f9fd2c..94579564 100644 --- a/src/Persistent_cohomology/doc/Intro_persistent_cohomology.h +++ b/src/Persistent_cohomology/doc/Intro_persistent_cohomology.h @@ -131,8 +131,7 @@ namespace persistent_cohomology { We provide several example files: run these examples with -h for details on their use, and read the README file. -\li <a href="_rips_complex_2rips_persistence_8cpp-example.html"> -Rips_complex/rips_persistence.cpp</a> computes the Rips complex of a point cloud and outputs its persistence +\li \gudhi_example_link{Rips_complex,rips_persistence.cpp} computes the Rips complex of a point cloud and outputs its persistence diagram. \code $> ./rips_persistence ../../data/points/tore3D_1307.off -r 0.25 -m 0.5 -d 3 -p 3 \endcode \code The complex contains 177838 simplices @@ -144,12 +143,10 @@ diagram. More details on the <a href="../../ripscomplex/">Rips complex utilities</a> dedicated page. -\li <a href="_persistent_cohomology_2rips_multifield_persistence_8cpp-example.html"> -Persistent_cohomology/rips_multifield_persistence.cpp</a> computes the Rips complex of a point cloud and outputs its +\li \gudhi_example_link{Persistent_cohomology,rips_multifield_persistence.cpp} computes the Rips complex of a point cloud and outputs its persistence diagram with a family of field coefficients. -\li <a href="_rips_complex_2rips_distance_matrix_persistence_8cpp-example.html"> -Rips_complex/rips_distance_matrix_persistence.cpp</a> computes the Rips complex of a distance matrix and +\li \gudhi_example_link{Rips_complex,rips_distance_matrix_persistence.cpp} computes the Rips complex of a distance matrix and outputs its persistence diagram. The file should contain square or lower triangular distance matrix with semicolons as separators. @@ -158,8 +155,7 @@ Please refer to data/distance_matrix/lower_triangular_distance_matrix.csv for an More details on the <a href="../../ripscomplex/">Rips complex utilities</a> dedicated page. -\li <a href="_rips_complex_2rips_correlation_matrix_persistence_8cpp-example.html"> -Rips_complex/rips_correlation_matrix_persistence.cpp</a> +\li \gudhi_example_link{Rips_complex,rips_correlation_matrix_persistence.cpp} computes the Rips complex of a correlation matrix and outputs its persistence diagram. Note that no check is performed if the matrix given as the input is a correlation matrix. @@ -169,8 +165,7 @@ Please refer to data/correlation_matrix/lower_triangular_correlation_matrix.csv More details on the <a href="../../ripscomplex/">Rips complex utilities</a> dedicated page. -\li <a href="_alpha_complex_2alpha_complex_3d_persistence_8cpp-example.html"> -Alpha_complex/alpha_complex_3d_persistence.cpp</a> computes the persistent homology with +\li \gudhi_example_link{Alpha_complex,alpha_complex_3d_persistence.cpp} computes the persistent homology with \f$\mathbb{Z}/2\mathbb{Z}\f$ coefficients of the alpha complex on points sampling from an OFF file. \code $> ./alpha_complex_3d_persistence ../../data/points/tore3D_300.off -p 2 -m 0.45 \endcode \code Simplex_tree dim: 3 @@ -235,8 +230,7 @@ Note that the lengths of the sides of the periodic cuboid have to be the same.<b 3 2 36.8838 inf 3 3 58.6783 inf \endcode -\li <a href="_alpha_complex_2alpha_complex_persistence_8cpp-example.html"> -Alpha_complex/alpha_complex_persistence.cpp</a> computes the persistent homology with +\li \gudhi_example_link{Alpha_complex,alpha_complex_persistence.cpp} computes the persistent homology with \f$\mathbb{Z}/p\mathbb{Z}\f$ coefficients of the alpha complex on points sampling from an OFF file. \code $> ./alpha_complex_persistence -r 32 -p 2 -m 0.45 ../../data/points/tore3D_300.off \endcode \code Alpha complex is of dimension 3 - 9273 simplices - 300 vertices. @@ -248,8 +242,7 @@ Simplex_tree dim: 3 More details on the <a href="../../alphacomplex/">Alpha complex utilities</a> dedicated page. -\li <a href="_persistent_cohomology_2plain_homology_8cpp-example.html"> -Persistent_cohomology/plain_homology.cpp</a> computes the plain homology of a simple simplicial complex without +\li \gudhi_example_link{Persistent_cohomology,plain_homology.cpp} computes the plain homology of a simple simplicial complex without filtration values. */ diff --git a/src/Persistent_cohomology/example/CMakeLists.txt b/src/Persistent_cohomology/example/CMakeLists.txt index c68c6524..d66954d7 100644 --- a/src/Persistent_cohomology/example/CMakeLists.txt +++ b/src/Persistent_cohomology/example/CMakeLists.txt @@ -11,7 +11,7 @@ if (TBB_FOUND) target_link_libraries(persistence_from_simple_simplex_tree ${TBB_LIBRARIES}) endif() add_test(NAME Persistent_cohomology_example_from_simple_simplex_tree COMMAND $<TARGET_FILE:persistence_from_simple_simplex_tree> - "1" "0") + "2" "0") if(TARGET Boost::program_options) add_executable(rips_persistence_step_by_step rips_persistence_step_by_step.cpp) @@ -40,9 +40,9 @@ if(TARGET Boost::program_options) target_link_libraries(persistence_from_file ${TBB_LIBRARIES}) endif() add_test(NAME Persistent_cohomology_example_from_file_3_2_0 COMMAND $<TARGET_FILE:persistence_from_file> - "${CMAKE_SOURCE_DIR}/data/filtered_simplicial_complex/bunny_5000_complex.fsc" "-p" "2" "-m" "0") + "${CMAKE_SOURCE_DIR}/data/filtered_simplicial_complex/Klein_bottle_complex.fsc" "-p" "2" "-m" "0") add_test(NAME Persistent_cohomology_example_from_file_3_3_100 COMMAND $<TARGET_FILE:persistence_from_file> - "${CMAKE_SOURCE_DIR}/data/filtered_simplicial_complex/bunny_5000_complex.fsc" "-p" "3" "-m" "100") + "${CMAKE_SOURCE_DIR}/data/filtered_simplicial_complex/Klein_bottle_complex.fsc" "-p" "3" "-m" "100") endif() if(GMP_FOUND) diff --git a/src/Persistent_cohomology/example/custom_persistence_sort.cpp b/src/Persistent_cohomology/example/custom_persistence_sort.cpp index 410cd987..bba0b2f7 100644 --- a/src/Persistent_cohomology/example/custom_persistence_sort.cpp +++ b/src/Persistent_cohomology/example/custom_persistence_sort.cpp @@ -33,7 +33,7 @@ using Persistent_cohomology = Gudhi::persistent_cohomology::Persistent_cohomolog Gudhi::persistent_cohomology::Field_Zp >; std::vector<Point> random_points() { - // Instanciate a random point generator + // Instantiate a random point generator CGAL::Random rng(0); // Generate "points_number" random points in a vector diff --git a/src/Persistent_cohomology/example/persistence_from_file.cpp b/src/Persistent_cohomology/example/persistence_from_file.cpp index 38c44514..7f89c001 100644 --- a/src/Persistent_cohomology/example/persistence_from_file.cpp +++ b/src/Persistent_cohomology/example/persistence_from_file.cpp @@ -93,7 +93,7 @@ void program_options(int argc, char * argv[] visible.add_options() ("help,h", "produce help message") ("output-file,o", po::value<std::string>(&output_file)->default_value(std::string()), - "Name of file in which the persistence diagram is written. Default print in std::clog") + "Name of file in which the persistence diagram is written. Default print in standard output") ("field-charac,p", po::value<int>(&p)->default_value(11), "Characteristic p of the coefficient field Z/pZ for computing homology.") ("min-persistence,m", po::value<Filtration_value>(&min_persistence), diff --git a/src/Persistent_cohomology/example/persistence_from_simple_simplex_tree.cpp b/src/Persistent_cohomology/example/persistence_from_simple_simplex_tree.cpp index bffaabdd..3da6771e 100644 --- a/src/Persistent_cohomology/example/persistence_from_simple_simplex_tree.cpp +++ b/src/Persistent_cohomology/example/persistence_from_simple_simplex_tree.cpp @@ -95,7 +95,7 @@ int main(int argc, char * const argv[]) { SimplexVector = {9, 10, 11}; st.insert_simplex_and_subfaces(SimplexVector, 0.3); - // ++ NINETH + // ++ NINTH std::clog << " - INSERT (2,10,12)" << std::endl; SimplexVector = {2, 10, 12}; st.insert_simplex_and_subfaces(SimplexVector, 0.3); diff --git a/src/Persistent_cohomology/example/rips_multifield_persistence.cpp b/src/Persistent_cohomology/example/rips_multifield_persistence.cpp index 2edf5bc4..84453898 100644 --- a/src/Persistent_cohomology/example/rips_multifield_persistence.cpp +++ b/src/Persistent_cohomology/example/rips_multifield_persistence.cpp @@ -96,7 +96,7 @@ void program_options(int argc, char * argv[] visible.add_options() ("help,h", "produce help message") ("output-file,o", po::value<std::string>(&filediag)->default_value(std::string()), - "Name of file in which the persistence diagram is written. Default print in std::clog") + "Name of file in which the persistence diagram is written. Default print in standard output") ("max-edge-length,r", po::value<Filtration_value>(&threshold)->default_value(0), "Maximal length of an edge for the Rips complex construction.") ("cpx-dimension,d", po::value<int>(&dim_max)->default_value(1), @@ -104,7 +104,7 @@ void program_options(int argc, char * argv[] ("min-field-charac,p", po::value<int>(&min_p)->default_value(2), "Minimal characteristic p of the coefficient field Z/pZ.") ("max-field-charac,q", po::value<int>(&max_p)->default_value(1223), - "Minimial characteristic q of the coefficient field Z/pZ.") + "Maximal characteristic q of the coefficient field Z/pZ.") ("min-persistence,m", po::value<Filtration_value>(&min_persistence), "Minimal lifetime of homology feature to be recorded. Default is 0"); diff --git a/src/Persistent_cohomology/example/rips_persistence_step_by_step.cpp b/src/Persistent_cohomology/example/rips_persistence_step_by_step.cpp index a503d983..6f37cf5c 100644 --- a/src/Persistent_cohomology/example/rips_persistence_step_by_step.cpp +++ b/src/Persistent_cohomology/example/rips_persistence_step_by_step.cpp @@ -112,7 +112,7 @@ void program_options(int argc, char * argv[] visible.add_options() ("help,h", "produce help message") ("output-file,o", po::value<std::string>(&filediag)->default_value(std::string()), - "Name of file in which the persistence diagram is written. Default print in std::clog") + "Name of file in which the persistence diagram is written. Default print in standard output") ("max-edge-length,r", po::value<Filtration_value>(&threshold)->default_value(std::numeric_limits<Filtration_value>::infinity()), "Maximal length of an edge for the Rips complex construction.") diff --git a/src/Persistent_cohomology/example/rips_persistence_via_boundary_matrix.cpp b/src/Persistent_cohomology/example/rips_persistence_via_boundary_matrix.cpp index 8c5742aa..6b60f603 100644 --- a/src/Persistent_cohomology/example/rips_persistence_via_boundary_matrix.cpp +++ b/src/Persistent_cohomology/example/rips_persistence_via_boundary_matrix.cpp @@ -109,7 +109,7 @@ void program_options(int argc, char * argv[] visible.add_options() ("help,h", "produce help message") ("output-file,o", po::value<std::string>(&filediag)->default_value(std::string()), - "Name of file in which the persistence diagram is written. Default print in std::clog") + "Name of file in which the persistence diagram is written. Default print in standard output") ("max-edge-length,r", po::value<Filtration_value>(&threshold)->default_value(0), "Maximal length of an edge for the Rips complex construction.") ("cpx-dimension,d", po::value<int>(&dim_max)->default_value(1), diff --git a/src/Persistent_cohomology/include/gudhi/Persistent_cohomology.h b/src/Persistent_cohomology/include/gudhi/Persistent_cohomology.h index d34ee07d..c00bd33d 100644 --- a/src/Persistent_cohomology/include/gudhi/Persistent_cohomology.h +++ b/src/Persistent_cohomology/include/gudhi/Persistent_cohomology.h @@ -100,7 +100,7 @@ class Persistent_cohomology { ds_rank_(num_simplices_), // union-find ds_parent_(num_simplices_), // union-find ds_repr_(num_simplices_, NULL), // union-find -> annotation vectors - dsets_(&ds_rank_[0], &ds_parent_[0]), // union-find + dsets_(ds_rank_.data(), ds_parent_.data()), // union-find cam_(), // collection of annotation vectors zero_cocycles_(), // union-find -> Simplex_key of creator for 0-homology transverse_idx_(), // key -> row @@ -211,7 +211,7 @@ class Persistent_cohomology { /** \brief Update the cohomology groups under the insertion of an edge. * * The 0-homology is maintained with a simple Union-Find data structure, which - * explains the existance of a specific function of edge insertions. */ + * explains the existence of a specific function of edge insertions. */ void update_cohomology_groups_edge(Simplex_handle sigma) { Simplex_handle u, v; boost::tie(u, v) = cpx_->endpoints(sigma); @@ -723,7 +723,7 @@ class Persistent_cohomology { boost::disjoint_sets<int *, Simplex_key *> dsets_; /* The compressed annotation matrix fields.*/ Cam cam_; - /* Dictionary establishing the correspondance between the Simplex_key of + /* Dictionary establishing the correspondence between the Simplex_key of * the root vertex in the union-find ds and the Simplex_key of the vertex which * created the connected component as a 0-dimension homology feature.*/ std::map<Simplex_key, Simplex_key> zero_cocycles_; diff --git a/src/Persistent_cohomology/include/gudhi/Persistent_cohomology/Field_Zp.h b/src/Persistent_cohomology/include/gudhi/Persistent_cohomology/Field_Zp.h index 0673625c..f442b632 100644 --- a/src/Persistent_cohomology/include/gudhi/Persistent_cohomology/Field_Zp.h +++ b/src/Persistent_cohomology/include/gudhi/Persistent_cohomology/Field_Zp.h @@ -13,6 +13,7 @@ #include <utility> #include <vector> +#include <stdexcept> namespace Gudhi { @@ -33,15 +34,28 @@ class Field_Zp { } void init(int charac) { - assert(charac > 0); // division by zero + non negative values Prime = charac; + + // Check that the provided prime is less than the maximum allowed as int, calculation below, and 'plus_times_equal' function : 46337 ; i.e (max_prime-1)*max_prime <= INT_MAX + if(Prime > 46337) + throw std::invalid_argument("Maximum homology_coeff_field allowed value is 46337"); + + // Check for primality + if (Prime <= 1) + throw std::invalid_argument("homology_coeff_field must be a prime number"); + inverse_.clear(); inverse_.reserve(charac); inverse_.push_back(0); for (int i = 1; i < Prime; ++i) { int inv = 1; - while (((inv * i) % Prime) != 1) + int mult = inv * i; + while ( (mult % Prime) != 1) { ++inv; + if(mult == Prime) + throw std::invalid_argument("homology_coeff_field must be a prime number"); + mult = inv * i; + } inverse_.push_back(inv); } } diff --git a/src/Persistent_cohomology/test/persistent_cohomology_unit_test.cpp b/src/Persistent_cohomology/test/persistent_cohomology_unit_test.cpp index fe3f8517..ea41a8aa 100644 --- a/src/Persistent_cohomology/test/persistent_cohomology_unit_test.cpp +++ b/src/Persistent_cohomology/test/persistent_cohomology_unit_test.cpp @@ -21,7 +21,7 @@ using namespace boost::unit_test; typedef Simplex_tree<> typeST; -std::string test_rips_persistence(int coefficient, int min_persistence) { +std::string test_persistence(int coefficient, int min_persistence) { // file is copied in CMakeLists.txt std::ifstream simplex_tree_stream; simplex_tree_stream.open("simplex_tree_file_for_unit_test.txt"); @@ -44,16 +44,16 @@ std::string test_rips_persistence(int coefficient, int min_persistence) { Persistent_cohomology<Simplex_tree<>, Field_Zp> pcoh(st); pcoh.init_coefficients( coefficient ); // initializes the coefficient field for homology - // Check infinite rips + // Compute the persistent homology of the complex pcoh.compute_persistent_cohomology( min_persistence ); // Minimal lifetime of homology feature to be recorded. - std::ostringstream ossInfinite; + std::ostringstream ossPers; - pcoh.output_diagram(ossInfinite); - std::string strInfinite = ossInfinite.str(); - return strInfinite; + pcoh.output_diagram(ossPers); + std::string strPers = ossPers.str(); + return strPers; } -void test_rips_persistence_in_dimension(int dimension) { +void test_persistence_with_coeff_field(int coeff_field) { std::string value0(" 0 0.02 1.12"); std::string value1(" 0 0.03 1.13"); std::string value2(" 0 0.04 1.14"); @@ -65,112 +65,104 @@ void test_rips_persistence_in_dimension(int dimension) { std::string value8(" 0 0 inf" ); std::string value9(" 0 0.01 inf" ); - value0.insert(0,std::to_string(dimension)); - value1.insert(0,std::to_string(dimension)); - value2.insert(0,std::to_string(dimension)); - value3.insert(0,std::to_string(dimension)); - value4.insert(0,std::to_string(dimension)); - value5.insert(0,std::to_string(dimension)); - value6.insert(0,std::to_string(dimension)); - value7.insert(0,std::to_string(dimension)); - value8.insert(0,std::to_string(dimension)); - value9.insert(0,std::to_string(dimension)); + value0.insert(0,std::to_string(coeff_field)); + value1.insert(0,std::to_string(coeff_field)); + value2.insert(0,std::to_string(coeff_field)); + value3.insert(0,std::to_string(coeff_field)); + value4.insert(0,std::to_string(coeff_field)); + value5.insert(0,std::to_string(coeff_field)); + value6.insert(0,std::to_string(coeff_field)); + value7.insert(0,std::to_string(coeff_field)); + value8.insert(0,std::to_string(coeff_field)); + value9.insert(0,std::to_string(coeff_field)); std::clog << "********************************************************************" << std::endl; - std::clog << "TEST OF RIPS_PERSISTENT_COHOMOLOGY_SINGLE_FIELD DIM=" << dimension << " MIN_PERS=0" << std::endl; + std::clog << "TEST OF PERSISTENT_COHOMOLOGY_SINGLE_FIELD COEFF_FIELD=" << coeff_field << " MIN_PERS=0" << std::endl; - std::string str_rips_persistence = test_rips_persistence(dimension, 0); - std::clog << str_rips_persistence << std::endl; + std::string str_persistence = test_persistence(coeff_field, 0); + std::clog << str_persistence << std::endl; - BOOST_CHECK(str_rips_persistence.find(value0) != std::string::npos); // Check found - BOOST_CHECK(str_rips_persistence.find(value1) != std::string::npos); // Check found - BOOST_CHECK(str_rips_persistence.find(value2) != std::string::npos); // Check found - BOOST_CHECK(str_rips_persistence.find(value3) != std::string::npos); // Check found - BOOST_CHECK(str_rips_persistence.find(value4) != std::string::npos); // Check found - BOOST_CHECK(str_rips_persistence.find(value5) != std::string::npos); // Check found - BOOST_CHECK(str_rips_persistence.find(value6) != std::string::npos); // Check found - BOOST_CHECK(str_rips_persistence.find(value7) != std::string::npos); // Check found - BOOST_CHECK(str_rips_persistence.find(value8) != std::string::npos); // Check found - BOOST_CHECK(str_rips_persistence.find(value9) != std::string::npos); // Check found - std::clog << "str_rips_persistence=" << str_rips_persistence << std::endl; + BOOST_CHECK(str_persistence.find(value0) != std::string::npos); // Check found + BOOST_CHECK(str_persistence.find(value1) != std::string::npos); // Check found + BOOST_CHECK(str_persistence.find(value2) != std::string::npos); // Check found + BOOST_CHECK(str_persistence.find(value3) != std::string::npos); // Check found + BOOST_CHECK(str_persistence.find(value4) != std::string::npos); // Check found + BOOST_CHECK(str_persistence.find(value5) != std::string::npos); // Check found + BOOST_CHECK(str_persistence.find(value6) != std::string::npos); // Check found + BOOST_CHECK(str_persistence.find(value7) != std::string::npos); // Check found + BOOST_CHECK(str_persistence.find(value8) != std::string::npos); // Check found + BOOST_CHECK(str_persistence.find(value9) != std::string::npos); // Check found + std::clog << "str_persistence=" << str_persistence << std::endl; std::clog << "********************************************************************" << std::endl; - std::clog << "TEST OF RIPS_PERSISTENT_COHOMOLOGY_SINGLE_FIELD DIM=" << dimension << " MIN_PERS=1" << std::endl; - - str_rips_persistence = test_rips_persistence(dimension, 1); - - BOOST_CHECK(str_rips_persistence.find(value0) != std::string::npos); // Check found - BOOST_CHECK(str_rips_persistence.find(value1) != std::string::npos); // Check found - BOOST_CHECK(str_rips_persistence.find(value2) != std::string::npos); // Check found - BOOST_CHECK(str_rips_persistence.find(value3) != std::string::npos); // Check found - BOOST_CHECK(str_rips_persistence.find(value4) != std::string::npos); // Check found - BOOST_CHECK(str_rips_persistence.find(value5) != std::string::npos); // Check found - BOOST_CHECK(str_rips_persistence.find(value6) != std::string::npos); // Check found - BOOST_CHECK(str_rips_persistence.find(value7) != std::string::npos); // Check found - BOOST_CHECK(str_rips_persistence.find(value8) != std::string::npos); // Check found - BOOST_CHECK(str_rips_persistence.find(value9) != std::string::npos); // Check found - std::clog << "str_rips_persistence=" << str_rips_persistence << std::endl; + std::clog << "TEST OF PERSISTENT_COHOMOLOGY_SINGLE_FIELD COEFF_FIELD=" << coeff_field << " MIN_PERS=1" << std::endl; + + str_persistence = test_persistence(coeff_field, 1); + + BOOST_CHECK(str_persistence.find(value0) != std::string::npos); // Check found + BOOST_CHECK(str_persistence.find(value1) != std::string::npos); // Check found + BOOST_CHECK(str_persistence.find(value2) != std::string::npos); // Check found + BOOST_CHECK(str_persistence.find(value3) != std::string::npos); // Check found + BOOST_CHECK(str_persistence.find(value4) != std::string::npos); // Check found + BOOST_CHECK(str_persistence.find(value5) != std::string::npos); // Check found + BOOST_CHECK(str_persistence.find(value6) != std::string::npos); // Check found + BOOST_CHECK(str_persistence.find(value7) != std::string::npos); // Check found + BOOST_CHECK(str_persistence.find(value8) != std::string::npos); // Check found + BOOST_CHECK(str_persistence.find(value9) != std::string::npos); // Check found + std::clog << "str_persistence=" << str_persistence << std::endl; std::clog << "********************************************************************" << std::endl; - std::clog << "TEST OF RIPS_PERSISTENT_COHOMOLOGY_SINGLE_FIELD DIM=" << dimension << " MIN_PERS=2" << std::endl; - - str_rips_persistence = test_rips_persistence(dimension, 2); - - BOOST_CHECK(str_rips_persistence.find(value0) == std::string::npos); // Check not found - BOOST_CHECK(str_rips_persistence.find(value1) == std::string::npos); // Check not found - BOOST_CHECK(str_rips_persistence.find(value2) == std::string::npos); // Check not found - BOOST_CHECK(str_rips_persistence.find(value3) == std::string::npos); // Check not found - BOOST_CHECK(str_rips_persistence.find(value4) == std::string::npos); // Check not found - BOOST_CHECK(str_rips_persistence.find(value5) == std::string::npos); // Check not found - BOOST_CHECK(str_rips_persistence.find(value6) == std::string::npos); // Check not found - BOOST_CHECK(str_rips_persistence.find(value7) == std::string::npos); // Check not found - BOOST_CHECK(str_rips_persistence.find(value8) != std::string::npos); // Check found - BOOST_CHECK(str_rips_persistence.find(value9) != std::string::npos); // Check found - std::clog << "str_rips_persistence=" << str_rips_persistence << std::endl; + std::clog << "TEST OF PERSISTENT_COHOMOLOGY_SINGLE_FIELD COEFF_FIELD=" << coeff_field << " MIN_PERS=2" << std::endl; + + str_persistence = test_persistence(coeff_field, 2); + + BOOST_CHECK(str_persistence.find(value0) == std::string::npos); // Check not found + BOOST_CHECK(str_persistence.find(value1) == std::string::npos); // Check not found + BOOST_CHECK(str_persistence.find(value2) == std::string::npos); // Check not found + BOOST_CHECK(str_persistence.find(value3) == std::string::npos); // Check not found + BOOST_CHECK(str_persistence.find(value4) == std::string::npos); // Check not found + BOOST_CHECK(str_persistence.find(value5) == std::string::npos); // Check not found + BOOST_CHECK(str_persistence.find(value6) == std::string::npos); // Check not found + BOOST_CHECK(str_persistence.find(value7) == std::string::npos); // Check not found + BOOST_CHECK(str_persistence.find(value8) != std::string::npos); // Check found + BOOST_CHECK(str_persistence.find(value9) != std::string::npos); // Check found + std::clog << "str_persistence=" << str_persistence << std::endl; std::clog << "********************************************************************" << std::endl; - std::clog << "TEST OF RIPS_PERSISTENT_COHOMOLOGY_SINGLE_FIELD DIM=" << dimension << " MIN_PERS=Inf" << std::endl; - - str_rips_persistence = test_rips_persistence(dimension, (std::numeric_limits<int>::max)()); - - BOOST_CHECK(str_rips_persistence.find(value0) == std::string::npos); // Check not found - BOOST_CHECK(str_rips_persistence.find(value1) == std::string::npos); // Check not found - BOOST_CHECK(str_rips_persistence.find(value2) == std::string::npos); // Check not found - BOOST_CHECK(str_rips_persistence.find(value3) == std::string::npos); // Check not found - BOOST_CHECK(str_rips_persistence.find(value4) == std::string::npos); // Check not found - BOOST_CHECK(str_rips_persistence.find(value5) == std::string::npos); // Check not found - BOOST_CHECK(str_rips_persistence.find(value6) == std::string::npos); // Check not found - BOOST_CHECK(str_rips_persistence.find(value7) == std::string::npos); // Check not found - BOOST_CHECK(str_rips_persistence.find(value8) != std::string::npos); // Check found - BOOST_CHECK(str_rips_persistence.find(value9) != std::string::npos); // Check found - std::clog << "str_rips_persistence=" << str_rips_persistence << std::endl; + std::clog << "TEST OF PERSISTENT_COHOMOLOGY_SINGLE_FIELD COEFF_FIELD=" << coeff_field << " MIN_PERS=Inf" << std::endl; + + str_persistence = test_persistence(coeff_field, (std::numeric_limits<int>::max)()); + + BOOST_CHECK(str_persistence.find(value0) == std::string::npos); // Check not found + BOOST_CHECK(str_persistence.find(value1) == std::string::npos); // Check not found + BOOST_CHECK(str_persistence.find(value2) == std::string::npos); // Check not found + BOOST_CHECK(str_persistence.find(value3) == std::string::npos); // Check not found + BOOST_CHECK(str_persistence.find(value4) == std::string::npos); // Check not found + BOOST_CHECK(str_persistence.find(value5) == std::string::npos); // Check not found + BOOST_CHECK(str_persistence.find(value6) == std::string::npos); // Check not found + BOOST_CHECK(str_persistence.find(value7) == std::string::npos); // Check not found + BOOST_CHECK(str_persistence.find(value8) != std::string::npos); // Check found + BOOST_CHECK(str_persistence.find(value9) != std::string::npos); // Check found + std::clog << "str_persistence=" << str_persistence << std::endl; } -BOOST_AUTO_TEST_CASE( rips_persistent_cohomology_single_field_dim_1 ) +BOOST_AUTO_TEST_CASE( persistent_cohomology_single_field_coeff_not_prime ) { - test_rips_persistence_in_dimension(1); + for (auto non_prime : {0, 1, 4, 6}) + BOOST_CHECK_THROW(test_persistence_with_coeff_field(non_prime), std::invalid_argument); } -BOOST_AUTO_TEST_CASE( rips_persistent_cohomology_single_field_dim_2 ) +BOOST_AUTO_TEST_CASE( persistent_cohomology_single_field_coeff_prime ) { - test_rips_persistence_in_dimension(2); + for (auto prime : {2, 3, 5, 11, 13}) + test_persistence_with_coeff_field(prime); } -BOOST_AUTO_TEST_CASE( rips_persistent_cohomology_single_field_dim_3 ) +BOOST_AUTO_TEST_CASE( persistent_cohomology_single_field_coeff_limit ) { - test_rips_persistence_in_dimension(3); + BOOST_CHECK_THROW(test_persistence_with_coeff_field(46349), std::invalid_argument); } -BOOST_AUTO_TEST_CASE( rips_persistent_cohomology_single_field_dim_5 ) -{ - test_rips_persistence_in_dimension(5); -} - -// TODO(VR): not working from 6 -// std::string str_rips_persistence = test_rips_persistence(6, 0); -// TODO(VR): division by zero -// std::string str_rips_persistence = test_rips_persistence(0, 0); - /** SimplexTree minimal options to test the limits. * * Maximum number of simplices to compute persistence is <CODE>std::numeric_limits<std::uint8_t>::max()<\CODE> = 256.*/ diff --git a/src/Persistent_cohomology/test/persistent_cohomology_unit_test_multi_field.cpp b/src/Persistent_cohomology/test/persistent_cohomology_unit_test_multi_field.cpp index 3602aa09..c6c0bfaf 100644 --- a/src/Persistent_cohomology/test/persistent_cohomology_unit_test_multi_field.cpp +++ b/src/Persistent_cohomology/test/persistent_cohomology_unit_test_multi_field.cpp @@ -21,7 +21,7 @@ using namespace boost::unit_test; typedef Simplex_tree<> typeST; -std::string test_rips_persistence(int min_coefficient, int max_coefficient, double min_persistence) { +std::string test_persistence(int min_coefficient, int max_coefficient, double min_persistence) { // file is copied in CMakeLists.txt std::ifstream simplex_tree_stream; simplex_tree_stream.open("simplex_tree_file_for_multi_field_unit_test.txt"); @@ -44,17 +44,17 @@ std::string test_rips_persistence(int min_coefficient, int max_coefficient, doub Persistent_cohomology<Simplex_tree<>, Multi_field> pcoh(st); pcoh.init_coefficients(min_coefficient, max_coefficient); // initializes the coefficient field for homology - // Check infinite rips + // Compute the persistent homology of the complex pcoh.compute_persistent_cohomology(min_persistence); // Minimal lifetime of homology feature to be recorded. - std::ostringstream ossRips; - pcoh.output_diagram(ossRips); + std::ostringstream ossPers; + pcoh.output_diagram(ossPers); - std::string strRips = ossRips.str(); - return strRips; + std::string strPers = ossPers.str(); + return strPers; } -void test_rips_persistence_in_dimension(int min_dimension, int max_dimension) { +void test_persistence_with_coeff_field(int min_coefficient, int max_coefficient) { // there are 2 discontinued ensembles std::string value0(" 0 0.25 inf"); std::string value1(" 1 0.4 inf"); @@ -69,47 +69,59 @@ void test_rips_persistence_in_dimension(int min_dimension, int max_dimension) { std::string value7(" 2 0.4 inf"); std::clog << "********************************************************************" << std::endl; - std::clog << "TEST OF RIPS_PERSISTENT_COHOMOLOGY_MULTI_FIELD MIN_DIM=" << min_dimension << " MAX_DIM=" << max_dimension << " MIN_PERS=0" << std::endl; + std::clog << "TEST OF PERSISTENT_COHOMOLOGY_MULTI_FIELD MIN_COEFF=" << min_coefficient << " MAX_COEFF=" << max_coefficient << " MIN_PERS=0" << std::endl; - std::string str_rips_persistence = test_rips_persistence(min_dimension, max_dimension, 0.0); - std::clog << "str_rips_persistence=" << str_rips_persistence << std::endl; + std::string str_persistence = test_persistence(min_coefficient, max_coefficient, 0.0); + std::clog << "str_persistence=" << str_persistence << std::endl; - BOOST_CHECK(str_rips_persistence.find(value0) != std::string::npos); // Check found - BOOST_CHECK(str_rips_persistence.find(value1) != std::string::npos); // Check found - BOOST_CHECK(str_rips_persistence.find(value2) != std::string::npos); // Check found + BOOST_CHECK(str_persistence.find(value0) != std::string::npos); // Check found + BOOST_CHECK(str_persistence.find(value1) != std::string::npos); // Check found + BOOST_CHECK(str_persistence.find(value2) != std::string::npos); // Check found - if ((min_dimension < 2) && (max_dimension < 2)) { - BOOST_CHECK(str_rips_persistence.find(value3) != std::string::npos); // Check found - BOOST_CHECK(str_rips_persistence.find(value4) != std::string::npos); // Check found - BOOST_CHECK(str_rips_persistence.find(value5) != std::string::npos); // Check found - BOOST_CHECK(str_rips_persistence.find(value6) != std::string::npos); // Check found - BOOST_CHECK(str_rips_persistence.find(value7) != std::string::npos); // Check found + if ((min_coefficient < 2) && (max_coefficient < 2)) { + BOOST_CHECK(str_persistence.find(value3) != std::string::npos); // Check found + BOOST_CHECK(str_persistence.find(value4) != std::string::npos); // Check found + BOOST_CHECK(str_persistence.find(value5) != std::string::npos); // Check found + BOOST_CHECK(str_persistence.find(value6) != std::string::npos); // Check found + BOOST_CHECK(str_persistence.find(value7) != std::string::npos); // Check found } else { - BOOST_CHECK(str_rips_persistence.find(value3) == std::string::npos); // Check not found - BOOST_CHECK(str_rips_persistence.find(value4) == std::string::npos); // Check not found - BOOST_CHECK(str_rips_persistence.find(value5) == std::string::npos); // Check not found - BOOST_CHECK(str_rips_persistence.find(value6) == std::string::npos); // Check not found - BOOST_CHECK(str_rips_persistence.find(value7) == std::string::npos); // Check not found + BOOST_CHECK(str_persistence.find(value3) == std::string::npos); // Check not found + BOOST_CHECK(str_persistence.find(value4) == std::string::npos); // Check not found + BOOST_CHECK(str_persistence.find(value5) == std::string::npos); // Check not found + BOOST_CHECK(str_persistence.find(value6) == std::string::npos); // Check not found + BOOST_CHECK(str_persistence.find(value7) == std::string::npos); // Check not found } } -BOOST_AUTO_TEST_CASE(rips_persistent_cohomology_multi_field_dim_1_2) { - test_rips_persistence_in_dimension(0, 1); +BOOST_AUTO_TEST_CASE(persistent_cohomology_multi_field_coeff_0_0) { + test_persistence_with_coeff_field(0, 0); } -BOOST_AUTO_TEST_CASE(rips_persistent_cohomology_multi_field_dim_2_3) { - test_rips_persistence_in_dimension(1, 3); +BOOST_AUTO_TEST_CASE(persistent_cohomology_multi_field_coeff_0_1) { + test_persistence_with_coeff_field(0, 1); } -BOOST_AUTO_TEST_CASE(rips_persistent_cohomology_multi_field_dim_1_5) { - test_rips_persistence_in_dimension(1, 5); +BOOST_AUTO_TEST_CASE(persistent_cohomology_multi_field_coeff_0_6) { + test_persistence_with_coeff_field(0, 6); } -// TODO(VR): not working from 6 -// std::string str_rips_persistence = test_rips_persistence(6, 0); -// TODO(VR): division by zero -// std::string str_rips_persistence = test_rips_persistence(0, 0); -// TODO(VR): is result OK of : -// test_rips_persistence_in_dimension(3, 4); +BOOST_AUTO_TEST_CASE(persistent_cohomology_multi_field_coeff_1_2) { + test_persistence_with_coeff_field(1, 2); +} + +BOOST_AUTO_TEST_CASE(persistent_cohomology_multi_field_coeff_1_3) { + test_persistence_with_coeff_field(1, 3); +} + +BOOST_AUTO_TEST_CASE(persistent_cohomology_multi_field_coeff_1_5) { + test_persistence_with_coeff_field(1, 5); +} + +BOOST_AUTO_TEST_CASE(persistent_cohomology_multi_field_coeff_2_3) { + test_persistence_with_coeff_field(2, 3); +} +BOOST_AUTO_TEST_CASE(persistent_cohomology_multi_field_coeff_3_4) { + test_persistence_with_coeff_field(3, 4); +} diff --git a/src/Rips_complex/doc/Intro_rips_complex.h b/src/Rips_complex/doc/Intro_rips_complex.h index b2840686..cd77b327 100644 --- a/src/Rips_complex/doc/Intro_rips_complex.h +++ b/src/Rips_complex/doc/Intro_rips_complex.h @@ -63,9 +63,8 @@ namespace rips_complex { * value set with \f$max(filtration(4,5), filtration(4,6), filtration(5,6))\f$. * And so on for simplex (0,1,2,3). * - * If the Rips_complex interfaces are not detailed enough for your need, please refer to - * <a href="_persistent_cohomology_2rips_persistence_step_by_step_8cpp-example.html"> - * rips_persistence_step_by_step.cpp</a> example, where the constructions of the graph and + * If the Rips_complex interfaces are not detailed enough for your need, please refer to the example + * \gudhi_example_link{Persistent_cohomology,rips_persistence_step_by_step.cpp} , where the constructions of the graph and * the Simplex_tree are more detailed. * * \section sparserips Sparse Rips complex @@ -111,7 +110,7 @@ namespace rips_complex { * * Then, it is asked to display information about the simplicial complex. * - * \include Rips_complex/example_one_skeleton_rips_from_points.cpp + * \include example_one_skeleton_rips_from_points.cpp * * When launching (Rips maximal distance between 2 points is 12.0, is expanded * until dimension 1 - one skeleton graph in other words): @@ -121,7 +120,7 @@ namespace rips_complex { * * the program output is: * - * \include Rips_complex/one_skeleton_rips_for_doc.txt + * \include one_skeleton_rips_for_doc.txt * * \subsection ripsoffexample Example from OFF file * @@ -132,7 +131,7 @@ namespace rips_complex { * * Then, it is asked to display information about the Rips complex. * - * \include Rips_complex/example_rips_complex_from_off_file.cpp + * \include example_rips_complex_from_off_file.cpp * * When launching: * @@ -141,7 +140,7 @@ namespace rips_complex { * * the program output is: * - * \include Rips_complex/full_skeleton_rips_for_doc.txt + * \include full_skeleton_rips_for_doc.txt * * * \subsection sparseripspointscloudexample Example of a sparse Rips from a point cloud @@ -149,7 +148,7 @@ namespace rips_complex { * This example builds the full sparse Rips of a set of 2D Euclidean points, then prints some minimal * information about the complex. * - * \include Rips_complex/example_sparse_rips.cpp + * \include example_sparse_rips.cpp * * When launching: * @@ -172,7 +171,7 @@ namespace rips_complex { * * Then, it is asked to display information about the simplicial complex. * - * \include Rips_complex/example_one_skeleton_rips_from_distance_matrix.cpp + * \include example_one_skeleton_rips_from_distance_matrix.cpp * * When launching (Rips maximal distance between 2 points is 1.0, is expanded until dimension 1 - one skeleton graph * with other words): @@ -182,7 +181,7 @@ namespace rips_complex { * * the program output is: * - * \include Rips_complex/one_skeleton_rips_for_doc.txt + * \include one_skeleton_rips_for_doc.txt * * \subsection ripscsvdistanceexample Example from a distance matrix read in a csv file * @@ -192,7 +191,7 @@ namespace rips_complex { * * Then, it is asked to display information about the Rips complex. * - * \include Rips_complex/example_rips_complex_from_csv_distance_matrix_file.cpp + * \include example_rips_complex_from_csv_distance_matrix_file.cpp * * When launching: * @@ -201,7 +200,7 @@ namespace rips_complex { * * the program output is: * - * \include Rips_complex/full_skeleton_rips_for_doc.txt + * \include full_skeleton_rips_for_doc.txt * * * \section ripscorrelationematrix Correlation matrix @@ -213,7 +212,7 @@ namespace rips_complex { * * Then, it is asked to display information about the simplicial complex. * - * \include Rips_complex/example_one_skeleton_rips_from_correlation_matrix.cpp + * \include example_one_skeleton_rips_from_correlation_matrix.cpp * * When launching: * @@ -222,7 +221,7 @@ namespace rips_complex { * * the program output is: * - * \include Rips_complex/one_skeleton_rips_from_correlation_matrix_for_doc.txt + * \include one_skeleton_rips_from_correlation_matrix_for_doc.txt * * All the other constructions discussed for Rips complex for distance matrix can be also performed for Rips complexes * construction from correlation matrices. diff --git a/src/Rips_complex/example/example_one_skeleton_rips_from_correlation_matrix.cpp b/src/Rips_complex/example/example_one_skeleton_rips_from_correlation_matrix.cpp index 3d2ba54f..3811d1f1 100644 --- a/src/Rips_complex/example/example_one_skeleton_rips_from_correlation_matrix.cpp +++ b/src/Rips_complex/example/example_one_skeleton_rips_from_correlation_matrix.cpp @@ -40,7 +40,7 @@ int main() { throw "The input matrix is not a correlation matrix. The program will now terminate.\n"; } correlations[i][j] = 1 - correlations[i][j]; - // Here we make sure that we will get the treshold value equal to maximal + // Here we make sure that we will get the threshold value equal to maximal // distance in the matrix. if (correlations[i][j] > threshold) threshold = correlations[i][j]; } diff --git a/src/Rips_complex/include/gudhi/Sparse_rips_complex.h b/src/Rips_complex/include/gudhi/Sparse_rips_complex.h index a5501004..7ae7b317 100644 --- a/src/Rips_complex/include/gudhi/Sparse_rips_complex.h +++ b/src/Rips_complex/include/gudhi/Sparse_rips_complex.h @@ -15,12 +15,71 @@ #include <gudhi/graph_simplicial_complex.h> #include <gudhi/choose_n_farthest_points.h> -#include <boost/graph/adjacency_list.hpp> +#include <boost/graph/graph_traits.hpp> #include <boost/range/metafunctions.hpp> +#include <boost/iterator/counting_iterator.hpp> #include <vector> namespace Gudhi { +namespace rips_complex { +// A custom graph class, because boost::adjacency_list does not conveniently allow to choose vertex descriptors +template <class Vertex_handle, class Filtration_value> +struct Graph { + typedef std::vector<Vertex_handle> VList; + typedef std::vector<std::tuple<Vertex_handle, Vertex_handle, Filtration_value>> EList; + typedef typename VList::const_iterator vertex_iterator; + typedef boost::counting_iterator<std::size_t> edge_iterator; + VList vlist; + EList elist; +}; +template <class Vertex_handle, class Filtration_value> +void add_vertex(Vertex_handle v, Graph<Vertex_handle, Filtration_value>&g) { g.vlist.push_back(v); } +template <class Vertex_handle, class Filtration_value> +void add_edge(Vertex_handle u, Vertex_handle v, Filtration_value f, Graph<Vertex_handle, Filtration_value>&g) { g.elist.emplace_back(u, v, f); } +template <class Vertex_handle, class Filtration_value> +std::size_t num_vertices(Graph<Vertex_handle, Filtration_value> const&g) { return g.vlist.size(); } +template <class Vertex_handle, class Filtration_value> +std::size_t num_edges(Graph<Vertex_handle, Filtration_value> const&g) { return g.elist.size(); } +template <class Vertex_handle, class Filtration_value, class Iter = typename Graph<Vertex_handle, Filtration_value>::vertex_iterator> +std::pair<Iter, Iter> +vertices(Graph<Vertex_handle, Filtration_value> const&g) { + return { g.vlist.begin(), g.vlist.end() }; +} +template <class Vertex_handle, class Filtration_value> +std::pair<boost::counting_iterator<std::size_t>, boost::counting_iterator<std::size_t>> +edges(Graph<Vertex_handle, Filtration_value> const&g) { + typedef boost::counting_iterator<std::size_t> I; + return { I(0), I(g.elist.size()) }; +} +template <class Vertex_handle, class Filtration_value> +Vertex_handle source(std::size_t e, Graph<Vertex_handle, Filtration_value> const&g) { return std::get<0>(g.elist[e]); } +template <class Vertex_handle, class Filtration_value> +Vertex_handle target(std::size_t e, Graph<Vertex_handle, Filtration_value> const&g) { return std::get<1>(g.elist[e]); } +template <class Vertex_handle, class Filtration_value> +Filtration_value get(vertex_filtration_t, Graph<Vertex_handle, Filtration_value> const&, Vertex_handle) { return 0; } +template <class Vertex_handle, class Filtration_value> +Filtration_value get(edge_filtration_t, Graph<Vertex_handle, Filtration_value> const&g, std::size_t e) { return std::get<2>(g.elist[e]); } +} // namespace rips_complex +} // namespace Gudhi +namespace boost { +template <class Vertex_handle, class Filtration_value> +struct graph_traits<Gudhi::rips_complex::Graph<Vertex_handle, Filtration_value>> { + typedef Gudhi::rips_complex::Graph<Vertex_handle, Filtration_value> G; + struct traversal_category : vertex_list_graph_tag, edge_list_graph_tag {}; + typedef Vertex_handle vertex_descriptor; + typedef typename G::vertex_iterator vertex_iterator; + typedef std::size_t vertices_size_type; + typedef std::size_t edge_descriptor; + typedef typename G::edge_iterator edge_iterator; + typedef std::size_t edges_size_type; + typedef directed_tag directed_category; + typedef disallow_parallel_edge_tag edge_parallel_category; +}; +// Etc, since we don't expose this graph to the world, we know we are not going to query property_traits for instance. +} + +namespace Gudhi { namespace rips_complex { @@ -45,12 +104,8 @@ template <typename Filtration_value> class Sparse_rips_complex { private: // TODO(MG): use a different graph where we know we can safely insert in parallel. - typedef typename boost::adjacency_list<boost::vecS, boost::vecS, boost::directedS, - boost::property<vertex_filtration_t, Filtration_value>, - boost::property<edge_filtration_t, Filtration_value>> - Graph; - typedef int Vertex_handle; + typedef rips_complex::Graph<Vertex_handle, Filtration_value> Graph; public: /** \brief Sparse_rips_complex constructor from a list of points. @@ -63,10 +118,11 @@ class Sparse_rips_complex { * */ template <typename RandomAccessPointRange, typename Distance> - Sparse_rips_complex(const RandomAccessPointRange& points, Distance distance, double epsilon, Filtration_value mini=-std::numeric_limits<Filtration_value>::infinity(), Filtration_value maxi=std::numeric_limits<Filtration_value>::infinity()) + Sparse_rips_complex(const RandomAccessPointRange& points, Distance distance, double const epsilon, Filtration_value const mini=-std::numeric_limits<Filtration_value>::infinity(), Filtration_value const maxi=std::numeric_limits<Filtration_value>::infinity()) : epsilon_(epsilon) { GUDHI_CHECK(epsilon > 0, "epsilon must be positive"); auto dist_fun = [&](Vertex_handle i, Vertex_handle j) { return distance(points[i], points[j]); }; + // TODO: stop choose_n_farthest_points once it reaches mini or 0? subsampling::choose_n_farthest_points(dist_fun, boost::irange<Vertex_handle>(0, boost::size(points)), -1, -1, std::back_inserter(sorted_points), std::back_inserter(params)); compute_sparse_graph(dist_fun, epsilon, mini, maxi); @@ -83,7 +139,7 @@ class Sparse_rips_complex { * @param[in] maxi Maximal filtration value. Ignore anything above this scale. */ template <typename DistanceMatrix> - Sparse_rips_complex(const DistanceMatrix& distance_matrix, double epsilon, Filtration_value mini=-std::numeric_limits<Filtration_value>::infinity(), Filtration_value maxi=std::numeric_limits<Filtration_value>::infinity()) + Sparse_rips_complex(const DistanceMatrix& distance_matrix, double const epsilon, Filtration_value const mini=-std::numeric_limits<Filtration_value>::infinity(), Filtration_value const maxi=std::numeric_limits<Filtration_value>::infinity()) : Sparse_rips_complex(boost::irange<Vertex_handle>(0, boost::size(distance_matrix)), [&](Vertex_handle i, Vertex_handle j) { return (i==j) ? 0 : (i<j) ? distance_matrix[j][i] : distance_matrix[i][j]; }, epsilon, mini, maxi) {} @@ -99,7 +155,7 @@ class Sparse_rips_complex { * */ template <typename SimplicialComplexForRips> - void create_complex(SimplicialComplexForRips& complex, int dim_max) { + void create_complex(SimplicialComplexForRips& complex, int const dim_max) { GUDHI_CHECK(complex.num_vertices() == 0, std::invalid_argument("Sparse_rips_complex::create_complex - simplicial complex is not empty")); @@ -108,17 +164,17 @@ class Sparse_rips_complex { complex.expansion(dim_max); return; } - const int n = boost::size(params); - std::vector<Filtration_value> lambda(n); + const std::size_t n = num_vertices(graph_); + std::vector<Filtration_value> lambda(max_v + 1); // lambda[original_order]=params[sorted_order] - for(int i=0;i<n;++i) + for(std::size_t i=0;i<n;++i) lambda[sorted_points[i]] = params[i]; double cst = epsilon_ * (1 - epsilon_) / 2; auto block = [cst,&complex,&lambda](typename SimplicialComplexForRips::Simplex_handle sh){ auto filt = complex.filtration(sh); - auto mini = filt * cst; + auto min_f = filt * cst; for(auto v : complex.simplex_vertex_range(sh)){ - if(lambda[v] < mini) + if(lambda[v] < min_f) return true; // v died before this simplex could be born } return false; @@ -129,32 +185,34 @@ class Sparse_rips_complex { private: // PointRange must be random access. template <typename Distance> - void compute_sparse_graph(Distance& dist, double epsilon, Filtration_value mini, Filtration_value maxi) { + void compute_sparse_graph(Distance& dist, double const epsilon, Filtration_value const mini, Filtration_value const maxi) { const auto& points = sorted_points; // convenience alias - const int n = boost::size(points); + std::size_t n = boost::size(points); double cst = epsilon * (1 - epsilon) / 2; - graph_.~Graph(); - new (&graph_) Graph(n); - // for(auto v : vertices(g)) // doesn't work :-( - typename boost::graph_traits<Graph>::vertex_iterator v_i, v_e; - for (std::tie(v_i, v_e) = vertices(graph_); v_i != v_e; ++v_i) { - auto v = *v_i; - // This whole loop might not be necessary, leave it until someone investigates if it is safe to remove. - put(vertex_filtration_t(), graph_, v, 0); + max_v = -1; // Useful for the size of the map lambda. + for (std::size_t i = 0; i < n; ++i) { + if ((params[i] < mini || params[i] <= 0) && i != 0) break; + // The parameter of the first point is not very meaningful, it is supposed to be infinite, + // but if the type does not support it... + // It would be better to do this reduction of the number of points earlier, around choose_n_farthest_points. + add_vertex(points[i], graph_); + max_v = std::max(max_v, points[i]); } + n = num_vertices(graph_); // TODO(MG): // - make it parallel // - only test near-enough neighbors - for (int i = 0; i < n; ++i) { + for (std::size_t i = 0; i < n; ++i) { auto&& pi = points[i]; auto li = params[i]; - if (li < mini) break; - for (int j = i + 1; j < n; ++j) { + // If we inserted all the points, points with multiplicity would get connected to their first representative, + // no need to handle the redundant ones in the outer loop. + // if (li <= 0 && i != 0) break; + for (std::size_t j = i + 1; j < n; ++j) { auto&& pj = points[j]; auto d = dist(pi, pj); auto lj = params[j]; - if (lj < mini) break; GUDHI_CHECK(lj <= li, "Bad furthest point sorting"); Filtration_value alpha; @@ -178,6 +236,7 @@ class Sparse_rips_complex { Graph graph_; double epsilon_; + Vertex_handle max_v; // Because of the arbitrary split between constructor and create_complex // sorted_points[sorted_order]=original_order std::vector<Vertex_handle> sorted_points; diff --git a/src/Rips_complex/utilities/rips_correlation_matrix_persistence.cpp b/src/Rips_complex/utilities/rips_correlation_matrix_persistence.cpp index b473738e..72ddc797 100644 --- a/src/Rips_complex/utilities/rips_correlation_matrix_persistence.cpp +++ b/src/Rips_complex/utilities/rips_correlation_matrix_persistence.cpp @@ -118,7 +118,7 @@ void program_options(int argc, char* argv[], std::string& csv_matrix_file, std:: po::options_description visible("Allowed options", 100); visible.add_options()("help,h", "produce help message")( "output-file,o", po::value<std::string>(&filediag)->default_value(std::string()), - "Name of file in which the persistence diagram is written. Default print in std::clog")( + "Name of file in which the persistence diagram is written. Default print in standard output")( "min-edge-corelation,c", po::value<Filtration_value>(&correlation_min)->default_value(0), "Minimal corelation of an edge for the Rips complex construction.")( "cpx-dimension,d", po::value<int>(&dim_max)->default_value(1), diff --git a/src/Rips_complex/utilities/rips_distance_matrix_persistence.cpp b/src/Rips_complex/utilities/rips_distance_matrix_persistence.cpp index 6306755d..77ad841a 100644 --- a/src/Rips_complex/utilities/rips_distance_matrix_persistence.cpp +++ b/src/Rips_complex/utilities/rips_distance_matrix_persistence.cpp @@ -79,7 +79,7 @@ void program_options(int argc, char* argv[], std::string& csv_matrix_file, std:: po::options_description visible("Allowed options", 100); visible.add_options()("help,h", "produce help message")( "output-file,o", po::value<std::string>(&filediag)->default_value(std::string()), - "Name of file in which the persistence diagram is written. Default print in std::clog")( + "Name of file in which the persistence diagram is written. Default print in standard output")( "max-edge-length,r", po::value<Filtration_value>(&threshold)->default_value(std::numeric_limits<Filtration_value>::infinity()), "Maximal length of an edge for the Rips complex construction.")( diff --git a/src/Rips_complex/utilities/rips_persistence.cpp b/src/Rips_complex/utilities/rips_persistence.cpp index 9d7490b3..43194821 100644 --- a/src/Rips_complex/utilities/rips_persistence.cpp +++ b/src/Rips_complex/utilities/rips_persistence.cpp @@ -81,7 +81,7 @@ void program_options(int argc, char* argv[], std::string& off_file_points, std:: po::options_description visible("Allowed options", 100); visible.add_options()("help,h", "produce help message")( "output-file,o", po::value<std::string>(&filediag)->default_value(std::string()), - "Name of file in which the persistence diagram is written. Default print in std::clog")( + "Name of file in which the persistence diagram is written. Default print in standard output")( "max-edge-length,r", po::value<Filtration_value>(&threshold)->default_value(std::numeric_limits<Filtration_value>::infinity()), "Maximal length of an edge for the Rips complex construction.")( diff --git a/src/Rips_complex/utilities/sparse_rips_persistence.cpp b/src/Rips_complex/utilities/sparse_rips_persistence.cpp index ac935b41..829c85e6 100644 --- a/src/Rips_complex/utilities/sparse_rips_persistence.cpp +++ b/src/Rips_complex/utilities/sparse_rips_persistence.cpp @@ -84,7 +84,7 @@ void program_options(int argc, char* argv[], std::string& off_file_points, std:: po::options_description visible("Allowed options", 100); visible.add_options()("help,h", "produce help message")( "output-file,o", po::value<std::string>(&filediag)->default_value(std::string()), - "Name of file in which the persistence diagram is written. Default print in std::clog")( + "Name of file in which the persistence diagram is written. Default print in standard output")( "max-edge-length,r", po::value<Filtration_value>(&threshold)->default_value(std::numeric_limits<Filtration_value>::infinity()), "Maximal length of an edge for the Rips complex construction.")( diff --git a/src/Simplex_tree/doc/Intro_simplex_tree.h b/src/Simplex_tree/doc/Intro_simplex_tree.h index 800879fe..2d3ecdec 100644 --- a/src/Simplex_tree/doc/Intro_simplex_tree.h +++ b/src/Simplex_tree/doc/Intro_simplex_tree.h @@ -39,11 +39,9 @@ namespace Gudhi { * \subsubsection filteredcomplexessimplextreeexamples Examples * * Here is a list of simplex tree examples : - * \li <a href="_simplex_tree_2simple_simplex_tree_8cpp-example.html"> - * Simplex_tree/simple_simplex_tree.cpp</a> - Simple simplex tree construction and basic function use. + * \li \gudhi_example_link{Simplex_tree,simple_simplex_tree.cpp} - Simple simplex tree construction and basic function use. * - * \li <a href="_simplex_tree_2simplex_tree_from_cliques_of_graph_8cpp-example.html"> - * Simplex_tree/simplex_tree_from_cliques_of_graph.cpp</a> - Simplex tree construction from cliques of graph read in + * \li \gudhi_example_link{Simplex_tree,simplex_tree_from_cliques_of_graph.cpp} - Simplex tree construction from cliques of graph read in * a file. * * Simplex tree construction with \f$\mathbb{Z}/3\mathbb{Z}\f$ coefficients on weighted graph Klein bottle file: @@ -54,12 +52,10 @@ Expand the simplex tree in 3.8e-05 s. Information of the Simplex Tree: Number of vertices = 10 Number of simplices = 98 \endcode * - * \li <a href="_simplex_tree_2example_alpha_shapes_3_simplex_tree_from_off_file_8cpp-example.html"> - * Simplex_tree/example_alpha_shapes_3_simplex_tree_from_off_file.cpp</a> - Simplex tree is computed and displayed + * \li \gudhi_example_link{Simplex_tree,example_alpha_shapes_3_simplex_tree_from_off_file.cpp} - Simplex tree is computed and displayed * from a 3D alpha complex (Requires CGAL, GMP and GMPXX to be installed). * - * \li <a href="_simplex_tree_2graph_expansion_with_blocker_8cpp-example.html"> - * Simplex_tree/graph_expansion_with_blocker.cpp</a> - Simple simplex tree construction from a one-skeleton graph with + * \li \gudhi_example_link{Simplex_tree,graph_expansion_with_blocker.cpp} - Simple simplex tree construction from a one-skeleton graph with * a simple blocker expansion method. * * \subsection filteredcomplexeshassecomplex Hasse complex diff --git a/src/Simplex_tree/example/CMakeLists.txt b/src/Simplex_tree/example/CMakeLists.txt index 73b2c6f9..81d352fc 100644 --- a/src/Simplex_tree/example/CMakeLists.txt +++ b/src/Simplex_tree/example/CMakeLists.txt @@ -29,7 +29,7 @@ if(GMP_FOUND AND NOT CGAL_VERSION VERSION_LESS 4.11.0) target_link_libraries(Simplex_tree_example_alpha_shapes_3_from_off ${TBB_LIBRARIES}) endif() add_test(NAME Simplex_tree_example_alpha_shapes_3_from_off COMMAND $<TARGET_FILE:Simplex_tree_example_alpha_shapes_3_from_off> - "${CMAKE_SOURCE_DIR}/data/points/bunny_5000.off") + "${CMAKE_SOURCE_DIR}/data/points/tore3D_1307.off") endif() diff --git a/src/Simplex_tree/example/README b/src/Simplex_tree/example/README deleted file mode 100644 index a9498173..00000000 --- a/src/Simplex_tree/example/README +++ /dev/null @@ -1,73 +0,0 @@ -To build the example, run in a Terminal: - -cd /path-to-gudhi/ -cmake . -cd /path-to-example/ -make - - -Example of use : - -*** Simple simplex tree construction - -./Simplex_tree_example_simple_simplex_tree - -******************************************************************** -EXAMPLE OF SIMPLE INSERTION - * INSERT 0 - + 0 INSERTED - * INSERT 1 - + 1 INSERTED - * INSERT (0,1) - + (0,1) INSERTED - * INSERT 2 - + 2 INSERTED - * INSERT (2,0) - + (2,0) INSERTED - * INSERT (2,1) - + (2,1) INSERTED - * INSERT (2,1,0) - + (2,1,0) INSERTED - * INSERT 3 - + 3 INSERTED - * INSERT (3,0) - + (3,0) INSERTED - * INSERT 0 (already inserted) - - 0 NOT INSERTED - * INSERT (2,1,0) (already inserted) - - (2,1,0) NOT INSERTED -******************************************************************** -* The complex contains 9 simplices - - dimension 2 - filtration 0.4 -* Iterator on Simplices in the filtration, with [filtration value]: - [0.1] 0 - [0.1] 1 - [0.1] 2 - [0.1] 3 - [0.2] 1 0 - [0.2] 2 0 - [0.2] 2 1 - [0.2] 3 0 - [0.3] 2 1 0 - -*** Simplex tree construction with Z/2Z coefficients on weighted graph Klein bottle file: - -./Simplex_tree_example_from_cliques_of_graph ../../../data/points/Klein_bottle_complex.txt 2 -Insert the 1-skeleton in the simplex tree in 0 s. -Expand the simplex tree in 0 s. -Information of the Simplex Tree: - Number of vertices = 10 Number of simplices = 82 - -with Z/3Z coefficients: - -./Simplex_tree_example_from_cliques_of_graph ../../../data/points/Klein_bottle_complex.txt 3 - -Insert the 1-skeleton in the simplex tree in 0 s. -Expand the simplex tree in 0 s. -Information of the Simplex Tree: - Number of vertices = 10 Number of simplices = 106 - -*** Simplex_tree computed and displayed from a 3D alpha complex: - [ Requires CGAL, GMP and GMPXX to be installed] - -./Simplex_tree_example_alpha_shapes_3_from_off ../../../data/points/bunny_5000 diff --git a/src/Simplex_tree/example/graph_expansion_with_blocker.cpp b/src/Simplex_tree/example/graph_expansion_with_blocker.cpp index df52bf43..eef8b665 100644 --- a/src/Simplex_tree/example/graph_expansion_with_blocker.cpp +++ b/src/Simplex_tree/example/graph_expansion_with_blocker.cpp @@ -42,7 +42,7 @@ int main(int argc, char* const argv[]) { std::clog << vertex << ", "; } std::clog << "] ( " << stree.filtration(sh); - // User can re-assign a new filtration value directly in the blocker (default is the maximal value of boudaries) + // User can re-assign a new filtration value directly in the blocker (default is the maximal value of boundaries) stree.assign_filtration(sh, stree.filtration(sh) + 1.); std::clog << " + 1. ) = " << result << std::endl; diff --git a/src/Simplex_tree/example/simple_simplex_tree.cpp b/src/Simplex_tree/example/simple_simplex_tree.cpp index e8bec596..965711da 100644 --- a/src/Simplex_tree/example/simple_simplex_tree.cpp +++ b/src/Simplex_tree/example/simple_simplex_tree.cpp @@ -129,7 +129,7 @@ int main(int argc, char* const argv[]) { std::clog << " - 3 NOT INSERTED" << std::endl; } - // ++ NINETH + // ++ NINTH std::clog << " * INSERT (3,0)" << std::endl; typeVectorVertex ninethSimplexVector = {3, 0}; returnValue = simplexTree.insert_simplex(ninethSimplexVector, Filtration_value(SECOND_FILTRATION_VALUE)); diff --git a/src/Simplex_tree/include/gudhi/Simplex_tree.h b/src/Simplex_tree/include/gudhi/Simplex_tree.h index 85d6c3b0..4177a0b8 100644 --- a/src/Simplex_tree/include/gudhi/Simplex_tree.h +++ b/src/Simplex_tree/include/gudhi/Simplex_tree.h @@ -24,6 +24,8 @@ #include <boost/iterator/transform_iterator.hpp> #include <boost/graph/adjacency_list.hpp> #include <boost/range/adaptor/reversed.hpp> +#include <boost/range/adaptor/transformed.hpp> +#include <boost/range/size.hpp> #include <boost/container/static_vector.hpp> #ifdef GUDHI_USE_TBB @@ -42,6 +44,10 @@ namespace Gudhi { +/** \addtogroup simplex_tree + * @{ + */ + /** * \class Extended_simplex_type Simplex_tree.h gudhi/Simplex_tree.h * \brief Extended simplex type data structure for representing the type of simplices in an extended filtration. @@ -97,8 +103,7 @@ class Simplex_tree { // Simplex_key next to each other). typedef typename boost::container::flat_map<Vertex_handle, Node> Dictionary; - /* \brief Set of nodes sharing a same parent in the simplex tree. */ - /* \brief Set of nodes sharing a same parent in the simplex tree. */ + /** \brief Set of nodes sharing a same parent in the simplex tree. */ typedef Simplex_tree_siblings<Simplex_tree, Dictionary> Siblings; @@ -187,6 +192,12 @@ class Simplex_tree { typedef Simplex_tree_boundary_simplex_iterator<Simplex_tree> Boundary_simplex_iterator; /** \brief Range over the simplices of the boundary of a simplex. */ typedef boost::iterator_range<Boundary_simplex_iterator> Boundary_simplex_range; + /** \brief Iterator over the simplices of the boundary of a simplex and their opposite vertices. + * + * 'value_type' is std::pair<Simplex_handle, Vertex_handle>. */ + typedef Simplex_tree_boundary_opposite_vertex_simplex_iterator<Simplex_tree> Boundary_opposite_vertex_simplex_iterator; + /** \brief Range over the simplices of the boundary of a simplex and their opposite vertices. */ + typedef boost::iterator_range<Boundary_opposite_vertex_simplex_iterator> Boundary_opposite_vertex_simplex_range; /** \brief Iterator over the simplices of the simplicial complex. * * 'value_type' is Simplex_handle. */ @@ -296,6 +307,23 @@ class Simplex_tree { Boundary_simplex_iterator(this)); } + /** \brief Given a simplex, returns a range over the simplices of its boundary and their opposite vertices. + * + * The boundary of a simplex is the set of codimension \f$1\f$ subsimplices of the simplex. + * If the simplex is \f$[v_0, \cdots ,v_d]\f$, with canonical orientation induced by \f$ v_0 < \cdots < v_d \f$, the + * iterator enumerates the simplices of the boundary in the order: + * \f$[v_0,\cdots,\widehat{v_i},\cdots,v_d]\f$ for \f$i\f$ from \f$d\f$ to \f$0\f$, where \f$\widehat{v_i}\f$ means + * that the vertex \f$v_i\f$, known as the opposite vertex, is omitted from boundary, but returned as the second + * element of a pair. + * + * @param[in] sh Simplex for which the boundary is computed. + */ + template<class SimplexHandle> + Boundary_opposite_vertex_simplex_range boundary_opposite_vertex_simplex_range(SimplexHandle sh) { + return Boundary_opposite_vertex_simplex_range(Boundary_opposite_vertex_simplex_iterator(this, sh), + Boundary_opposite_vertex_simplex_iterator(this)); + } + /** @} */ // end range and iterator methods /** \name Constructor/Destructor * @{ */ @@ -676,10 +704,10 @@ class Simplex_tree { return true; } - private: - /** \brief Inserts a simplex represented by a vector of vertex. - * @param[in] simplex vector of Vertex_handles, representing the vertices of the new simplex. The vector must be - * sorted by increasing vertex handle order. + protected: + /** \brief Inserts a simplex represented by a range of vertex. + * @param[in] simplex range of Vertex_handles, representing the vertices of the new simplex. The range must be + * sorted by increasing vertex handle order, and not empty. * @param[in] filtration the filtration value assigned to the new simplex. * @return If the new simplex is inserted successfully (i.e. it was not in the * simplicial complex yet) the bool is set to true and the Simplex_handle is the handle assigned @@ -691,12 +719,13 @@ class Simplex_tree { * null_simplex. * */ - std::pair<Simplex_handle, bool> insert_vertex_vector(const std::vector<Vertex_handle>& simplex, + template <class RandomVertexHandleRange = std::initializer_list<Vertex_handle>> + std::pair<Simplex_handle, bool> insert_simplex_raw(const RandomVertexHandleRange& simplex, Filtration_value filtration) { Siblings * curr_sib = &root_; std::pair<Simplex_handle, bool> res_insert; auto vi = simplex.begin(); - for (; vi != simplex.end() - 1; ++vi) { + for (; vi != std::prev(simplex.end()); ++vi) { GUDHI_CHECK(*vi != null_vertex(), "cannot use the dummy null_vertex() as a real vertex"); res_insert = curr_sib->members_.emplace(*vi, Node(curr_sib, filtration)); if (!(has_children(res_insert.first))) { @@ -717,9 +746,10 @@ class Simplex_tree { return std::pair<Simplex_handle, bool>(null_simplex(), false); } // otherwise the insertion has succeeded - size is a size_type - if (static_cast<int>(simplex.size()) - 1 > dimension_) { + int dim = static_cast<int>(boost::size(simplex)) - 1; + if (dim > dimension_) { // Update dimension if needed - dimension_ = static_cast<int>(simplex.size()) - 1; + dimension_ = dim; } return res_insert; } @@ -760,7 +790,7 @@ class Simplex_tree { // Copy before sorting std::vector<Vertex_handle> copy(first, last); std::sort(std::begin(copy), std::end(copy)); - return insert_vertex_vector(copy, filtration); + return insert_simplex_raw(copy, filtration); } /** \brief Insert a N-simplex and all his subfaces, from a N-simplex represented by a range of @@ -942,7 +972,7 @@ class Simplex_tree { // If we reached the end of the vertices, and the simplex has more vertices than the given simplex // => we found a coface - // Add a coface if we wan't the star or if the number of vertices of the current simplex matches with nbVertices + // Add a coface if we want the star or if the number of vertices of the current simplex matches with nbVertices bool addCoface = (star || curr_nbVertices == nbVertices); if (addCoface) cofaces.push_back(simplex); @@ -1060,8 +1090,8 @@ class Simplex_tree { * * Inserts all vertices and edges given by a OneSkeletonGraph. * OneSkeletonGraph must be a model of - * <a href="http://www.boost.org/doc/libs/1_65_1/libs/graph/doc/EdgeListGraph.html">boost::EdgeListGraph</a> - * and <a href="http://www.boost.org/doc/libs/1_65_1/libs/graph/doc/PropertyGraph.html">boost::PropertyGraph</a>. + * <a href="https://www.boost.org/doc/libs/release/libs/graph/doc/VertexAndEdgeListGraph.html">boost::VertexAndEdgeListGraph</a> + * and <a href="https://www.boost.org/doc/libs/release/libs/graph/doc/PropertyGraph.html">boost::PropertyGraph</a>. * * The vertex filtration value is accessible through the property tag * vertex_filtration_t. @@ -1081,7 +1111,10 @@ class Simplex_tree { // the simplex tree must be empty assert(num_simplices() == 0); - if (boost::num_vertices(skel_graph) == 0) { + // is there a better way to let the compiler know that we don't mean Simplex_tree::num_vertices? + using boost::num_vertices; + + if (num_vertices(skel_graph) == 0) { return; } if (num_edges(skel_graph) == 0) { @@ -1090,25 +1123,21 @@ class Simplex_tree { dimension_ = 1; } - root_.members_.reserve(boost::num_vertices(skel_graph)); + root_.members_.reserve(num_vertices(skel_graph)); // probably useless in most cases + auto verts = vertices(skel_graph) | boost::adaptors::transformed([&](auto v){ + return Dit_value_t(v, Node(&root_, get(vertex_filtration_t(), skel_graph, v))); }); + root_.members_.insert(boost::begin(verts), boost::end(verts)); + // This automatically sorts the vertices, the graph concept doesn't guarantee the order in which we iterate. - typename boost::graph_traits<OneSkeletonGraph>::vertex_iterator v_it, - v_it_end; - for (std::tie(v_it, v_it_end) = boost::vertices(skel_graph); v_it != v_it_end; - ++v_it) { - root_.members_.emplace_hint( - root_.members_.end(), *v_it, - Node(&root_, boost::get(vertex_filtration_t(), skel_graph, *v_it))); - } std::pair<typename boost::graph_traits<OneSkeletonGraph>::edge_iterator, - typename boost::graph_traits<OneSkeletonGraph>::edge_iterator> boost_edges = boost::edges(skel_graph); + typename boost::graph_traits<OneSkeletonGraph>::edge_iterator> boost_edges = edges(skel_graph); // boost_edges.first is the equivalent to boost_edges.begin() // boost_edges.second is the equivalent to boost_edges.end() for (; boost_edges.first != boost_edges.second; boost_edges.first++) { auto edge = *(boost_edges.first); auto u = source(edge, skel_graph); auto v = target(edge, skel_graph); - if (u == v) throw "Self-loops are not simplicial"; + if (u == v) throw std::invalid_argument("Self-loops are not simplicial"); // We cannot skip edges with the wrong orientation and expect them to // come a second time with the right orientation, that does not always // happen in practice. emplace() should be a NOP when an element with the @@ -1123,10 +1152,25 @@ class Simplex_tree { } sh->second.children()->members().emplace(v, - Node(sh->second.children(), boost::get(edge_filtration_t(), skel_graph, edge))); + Node(sh->second.children(), get(edge_filtration_t(), skel_graph, edge))); } } + /** \brief Inserts several vertices. + * @param[in] vertices A range of Vertex_handle + * @param[in] filt filtration value of the new vertices (the same for all) + * + * This may be faster than inserting the vertices one by one, especially in a random order. + * The complex does not need to be empty before calling this function. However, if a vertex is + * already present, its filtration value is not modified, unlike with other insertion functions. */ + template <class VertexRange> + void insert_batch_vertices(VertexRange const& vertices, Filtration_value filt = 0) { + auto verts = vertices | boost::adaptors::transformed([&](auto v){ + return Dit_value_t(v, Node(&root_, filt)); }); + root_.members_.insert(boost::begin(verts), boost::end(verts)); + if (dimension_ < 0 && !root_.members_.empty()) dimension_ = 0; + } + /** \brief Expands the Simplex_tree containing only its one skeleton * until dimension max_dim. * @@ -1280,6 +1324,7 @@ class Simplex_tree { Siblings * new_sib = new Siblings(siblings, // oncles simplex->first, // parent boost::adaptors::reverse(intersection)); // boost::container::ordered_unique_range_t + simplex->second.assign_children(new_sib); std::vector<Vertex_handle> blocked_new_sib_vertex_list; // As all intersections are inserted, we can call the blocker function on all new_sib members for (auto new_sib_member = new_sib->members().begin(); @@ -1302,7 +1347,6 @@ class Simplex_tree { new_sib->members().erase(blocked_new_sib_member); } // ensure recursive call - simplex->second.assign_children(new_sib); siblings_expansion_with_blockers(new_sib, max_dim, k - 1, block_simplex); } } else { @@ -1312,7 +1356,7 @@ class Simplex_tree { } } - /* \private Returns the Simplex_handle composed of the vertex list (from the Simplex_handle), plus the given + /** \private Returns the Simplex_handle composed of the vertex list (from the Simplex_handle), plus the given * Vertex_handle if the Vertex_handle is found in the Simplex_handle children list. * Returns null_simplex() if it does not exist */ @@ -1465,7 +1509,7 @@ class Simplex_tree { int sh_dimension = dimension(sh); if (sh_dimension >= dimension_) - // Stop browsing as soon as the dimension is reached, no need to go furter + // Stop browsing as soon as the dimension is reached, no need to go further return false; new_dimension = (std::max)(new_dimension, sh_dimension); } @@ -1569,7 +1613,7 @@ class Simplex_tree { Simplex_tree st_copy = *this; // Add point for coning the simplicial complex - this->insert_simplex({maxvert}, -3); + this->insert_simplex_raw({maxvert}, -3); // For each simplex std::vector<Vertex_handle> vr; @@ -1775,7 +1819,7 @@ struct Simplex_tree_options_fast_persistence { static const bool contiguous_vertices = true; }; -/** @} */ // end defgroup simplex_tree +/** @}*/ // end addtogroup simplex_tree } // namespace Gudhi diff --git a/src/Simplex_tree/include/gudhi/Simplex_tree/Simplex_tree_iterators.h b/src/Simplex_tree/include/gudhi/Simplex_tree/Simplex_tree_iterators.h index ee64a277..b63a5595 100644 --- a/src/Simplex_tree/include/gudhi/Simplex_tree/Simplex_tree_iterators.h +++ b/src/Simplex_tree/include/gudhi/Simplex_tree/Simplex_tree_iterators.h @@ -5,6 +5,7 @@ * Copyright (C) 2014 Inria * * Modification(s): + * - 2022/04 Vincent Rouvreau: Add Simplex_tree_boundary_opposite_vertex_simplex_iterator for alpha and cech purpose * - YYYY/MM Author: Description of the modification */ @@ -14,19 +15,19 @@ #include <gudhi/Debug_utils.h> #include <boost/iterator/iterator_facade.hpp> -#include <boost/version.hpp> #include <boost/container/static_vector.hpp> #include <vector> +#include <utility> // for std::pair namespace Gudhi { -/* \addtogroup simplex_tree +/** \addtogroup simplex_tree * Iterators and range types for the Simplex_tree. - * @{ + * @{ */ -/* \brief Iterator over the vertices of a simplex +/** \brief Iterator over the vertices of a simplex * in a SimplexTree. * * Forward iterator, 'value_type' is SimplexTree::Vertex_handle.*/ @@ -72,7 +73,7 @@ class Simplex_tree_simplex_vertex_iterator : public boost::iterator_facade< }; /*---------------------------------------------------------------------------*/ -/* \brief Iterator over the simplices of the boundary of a +/** \brief Iterator over the simplices of the boundary of a * simplex. * * Forward iterator, value_type is SimplexTree::Simplex_handle.*/ @@ -124,7 +125,7 @@ class Simplex_tree_boundary_simplex_iterator : public boost::iterator_facade< private: friend class boost::iterator_core_access; -// valid when iterating along the SAME boundary. + // valid when iterating along the SAME boundary. bool equal(Simplex_tree_boundary_simplex_iterator const& other) const { return sh_ == other.sh_; } @@ -179,8 +180,118 @@ class Simplex_tree_boundary_simplex_iterator : public boost::iterator_facade< Simplex_handle sh_; // current Simplex_handle in the boundary SimplexTree * st_; // simplex containing the simplicial complex }; + +/** \brief Iterator over the simplices of the boundary of a simplex and their opposite vertices. + * + * Forward iterator, value_type is std::pair<SimplexTree::Simplex_handle, SimplexTree::Vertex_handle>.*/ +template<class SimplexTree> +class Simplex_tree_boundary_opposite_vertex_simplex_iterator : public boost::iterator_facade< + Simplex_tree_boundary_opposite_vertex_simplex_iterator<SimplexTree>, + std::pair<typename SimplexTree::Simplex_handle, typename SimplexTree::Vertex_handle> const, boost::forward_traversal_tag> { + public: + using Simplex_handle = typename SimplexTree::Simplex_handle; + using Vertex_handle = typename SimplexTree::Vertex_handle; + using Siblings = typename SimplexTree::Siblings; + + // For cython purpose only. The object it initializes should be overwritten ASAP and never used before it is + // overwritten. + Simplex_tree_boundary_opposite_vertex_simplex_iterator() + : sib_(nullptr), + st_(nullptr) { + } + + // any end() iterator + explicit Simplex_tree_boundary_opposite_vertex_simplex_iterator(SimplexTree * st) + : last_(st->null_vertex()), + next_(st->null_vertex()), + sib_(nullptr), + baov_(st->null_simplex(), st->null_vertex()), + st_(st) { + } + + template<class SimplexHandle> + Simplex_tree_boundary_opposite_vertex_simplex_iterator(SimplexTree * st, SimplexHandle sh) + : last_(sh->first), + next_(st->null_vertex()), + sib_(nullptr), + baov_(st->null_simplex(), sh->first), + st_(st) { + // Only check once at the beginning instead of for every increment, as this is expensive. + if (SimplexTree::Options::contiguous_vertices) + GUDHI_CHECK(st_->contiguous_vertices(), "The set of vertices is not { 0, ..., n } without holes"); + Siblings * sib = st->self_siblings(sh); + next_ = sib->parent(); + sib_ = sib->oncles(); + if (sib_ != nullptr) { + if (SimplexTree::Options::contiguous_vertices && sib_->oncles() == nullptr) + // Only relevant for edges + baov_.first = sib_->members_.begin()+next_; + else + baov_.first = sib_->find(next_); + } + } + + private: + friend class boost::iterator_core_access; + + // valid when iterating along the SAME boundary. + bool equal(Simplex_tree_boundary_opposite_vertex_simplex_iterator const& other) const { + return (baov_.first == other.baov_.first); + } + + std::pair<Simplex_handle, Vertex_handle> const& dereference() const { + return baov_; + } + + void increment() { + if (sib_ == nullptr) { + baov_.first = st_->null_simplex(); + return; // ------>> + } + Siblings * for_sib = sib_; + Siblings * new_sib = sib_->oncles(); + auto rit = suffix_.rbegin(); + if (SimplexTree::Options::contiguous_vertices && new_sib == nullptr) { + // We reached the root, use a short-cut to find a vertex. + if (rit == suffix_.rend()) { + baov_.second = baov_.first->first; + // Segment, this vertex is the last boundary simplex + baov_.first = for_sib->members_.begin()+last_; + sib_ = nullptr; + return; + } else { + // Dim >= 2, initial step of the descent + baov_.first = for_sib->members_.begin()+*rit; + for_sib = baov_.first->second.children(); + ++rit; + } + } + for (; rit != suffix_.rend(); ++rit) { + baov_.first = for_sib->find(*rit); + for_sib = baov_.first->second.children(); + } + baov_.first = for_sib->find(last_); // baov_.first points to the right simplex now + suffix_.push_back(next_); + next_ = sib_->parent(); + sib_ = new_sib; + baov_.second = suffix_.back(); + } + + // Most of the storage should be moved to the range, iterators should be light. + Vertex_handle last_; // last vertex of the simplex + Vertex_handle next_; // next vertex to push in suffix_ + // 40 seems a conservative bound on the dimension of a Simplex_tree for now, + // as it would not fit on the biggest hard-drive. + boost::container::static_vector<Vertex_handle, 40> suffix_; + // static_vector still has some overhead compared to a trivial hand-made + // version using std::aligned_storage, or compared to making suffix_ static. + Siblings * sib_; // where the next search will start from + std::pair<Simplex_handle, Vertex_handle> baov_; // a pair containing the current Simplex_handle in the boundary and its opposite vertex + SimplexTree * st_; // simplex containing the simplicial complex +}; + /*---------------------------------------------------------------------------*/ -/* \brief Iterator over the simplices of a simplicial complex. +/** \brief Iterator over the simplices of a simplicial complex. * * Forward iterator, value_type is SimplexTree::Simplex_handle.*/ template<class SimplexTree> @@ -253,7 +364,7 @@ class Simplex_tree_complex_simplex_iterator : public boost::iterator_facade< SimplexTree * st_; }; -/* \brief Iterator over the simplices of the skeleton of a given +/** \brief Iterator over the simplices of the skeleton of a given * dimension of the simplicial complex. * * Forward iterator, value_type is SimplexTree::Simplex_handle.*/ @@ -336,7 +447,8 @@ class Simplex_tree_skeleton_simplex_iterator : public boost::iterator_facade< int curr_dim_; }; -/* @} */ // end addtogroup simplex_tree +/** @}*/ // end addtogroup simplex_tree + } // namespace Gudhi #endif // SIMPLEX_TREE_SIMPLEX_TREE_ITERATORS_H_ diff --git a/src/Simplex_tree/include/gudhi/Simplex_tree/Simplex_tree_node_explicit_storage.h b/src/Simplex_tree/include/gudhi/Simplex_tree/Simplex_tree_node_explicit_storage.h index ae140859..63023daa 100644 --- a/src/Simplex_tree/include/gudhi/Simplex_tree/Simplex_tree_node_explicit_storage.h +++ b/src/Simplex_tree/include/gudhi/Simplex_tree/Simplex_tree_node_explicit_storage.h @@ -15,16 +15,15 @@ namespace Gudhi { -/* \addtogroup simplex_tree +/** \addtogroup simplex_tree * Represents a node of a Simplex_tree. * @{ */ -/* - * \brief Node of a simplex tree with filtration value +/** \brief Node of a simplex tree with filtration value * and simplex key. * - * It stores explicitely its own filtration value and its own Simplex_key. + * It stores explicitly its own filtration value and its own Simplex_key. */ template<class SimplexTree> struct Simplex_tree_node_explicit_storage : SimplexTree::Filtration_simplex_base, SimplexTree::Key_simplex_base { @@ -54,7 +53,8 @@ struct Simplex_tree_node_explicit_storage : SimplexTree::Filtration_simplex_base Siblings * children_; }; -/* @} */ // end addtogroup simplex_tree +/** @}*/ // end addtogroup simplex_tree + } // namespace Gudhi #endif // SIMPLEX_TREE_SIMPLEX_TREE_NODE_EXPLICIT_STORAGE_H_ diff --git a/src/Simplex_tree/include/gudhi/Simplex_tree/Simplex_tree_siblings.h b/src/Simplex_tree/include/gudhi/Simplex_tree/Simplex_tree_siblings.h index b53bad29..d849eeba 100644 --- a/src/Simplex_tree/include/gudhi/Simplex_tree/Simplex_tree_siblings.h +++ b/src/Simplex_tree/include/gudhi/Simplex_tree/Simplex_tree_siblings.h @@ -20,12 +20,12 @@ namespace Gudhi { -/* \addtogroup simplex_tree +/** \addtogroup simplex_tree * Represents a set of node of a Simplex_tree that share the same parent. * @{ */ -/* \brief Data structure to store a set of nodes in a SimplexTree sharing +/** \brief Data structure to store a set of nodes in a SimplexTree sharing * the same parent node.*/ template<class SimplexTree, class MapContainer> class Simplex_tree_siblings { @@ -36,6 +36,7 @@ class Simplex_tree_siblings { template<class T> friend class Simplex_tree_boundary_simplex_iterator; template<class T> friend class Simplex_tree_complex_simplex_iterator; template<class T> friend class Simplex_tree_skeleton_simplex_iterator; + template<class T> friend class Simplex_tree_boundary_opposite_vertex_simplex_iterator; typedef typename SimplexTree::Vertex_handle Vertex_handle; typedef typename SimplexTree::Filtration_value Filtration_value; @@ -57,7 +58,7 @@ class Simplex_tree_siblings { members_() { } - /* \brief Constructor with initialized set of members. + /** \brief Constructor with initialized set of members. * * 'members' must be sorted and unique.*/ template<typename RandomAccessVertexRange> @@ -71,8 +72,7 @@ class Simplex_tree_siblings { } } - /* - * \brief Inserts a Node in the set of siblings nodes. + /** \brief Inserts a Node in the set of siblings nodes. * * If already present, assigns the minimal filtration value * between input filtration_value and the value already @@ -113,7 +113,8 @@ class Simplex_tree_siblings { Dictionary members_; }; -/* @} */ // end addtogroup simplex_tree +/** @}*/ // end addtogroup simplex_tree + } // namespace Gudhi #endif // SIMPLEX_TREE_SIMPLEX_TREE_SIBLINGS_H_ diff --git a/src/Simplex_tree/include/gudhi/Simplex_tree/indexing_tag.h b/src/Simplex_tree/include/gudhi/Simplex_tree/indexing_tag.h index 3e395ae2..29c76e50 100644 --- a/src/Simplex_tree/include/gudhi/Simplex_tree/indexing_tag.h +++ b/src/Simplex_tree/include/gudhi/Simplex_tree/indexing_tag.h @@ -20,7 +20,7 @@ namespace Gudhi { struct linear_indexing_tag { }; -/* \brief Tag for a zigzag ordering of simplices. */ +/** \brief Tag for a zigzag ordering of simplices. */ // struct zigzag_indexing_tag {}; } // namespace Gudhi diff --git a/src/Simplex_tree/test/CMakeLists.txt b/src/Simplex_tree/test/CMakeLists.txt index cf2b0153..25b562e0 100644 --- a/src/Simplex_tree/test/CMakeLists.txt +++ b/src/Simplex_tree/test/CMakeLists.txt @@ -34,3 +34,9 @@ if (TBB_FOUND) target_link_libraries(Simplex_tree_make_filtration_non_decreasing_test_unit ${TBB_LIBRARIES}) endif() gudhi_add_boost_test(Simplex_tree_make_filtration_non_decreasing_test_unit) + +add_executable ( Simplex_tree_graph_expansion_test_unit simplex_tree_graph_expansion_unit_test.cpp ) +if (TBB_FOUND) + target_link_libraries(Simplex_tree_graph_expansion_test_unit ${TBB_LIBRARIES}) +endif() +gudhi_add_boost_test(Simplex_tree_graph_expansion_test_unit) diff --git a/src/Simplex_tree/test/simplex_tree_ctor_and_move_unit_test.cpp b/src/Simplex_tree/test/simplex_tree_ctor_and_move_unit_test.cpp index 229ae46f..f6118fe0 100644 --- a/src/Simplex_tree/test/simplex_tree_ctor_and_move_unit_test.cpp +++ b/src/Simplex_tree/test/simplex_tree_ctor_and_move_unit_test.cpp @@ -98,8 +98,16 @@ BOOST_AUTO_TEST_CASE_TEMPLATE(simplex_copy_constructor, Simplex_tree, list_of_te BOOST_CHECK(st == st4); BOOST_CHECK(st3 == st); +#ifdef __clang__ +#pragma GCC diagnostic push +#pragma GCC diagnostic ignored "-Wself-assign-overloaded" +#endif st = st; - print_simplex_filtration(st4, "Third self copy assignment from the default Simplex_tree"); +#ifdef __clang__ +#pragma GCC diagnostic pop +#endif + + print_simplex_filtration(st, "Third self copy assignment from the default Simplex_tree"); BOOST_CHECK(st3 == st); diff --git a/src/Simplex_tree/test/simplex_tree_graph_expansion_unit_test.cpp b/src/Simplex_tree/test/simplex_tree_graph_expansion_unit_test.cpp index 881a06ae..54e23204 100644 --- a/src/Simplex_tree/test/simplex_tree_graph_expansion_unit_test.cpp +++ b/src/Simplex_tree/test/simplex_tree_graph_expansion_unit_test.cpp @@ -9,33 +9,62 @@ */ #include <iostream> -#include <fstream> -#include <string> -#include <algorithm> -#include <utility> // std::pair, std::make_pair -#include <cmath> // float comparison -#include <limits> -#include <functional> // greater +#include <vector> #define BOOST_TEST_DYN_LINK -#define BOOST_TEST_MODULE "simplex_tree" +#define BOOST_TEST_MODULE "simplex_tree_graph_expansion" #include <boost/test/unit_test.hpp> #include <boost/mpl/list.hpp> -// ^ -// /!\ Nothing else from Simplex_tree shall be included to test includes are well defined. #include "gudhi/Simplex_tree.h" +#include <gudhi/Unitary_tests_utils.h> using namespace Gudhi; typedef boost::mpl::list<Simplex_tree<>, Simplex_tree<Simplex_tree_options_fast_persistence>> list_of_tested_variants; +BOOST_AUTO_TEST_CASE_TEMPLATE(simplex_tree_expansion_all_is_blocked, typeST, list_of_tested_variants) { + std::clog << "********************************************************************\n"; + std::clog << "simplex_tree_expansion_all_is_blocked\n"; + std::clog << "********************************************************************\n"; + using Simplex_handle = typename typeST::Simplex_handle; + // Construct the Simplex Tree with a 1-skeleton graph example + typeST simplex_tree; + + simplex_tree.insert_simplex({0, 1}, 0.); + simplex_tree.insert_simplex({0, 2}, 1.); + simplex_tree.insert_simplex({0, 3}, 2.); + simplex_tree.insert_simplex({1, 2}, 3.); + simplex_tree.insert_simplex({1, 3}, 4.); + simplex_tree.insert_simplex({2, 3}, 5.); + simplex_tree.insert_simplex({2, 4}, 6.); + simplex_tree.insert_simplex({3, 6}, 7.); + simplex_tree.insert_simplex({4, 5}, 8.); + simplex_tree.insert_simplex({4, 6}, 9.); + simplex_tree.insert_simplex({5, 6}, 10.); + simplex_tree.insert_simplex({6}, 10.); -bool AreAlmostTheSame(float a, float b) { - return std::fabs(a - b) < std::numeric_limits<float>::epsilon(); + typeST stree_copy = simplex_tree; + + simplex_tree.expansion_with_blockers(3, [&](Simplex_handle sh){ return true; }); + + std::clog << "* The complex contains " << simplex_tree.num_simplices() << " simplices"; + std::clog << " - dimension " << simplex_tree.dimension() << "\n"; + std::clog << "* Iterator on Simplices in the filtration, with [filtration value]:\n"; + for (auto f_simplex : simplex_tree.filtration_simplex_range()) { + std::clog << " " << "[" << simplex_tree.filtration(f_simplex) << "] "; + for (auto vertex : simplex_tree.simplex_vertex_range(f_simplex)) + std::clog << "(" << vertex << ")"; + std::clog << std::endl; + } + + BOOST_CHECK(stree_copy == simplex_tree); } BOOST_AUTO_TEST_CASE_TEMPLATE(simplex_tree_expansion_with_blockers_3, typeST, list_of_tested_variants) { + std::clog << "********************************************************************\n"; + std::clog << "simplex_tree_expansion_with_blockers_3\n"; + std::clog << "********************************************************************\n"; using Simplex_handle = typename typeST::Simplex_handle; // Construct the Simplex Tree with a 1-skeleton graph example typeST simplex_tree; @@ -64,7 +93,7 @@ BOOST_AUTO_TEST_CASE_TEMPLATE(simplex_tree_expansion_with_blockers_3, typeST, li std::clog << vertex << ", "; } std::clog << "] ( " << simplex_tree.filtration(sh); - // User can re-assign a new filtration value directly in the blocker (default is the maximal value of boudaries) + // User can re-assign a new filtration value directly in the blocker (default is the maximal value of boundaries) simplex_tree.assign_filtration(sh, simplex_tree.filtration(sh) + 1.); std::clog << " + 1. ) = " << result << std::endl; @@ -72,9 +101,6 @@ BOOST_AUTO_TEST_CASE_TEMPLATE(simplex_tree_expansion_with_blockers_3, typeST, li return result; }); - std::clog << "********************************************************************\n"; - std::clog << "simplex_tree_expansion_with_blockers_3\n"; - std::clog << "********************************************************************\n"; std::clog << "* The complex contains " << simplex_tree.num_simplices() << " simplices"; std::clog << " - dimension " << simplex_tree.dimension() << "\n"; std::clog << "* Iterator on Simplices in the filtration, with [filtration value]:\n"; @@ -89,15 +115,23 @@ BOOST_AUTO_TEST_CASE_TEMPLATE(simplex_tree_expansion_with_blockers_3, typeST, li BOOST_CHECK(simplex_tree.dimension() == 3); // {4, 5, 6} shall be blocked BOOST_CHECK(simplex_tree.find({4, 5, 6}) == simplex_tree.null_simplex()); - BOOST_CHECK(AreAlmostTheSame(simplex_tree.filtration(simplex_tree.find({0,1,2})), 4.)); - BOOST_CHECK(AreAlmostTheSame(simplex_tree.filtration(simplex_tree.find({0,1,3})), 5.)); - BOOST_CHECK(AreAlmostTheSame(simplex_tree.filtration(simplex_tree.find({0,2,3})), 6.)); - BOOST_CHECK(AreAlmostTheSame(simplex_tree.filtration(simplex_tree.find({1,2,3})), 6.)); - BOOST_CHECK(AreAlmostTheSame(simplex_tree.filtration(simplex_tree.find({0,1,2,3})), 7.)); + GUDHI_TEST_FLOAT_EQUALITY_CHECK(simplex_tree.filtration(simplex_tree.find({0,1,2})), + static_cast<typename typeST::Filtration_value>(4.)); + GUDHI_TEST_FLOAT_EQUALITY_CHECK(simplex_tree.filtration(simplex_tree.find({0,1,3})), + static_cast<typename typeST::Filtration_value>(5.)); + GUDHI_TEST_FLOAT_EQUALITY_CHECK(simplex_tree.filtration(simplex_tree.find({0,2,3})), + static_cast<typename typeST::Filtration_value>(6.)); + GUDHI_TEST_FLOAT_EQUALITY_CHECK(simplex_tree.filtration(simplex_tree.find({1,2,3})), + static_cast<typename typeST::Filtration_value>(6.)); + GUDHI_TEST_FLOAT_EQUALITY_CHECK(simplex_tree.filtration(simplex_tree.find({0,1,2,3})), + static_cast<typename typeST::Filtration_value>(7.)); } BOOST_AUTO_TEST_CASE_TEMPLATE(simplex_tree_expansion_with_blockers_2, typeST, list_of_tested_variants) { + std::clog << "********************************************************************\n"; + std::clog << "simplex_tree_expansion_with_blockers_2\n"; + std::clog << "********************************************************************\n"; using Simplex_handle = typename typeST::Simplex_handle; // Construct the Simplex Tree with a 1-skeleton graph example typeST simplex_tree; @@ -126,7 +160,7 @@ BOOST_AUTO_TEST_CASE_TEMPLATE(simplex_tree_expansion_with_blockers_2, typeST, li std::clog << vertex << ", "; } std::clog << "] ( " << simplex_tree.filtration(sh); - // User can re-assign a new filtration value directly in the blocker (default is the maximal value of boudaries) + // User can re-assign a new filtration value directly in the blocker (default is the maximal value of boundaries) simplex_tree.assign_filtration(sh, simplex_tree.filtration(sh) + 1.); std::clog << " + 1. ) = " << result << std::endl; @@ -134,9 +168,6 @@ BOOST_AUTO_TEST_CASE_TEMPLATE(simplex_tree_expansion_with_blockers_2, typeST, li return result; }); - std::clog << "********************************************************************\n"; - std::clog << "simplex_tree_expansion_with_blockers_2\n"; - std::clog << "********************************************************************\n"; std::clog << "* The complex contains " << simplex_tree.num_simplices() << " simplices"; std::clog << " - dimension " << simplex_tree.dimension() << "\n"; std::clog << "* Iterator on Simplices in the filtration, with [filtration value]:\n"; @@ -151,14 +182,22 @@ BOOST_AUTO_TEST_CASE_TEMPLATE(simplex_tree_expansion_with_blockers_2, typeST, li BOOST_CHECK(simplex_tree.dimension() == 2); // {4, 5, 6} shall be blocked BOOST_CHECK(simplex_tree.find({4, 5, 6}) == simplex_tree.null_simplex()); - BOOST_CHECK(AreAlmostTheSame(simplex_tree.filtration(simplex_tree.find({0,1,2})), 4.)); - BOOST_CHECK(AreAlmostTheSame(simplex_tree.filtration(simplex_tree.find({0,1,3})), 5.)); - BOOST_CHECK(AreAlmostTheSame(simplex_tree.filtration(simplex_tree.find({0,2,3})), 6.)); - BOOST_CHECK(AreAlmostTheSame(simplex_tree.filtration(simplex_tree.find({1,2,3})), 6.)); + GUDHI_TEST_FLOAT_EQUALITY_CHECK(simplex_tree.filtration(simplex_tree.find({0,1,2})), + static_cast<typename typeST::Filtration_value>(4.)); + GUDHI_TEST_FLOAT_EQUALITY_CHECK(simplex_tree.filtration(simplex_tree.find({0,1,3})), + static_cast<typename typeST::Filtration_value>(5.)); + GUDHI_TEST_FLOAT_EQUALITY_CHECK(simplex_tree.filtration(simplex_tree.find({0,2,3})), + static_cast<typename typeST::Filtration_value>(6.)); + GUDHI_TEST_FLOAT_EQUALITY_CHECK(simplex_tree.filtration(simplex_tree.find({1,2,3})), + static_cast<typename typeST::Filtration_value>(6.)); BOOST_CHECK(simplex_tree.find({0,1,2,3}) == simplex_tree.null_simplex()); } -BOOST_AUTO_TEST_CASE_TEMPLATE(simplex_tree_expansion, typeST, list_of_tested_variants) { +BOOST_AUTO_TEST_CASE_TEMPLATE(simplex_tree_expansion_with_find_simplex_blockers, typeST, list_of_tested_variants) { + std::clog << "********************************************************************\n"; + std::clog << "simplex_tree_expansion_with_find_simplex_blockers\n"; + std::clog << "********************************************************************\n"; + using Simplex_handle = typename typeST::Simplex_handle; // Construct the Simplex Tree with a 1-skeleton graph example typeST simplex_tree; @@ -175,10 +214,66 @@ BOOST_AUTO_TEST_CASE_TEMPLATE(simplex_tree_expansion, typeST, list_of_tested_var simplex_tree.insert_simplex({5, 6}, 10.); simplex_tree.insert_simplex({6}, 10.); - simplex_tree.expansion(3); + simplex_tree.expansion_with_blockers(3, [&](Simplex_handle sh){ + bool result = false; + std::clog << "Blocker on ["; + std::vector<typename typeST::Vertex_handle> simplex; + // User can loop on the vertices from the given simplex_handle i.e. + for (auto vertex : simplex_tree.simplex_vertex_range(sh)) { + // We block the expansion, if the vertex '1' is in the given list of vertices + if (vertex == 1) + result = true; + std::clog << vertex << ", "; + simplex.push_back(vertex); + } + std::clog << "] => " << result << std::endl; + // Not efficient but test it works - required by the python interface + BOOST_CHECK(simplex_tree.find(simplex) == sh); + return result; + }); + + std::clog << "* The complex contains " << simplex_tree.num_simplices() << " simplices"; + std::clog << " - dimension " << simplex_tree.dimension() << "\n"; + std::clog << "* Iterator on Simplices in the filtration, with [filtration value]:\n"; + for (auto f_simplex : simplex_tree.filtration_simplex_range()) { + std::clog << " " << "[" << simplex_tree.filtration(f_simplex) << "] "; + for (auto vertex : simplex_tree.simplex_vertex_range(f_simplex)) + std::clog << "(" << vertex << ")"; + std::clog << std::endl; + } + + BOOST_CHECK(simplex_tree.num_simplices() == 20); + BOOST_CHECK(simplex_tree.dimension() == 2); + + // {1, 2, 3}, {0, 1, 2} and {0, 1, 3} shall be blocked as it contains vertex 1 + BOOST_CHECK(simplex_tree.find({4, 5, 6}) != simplex_tree.null_simplex()); + BOOST_CHECK(simplex_tree.find({1, 2, 3}) == simplex_tree.null_simplex()); + BOOST_CHECK(simplex_tree.find({0, 2, 3}) != simplex_tree.null_simplex()); + BOOST_CHECK(simplex_tree.find({0, 1, 2}) == simplex_tree.null_simplex()); + BOOST_CHECK(simplex_tree.find({0, 1, 3}) == simplex_tree.null_simplex()); +} + +BOOST_AUTO_TEST_CASE_TEMPLATE(simplex_tree_expansion_3, typeST, list_of_tested_variants) { std::clog << "********************************************************************\n"; std::clog << "simplex_tree_expansion_3\n"; std::clog << "********************************************************************\n"; + // Construct the Simplex Tree with a 1-skeleton graph example + typeST simplex_tree; + + simplex_tree.insert_simplex({0, 1}, 0.); + simplex_tree.insert_simplex({0, 2}, 1.); + simplex_tree.insert_simplex({0, 3}, 2.); + simplex_tree.insert_simplex({1, 2}, 3.); + simplex_tree.insert_simplex({1, 3}, 4.); + simplex_tree.insert_simplex({2, 3}, 5.); + simplex_tree.insert_simplex({2, 4}, 6.); + simplex_tree.insert_simplex({3, 6}, 7.); + simplex_tree.insert_simplex({4, 5}, 8.); + simplex_tree.insert_simplex({4, 6}, 9.); + simplex_tree.insert_simplex({5, 6}, 10.); + simplex_tree.insert_simplex({6}, 10.); + + simplex_tree.expansion(3); std::clog << "* The complex contains " << simplex_tree.num_simplices() << " simplices"; std::clog << " - dimension " << simplex_tree.dimension() << "\n"; std::clog << "* Iterator on Simplices in the filtration, with [filtration value]:\n"; @@ -192,16 +287,25 @@ BOOST_AUTO_TEST_CASE_TEMPLATE(simplex_tree_expansion, typeST, list_of_tested_var BOOST_CHECK(simplex_tree.num_simplices() == 24); BOOST_CHECK(simplex_tree.dimension() == 3); - BOOST_CHECK(AreAlmostTheSame(simplex_tree.filtration(simplex_tree.find({4,5,6})), 10.)); - BOOST_CHECK(AreAlmostTheSame(simplex_tree.filtration(simplex_tree.find({0,1,2})), 3.)); - BOOST_CHECK(AreAlmostTheSame(simplex_tree.filtration(simplex_tree.find({0,1,3})), 4.)); - BOOST_CHECK(AreAlmostTheSame(simplex_tree.filtration(simplex_tree.find({0,2,3})), 5.)); - BOOST_CHECK(AreAlmostTheSame(simplex_tree.filtration(simplex_tree.find({1,2,3})), 5.)); - BOOST_CHECK(AreAlmostTheSame(simplex_tree.filtration(simplex_tree.find({0,1,2,3})), 5.)); + GUDHI_TEST_FLOAT_EQUALITY_CHECK(simplex_tree.filtration(simplex_tree.find({4,5,6})), + static_cast<typename typeST::Filtration_value>(10.)); + GUDHI_TEST_FLOAT_EQUALITY_CHECK(simplex_tree.filtration(simplex_tree.find({0,1,2})), + static_cast<typename typeST::Filtration_value>(3.)); + GUDHI_TEST_FLOAT_EQUALITY_CHECK(simplex_tree.filtration(simplex_tree.find({0,1,3})), + static_cast<typename typeST::Filtration_value>(4.)); + GUDHI_TEST_FLOAT_EQUALITY_CHECK(simplex_tree.filtration(simplex_tree.find({0,2,3})), + static_cast<typename typeST::Filtration_value>(5.)); + GUDHI_TEST_FLOAT_EQUALITY_CHECK(simplex_tree.filtration(simplex_tree.find({1,2,3})), + static_cast<typename typeST::Filtration_value>(5.)); + GUDHI_TEST_FLOAT_EQUALITY_CHECK(simplex_tree.filtration(simplex_tree.find({0,1,2,3})), + static_cast<typename typeST::Filtration_value>(5.)); } BOOST_AUTO_TEST_CASE_TEMPLATE(simplex_tree_expansion_2, typeST, list_of_tested_variants) { + std::clog << "********************************************************************\n"; + std::clog << "simplex_tree_expansion_2\n"; + std::clog << "********************************************************************\n"; // Construct the Simplex Tree with a 1-skeleton graph example typeST simplex_tree; @@ -220,9 +324,6 @@ BOOST_AUTO_TEST_CASE_TEMPLATE(simplex_tree_expansion_2, typeST, list_of_tested_v simplex_tree.expansion(2); - std::clog << "********************************************************************\n"; - std::clog << "simplex_tree_expansion_2\n"; - std::clog << "********************************************************************\n"; std::clog << "* The complex contains " << simplex_tree.num_simplices() << " simplices"; std::clog << " - dimension " << simplex_tree.dimension() << "\n"; std::clog << "* Iterator on Simplices in the filtration, with [filtration value]:\n"; @@ -236,10 +337,15 @@ BOOST_AUTO_TEST_CASE_TEMPLATE(simplex_tree_expansion_2, typeST, list_of_tested_v BOOST_CHECK(simplex_tree.num_simplices() == 23); BOOST_CHECK(simplex_tree.dimension() == 2); - BOOST_CHECK(AreAlmostTheSame(simplex_tree.filtration(simplex_tree.find({4,5,6})), 10.)); - BOOST_CHECK(AreAlmostTheSame(simplex_tree.filtration(simplex_tree.find({0,1,2})), 3.)); - BOOST_CHECK(AreAlmostTheSame(simplex_tree.filtration(simplex_tree.find({0,1,3})), 4.)); - BOOST_CHECK(AreAlmostTheSame(simplex_tree.filtration(simplex_tree.find({0,2,3})), 5.)); - BOOST_CHECK(AreAlmostTheSame(simplex_tree.filtration(simplex_tree.find({1,2,3})), 5.)); + GUDHI_TEST_FLOAT_EQUALITY_CHECK(simplex_tree.filtration(simplex_tree.find({4,5,6})), + static_cast<typename typeST::Filtration_value>(10.)); + GUDHI_TEST_FLOAT_EQUALITY_CHECK(simplex_tree.filtration(simplex_tree.find({0,1,2})), + static_cast<typename typeST::Filtration_value>(3.)); + GUDHI_TEST_FLOAT_EQUALITY_CHECK(simplex_tree.filtration(simplex_tree.find({0,1,3})), + static_cast<typename typeST::Filtration_value>(4.)); + GUDHI_TEST_FLOAT_EQUALITY_CHECK(simplex_tree.filtration(simplex_tree.find({0,2,3})), + static_cast<typename typeST::Filtration_value>(5.)); + GUDHI_TEST_FLOAT_EQUALITY_CHECK(simplex_tree.filtration(simplex_tree.find({1,2,3})), + static_cast<typename typeST::Filtration_value>(5.)); BOOST_CHECK(simplex_tree.find({0,1,2,3}) == simplex_tree.null_simplex()); } diff --git a/src/Simplex_tree/test/simplex_tree_unit_test.cpp b/src/Simplex_tree/test/simplex_tree_unit_test.cpp index bdd41d34..ebcc406c 100644 --- a/src/Simplex_tree/test/simplex_tree_unit_test.cpp +++ b/src/Simplex_tree/test/simplex_tree_unit_test.cpp @@ -17,6 +17,8 @@ #include <limits> #include <functional> // greater #include <tuple> // std::tie +#include <iterator> // for std::distance +#include <cstddef> // for std::size_t #define BOOST_TEST_DYN_LINK #define BOOST_TEST_MODULE "simplex_tree" @@ -285,7 +287,7 @@ BOOST_AUTO_TEST_CASE_TEMPLATE(simplex_tree_insertion, typeST, list_of_tested_var set_and_test_simplex_tree_dim_fil(st, eighthSimplexVector.size(), eighthSimplex.second); BOOST_CHECK(st.num_vertices() == (size_t) 4); - // ++ NINETH + // ++ NINTH std::clog << " - INSERT (3,0)" << std::endl; typeVectorVertex ninethSimplexVector{3, 0}; BOOST_CHECK(ninethSimplexVector.size() == 2); @@ -359,7 +361,7 @@ BOOST_AUTO_TEST_CASE_TEMPLATE(simplex_tree_insertion, typeST, list_of_tested_var test_simplex_tree_contains(st, seventhSimplex, 8); // (2,1,0) -> 8 std::clog << "simplex_tree_insertion - eighth - 3" << std::endl; test_simplex_tree_contains(st, eighthSimplex, 3); // (3) -> 3 - std::clog << "simplex_tree_insertion - nineth - 7" << std::endl; + std::clog << "simplex_tree_insertion - ninth - 7" << std::endl; test_simplex_tree_contains(st, ninethSimplex, 7); // (3,0) -> 7 // Display the Simplex_tree - Can not be done in the middle of 2 inserts @@ -991,3 +993,62 @@ BOOST_AUTO_TEST_CASE_TEMPLATE(simplex_tree_reset_filtration, typeST, list_of_tes } +BOOST_AUTO_TEST_CASE_TEMPLATE(simplex_tree_boundaries_and_opposite_vertex_iterator, typeST, list_of_tested_variants) { + std::clog << "********************************************************************" << std::endl; + std::clog << "TEST OF BOUNDARIES AND OPPOSITE VERTEX ITERATORS" << std::endl; + typeST st; + + st.insert_simplex_and_subfaces({2, 1, 0}, 3.); + st.insert_simplex_and_subfaces({3, 0}, 2.); + st.insert_simplex_and_subfaces({3, 4, 5}, 3.); + st.insert_simplex_and_subfaces({0, 1, 6, 7}, 4.); + + /* Inserted simplex: */ + /* 1 6 */ + /* o---o */ + /* /X\7/ */ + /* o---o---o---o */ + /* 2 0 3\X/4 */ + /* o */ + /* 5 */ + using Simplex = std::vector<typename typeST::Vertex_handle>; + // simplices must be kept sorted by vertex number for std::vector to use operator== - cf. last BOOST_CHECK + std::vector<Simplex> simplices = {{0, 1, 2}, {0, 3}, {0, 1, 6, 7}, {3, 4, 5}, {3, 5}, {2}}; + for (auto simplex : simplices) { + Simplex opposite_vertices; + for(auto boundary_and_opposite_vertex : st.boundary_opposite_vertex_simplex_range(st.find(simplex))) { + Simplex output; + for (auto vertex : st.simplex_vertex_range(boundary_and_opposite_vertex.first)) { + std::clog << vertex << " "; + output.emplace_back(vertex); + } + std::clog << " - opposite vertex = " << boundary_and_opposite_vertex.second << std::endl; + // Check that boundary simplex + opposite vertex = simplex given as input + output.emplace_back(boundary_and_opposite_vertex.second); + std::sort(output.begin(), output.end()); + BOOST_CHECK(simplex == output); + opposite_vertices.emplace_back(boundary_and_opposite_vertex.second); + } + // Check that the list of all opposite vertices = simplex given as input + // no opposite vertices if simplex given as input is of dimension 1 + std::sort(opposite_vertices.begin(), opposite_vertices.end()); + if (simplex.size() > 1) + BOOST_CHECK(simplex == opposite_vertices); + else + BOOST_CHECK(opposite_vertices.size() == 0); + } +} + +BOOST_AUTO_TEST_CASE(batch_vertices) { + typedef Simplex_tree<> typeST; + std::clog << "********************************************************************" << std::endl; + std::clog << "TEST BATCH VERTEX INSERTION" << std::endl; + typeST st; + st.insert_simplex_and_subfaces({3}, 1.5); + std::vector verts { 2, 3, 5, 6 }; + st.insert_batch_vertices(verts); + BOOST_CHECK(st.num_vertices() == 4); + BOOST_CHECK(st.num_simplices() == 4); + BOOST_CHECK(st.filtration(st.find({2})) == 0.); + BOOST_CHECK(st.filtration(st.find({3})) == 1.5); +} diff --git a/src/Skeleton_blocker/concept/SkeletonBlockerDS.h b/src/Skeleton_blocker/concept/SkeletonBlockerDS.h index 0c2014bd..23eb3670 100644 --- a/src/Skeleton_blocker/concept/SkeletonBlockerDS.h +++ b/src/Skeleton_blocker/concept/SkeletonBlockerDS.h @@ -29,7 +29,7 @@ struct SkeletonBlockerDS { /** * @brief Root_vertex_handle and Vertex_handle are similar to global and local vertex descriptor - * used in <a href="http://www.boost.org/doc/libs/1_38_0/libs/graph/doc/subgraph.html">boost subgraphs</a> + * used in <a href="https://www.boost.org/doc/libs/release/libs/graph/doc/subgraph.html">boost subgraphs</a> * and allow to localize a vertex of a subcomplex on its parent root complex. * * In gross, vertices are stored in a vector diff --git a/src/Skeleton_blocker/include/gudhi/Skeleton_blocker.h b/src/Skeleton_blocker/include/gudhi/Skeleton_blocker.h index 653a63fd..0fd56c67 100644 --- a/src/Skeleton_blocker/include/gudhi/Skeleton_blocker.h +++ b/src/Skeleton_blocker/include/gudhi/Skeleton_blocker.h @@ -52,8 +52,7 @@ when \f$ \tau \neq \sigma\f$ we say that \f$ \tau\f$ is a proper-face of \f$ \si An abstract simplicial complex is a set of simplices that contains all the faces of its simplices. The 1-skeleton of a simplicial complex (or its graph) consists of its elements of dimension lower than 2. - *\image html "ds_representation.png" "Skeleton-blocker representation" width=20cm - +\image html "ds_representation.png" "Skeleton-blocker representation" To encode, a simplicial complex, one can encodes all its simplices. In case when this number gets too large, @@ -73,11 +72,7 @@ For instance, the numbers of blockers is depicted for random 3-dimensional spher in next figure. Storing the graph and blockers of such simplicial complexes is much compact in this case than storing their simplices. - - *\image html "blockers_curve.png" "Number of blockers of random triangulations of 3-spheres" width=10cm - - - +\image html "blockers_curve.png" "Number of blockers of random triangulations of 3-spheres" \section API diff --git a/src/Skeleton_blocker/include/gudhi/Skeleton_blocker/Skeleton_blocker_simple_traits.h b/src/Skeleton_blocker/include/gudhi/Skeleton_blocker/Skeleton_blocker_simple_traits.h index 0c0cc624..d091d7dd 100644 --- a/src/Skeleton_blocker/include/gudhi/Skeleton_blocker/Skeleton_blocker_simple_traits.h +++ b/src/Skeleton_blocker/include/gudhi/Skeleton_blocker/Skeleton_blocker_simple_traits.h @@ -28,7 +28,7 @@ namespace skeleton_blocker { */ struct Skeleton_blocker_simple_traits { /** - * @brief Global and local handle similar to <a href="http://www.boost.org/doc/libs/1_38_0/libs/graph/doc/subgraph.html">boost subgraphs</a>. + * @brief Global and local handle similar to <a href="https://www.boost.org/doc/libs/release/libs/graph/doc/subgraph.html">boost subgraphs</a>. * Vertices are stored in a vector. * For the root simplicial complex, the local and global descriptors are the same. * For a subcomplex L and one of its vertices 'v', the local descriptor of 'v' is its position in diff --git a/src/Skeleton_blocker/include/gudhi/Skeleton_blocker/Skeleton_blocker_simplex.h b/src/Skeleton_blocker/include/gudhi/Skeleton_blocker/Skeleton_blocker_simplex.h index 12fe6469..d83c0ab3 100644 --- a/src/Skeleton_blocker/include/gudhi/Skeleton_blocker/Skeleton_blocker_simplex.h +++ b/src/Skeleton_blocker/include/gudhi/Skeleton_blocker/Skeleton_blocker_simplex.h @@ -134,7 +134,7 @@ class Skeleton_blocker_simplex { } /** - * Substracts a from the simplex. + * Subtracts a from the simplex. */ void difference(const Skeleton_blocker_simplex & a) { std::vector<T> v; diff --git a/src/Skeleton_blocker/include/gudhi/Skeleton_blocker/Skeleton_blocker_sub_complex.h b/src/Skeleton_blocker/include/gudhi/Skeleton_blocker/Skeleton_blocker_sub_complex.h index 4c48ff31..4c0c7dad 100644 --- a/src/Skeleton_blocker/include/gudhi/Skeleton_blocker/Skeleton_blocker_sub_complex.h +++ b/src/Skeleton_blocker/include/gudhi/Skeleton_blocker/Skeleton_blocker_sub_complex.h @@ -76,8 +76,8 @@ class Skeleton_blocker_sub_complex : public ComplexType { public: /** * Add a vertex 'global' of K to L. When added to L, this vertex will receive - * another number, addresses(global), its local adress. - * return the adress where the vertex lay on L. + * another number, addresses(global), its local address. + * return the address where the vertex lay on L. * The vertex corresponding to 'global' must not be already present * in the complex. */ @@ -174,7 +174,7 @@ class Skeleton_blocker_sub_complex : public ComplexType { // /** // * Allocates a simplex in L corresponding to the simplex s in K - // * with its local adresses and returns an AddressSimplex. + // * with its local addresses and returns an AddressSimplex. // */ // boost::optional<Simplex> get_address(const Root_simplex_handle & s) const; @@ -196,10 +196,8 @@ class Skeleton_blocker_sub_complex : public ComplexType { }; /** - * @remark remarque perte de temps a creer un nouveau simplexe a chaque fois - * alors qu'on pourrait utiliser a la place de 'addresses_sigma_in_link' - * un simplex avec des valeurs sp�ciales ComplexDS::null_vertex par exemple - * pour indiquer qu'un vertex n'appartient pas au complex + * @remark waste of time to create a new simplex each time when we could use instead of addresses_sigma_in_link a + * simplex with special values (ComplexDS::null_vertex e.g.) to indicate that a vertex does not belong to the complex. */ template<typename ComplexType> bool proper_face_in_union( @@ -226,7 +224,7 @@ bool proper_face_in_union( } // Remark: this function should be friend in order to leave get_adresses private -// however doing so seemes currently not possible due to a visual studio bug c2668 +// however doing so seems currently not possible due to a visual studio bug c2668 // "the compiler does not support partial ordering of template functions as specified in the C++ Standard" // http://www.serkey.com/error-c2668-ambiguous-call-to-overloaded-function-bb45ft.html diff --git a/src/Skeleton_blocker/include/gudhi/Skeleton_blocker/internal/Trie.h b/src/Skeleton_blocker/include/gudhi/Skeleton_blocker/internal/Trie.h index a43fa034..116bc779 100644 --- a/src/Skeleton_blocker/include/gudhi/Skeleton_blocker/internal/Trie.h +++ b/src/Skeleton_blocker/include/gudhi/Skeleton_blocker/internal/Trie.h @@ -107,7 +107,7 @@ struct Trie { } /** - * Goes to the root in the trie to consitute simplex + * Goes to the root in the trie to constitute simplex */ void add_vertices_up_to_the_root(Simplex& res) const { res.add_vertex(v); @@ -150,7 +150,7 @@ struct Trie { ++s_pos; while (s_pos != s.end() && current != 0) { bool found = false; - for (const auto child : current->childs) { + for (const auto& child : current->childs) { if (child->v == *s_pos) { ++s_pos; current = child.get(); diff --git a/src/Skeleton_blocker/include/gudhi/Skeleton_blocker/iterators/Skeleton_blockers_triangles_iterators.h b/src/Skeleton_blocker/include/gudhi/Skeleton_blocker/iterators/Skeleton_blockers_triangles_iterators.h index 37c0b4d3..2c49a1b8 100644 --- a/src/Skeleton_blocker/include/gudhi/Skeleton_blocker/iterators/Skeleton_blockers_triangles_iterators.h +++ b/src/Skeleton_blocker/include/gudhi/Skeleton_blocker/iterators/Skeleton_blockers_triangles_iterators.h @@ -21,7 +21,7 @@ namespace skeleton_blocker { /** * \brief Iterator over the triangles that are * adjacent to a vertex of the simplicial complex. - * \remark Will be removed soon -> dont look + * \remark Will be removed soon -> don't look */ template<typename Complex, typename LinkType> class Triangle_around_vertex_iterator : public boost::iterator_facade @@ -95,7 +95,7 @@ class Triangle_around_vertex_iterator : public boost::iterator_facade /** * \brief Iterator over the triangles of the * simplicial complex. - * \remark Will be removed soon -> dont look + * \remark Will be removed soon -> don't look * */ template<typename SkeletonBlockerComplex> diff --git a/src/Skeleton_blocker/include/gudhi/Skeleton_blocker_complex.h b/src/Skeleton_blocker/include/gudhi/Skeleton_blocker_complex.h index 125c6387..b4ffc756 100644 --- a/src/Skeleton_blocker/include/gudhi/Skeleton_blocker_complex.h +++ b/src/Skeleton_blocker/include/gudhi/Skeleton_blocker_complex.h @@ -438,7 +438,7 @@ class Skeleton_blocker_complex { } /** - * return the id of a vertex of adress local present in the graph + * return the id of a vertex of address local present in the graph */ Root_vertex_handle get_id(Vertex_handle local) const { assert(0 <= local.vertex && local.vertex < boost::num_vertices(skeleton)); @@ -740,7 +740,7 @@ class Skeleton_blocker_complex { * complex to the smallest flag complex that contains it. */ void remove_blockers() { - // Desallocate the blockers + // Deallocate the blockers while (!blocker_map_.empty()) { delete_blocker(blocker_map_.begin()->second); } @@ -764,8 +764,8 @@ class Skeleton_blocker_complex { public: /** - * Removes the simplex s from the set of blockers - * and desallocate s. + * Removes the simplex sigma from the set of blockers + * and deallocate sigma. */ void delete_blocker(Blocker_handle sigma) { if (visitor) @@ -960,7 +960,7 @@ class Skeleton_blocker_complex { } /* - * @brief returnrs true iff the complex is empty. + * @brief returns true iff the complex is empty. */ bool empty() const { return num_vertices() == 0; @@ -1043,7 +1043,7 @@ class Skeleton_blocker_complex { if (num_vertices() == 1) return true; for (auto vi : vertex_range()) { - // xxx todo faire une methode bool is_in_blocker(Vertex_handle) + // xxx todo create a method: bool is_in_blocker(Vertex_handle) if (blocker_map_.find(vi) == blocker_map_.end()) { // no blocker passes through the vertex, we just need to // check if the current vertex is linked to all others vertices of the complex @@ -1071,7 +1071,6 @@ class Skeleton_blocker_complex { /** * Removes all the popable blockers of the complex and delete them. - * @returns the number of popable blockers deleted */ void remove_popable_blockers(); @@ -1103,7 +1102,6 @@ class Skeleton_blocker_complex { public: /** * Remove the star of the edge connecting vertices a and b. - * @returns the number of blocker that have been removed */ void remove_star(Vertex_handle a, Vertex_handle b); @@ -1293,7 +1291,7 @@ class Skeleton_blocker_complex { typedef boost::iterator_range<Complex_neighbors_vertices_iterator> Complex_neighbors_vertices_range; /** - * @brief Returns a Complex_edge_range over all edges of the simplicial complex that passes trough v + * @brief Returns a Complex_edge_range over all edges of the simplicial complex that passes through v */ Complex_neighbors_vertices_range vertex_range(Vertex_handle v) const { auto begin = Complex_neighbors_vertices_iterator(this, v); diff --git a/src/Skeleton_blocker/include/gudhi/Skeleton_blocker_link_complex.h b/src/Skeleton_blocker/include/gudhi/Skeleton_blocker_link_complex.h index a2637da3..b3bf0382 100644 --- a/src/Skeleton_blocker/include/gudhi/Skeleton_blocker_link_complex.h +++ b/src/Skeleton_blocker/include/gudhi/Skeleton_blocker_link_complex.h @@ -164,7 +164,7 @@ ComplexType> { Vertex_handle y_parent = *parent_complex.get_address( this->get_id(*y_link)); if (parent_complex.contains_edge(x_parent, y_parent)) { - // we check that there is no blocker subset of alpha passing trough x and y + // we check that there is no blocker subset of alpha passing through x and y bool new_edge = true; for (auto blocker_parent : parent_complex.const_blocker_range( x_parent)) { diff --git a/src/Skeleton_blocker/include/gudhi/Skeleton_blocker_simplifiable_complex.h b/src/Skeleton_blocker/include/gudhi/Skeleton_blocker_simplifiable_complex.h index 404f04f9..e686aaec 100644..100755 --- a/src/Skeleton_blocker/include/gudhi/Skeleton_blocker_simplifiable_complex.h +++ b/src/Skeleton_blocker/include/gudhi/Skeleton_blocker_simplifiable_complex.h @@ -39,7 +39,6 @@ bool Skeleton_blocker_complex<SkeletonBlockerDS>::is_popable_blocker(Blocker_han /** * Removes all the popable blockers of the complex and delete them. - * @returns the number of popable blockers deleted */ template<typename SkeletonBlockerDS> void Skeleton_blocker_complex<SkeletonBlockerDS>::remove_popable_blockers() { @@ -160,7 +159,6 @@ void Skeleton_blocker_complex<SkeletonBlockerDS>::update_blockers_after_remove_s /** * Remove the star of the edge connecting vertices a and b. - * @returns the number of blocker that have been removed */ template<typename SkeletonBlockerDS> void Skeleton_blocker_complex<SkeletonBlockerDS>::remove_star(Vertex_handle a, Vertex_handle b) { @@ -269,7 +267,7 @@ void Skeleton_blocker_complex<SkeletonBlockerDS>::remove_blocker_include_in_simp template<typename SkeletonBlockerDS> void Skeleton_blocker_complex<SkeletonBlockerDS>::tip_blockers(Vertex_handle a, Vertex_handle b, std::vector<Simplex> & buffer) const { - for (auto const & blocker : this->const_blocker_range(a)) { + for (auto const blocker : this->const_blocker_range(a)) { Simplex beta = (*blocker); beta.remove_vertex(a); buffer.push_back(beta); diff --git a/src/Spatial_searching/doc/Intro_spatial_searching.h b/src/Spatial_searching/doc/Intro_spatial_searching.h index 30805570..81c5a3aa 100644 --- a/src/Spatial_searching/doc/Intro_spatial_searching.h +++ b/src/Spatial_searching/doc/Intro_spatial_searching.h @@ -36,7 +36,7 @@ namespace spatial_searching { * * This example generates 500 random points, then performs all-near-neighbors searches, and queries for nearest and furthest neighbors using different methods. * - * \include Spatial_searching/example_spatial_searching.cpp + * \include example_spatial_searching.cpp * */ /** @} */ // end defgroup spatial_searching diff --git a/src/Spatial_searching/example/example_spatial_searching.cpp b/src/Spatial_searching/example/example_spatial_searching.cpp index 8f9151fc..09c2dabf 100644 --- a/src/Spatial_searching/example/example_spatial_searching.cpp +++ b/src/Spatial_searching/example/example_spatial_searching.cpp @@ -25,7 +25,7 @@ int main(void) { // 10-nearest neighbor query std::clog << "10 nearest neighbors from points[20]:\n"; auto knn_range = points_ds.k_nearest_neighbors(points[20], 10, true); - for (auto const& nghb : knn_range) + for (auto const nghb : knn_range) std::clog << nghb.first << " (sq. dist. = " << nghb.second << ")\n"; // Incremental nearest neighbor query @@ -38,7 +38,7 @@ int main(void) { // 10-furthest neighbor query std::clog << "10 furthest neighbors from points[20]:\n"; auto kfn_range = points_ds.k_furthest_neighbors(points[20], 10, true); - for (auto const& nghb : kfn_range) + for (auto const nghb : kfn_range) std::clog << nghb.first << " (sq. dist. = " << nghb.second << ")\n"; // Incremental furthest neighbor query diff --git a/src/Spatial_searching/include/gudhi/Kd_tree_search.h b/src/Spatial_searching/include/gudhi/Kd_tree_search.h index a50a8537..6fb611f2 100644 --- a/src/Spatial_searching/include/gudhi/Kd_tree_search.h +++ b/src/Spatial_searching/include/gudhi/Kd_tree_search.h @@ -139,7 +139,7 @@ class Kd_tree_search { } template <typename Coord_iterator> - bool contains_point_given_as_coordinates(Coord_iterator pi, Coord_iterator CGAL_UNUSED) const { + bool contains_point_given_as_coordinates(Coord_iterator pi, Coord_iterator) const { FT distance = 0; auto ccci = traits.construct_cartesian_const_iterator_d_object(); auto ci = ccci(c); diff --git a/src/Spatial_searching/test/test_Kd_tree_search.cpp b/src/Spatial_searching/test/test_Kd_tree_search.cpp index d6c6fba3..e9acfaa7 100644 --- a/src/Spatial_searching/test/test_Kd_tree_search.cpp +++ b/src/Spatial_searching/test/test_Kd_tree_search.cpp @@ -45,7 +45,7 @@ BOOST_AUTO_TEST_CASE(test_Kd_tree_search) { std::vector<std::size_t> knn_result; FT last_dist = -1.; - for (auto const& nghb : kns_range) { + for (auto const nghb : kns_range) { BOOST_CHECK(nghb.second > last_dist); knn_result.push_back(nghb.second); last_dist = nghb.second; @@ -76,7 +76,7 @@ BOOST_AUTO_TEST_CASE(test_Kd_tree_search) { std::vector<std::size_t> kfn_result; last_dist = kfn_range.begin()->second; - for (auto const& nghb : kfn_range) { + for (auto const nghb : kfn_range) { BOOST_CHECK(nghb.second <= last_dist); kfn_result.push_back(nghb.second); last_dist = nghb.second; diff --git a/src/Subsampling/doc/Intro_subsampling.h b/src/Subsampling/doc/Intro_subsampling.h index 1c84fb2e..1c366fe6 100644 --- a/src/Subsampling/doc/Intro_subsampling.h +++ b/src/Subsampling/doc/Intro_subsampling.h @@ -32,20 +32,20 @@ namespace subsampling { * squared distance between any two points * is greater than or equal to 0.4. * - * \include Subsampling/example_sparsify_point_set.cpp + * \include example_sparsify_point_set.cpp * * \section farthestpointexamples Example: choose_n_farthest_points * * This example outputs a subset of 100 points obtained by González algorithm, * starting with a random point. * - * \include Subsampling/example_choose_n_farthest_points.cpp + * \include example_choose_n_farthest_points.cpp * * \section randompointexamples Example: pick_n_random_points * * This example outputs a subset of 100 points picked randomly. * - * \include Subsampling/example_pick_n_random_points.cpp + * \include example_pick_n_random_points.cpp */ /** @} */ // end defgroup subsampling diff --git a/src/Subsampling/include/gudhi/choose_n_farthest_points.h b/src/Subsampling/include/gudhi/choose_n_farthest_points.h index e6347d96..44c02df1 100644 --- a/src/Subsampling/include/gudhi/choose_n_farthest_points.h +++ b/src/Subsampling/include/gudhi/choose_n_farthest_points.h @@ -42,7 +42,7 @@ enum : std::size_t { * The iteration starts with the landmark `starting point` or, if `starting point==random_starting_point`, * with a random landmark. * It chooses `final_size` points from a random access range - * `input_pts` (or the number of distinct points if `final_size` is larger) + * `input_pts` (or the number of input points if `final_size` is larger) * and outputs them in the output iterator `output_it`. It also * outputs the distance from each of those points to the set of previous * points in `dist_it`. @@ -88,34 +88,57 @@ void choose_n_farthest_points(Distance dist, starting_point = dis(gen); } - std::size_t current_number_of_landmarks = 0; // counter for landmarks - static_assert(std::numeric_limits<double>::has_infinity, "the number type needs to support infinity()"); // FIXME: don't hard-code the type as double. For Epeck_d, we also want to handle types that do not have an infinity. - const double infty = std::numeric_limits<double>::infinity(); // infinity (see next entry) - std::vector< double > dist_to_L(nb_points, infty); // vector of current distances to L from input_pts + static_assert(std::numeric_limits<double>::has_infinity, "the number type needs to support infinity()"); + + *output_it++ = input_pts[starting_point]; + *dist_it++ = std::numeric_limits<double>::infinity(); + if (final_size == 1) return; + + std::vector<std::size_t> points(nb_points); // map from remaining points to indexes in input_pts + std::vector< double > dist_to_L(nb_points); // vector of current distances to L from points + for(std::size_t i = 0; i < nb_points; ++i) { + points[i] = i; + dist_to_L[i] = dist(input_pts[i], input_pts[starting_point]); + } + // The indirection through points makes the program a bit slower. Some alternatives: + // - the original code never removed points and counted on them not + // reappearing because of a self-distance of 0. This causes unnecessary + // computations when final_size is large. It also causes trouble if there are + // input points at distance 0 from each other. + // - copy input_pts and update the local copy when removing points. std::size_t curr_max_w = starting_point; - for (current_number_of_landmarks = 0; current_number_of_landmarks != final_size; current_number_of_landmarks++) { - // curr_max_w at this point is the next landmark - *output_it++ = input_pts[curr_max_w]; - *dist_it++ = dist_to_L[curr_max_w]; + for (std::size_t current_number_of_landmarks = 1; current_number_of_landmarks != final_size; current_number_of_landmarks++) { + std::size_t latest_landmark = points[curr_max_w]; + // To remove the latest landmark at index curr_max_w, replace it + // with the last point and reduce the length of the vector. + std::size_t last = points.size() - 1; + if (curr_max_w != last) { + points[curr_max_w] = points[last]; + dist_to_L[curr_max_w] = dist_to_L[last]; + } + points.pop_back(); + + // Update distances to L. std::size_t i = 0; - for (auto&& p : input_pts) { - double curr_dist = dist(p, input_pts[curr_max_w]); + for (auto p : points) { + double curr_dist = dist(input_pts[p], input_pts[latest_landmark]); if (curr_dist < dist_to_L[i]) dist_to_L[i] = curr_dist; ++i; } - // choose the next curr_max_w - double curr_max_dist = 0; // used for defining the furhest point from L - for (i = 0; i < dist_to_L.size(); i++) + // choose the next landmark + curr_max_w = 0; + double curr_max_dist = dist_to_L[curr_max_w]; // used for defining the furthest point from L + for (i = 1; i < points.size(); i++) if (dist_to_L[i] > curr_max_dist) { curr_max_dist = dist_to_L[i]; curr_max_w = i; } - // If all that remains are duplicates of points already taken, stop. - if (curr_max_dist == 0) break; + *output_it++ = input_pts[points[curr_max_w]]; + *dist_it++ = dist_to_L[curr_max_w]; } } diff --git a/src/Subsampling/include/gudhi/sparsify_point_set.h b/src/Subsampling/include/gudhi/sparsify_point_set.h index 4571b8f3..b325fe3c 100644 --- a/src/Subsampling/include/gudhi/sparsify_point_set.h +++ b/src/Subsampling/include/gudhi/sparsify_point_set.h @@ -11,12 +11,7 @@ #ifndef SPARSIFY_POINT_SET_H_ #define SPARSIFY_POINT_SET_H_ -#include <boost/version.hpp> -#if BOOST_VERSION < 106600 -# include <boost/function_output_iterator.hpp> -#else # include <boost/iterator/function_output_iterator.hpp> -#endif #include <gudhi/Kd_tree_search.h> #ifdef GUDHI_SUBSAMPLING_PROFILING diff --git a/src/Subsampling/test/test_choose_n_farthest_points.cpp b/src/Subsampling/test/test_choose_n_farthest_points.cpp index 94793295..c384c61b 100644 --- a/src/Subsampling/test/test_choose_n_farthest_points.cpp +++ b/src/Subsampling/test/test_choose_n_farthest_points.cpp @@ -102,11 +102,12 @@ BOOST_AUTO_TEST_CASE_TEMPLATE(test_choose_farthest_point_limits, Kernel, list_of BOOST_CHECK(distances[1] == 1); landmarks.clear(); distances.clear(); - // Ignore duplicated points + // Accept duplicated points points.emplace_back(point.begin(), point.end()); Gudhi::subsampling::choose_n_farthest_points(d, points, -1, -1, std::back_inserter(landmarks), std::back_inserter(distances)); - BOOST_CHECK(landmarks.size() == 2 && distances.size() == 2); + BOOST_CHECK(landmarks.size() == 3 && distances.size() == 3); BOOST_CHECK(distances[0] == std::numeric_limits<FT>::infinity()); BOOST_CHECK(distances[1] == 1); + BOOST_CHECK(distances[2] == 0); landmarks.clear(); distances.clear(); } diff --git a/src/Tangential_complex/benchmark/XML_exporter.h b/src/Tangential_complex/benchmark/XML_exporter.h index 16b62eb6..38fe049f 100644 --- a/src/Tangential_complex/benchmark/XML_exporter.h +++ b/src/Tangential_complex/benchmark/XML_exporter.h @@ -157,7 +157,7 @@ class Streaming_XML_exporter { m_xml_fstream << " </" << m_element_name << ">" << std::endl; // Save current pointer position - std::ofstream::streampos pos = m_xml_fstream.tellp(); + auto pos = m_xml_fstream.tellp(); // Close the XML file (temporarily) so that the XML file is always correct m_xml_fstream << "</" << m_list_name << ">" << std::endl; // Restore the pointer position so that the next "add_element" will overwrite diff --git a/src/Tangential_complex/benchmark/benchmark_tc.cpp b/src/Tangential_complex/benchmark/benchmark_tc.cpp index e3b2a04f..8e7c72ff 100644 --- a/src/Tangential_complex/benchmark/benchmark_tc.cpp +++ b/src/Tangential_complex/benchmark/benchmark_tc.cpp @@ -33,6 +33,7 @@ const std::size_t ONLY_LOAD_THE_FIRST_N_POINTS = 20000000; #include <gudhi/sparsify_point_set.h> #include <gudhi/random_point_generators.h> #include <gudhi/Tangential_complex/utilities.h> +#include <gudhi/Simplex_tree.h> #include <CGAL/assertions_behaviour.h> #include <CGAL/Epick_d.h> @@ -704,7 +705,7 @@ int main() { points = Gudhi::generate_points_on_torus_d<Kernel>( num_points, intrinsic_dim, - param1 == "Y", // uniform + (param1 == "Y") ? "grid" : "random", // grid or random sample type std::atof(param2.c_str())); // radius_noise_percentage } else if (input == "generate_klein_bottle_3D") { points = Gudhi::generate_points_on_klein_bottle_3D<Kernel>( diff --git a/src/Tangential_complex/doc/Intro_tangential_complex.h b/src/Tangential_complex/doc/Intro_tangential_complex.h index ce277185..cb8c6122 100644 --- a/src/Tangential_complex/doc/Intro_tangential_complex.h +++ b/src/Tangential_complex/doc/Intro_tangential_complex.h @@ -88,7 +88,7 @@ This example builds the Tangential complex of point set. Note that the dimension of the kernel here is dynamic, which is slower, but more flexible: the intrinsic and ambient dimensions does not have to be known at compile-time. -\include Tangential_complex/example_basic.cpp +\include example_basic.cpp \section example_with_perturb Example with perturbation @@ -97,7 +97,7 @@ by perturbing the positions of points involved in inconsistent simplices. Note that the dimension of the kernel here is static, which is the best choice when the dimensions are known at compile-time. -\include Tangential_complex/example_with_perturb.cpp +\include example_with_perturb.cpp */ /** @} */ // end defgroup tangential_complex diff --git a/src/Tangential_complex/example/example_basic.cpp b/src/Tangential_complex/example/example_basic.cpp index ab35edf0..c50b9b8c 100644 --- a/src/Tangential_complex/example/example_basic.cpp +++ b/src/Tangential_complex/example/example_basic.cpp @@ -1,7 +1,6 @@ #include <gudhi/Tangential_complex.h> #include <gudhi/sparsify_point_set.h> -//#include <gudhi/Fake_simplex_tree.h> - +#include <gudhi/Simplex_tree.h> #include <CGAL/Epick_d.h> #include <CGAL/Random.h> @@ -39,7 +38,6 @@ int main(void) { // Export the TC into a Simplex_tree Gudhi::Simplex_tree<> stree; - //Gudhi::Fake_simplex_tree stree; tc.create_complex(stree); // Display stats about inconsistencies diff --git a/src/Tangential_complex/example/example_with_perturb.cpp b/src/Tangential_complex/example/example_with_perturb.cpp index d0d877ea..e70e2980 100644 --- a/src/Tangential_complex/example/example_with_perturb.cpp +++ b/src/Tangential_complex/example/example_with_perturb.cpp @@ -1,5 +1,6 @@ #include <gudhi/Tangential_complex.h> #include <gudhi/sparsify_point_set.h> +#include <gudhi/Simplex_tree.h> #include <CGAL/Epick_d.h> #include <CGAL/Random.h> diff --git a/src/Tangential_complex/include/gudhi/Tangential_complex.h b/src/Tangential_complex/include/gudhi/Tangential_complex.h index f3491f91..ab203ca5 100644 --- a/src/Tangential_complex/include/gudhi/Tangential_complex.h +++ b/src/Tangential_complex/include/gudhi/Tangential_complex.h @@ -36,7 +36,6 @@ #include <Eigen/Eigen> #include <Eigen/src/Core/util/Macros.h> // for EIGEN_VERSION_AT_LEAST -#include <boost/optional.hpp> #include <boost/iterator/transform_iterator.hpp> #include <boost/range/adaptor/transformed.hpp> #include <boost/range/counting_range.hpp> @@ -56,6 +55,8 @@ #include <cmath> // for std::sqrt #include <string> #include <cstddef> // for std::size_t +#include <optional> +#include <numeric> // for std::iota #ifdef GUDHI_USE_TBB #include <tbb/parallel_for.h> @@ -345,10 +346,11 @@ class Tangential_complex { m_stars.resize(m_points.size()); m_squared_star_spheres_radii_incl_margin.resize(m_points.size(), FT(-1)); #ifdef GUDHI_TC_PERTURB_POSITION - if (m_points.empty()) + if (m_points.empty()) { m_translations.clear(); - else + } else { m_translations.resize(m_points.size(), m_k.construct_vector_d_object()(m_ambient_dim)); + } #if defined(GUDHI_USE_TBB) delete[] m_p_perturb_mutexes; m_p_perturb_mutexes = new Mutex_for_perturb[m_points.size()]; @@ -623,6 +625,11 @@ class Tangential_complex { int max_dim = -1; + // Ordered vertices to be inserted first by the create_complex method to avoid quadratic complexity. + std::vector<typename Simplex_tree_::Vertex_handle> vertices(m_points.size()); + std::iota(vertices.begin(), vertices.end(), 0); + tree.insert_batch_vertices(vertices); + // For each triangulation for (std::size_t idx = 0; idx < m_points.size(); ++idx) { // For each cell of the star @@ -994,7 +1001,7 @@ class Tangential_complex { // circumspheres of the star of "center_vertex" // If th the m_max_squared_edge_length is set the maximal radius of the "star sphere" // is at most square root of m_max_squared_edge_length - boost::optional<FT> squared_star_sphere_radius_plus_margin = m_max_squared_edge_length; + std::optional<FT> squared_star_sphere_radius_plus_margin = m_max_squared_edge_length; // Insert points until we find a point which is outside "star sphere" for (auto nn_it = ins_range.begin(); nn_it != ins_range.end(); ++nn_it) { @@ -1036,7 +1043,7 @@ class Tangential_complex { // Let's recompute squared_star_sphere_radius_plus_margin if (triangulation.current_dimension() >= tangent_space_dim) { - squared_star_sphere_radius_plus_margin = boost::none; + squared_star_sphere_radius_plus_margin = std::nullopt; // Get the incident cells and look for the biggest circumsphere std::vector<Tr_full_cell_handle> incident_cells; triangulation.incident_full_cells(center_vertex, std::back_inserter(incident_cells)); @@ -1044,7 +1051,7 @@ class Tangential_complex { cit != incident_cells.end(); ++cit) { Tr_full_cell_handle cell = *cit; if (triangulation.is_infinite(cell)) { - squared_star_sphere_radius_plus_margin = boost::none; + squared_star_sphere_radius_plus_margin = std::nullopt; break; } else { // Note that this uses the perturbed point since it uses @@ -1152,7 +1159,7 @@ class Tangential_complex { #ifdef GUDHI_TC_VERY_VERBOSE std::cerr << "Inserted " << num_inserted_points << " points / " << num_attempts_to_insert_points - << " attemps to compute the star\n"; + << " attempts to compute the star\n"; #endif update_star(i); @@ -2030,7 +2037,7 @@ class Tangential_complex { // and their center vertex Stars_container m_stars; std::vector<FT> m_squared_star_spheres_radii_incl_margin; - boost::optional<FT> m_max_squared_edge_length; + std::optional<FT> m_max_squared_edge_length; #ifdef GUDHI_TC_USE_ANOTHER_POINT_SET_FOR_TANGENT_SPACE_ESTIM Points m_points_for_tse; diff --git a/src/Tangential_complex/test/test_tangential_complex.cpp b/src/Tangential_complex/test/test_tangential_complex.cpp index 023c1e1a..a24b9ae2 100644 --- a/src/Tangential_complex/test/test_tangential_complex.cpp +++ b/src/Tangential_complex/test/test_tangential_complex.cpp @@ -14,6 +14,7 @@ #include <gudhi/Tangential_complex.h> #include <gudhi/sparsify_point_set.h> +#include <gudhi/Simplex_tree.h> #include <CGAL/Epick_d.h> #include <CGAL/Random.h> diff --git a/src/Toplex_map/benchmark/CMakeLists.txt b/src/Toplex_map/benchmark/CMakeLists.txt index 2d58a156..6703d9d0 100644 --- a/src/Toplex_map/benchmark/CMakeLists.txt +++ b/src/Toplex_map/benchmark/CMakeLists.txt @@ -1,3 +1,7 @@ project(Toplex_map_benchmark) add_executable(Toplex_map_benchmark benchmark_tm.cpp) + +if (TBB_FOUND) + target_link_libraries(Toplex_map_benchmark ${TBB_LIBRARIES}) +endif() diff --git a/src/Witness_complex/doc/Witness_complex_doc.h b/src/Witness_complex/doc/Witness_complex_doc.h index 202f4539..c66b106e 100644 --- a/src/Witness_complex/doc/Witness_complex_doc.h +++ b/src/Witness_complex/doc/Witness_complex_doc.h @@ -108,14 +108,14 @@ int main(int argc, char * const argv[]) { Here is an example of constructing a strong witness complex filtration and computing persistence on it: - \include Witness_complex/strong_witness_persistence.cpp + \include strong_witness_persistence.cpp \section witnessexample3 Example3: Computing relaxed witness complex persistence from a distance matrix In this example we compute the relaxed witness complex persistence from a given matrix of closest landmarks to each witness. Each landmark is given as the couple (index, distance). - \include Witness_complex/example_nearest_landmark_table.cpp + \include example_nearest_landmark_table.cpp */ diff --git a/src/Witness_complex/include/gudhi/Active_witness/Active_witness.h b/src/Witness_complex/include/gudhi/Active_witness/Active_witness.h index 2ae1d6e0..1aebb045 100644 --- a/src/Witness_complex/include/gudhi/Active_witness/Active_witness.h +++ b/src/Witness_complex/include/gudhi/Active_witness/Active_witness.h @@ -18,7 +18,7 @@ namespace Gudhi { namespace witness_complex { - /* \class Active_witness + /** \class Active_witness * \brief Class representing a list of nearest neighbors to a given witness. * \details Every element is a pair of a landmark identifier and the squared distance to it. */ diff --git a/src/Witness_complex/include/gudhi/Active_witness/Active_witness_iterator.h b/src/Witness_complex/include/gudhi/Active_witness/Active_witness_iterator.h index 4f8fddba..18f19650 100644 --- a/src/Witness_complex/include/gudhi/Active_witness/Active_witness_iterator.h +++ b/src/Witness_complex/include/gudhi/Active_witness/Active_witness_iterator.h @@ -18,7 +18,7 @@ namespace Gudhi { namespace witness_complex { -/* \brief Iterator in the nearest landmark list. +/** \brief Iterator in the nearest landmark list. * \details After the iterator reaches the end of the list, * the list is augmented by a (nearest landmark, distance) pair if possible. * If all the landmarks are present in the list, iterator returns the specific end value diff --git a/src/Witness_complex/include/gudhi/Strong_witness_complex.h b/src/Witness_complex/include/gudhi/Strong_witness_complex.h index b3699f77..ddc0da32 100644 --- a/src/Witness_complex/include/gudhi/Strong_witness_complex.h +++ b/src/Witness_complex/include/gudhi/Strong_witness_complex.h @@ -125,7 +125,7 @@ class Strong_witness_complex { //@} private: - /* \brief Adds recursively all the faces of a certain dimension dim-1 witnessed by the same witness. + /** \brief Adds recursively all the faces of a certain dimension dim-1 witnessed by the same witness. * Iterator is needed to know until how far we can take landmarks to form simplexes. * simplex is the prefix of the simplexes to insert. * The landmark pointed by aw_it is added to all formed simplices. diff --git a/src/Witness_complex/include/gudhi/Witness_complex.h b/src/Witness_complex/include/gudhi/Witness_complex.h index d655c7f6..66ae7af2 100644 --- a/src/Witness_complex/include/gudhi/Witness_complex.h +++ b/src/Witness_complex/include/gudhi/Witness_complex.h @@ -127,7 +127,7 @@ class Witness_complex { //@} private: - /* \brief Adds recursively all the faces of a certain dimension dim witnessed by the same witness. + /** \brief Adds recursively all the faces of a certain dimension dim witnessed by the same witness. * Iterator is needed to know until how far we can take landmarks to form simplexes. * simplex is the prefix of the simplexes to insert. * The output value indicates if the witness rests active or not. diff --git a/src/Witness_complex/include/gudhi/Witness_complex/all_faces_in.h b/src/Witness_complex/include/gudhi/Witness_complex/all_faces_in.h index 5845728a..007ab084 100644 --- a/src/Witness_complex/include/gudhi/Witness_complex/all_faces_in.h +++ b/src/Witness_complex/include/gudhi/Witness_complex/all_faces_in.h @@ -11,7 +11,7 @@ #ifndef WITNESS_COMPLEX_ALL_FACES_IN_H_ #define WITNESS_COMPLEX_ALL_FACES_IN_H_ -/* \brief Check if the facets of the k-dimensional simplex witnessed +/** \brief Check if the facets of the k-dimensional simplex witnessed * by witness witness_id are already in the complex. * inserted_vertex is the handle of the (k+1)-th vertex witnessed by witness_id */ diff --git a/src/Witness_complex/utilities/strong_witness_persistence.cpp b/src/Witness_complex/utilities/strong_witness_persistence.cpp index 614de0d4..b2ecad82 100644 --- a/src/Witness_complex/utilities/strong_witness_persistence.cpp +++ b/src/Witness_complex/utilities/strong_witness_persistence.cpp @@ -108,7 +108,7 @@ void program_options(int argc, char* argv[], int& nbL, std::string& file_name, s visible.add_options()("help,h", "produce help message")("landmarks,l", po::value<int>(&nbL), "Number of landmarks to choose from the point cloud.")( "output-file,o", po::value<std::string>(&filediag)->default_value(std::string()), - "Name of file in which the persistence diagram is written. Default print in std::clog")( + "Name of file in which the persistence diagram is written. Default print in standard output")( "max-sq-alpha,a", po::value<Filtration_value>(&max_squared_alpha)->default_value(default_alpha), "Maximal squared relaxation parameter.")( "field-charac,p", po::value<int>(&p)->default_value(11), diff --git a/src/Witness_complex/utilities/weak_witness_persistence.cpp b/src/Witness_complex/utilities/weak_witness_persistence.cpp index 5ea31d6b..c7ead7de 100644 --- a/src/Witness_complex/utilities/weak_witness_persistence.cpp +++ b/src/Witness_complex/utilities/weak_witness_persistence.cpp @@ -108,7 +108,7 @@ void program_options(int argc, char* argv[], int& nbL, std::string& file_name, s visible.add_options()("help,h", "produce help message")("landmarks,l", po::value<int>(&nbL), "Number of landmarks to choose from the point cloud.")( "output-file,o", po::value<std::string>(&filediag)->default_value(std::string()), - "Name of file in which the persistence diagram is written. Default print in std::clog")( + "Name of file in which the persistence diagram is written. Default print in standard output")( "max-sq-alpha,a", po::value<Filtration_value>(&max_squared_alpha)->default_value(default_alpha), "Maximal squared relaxation parameter.")( "field-charac,p", po::value<int>(&p)->default_value(11), diff --git a/src/Witness_complex/utilities/witnesscomplex.md b/src/Witness_complex/utilities/witnesscomplex.md index 3a3a7d83..e994e0b8 100644 --- a/src/Witness_complex/utilities/witnesscomplex.md +++ b/src/Witness_complex/utilities/witnesscomplex.md @@ -29,7 +29,7 @@ and `p` is the characteristic of the field *Z/pZ* used for homology coefficients * `-h [ --help ]` Produce help message
* `-l [ --landmarks ]` Number of landmarks to choose from the point cloud.
-* `-o [ --output-file ]` Name of file in which the persistence diagram is written. By default, print in std::clog.
+* `-o [ --output-file ]` Name of file in which the persistence diagram is written. By default, print in standard output.
* `-a [ --max-sq-alpha ]` (default = inf) Maximal squared relaxation parameter.
* `-p [ --field-charac ]` (default = 11) Characteristic p of the coefficient field Z/pZ for computing homology.
* `-m [ --min-persistence ]` (default = 0) Minimal lifetime of homology feature to be recorded. Enter a negative value to see zero length intervals.
@@ -60,7 +60,7 @@ and `p` is the characteristic of the field *Z/pZ* used for homology coefficients * `-h [ --help ]` Produce help message
* `-l [ --landmarks ]` Number of landmarks to choose from the point cloud.
-* `-o [ --output-file ]` Name of file in which the persistence diagram is written. By default, print in std::clog.
+* `-o [ --output-file ]` Name of file in which the persistence diagram is written. By default, print in standard output.
* `-a [ --max-sq-alpha ]` (default = inf) Maximal squared relaxation parameter.
* `-p [ --field-charac ]` (default = 11) Characteristic p of the coefficient field Z/pZ for computing homology.
* `-m [ --min-persistence ]` (default = 0) Minimal lifetime of homology feature to be recorded. Enter a negative value to see zero length intervals.
diff --git a/src/cmake/modules/FindTBB.cmake b/src/cmake/modules/FindTBB.cmake index 13f4d929..e6c42dc7 100644 --- a/src/cmake/modules/FindTBB.cmake +++ b/src/cmake/modules/FindTBB.cmake @@ -34,7 +34,7 @@ # # GvdB: Mac OS X distribution places libraries directly in lib directory. # -# For backwards compatibility, you may explicitely set the CMake variables TBB_ARCHITECTURE and TBB_COMPILER. +# For backwards compatibility, you may explicitly set the CMake variables TBB_ARCHITECTURE and TBB_COMPILER. # TBB_ARCHITECTURE [ ia32 | em64t | itanium ] # which architecture to use # TBB_COMPILER e.g. vc9 or cc3.2.3_libc2.3.2_kernel2.4.21 or cc4.0.1_os10.4.9 @@ -54,8 +54,8 @@ # TBB_MALLOC_DEBUG_LIBRARY, the TBB debug malloc library # TBB_FOUND, If false, don't try to use TBB. # TBB_INTERFACE_VERSION, as defined in tbb/tbb_stddef.h -# TBB_MALLOCPROXY_DEBUG_LIBRARY, the TBB debug malloc_proxy library (not included in TBB_LIBRARIES since it's optionnal) -# TBB_MALLOCPROXY_RELEASE_LIBRARY, the TBB release malloc_proxy library (not included in TBB_LIBRARIES since it's optionnal) +# TBB_MALLOCPROXY_DEBUG_LIBRARY, the TBB debug malloc_proxy library (not included in TBB_LIBRARIES since it's optional) +# TBB_MALLOCPROXY_RELEASE_LIBRARY, the TBB release malloc_proxy library (not included in TBB_LIBRARIES since it's optional) include(CheckCXXSourceCompiles) diff --git a/src/cmake/modules/GUDHI_compilation_flags.cmake b/src/cmake/modules/GUDHI_compilation_flags.cmake index 567fbc40..b43ccf73 100644 --- a/src/cmake/modules/GUDHI_compilation_flags.cmake +++ b/src/cmake/modules/GUDHI_compilation_flags.cmake @@ -11,7 +11,8 @@ macro(add_cxx_compiler_flag _flag) endif() endmacro() -set (CMAKE_CXX_STANDARD 14) +set (CMAKE_CXX_STANDARD 17) +# This number needs to be changed in python/CMakeLists.txt at the same time enable_testing() diff --git a/src/cmake/modules/GUDHI_doxygen_target.cmake b/src/cmake/modules/GUDHI_doxygen_target.cmake index 7a84c4e0..327513da 100644 --- a/src/cmake/modules/GUDHI_doxygen_target.cmake +++ b/src/cmake/modules/GUDHI_doxygen_target.cmake @@ -8,14 +8,61 @@ if(DOXYGEN_FOUND) get_property(DOXYGEN_EXECUTABLE TARGET Doxygen::doxygen PROPERTY IMPORTED_LOCATION) endif() - add_custom_target(doxygen ${DOXYGEN_EXECUTABLE} ${GUDHI_USER_VERSION_DIR}/Doxyfile - WORKING_DIRECTORY ${GUDHI_USER_VERSION_DIR} - COMMENT "Generating API documentation with Doxygen in ${GUDHI_USER_VERSION_DIR}/doc/html/" VERBATIM) + message("++ Project = ${CMAKE_PROJECT_NAME}") + if (CMAKE_PROJECT_NAME STREQUAL "GUDHIdev") + # Set Doxyfile.in variables for the developer version + set(GUDHI_DOXYGEN_SOURCE_PREFIX "${CMAKE_SOURCE_DIR}/src") + foreach(GUDHI_MODULE ${GUDHI_MODULES_FULL_LIST}) + if(EXISTS "${GUDHI_DOXYGEN_SOURCE_PREFIX}/${GUDHI_MODULE}/doc/") + set(GUDHI_DOXYGEN_IMAGE_PATH "${GUDHI_DOXYGEN_IMAGE_PATH} ${GUDHI_DOXYGEN_SOURCE_PREFIX}/${GUDHI_MODULE}/doc/ \\ \n") + endif() + if(EXISTS "${GUDHI_DOXYGEN_SOURCE_PREFIX}/${GUDHI_MODULE}/example/") + set(GUDHI_DOXYGEN_EXAMPLE_PATH "${GUDHI_DOXYGEN_EXAMPLE_PATH} ${GUDHI_DOXYGEN_SOURCE_PREFIX}/${GUDHI_MODULE}/example/ \\ \n") + endif() + if(EXISTS "${GUDHI_DOXYGEN_SOURCE_PREFIX}/${GUDHI_MODULE}/utilities/") + set(GUDHI_DOXYGEN_EXAMPLE_PATH "${GUDHI_DOXYGEN_EXAMPLE_PATH} ${GUDHI_DOXYGEN_SOURCE_PREFIX}/${GUDHI_MODULE}/utilities/ \\ \n") + endif() + endforeach(GUDHI_MODULE ${GUDHI_MODULES_FULL_LIST}) + set(GUDHI_DOXYGEN_COMMON_DOC_PATH "${GUDHI_DOXYGEN_SOURCE_PREFIX}/common/doc") + set(GUDHI_DOXYGEN_UTILS_PATH "*/utilities") + endif() + if (CMAKE_PROJECT_NAME STREQUAL "GUDHI") + # Set Doxyfile.in variables for the user version + set(GUDHI_DOXYGEN_SOURCE_PREFIX "${CMAKE_SOURCE_DIR}") + foreach(GUDHI_MODULE ${GUDHI_MODULES_FULL_LIST}) + if(EXISTS "${GUDHI_DOXYGEN_SOURCE_PREFIX}/doc/${GUDHI_MODULE}") + set(GUDHI_DOXYGEN_IMAGE_PATH "${GUDHI_DOXYGEN_IMAGE_PATH} ${GUDHI_DOXYGEN_SOURCE_PREFIX}/doc/${GUDHI_MODULE}/ \\ \n") + endif() + if(EXISTS "${GUDHI_DOXYGEN_SOURCE_PREFIX}/example/${GUDHI_MODULE}") + set(GUDHI_DOXYGEN_EXAMPLE_PATH "${GUDHI_DOXYGEN_EXAMPLE_PATH} ${GUDHI_DOXYGEN_SOURCE_PREFIX}/example/${GUDHI_MODULE}/ \\ \n") + endif() + if(EXISTS "${GUDHI_DOXYGEN_SOURCE_PREFIX}/utilities/${GUDHI_MODULE}") + set(GUDHI_DOXYGEN_EXAMPLE_PATH "${GUDHI_DOXYGEN_EXAMPLE_PATH} ${GUDHI_DOXYGEN_SOURCE_PREFIX}/utilities/${GUDHI_MODULE}/ \\ \n") + endif() + endforeach(GUDHI_MODULE ${GUDHI_MODULES_FULL_LIST}) + set(GUDHI_DOXYGEN_COMMON_DOC_PATH "${GUDHI_DOXYGEN_SOURCE_PREFIX}/doc/common") + set(GUDHI_DOXYGEN_UTILS_PATH "utilities/*") + endif() - if(TARGET user_version) - # In dev version, doxygen target depends on user_version target. Not existing in user version - add_dependencies(doxygen user_version) + message("++ Doxygen version ${DOXYGEN_VERSION}") + if (DOXYGEN_VERSION VERSION_LESS 1.9.3) + set(GUDHI_DOXYGEN_CLASS_DIAGRAMS "CLASS_DIAGRAMS = NO") + else() + set(GUDHI_DOXYGEN_CLASS_DIAGRAMS "") + endif() + if (DOXYGEN_VERSION VERSION_LESS 1.9.2) + set(GUDHI_DOXYGEN_MATHJAX_VERSION "MATHJAX_VERSION = MathJax_2") + set(GUDHI_DOXYGEN_MATHJAX_EXTENSIONS "TeX/AMSmath TeX/AMSsymbols") + else() + set(GUDHI_DOXYGEN_MATHJAX_VERSION "MATHJAX_VERSION = MathJax_3") + set(GUDHI_DOXYGEN_MATHJAX_EXTENSIONS "ams") endif() + + configure_file(${GUDHI_DOXYGEN_SOURCE_PREFIX}/Doxyfile.in "${CMAKE_CURRENT_BINARY_DIR}/Doxyfile" @ONLY) + + add_custom_target(doxygen ${DOXYGEN_EXECUTABLE} ${CMAKE_CURRENT_BINARY_DIR}/Doxyfile + WORKING_DIRECTORY ${CMAKE_CURRENT_BINARY_DIR} + COMMENT "Generating API documentation with Doxygen in 'html' directory" VERBATIM) else() set(GUDHI_MISSING_MODULES ${GUDHI_MISSING_MODULES} "cpp-documentation" CACHE INTERNAL "GUDHI_MISSING_MODULES") endif() diff --git a/src/cmake/modules/GUDHI_modules.cmake b/src/cmake/modules/GUDHI_modules.cmake index ccaf1ac5..ec1f756b 100644 --- a/src/cmake/modules/GUDHI_modules.cmake +++ b/src/cmake/modules/GUDHI_modules.cmake @@ -2,7 +2,7 @@ set(GUDHI_MODULES_FULL_LIST "") function(add_gudhi_module file_path) - option("WITH_MODULE_GUDHI_${file_path}" "Activate/desactivate ${file_path} compilation and installation" ON) + option("WITH_MODULE_GUDHI_${file_path}" "Activate/deactivate ${file_path} compilation and installation" ON) if (WITH_MODULE_GUDHI_${file_path}) set(GUDHI_MODULES ${GUDHI_MODULES} ${file_path} CACHE INTERNAL "GUDHI_MODULES") else() @@ -10,19 +10,13 @@ function(add_gudhi_module file_path) endif() # Required by user_version set(GUDHI_MODULES_FULL_LIST ${GUDHI_MODULES_FULL_LIST} ${file_path} PARENT_SCOPE) - # Include module headers is independant - You may ask for no Alpha complex module but Python interface i.e. + # Include module headers is independent - You may ask for no Alpha complex module but Python interface i.e. if(IS_DIRECTORY ${CMAKE_SOURCE_DIR}/src/${file_path}/include/) include_directories(src/${file_path}/include/) endif() endfunction(add_gudhi_module) -option(WITH_GUDHI_BENCHMARK "Activate/desactivate benchmark compilation" OFF) -option(WITH_GUDHI_EXAMPLE "Activate/desactivate examples compilation and installation" OFF) -option(WITH_GUDHI_PYTHON "Activate/desactivate python module compilation and installation" ON) -option(WITH_GUDHI_TEST "Activate/desactivate examples compilation and installation" ON) -option(WITH_GUDHI_UTILITIES "Activate/desactivate utilities compilation and installation" ON) - if (WITH_GUDHI_BENCHMARK) set(GUDHI_SUB_DIRECTORIES "${GUDHI_SUB_DIRECTORIES};benchmark") endif() diff --git a/src/cmake/modules/GUDHI_options.cmake b/src/cmake/modules/GUDHI_options.cmake new file mode 100644 index 00000000..8379e3c6 --- /dev/null +++ b/src/cmake/modules/GUDHI_options.cmake @@ -0,0 +1,15 @@ +option(WITH_GUDHI_BENCHMARK "Activate/deactivate benchmark compilation" OFF) +option(WITH_GUDHI_EXAMPLE "Activate/deactivate examples compilation and installation" OFF) +option(WITH_GUDHI_REMOTE_TEST "Activate/deactivate datasets fetching test which uses the Internet" OFF) +option(WITH_GUDHI_PYTHON "Activate/deactivate python module compilation and installation" ON) +option(WITH_GUDHI_TEST "Activate/deactivate examples compilation and installation" ON) +option(WITH_GUDHI_UTILITIES "Activate/deactivate utilities compilation and installation" ON) +option(WITH_GUDHI_THIRD_PARTY "Activate/deactivate third party libraries cmake detection. When set to OFF, it is useful for doxygen or user_version i.e." ON) + +if (NOT WITH_GUDHI_THIRD_PARTY) + set (WITH_GUDHI_BENCHMARK OFF) + set (WITH_GUDHI_EXAMPLE OFF) + set (WITH_GUDHI_PYTHON OFF) + set (WITH_GUDHI_TEST OFF) + set (WITH_GUDHI_UTILITIES OFF) +endif() diff --git a/src/cmake/modules/GUDHI_submodules.cmake b/src/cmake/modules/GUDHI_submodules.cmake new file mode 100644 index 00000000..9ede852d --- /dev/null +++ b/src/cmake/modules/GUDHI_submodules.cmake @@ -0,0 +1,5 @@ +# For those who dislike bundled dependencies, this indicates where to find a preinstalled Hera. +set(HERA_INTERNAL_INCLUDE_DIR ${CMAKE_SOURCE_DIR}/ext/hera/include) +set(HERA_INCLUDE_DIR ${HERA_INTERNAL_INCLUDE_DIR} CACHE PATH "Directory where one can find hera/{wasserstein.h,bottleneck.h}") +# since everything is cleanly under include/hera/, there is no harm always including it +include_directories(${HERA_INCLUDE_DIR}) diff --git a/src/cmake/modules/GUDHI_third_party_libraries.cmake b/src/cmake/modules/GUDHI_third_party_libraries.cmake index e1566877..2cf6787e 100644 --- a/src/cmake/modules/GUDHI_third_party_libraries.cmake +++ b/src/cmake/modules/GUDHI_third_party_libraries.cmake @@ -1,11 +1,14 @@ # This files manage third party libraries required by GUDHI -find_package(Boost 1.56.0 QUIET OPTIONAL_COMPONENTS filesystem unit_test_framework program_options) +find_package(Boost 1.66.0 QUIET OPTIONAL_COMPONENTS filesystem unit_test_framework program_options) # Boost_FOUND is not reliable if(NOT Boost_VERSION) message(FATAL_ERROR "NOTICE: This program requires Boost and will not be compiled.") endif(NOT Boost_VERSION) +include_directories(${Boost_INCLUDE_DIRS}) +message(STATUS "boost include dirs:" ${Boost_INCLUDE_DIRS}) +message(STATUS "boost library dirs:" ${Boost_LIBRARY_DIRS}) find_package(GMP) if(GMP_FOUND) @@ -16,6 +19,15 @@ if(GMP_FOUND) endif() endif() +# from windows vcpkg eigen 3.4.0#2 : build fails with +# error C2440: '<function-style-cast>': cannot convert from 'Eigen::EigenBase<Derived>::Index' to '__gmp_expr<mpq_t,mpq_t>' +# cf. https://gitlab.com/libeigen/eigen/-/issues/2476 +# Workaround is to compile with '-DEIGEN_DEFAULT_DENSE_INDEX_TYPE=int' +if (FORCE_EIGEN_DEFAULT_DENSE_INDEX_TYPE_TO_INT) + message("++ User explicit demand to force EIGEN_DEFAULT_DENSE_INDEX_TYPE to int") + add_definitions(-DEIGEN_DEFAULT_DENSE_INDEX_TYPE=int) +endif() + # In CMakeLists.txt, when include(${CGAL_USE_FILE}), CMAKE_CXX_FLAGS are overwritten. # cf. http://doc.cgal.org/latest/Manual/installation.html#title40 # A workaround is to include(${CGAL_USE_FILE}) before adding "-std=c++11". @@ -36,12 +48,6 @@ if(CGAL_FOUND) include( ${CGAL_USE_FILE} ) endif() -# For those who dislike bundled dependencies, this indicates where to find a preinstalled Hera. -set(HERA_WASSERSTEIN_INTERNAL_INCLUDE_DIR ${CMAKE_SOURCE_DIR}/ext/hera/wasserstein/include) -set(HERA_WASSERSTEIN_INCLUDE_DIR ${HERA_WASSERSTEIN_INTERNAL_INCLUDE_DIR} CACHE PATH "Directory where one can find Hera's wasserstein.h") -set(HERA_BOTTLENECK_INTERNAL_INCLUDE_DIR ${CMAKE_SOURCE_DIR}/ext/hera/bottleneck/include) -set(HERA_BOTTLENECK_INCLUDE_DIR ${HERA_BOTTLENECK_INTERNAL_INCLUDE_DIR} CACHE PATH "Directory where one can find Hera's bottleneck.h") - option(WITH_GUDHI_USE_TBB "Build with Intel TBB parallelization" ON) # Find TBB package for parallel sort - not mandatory, just optional. @@ -89,92 +95,92 @@ add_definitions( -DBOOST_ALL_DYN_LINK ) # problem on Mac with boost_system and boost_thread add_definitions( -DBOOST_SYSTEM_NO_DEPRECATED ) -message(STATUS "boost include dirs:" ${Boost_INCLUDE_DIRS}) -message(STATUS "boost library dirs:" ${Boost_LIBRARY_DIRS}) - -# Find the correct Python interpreter. -# Can be set with -DPYTHON_EXECUTABLE=/usr/bin/python3 or -DPython_ADDITIONAL_VERSIONS=3 for instance. -find_package( PythonInterp ) - -# find_python_module tries to import module in Python interpreter and to retrieve its version number -# returns ${PYTHON_MODULE_NAME_UP}_VERSION and ${PYTHON_MODULE_NAME_UP}_FOUND -function( find_python_module PYTHON_MODULE_NAME ) - string(TOUPPER ${PYTHON_MODULE_NAME} PYTHON_MODULE_NAME_UP) - execute_process( - COMMAND ${PYTHON_EXECUTABLE} -c "import ${PYTHON_MODULE_NAME}; print(${PYTHON_MODULE_NAME}.__version__)" - RESULT_VARIABLE PYTHON_MODULE_RESULT - OUTPUT_VARIABLE PYTHON_MODULE_VERSION - ERROR_VARIABLE PYTHON_MODULE_ERROR) - if(PYTHON_MODULE_RESULT EQUAL 0) - # Remove all carriage returns as it can be multiline - string(REGEX REPLACE "\n" " " PYTHON_MODULE_VERSION "${PYTHON_MODULE_VERSION}") - message ("++ Python module ${PYTHON_MODULE_NAME} - Version ${PYTHON_MODULE_VERSION} found") - - set(${PYTHON_MODULE_NAME_UP}_VERSION ${PYTHON_MODULE_VERSION} PARENT_SCOPE) - set(${PYTHON_MODULE_NAME_UP}_FOUND TRUE PARENT_SCOPE) - else() - message ("PYTHON_MODULE_NAME = ${PYTHON_MODULE_NAME} - - PYTHON_MODULE_RESULT = ${PYTHON_MODULE_RESULT} - - PYTHON_MODULE_VERSION = ${PYTHON_MODULE_VERSION} - - PYTHON_MODULE_ERROR = ${PYTHON_MODULE_ERROR}") - unset(${PYTHON_MODULE_NAME_UP}_VERSION PARENT_SCOPE) - set(${PYTHON_MODULE_NAME_UP}_FOUND FALSE PARENT_SCOPE) +if (WITH_GUDHI_PYTHON) + # Find the correct Python interpreter. + # Can be set with -DPYTHON_EXECUTABLE=/usr/bin/python3 or -DPython_ADDITIONAL_VERSIONS=3 for instance. + find_package( PythonInterp ) + + # find_python_module tries to import module in Python interpreter and to retrieve its version number + # returns ${PYTHON_MODULE_NAME_UP}_VERSION and ${PYTHON_MODULE_NAME_UP}_FOUND + function( find_python_module PYTHON_MODULE_NAME ) + string(TOUPPER ${PYTHON_MODULE_NAME} PYTHON_MODULE_NAME_UP) + execute_process( + COMMAND ${PYTHON_EXECUTABLE} -c "import ${PYTHON_MODULE_NAME}; print(${PYTHON_MODULE_NAME}.__version__)" + RESULT_VARIABLE PYTHON_MODULE_RESULT + OUTPUT_VARIABLE PYTHON_MODULE_VERSION + ERROR_VARIABLE PYTHON_MODULE_ERROR) + if(PYTHON_MODULE_RESULT EQUAL 0) + # Remove all carriage returns as it can be multiline + string(REGEX REPLACE "\n" " " PYTHON_MODULE_VERSION "${PYTHON_MODULE_VERSION}") + message ("++ Python module ${PYTHON_MODULE_NAME} - Version ${PYTHON_MODULE_VERSION} found") + + set(${PYTHON_MODULE_NAME_UP}_VERSION ${PYTHON_MODULE_VERSION} PARENT_SCOPE) + set(${PYTHON_MODULE_NAME_UP}_FOUND TRUE PARENT_SCOPE) + else() + message ("PYTHON_MODULE_NAME = ${PYTHON_MODULE_NAME} + - PYTHON_MODULE_RESULT = ${PYTHON_MODULE_RESULT} + - PYTHON_MODULE_VERSION = ${PYTHON_MODULE_VERSION} + - PYTHON_MODULE_ERROR = ${PYTHON_MODULE_ERROR}") + unset(${PYTHON_MODULE_NAME_UP}_VERSION PARENT_SCOPE) + set(${PYTHON_MODULE_NAME_UP}_FOUND FALSE PARENT_SCOPE) + endif() + endfunction( find_python_module ) + + # For modules that do not define module.__version__ + function( find_python_module_no_version PYTHON_MODULE_NAME ) + string(TOUPPER ${PYTHON_MODULE_NAME} PYTHON_MODULE_NAME_UP) + execute_process( + COMMAND ${PYTHON_EXECUTABLE} -c "import ${PYTHON_MODULE_NAME}" + RESULT_VARIABLE PYTHON_MODULE_RESULT + ERROR_VARIABLE PYTHON_MODULE_ERROR) + if(PYTHON_MODULE_RESULT EQUAL 0) + # Remove carriage return + message ("++ Python module ${PYTHON_MODULE_NAME} found") + set(${PYTHON_MODULE_NAME_UP}_FOUND TRUE PARENT_SCOPE) + else() + message ("PYTHON_MODULE_NAME = ${PYTHON_MODULE_NAME} + - PYTHON_MODULE_RESULT = ${PYTHON_MODULE_RESULT} + - PYTHON_MODULE_ERROR = ${PYTHON_MODULE_ERROR}") + set(${PYTHON_MODULE_NAME_UP}_FOUND FALSE PARENT_SCOPE) + endif() + endfunction( find_python_module_no_version ) + + if( PYTHONINTERP_FOUND ) + find_python_module("cython") + find_python_module("pytest") + find_python_module("matplotlib") + find_python_module("numpy") + find_python_module("scipy") + find_python_module("sphinx") + find_python_module("sklearn") + find_python_module("ot") + find_python_module("pybind11") + find_python_module("torch") + find_python_module("pykeops") + find_python_module("eagerpy") + find_python_module_no_version("hnswlib") + find_python_module("tensorflow") + find_python_module("sphinx_paramlinks") + find_python_module_no_version("python_docs_theme") endif() -endfunction( find_python_module ) - -# For modules that do not define module.__version__ -function( find_python_module_no_version PYTHON_MODULE_NAME ) - string(TOUPPER ${PYTHON_MODULE_NAME} PYTHON_MODULE_NAME_UP) - execute_process( - COMMAND ${PYTHON_EXECUTABLE} -c "import ${PYTHON_MODULE_NAME}" - RESULT_VARIABLE PYTHON_MODULE_RESULT - ERROR_VARIABLE PYTHON_MODULE_ERROR) - if(PYTHON_MODULE_RESULT EQUAL 0) - # Remove carriage return - message ("++ Python module ${PYTHON_MODULE_NAME} found") - set(${PYTHON_MODULE_NAME_UP}_FOUND TRUE PARENT_SCOPE) - else() - message ("PYTHON_MODULE_NAME = ${PYTHON_MODULE_NAME} - - PYTHON_MODULE_RESULT = ${PYTHON_MODULE_RESULT} - - PYTHON_MODULE_ERROR = ${PYTHON_MODULE_ERROR}") - set(${PYTHON_MODULE_NAME_UP}_FOUND FALSE PARENT_SCOPE) - endif() -endfunction( find_python_module_no_version ) - -if( PYTHONINTERP_FOUND ) - find_python_module("cython") - find_python_module("pytest") - find_python_module("matplotlib") - find_python_module("numpy") - find_python_module("scipy") - find_python_module("sphinx") - find_python_module("sklearn") - find_python_module("ot") - find_python_module("pybind11") - find_python_module("torch") - find_python_module("pykeops") - find_python_module("eagerpy") - find_python_module_no_version("hnswlib") - find_python_module("tensorflow") -endif() - -if(NOT GUDHI_PYTHON_PATH) - message(FATAL_ERROR "ERROR: GUDHI_PYTHON_PATH is not valid.") -endif(NOT GUDHI_PYTHON_PATH) - -option(WITH_GUDHI_PYTHON_RUNTIME_LIBRARY_DIRS "Build with setting runtime_library_dirs. Usefull when setting rpath is not allowed" ON) - -if(PYTHONINTERP_FOUND AND CYTHON_FOUND) - if(SPHINX_FOUND) - # Documentation generation is available through sphinx - find_program( SPHINX_PATH sphinx-build ) - - if(NOT SPHINX_PATH) - if(PYTHON_VERSION_MAJOR EQUAL 3) - # In Python3, just hack sphinx-build if it does not exist - set(SPHINX_PATH "${PYTHON_EXECUTABLE}" "-m" "sphinx.cmd.build") - endif(PYTHON_VERSION_MAJOR EQUAL 3) - endif(NOT SPHINX_PATH) - endif(SPHINX_FOUND) -endif(PYTHONINTERP_FOUND AND CYTHON_FOUND) - + + if(NOT GUDHI_PYTHON_PATH) + message(FATAL_ERROR "ERROR: GUDHI_PYTHON_PATH is not valid.") + endif(NOT GUDHI_PYTHON_PATH) + + option(WITH_GUDHI_PYTHON_RUNTIME_LIBRARY_DIRS "Build with setting runtime_library_dirs. Useful when setting rpath is not allowed" ON) + + if(PYTHONINTERP_FOUND AND CYTHON_FOUND) + if(SPHINX_FOUND) + # Documentation generation is available through sphinx + find_program( SPHINX_PATH sphinx-build ) + + if(NOT SPHINX_PATH) + if(PYTHON_VERSION_MAJOR EQUAL 3) + # In Python3, just hack sphinx-build if it does not exist + set(SPHINX_PATH "${PYTHON_EXECUTABLE}" "-m" "sphinx.cmd.build") + endif(PYTHON_VERSION_MAJOR EQUAL 3) + endif(NOT SPHINX_PATH) + endif(SPHINX_FOUND) + endif(PYTHONINTERP_FOUND AND CYTHON_FOUND) +endif (WITH_GUDHI_PYTHON) diff --git a/src/cmake/modules/GUDHI_user_version_target.cmake b/src/cmake/modules/GUDHI_user_version_target.cmake index e4f39aae..b9bf1414 100644 --- a/src/cmake/modules/GUDHI_user_version_target.cmake +++ b/src/cmake/modules/GUDHI_user_version_target.cmake @@ -14,27 +14,21 @@ add_custom_command(TARGET user_version PRE_BUILD COMMAND ${CMAKE_COMMAND} -E make_directory ${GUDHI_USER_VERSION_DIR} COMMENT "user_version creation in ${GUDHI_USER_VERSION_DIR}") -foreach(GUDHI_MODULE ${GUDHI_MODULES_FULL_LIST}) - set(GUDHI_DOXYGEN_IMAGE_PATH "${GUDHI_DOXYGEN_IMAGE_PATH} doc/${GUDHI_MODULE}/ \\ \n") -endforeach(GUDHI_MODULE ${GUDHI_MODULES_FULL_LIST}) - -# Generate Doxyfile for Doxygen - cf. root CMakeLists.txt for explanation -configure_file(${CMAKE_SOURCE_DIR}/src/Doxyfile.in "${CMAKE_CURRENT_BINARY_DIR}/src/Doxyfile" @ONLY) -add_custom_command(TARGET user_version PRE_BUILD COMMAND ${CMAKE_COMMAND} -E - copy ${CMAKE_CURRENT_BINARY_DIR}/src/Doxyfile ${GUDHI_USER_VERSION_DIR}/Doxyfile) - # Generate bib files for Doxygen - cf. root CMakeLists.txt for explanation string(TIMESTAMP GUDHI_VERSION_YEAR "%Y") configure_file(${CMAKE_SOURCE_DIR}/biblio/how_to_cite_gudhi.bib.in "${CMAKE_CURRENT_BINARY_DIR}/biblio/how_to_cite_gudhi.bib" @ONLY) file(COPY "${CMAKE_SOURCE_DIR}/biblio/bibliography.bib" DESTINATION "${CMAKE_CURRENT_BINARY_DIR}/biblio/") +file(COPY "${CMAKE_SOURCE_DIR}/biblio/test" DESTINATION "${CMAKE_CURRENT_BINARY_DIR}/biblio") # append cgal citation inside bibliography - sphinx cannot deal with more than one bib file file(READ "${CMAKE_SOURCE_DIR}/biblio/how_to_cite_cgal.bib" CGAL_CITATION_CONTENT) file(APPEND "${CMAKE_CURRENT_BINARY_DIR}/biblio/bibliography.bib" "${CGAL_CITATION_CONTENT}") -# Copy biblio directory for user version +# Copy biblio files for user version +add_custom_command(TARGET user_version PRE_BUILD COMMAND ${CMAKE_COMMAND} -E + copy ${CMAKE_CURRENT_BINARY_DIR}/biblio/bibliography.bib ${GUDHI_USER_VERSION_DIR}/biblio/bibliography.bib) add_custom_command(TARGET user_version PRE_BUILD COMMAND ${CMAKE_COMMAND} -E - copy_directory ${CMAKE_CURRENT_BINARY_DIR}/biblio ${GUDHI_USER_VERSION_DIR}/biblio) + copy ${CMAKE_CURRENT_BINARY_DIR}/biblio/how_to_cite_gudhi.bib ${GUDHI_USER_VERSION_DIR}/biblio/how_to_cite_gudhi.bib) add_custom_command(TARGET user_version PRE_BUILD COMMAND ${CMAKE_COMMAND} -E copy ${CMAKE_SOURCE_DIR}/README.md ${GUDHI_USER_VERSION_DIR}/README.md) @@ -48,6 +42,8 @@ add_custom_command(TARGET user_version PRE_BUILD COMMAND ${CMAKE_COMMAND} -E copy ${CMAKE_SOURCE_DIR}/src/GUDHIConfig.cmake.in ${GUDHI_USER_VERSION_DIR}/GUDHIConfig.cmake.in) add_custom_command(TARGET user_version PRE_BUILD COMMAND ${CMAKE_COMMAND} -E copy ${CMAKE_SOURCE_DIR}/CMakeGUDHIVersion.txt ${GUDHI_USER_VERSION_DIR}/CMakeGUDHIVersion.txt) +add_custom_command(TARGET user_version PRE_BUILD COMMAND ${CMAKE_COMMAND} -E + copy ${CMAKE_SOURCE_DIR}/src/Doxyfile.in ${GUDHI_USER_VERSION_DIR}/Doxyfile.in) # As cython generates .cpp files in source, we have to copy all except cpp files from python directory file(GLOB_RECURSE PYTHON_FILES ${CMAKE_SOURCE_DIR}/${GUDHI_PYTHON_PATH}/*) @@ -67,10 +63,9 @@ add_custom_command(TARGET user_version PRE_BUILD COMMAND ${CMAKE_COMMAND} -E add_custom_command(TARGET user_version PRE_BUILD COMMAND ${CMAKE_COMMAND} -E copy_directory ${CMAKE_SOURCE_DIR}/src/GudhUI ${GUDHI_USER_VERSION_DIR}/GudhUI) -if(HERA_WASSERSTEIN_INCLUDE_DIR STREQUAL HERA_WASSERSTEIN_INTERNAL_INCLUDE_DIR OR - HERA_BOTTLENECK_INCLUDE_DIR STREQUAL HERA_BOTTLENECK_INTERNAL_INCLUDE_DIR) +if(HERA_INCLUDE_DIR STREQUAL HERA_INTERNAL_INCLUDE_DIR) add_custom_command(TARGET user_version PRE_BUILD COMMAND ${CMAKE_COMMAND} -E - copy_directory ${CMAKE_SOURCE_DIR}/ext/hera ${GUDHI_USER_VERSION_DIR}/ext/hera) + copy_directory ${CMAKE_SOURCE_DIR}/ext/hera/include ${GUDHI_USER_VERSION_DIR}/ext/hera/include) endif() set(GUDHI_DIRECTORIES "doc;example;concept;utilities") diff --git a/src/common/benchmark/CMakeLists.txt b/src/common/benchmark/CMakeLists.txt index a3787d6e..26e4e6af 100644 --- a/src/common/benchmark/CMakeLists.txt +++ b/src/common/benchmark/CMakeLists.txt @@ -1,3 +1,7 @@ project(common_benchmark) add_executable(Graph_simplicial_complex_benchmark Graph_simplicial_complex_benchmark.cpp) + +if (TBB_FOUND) + target_link_libraries(Graph_simplicial_complex_benchmark ${TBB_LIBRARIES}) +endif() diff --git a/src/common/doc/examples.h b/src/common/doc/examples.h index 474f8699..1634b19e 100644 --- a/src/common/doc/examples.h +++ b/src/common/doc/examples.h @@ -1,96 +1,133 @@ -// List of GUDHI examples - Doxygen needs at least a file tag to analyse comments -// In user_version, `find . -name "*.cpp"` in example and utilities folders -/*! @file Examples - * @example Alpha_complex/Alpha_complex_from_off.cpp - * @example Alpha_complex/Alpha_complex_from_points.cpp - * @example Bottleneck_distance/bottleneck_basic_example.cpp - * @example Bottleneck_distance/alpha_rips_persistence_bottleneck_distance.cpp - * @example Witness_complex/example_nearest_landmark_table.cpp - * @example Witness_complex/example_witness_complex_off.cpp - * @example Witness_complex/example_witness_complex_sphere.cpp - * @example Witness_complex/example_strong_witness_complex_off.cpp - * @example Simplex_tree/mini_simplex_tree.cpp - * @example Simplex_tree/graph_expansion_with_blocker.cpp - * @example Simplex_tree/simple_simplex_tree.cpp - * @example Simplex_tree/simplex_tree_from_cliques_of_graph.cpp - * @example Simplex_tree/example_alpha_shapes_3_simplex_tree_from_off_file.cpp - * @example Simplex_tree/cech_complex_cgal_mini_sphere_3d.cpp - * @example Persistent_cohomology/plain_homology.cpp - * @example Persistent_cohomology/persistence_from_file.cpp - * @example Persistent_cohomology/rips_persistence_step_by_step.cpp - * @example Persistent_cohomology/rips_persistence_via_boundary_matrix.cpp - * @example Persistent_cohomology/custom_persistence_sort.cpp - * @example Persistent_cohomology/persistence_from_simple_simplex_tree.cpp - * @example Persistent_cohomology/rips_multifield_persistence.cpp - * @example Skeleton_blocker/Skeleton_blocker_from_simplices.cpp - * @example Skeleton_blocker/Skeleton_blocker_iteration.cpp - * @example Skeleton_blocker/Skeleton_blocker_link.cpp - * @example Contraction/Garland_heckbert.cpp - * @example Contraction/Rips_contraction.cpp - * @example Bitmap_cubical_complex/Random_bitmap_cubical_complex.cpp - * @example common/example_CGAL_3D_points_off_reader.cpp - * @example common/example_vector_double_points_off_reader.cpp - * @example common/example_CGAL_points_off_reader.cpp - * @example Rips_complex/example_one_skeleton_rips_from_distance_matrix.cpp - * @example Rips_complex/example_one_skeleton_rips_from_points.cpp - * @example Rips_complex/example_rips_complex_from_csv_distance_matrix_file.cpp - * @example Rips_complex/example_rips_complex_from_off_file.cpp - * @example Persistence_representations/persistence_intervals.cpp - * @example Persistence_representations/persistence_vectors.cpp - * @example Persistence_representations/persistence_heat_maps.cpp - * @example Persistence_representations/persistence_landscape_on_grid.cpp - * @example Persistence_representations/persistence_landscape.cpp - * @example Tangential_complex/example_basic.cpp - * @example Tangential_complex/example_with_perturb.cpp - * @example Subsampling/example_custom_distance.cpp - * @example Subsampling/example_choose_n_farthest_points.cpp - * @example Subsampling/example_sparsify_point_set.cpp - * @example Subsampling/example_pick_n_random_points.cpp - * @example Nerve_GIC/CoordGIC.cpp - * @example Nerve_GIC/Nerve.cpp - * @example Nerve_GIC/FuncGIC.cpp - * @example Nerve_GIC/VoronoiGIC.cpp - * @example Spatial_searching/example_spatial_searching.cpp - * @example Alpha_complex/alpha_complex_3d_persistence.cpp - * @example Alpha_complex/alpha_complex_persistence.cpp - * @example Alpha_complex/Weighted_alpha_complex_3d_from_points.cpp - * @example Bottleneck_distance/bottleneck_distance.cpp - * @example Witness_complex/weak_witness_persistence.cpp - * @example Witness_complex/strong_witness_persistence.cpp - * @example Bitmap_cubical_complex/cubical_complex_persistence.cpp - * @example Bitmap_cubical_complex/periodic_cubical_complex_persistence.cpp - * @example common/off_file_from_shape_generator.cpp - * @example Rips_complex/rips_distance_matrix_persistence.cpp - * @example Rips_complex/rips_persistence.cpp - * @example Persistence_representations/persistence_landscapes_on_grid/create_landscapes_on_grid.cpp - * @example Persistence_representations/persistence_landscapes_on_grid/plot_landscapes_on_grid.cpp - * @example Persistence_representations/persistence_landscapes_on_grid/compute_scalar_product_of_landscapes_on_grid.cpp - * @example Persistence_representations/persistence_landscapes_on_grid/compute_distance_of_landscapes_on_grid.cpp - * @example Persistence_representations/persistence_landscapes_on_grid/average_landscapes_on_grid.cpp - * @example Persistence_representations/persistence_intervals/compute_birth_death_range_in_persistence_diagram.cpp - * @example Persistence_representations/persistence_intervals/compute_number_of_dominant_intervals.cpp - * @example Persistence_representations/persistence_intervals/plot_persistence_Betti_numbers.cpp - * @example Persistence_representations/persistence_intervals/plot_persistence_intervals.cpp - * @example Persistence_representations/persistence_intervals/plot_histogram_of_intervals_lengths.cpp - * @example Persistence_representations/persistence_intervals/compute_bottleneck_distance.cpp - * @example Persistence_representations/persistence_heat_maps/create_pssk.cpp - * @example Persistence_representations/persistence_heat_maps/create_p_h_m_weighted_by_arctan_of_their_persistence.cpp - * @example Persistence_representations/persistence_heat_maps/create_p_h_m_weighted_by_squared_diag_distance.cpp - * @example Persistence_representations/persistence_heat_maps/compute_distance_of_persistence_heat_maps.cpp - * @example Persistence_representations/persistence_heat_maps/compute_scalar_product_of_persistence_heat_maps.cpp - * @example Persistence_representations/persistence_heat_maps/create_p_h_m_weighted_by_distance_from_diagonal.cpp - * @example Persistence_representations/persistence_heat_maps/average_persistence_heat_maps.cpp - * @example Persistence_representations/persistence_heat_maps/plot_persistence_heat_map.cpp - * @example Persistence_representations/persistence_heat_maps/create_persistence_heat_maps.cpp - * @example Persistence_representations/persistence_vectors/plot_persistence_vectors.cpp - * @example Persistence_representations/persistence_vectors/compute_distance_of_persistence_vectors.cpp - * @example Persistence_representations/persistence_vectors/average_persistence_vectors.cpp - * @example Persistence_representations/persistence_vectors/create_persistence_vectors.cpp - * @example Persistence_representations/persistence_vectors/compute_scalar_product_of_persistence_vectors.cpp - * @example Persistence_representations/persistence_landscapes/average_landscapes.cpp - * @example Persistence_representations/persistence_landscapes/compute_scalar_product_of_landscapes.cpp - * @example Persistence_representations/persistence_landscapes/create_landscapes.cpp - * @example Persistence_representations/persistence_landscapes/compute_distance_of_landscapes.cpp - * @example Persistence_representations/persistence_landscapes/plot_landscapes.cpp +// List of GUDHI examples and utils - Doxygen needs at least a file tag to analyse comments +// Generated from scripts/cpp_examples_for_doxygen.py +/*! @file + * \section Witness_complex_example_section Witness_complex + * @example strong_witness_persistence.cpp + * @example weak_witness_persistence.cpp + * @example example_witness_complex_off.cpp + * @example example_strong_witness_complex_off.cpp + * @example example_nearest_landmark_table.cpp + * @example example_witness_complex_sphere.cpp + * \section Contraction_example_section Contraction + * @example Rips_contraction.cpp + * @example Garland_heckbert.cpp + * \section Simplex_tree_example_section Simplex_tree + * @example mini_simplex_tree.cpp + * @example cech_complex_cgal_mini_sphere_3d.cpp + * @example graph_expansion_with_blocker.cpp + * @example simple_simplex_tree.cpp + * @example simplex_tree_from_cliques_of_graph.cpp + * @example example_alpha_shapes_3_simplex_tree_from_off_file.cpp + * \section Persistent_cohomology_example_section Persistent_cohomology + * @example custom_persistence_sort.cpp + * @example rips_persistence_step_by_step.cpp + * @example persistence_from_file.cpp + * @example rips_persistence_via_boundary_matrix.cpp + * @example plain_homology.cpp + * @example rips_multifield_persistence.cpp + * @example persistence_from_simple_simplex_tree.cpp + * \section Subsampling_example_section Subsampling + * @example example_sparsify_point_set.cpp + * @example example_choose_n_farthest_points.cpp + * @example example_custom_distance.cpp + * @example example_pick_n_random_points.cpp + * \section Toplex_map_example_section Toplex_map + * @example simple_toplex_map.cpp + * \section Collapse_example_section Collapse + * @example distance_matrix_edge_collapse_rips_persistence.cpp + * @example point_cloud_edge_collapse_rips_persistence.cpp + * @example edge_collapse_conserve_persistence.cpp + * @example edge_collapse_basic_example.cpp + * \section Cech_complex_example_section Cech_complex + * @example cech_persistence.cpp + * @example cech_complex_example_from_points.cpp + * \section Bitmap_cubical_complex_example_section Bitmap_cubical_complex + * @example periodic_cubical_complex_persistence.cpp + * @example cubical_complex_persistence.cpp + * @example Random_bitmap_cubical_complex.cpp + * \section Coxeter_triangulation_example_section Coxeter_triangulation + * @example cell_complex_from_basic_circle_manifold.cpp + * @example manifold_tracing_flat_torus_with_boundary.cpp + * @example manifold_tracing_custom_function.cpp + * \section Nerve_GIC_example_section Nerve_GIC + * @example VoronoiGIC.cpp + * @example Nerve.cpp + * @example CoordGIC.cpp + * @example FuncGIC.cpp + * \section Tangential_complex_example_section Tangential_complex + * @example example_basic.cpp + * @example example_with_perturb.cpp + * \section Persistence_representations_example_section Persistence_representations + * @example persistence_vectors/create_persistence_vectors.cpp + * @example persistence_vectors/compute_scalar_product_of_persistence_vectors.cpp + * @example persistence_vectors/plot_persistence_vectors.cpp + * @example persistence_vectors/average_persistence_vectors.cpp + * @example persistence_vectors/compute_distance_of_persistence_vectors.cpp + * @example persistence_landscapes_on_grid/average_landscapes_on_grid.cpp + * @example persistence_landscapes_on_grid/create_landscapes_on_grid.cpp + * @example persistence_landscapes_on_grid/compute_distance_of_landscapes_on_grid.cpp + * @example persistence_landscapes_on_grid/compute_scalar_product_of_landscapes_on_grid.cpp + * @example persistence_landscapes_on_grid/plot_landscapes_on_grid.cpp + * @example persistence_intervals/compute_birth_death_range_in_persistence_diagram.cpp + * @example persistence_intervals/plot_persistence_Betti_numbers.cpp + * @example persistence_intervals/compute_bottleneck_distance.cpp + * @example persistence_intervals/compute_number_of_dominant_intervals.cpp + * @example persistence_intervals/plot_histogram_of_intervals_lengths.cpp + * @example persistence_intervals/plot_persistence_intervals.cpp + * @example persistence_heat_maps/compute_distance_of_persistence_heat_maps.cpp + * @example persistence_heat_maps/create_pssk.cpp + * @example persistence_heat_maps/create_p_h_m_weighted_by_arctan_of_their_persistence.cpp + * @example persistence_heat_maps/create_p_h_m_weighted_by_distance_from_diagonal.cpp + * @example persistence_heat_maps/create_p_h_m_weighted_by_squared_diag_distance.cpp + * @example persistence_heat_maps/compute_scalar_product_of_persistence_heat_maps.cpp + * @example persistence_heat_maps/plot_persistence_heat_map.cpp + * @example persistence_heat_maps/create_persistence_heat_maps.cpp + * @example persistence_heat_maps/average_persistence_heat_maps.cpp + * @example persistence_landscapes/compute_distance_of_landscapes.cpp + * @example persistence_landscapes/compute_scalar_product_of_landscapes.cpp + * @example persistence_landscapes/average_landscapes.cpp + * @example persistence_landscapes/plot_landscapes.cpp + * @example persistence_landscapes/create_landscapes.cpp + * @example persistence_landscape_on_grid.cpp + * @example persistence_intervals.cpp + * @example persistence_landscape.cpp + * @example persistence_vectors.cpp + * @example sliced_wasserstein.cpp + * @example persistence_heat_maps.cpp + * \section Spatial_searching_example_section Spatial_searching + * @example example_spatial_searching.cpp + * \section Bottleneck_distance_example_section Bottleneck_distance + * @example bottleneck_distance.cpp + * @example bottleneck_basic_example.cpp + * @example alpha_rips_persistence_bottleneck_distance.cpp + * \section common_example_section common + * @example off_file_from_shape_generator.cpp + * @example example_vector_double_points_off_reader.cpp + * @example example_CGAL_points_off_reader.cpp + * @example example_CGAL_3D_points_off_reader.cpp + * \section Alpha_complex_example_section Alpha_complex + * @example alpha_complex_3d_persistence.cpp + * @example alpha_complex_persistence.cpp + * @example Fast_alpha_complex_from_off.cpp + * @example Alpha_complex_3d_from_points.cpp + * @example Alpha_complex_from_off.cpp + * @example Weighted_alpha_complex_3d_from_points.cpp + * @example Weighted_alpha_complex_from_points.cpp + * @example Alpha_complex_from_points.cpp + * \section Skeleton_blocker_example_section Skeleton_blocker + * @example Skeleton_blocker_from_simplices.cpp + * @example Skeleton_blocker_link.cpp + * @example Skeleton_blocker_iteration.cpp + * \section Rips_complex_example_section Rips_complex + * @example rips_persistence.cpp + * @example rips_correlation_matrix_persistence.cpp + * @example sparse_rips_persistence.cpp + * @example rips_distance_matrix_persistence.cpp + * @example example_sparse_rips.cpp + * @example example_rips_complex_from_csv_distance_matrix_file.cpp + * @example example_one_skeleton_rips_from_correlation_matrix.cpp + * @example example_one_skeleton_rips_from_distance_matrix.cpp + * @example example_one_skeleton_rips_from_points.cpp + * @example example_rips_complex_from_off_file.cpp */ diff --git a/src/common/doc/footer.html b/src/common/doc/footer.html index 4168c6bc..08a2cbd0 100644 --- a/src/common/doc/footer.html +++ b/src/common/doc/footer.html @@ -1,5 +1,9 @@ -<!-- HTML footer for doxygen 1.8.6--> +<!-- HTML footer for doxygen 1.9.4--> <!-- start footer part --> +<!--BEGIN GENERATE_TREEVIEW--> +<div id="nav-path" class="navpath"><!-- id is needed for treeview function! --> +<!--END GENERATE_TREEVIEW--> +<ul> <table style="width:100%"> <tr class="no-bullet shadow-black"> <td class="network-entypo"> @@ -10,14 +14,15 @@ <!--END PROJECT_NAME--> </td> <td class="network-entypo"> -<!--BEGIN GENERATE_TREEVIEW--> $generatedby <a href="http://www.doxygen.org/index.html"> Doxygen</a> $doxygenversion -<!--END GENERATE_TREEVIEW--> </td> </tr> </table> - +</ul> +<!--BEGIN GENERATE_TREEVIEW--> +</div> +<!--END GENERATE_TREEVIEW--> </body> </html> diff --git a/src/common/doc/header.html b/src/common/doc/header.html index 9da20bbc..a97e1b2f 100644 --- a/src/common/doc/header.html +++ b/src/common/doc/header.html @@ -8,9 +8,6 @@ <meta name="generator" content="Doxygen $doxygenversion"/> <!--BEGIN PROJECT_NAME--><title>$projectname: $title</title><!--END PROJECT_NAME--> <!--BEGIN !PROJECT_NAME--><title>$title</title><!--END !PROJECT_NAME--> -<!-- GUDHI website css for header BEGIN --> -<link rel="stylesheet" type="text/css" href="https://gudhi.inria.fr/assets/css/styles_feeling_responsive.css" /> -<!-- GUDHI website css for header END --> <link href="$relpath^tabs.css" rel="stylesheet" type="text/css"/> <script type="text/javascript" src="$relpath^jquery.js"></script> <script type="text/javascript" src="$relpath^dynsections.js"></script> @@ -18,13 +15,17 @@ $treeview $search $mathjax <link href="$relpath^$stylesheet" rel="stylesheet" type="text/css" /> +<!-- GUDHI website css for header BEGIN --> +<link rel="stylesheet" type="text/css" href="https://gudhi.inria.fr/assets/css/styles_feeling_responsive.css" /> +<!-- GUDHI website css for header END --> $extrastylesheet </head> <body> +<div id="top"><!-- do not remove this div, it is closed by doxygen! --> <!-- GUDHI website header BEGIN --> <div id="navigation" class="sticky"> - <nav class="top-bar" role="navigation" data-topbar> + <nav class="top-bar" role="navigation" data-topbar="true"> <ul class="title-area"> <li class="name"> <h1 class="show-for-small-only"><a href="" class="icon-tree"> GUDHI library</a></h1> @@ -38,7 +39,7 @@ $extrastylesheet <li><a href="/contact/">Contact</a></li> </ul> <ul class="left"> - <li><a href="/"> <img src="/assets/img/home.png" alt=" GUDHI"> GUDHI </a></li> + <li><a href="/"> <img src="/assets/img/home.png" alt=" GUDHI"/> GUDHI </a></li> <li class="divider"></li> <li class="has-dropdown"> <a href="#">Project</a> @@ -49,6 +50,7 @@ $extrastylesheet <li><a href="/relatedprojects/">Related projects</a></li> <li><a href="/theyaretalkingaboutus/">They are talking about us</a></li> <li><a href="/inaction/">GUDHI in action</a></li> + <li><a href="/etymology/">Etymology</a></li> </ul> </li> <li class="divider"></li> @@ -84,7 +86,6 @@ $extrastylesheet </div><!-- /#navigation --> <!-- GUDHI website header END --> -<div id="top"><!-- do not remove this div, it is closed by doxygen! --> <!--BEGIN TITLEAREA--> <div id="titlearea"> diff --git a/src/common/doc/installation.h b/src/common/doc/installation.h index c2e63a24..f2f8a476 100644 --- a/src/common/doc/installation.h +++ b/src/common/doc/installation.h @@ -5,9 +5,9 @@ * Examples of GUDHI headers inclusion can be found in \ref utilities. * * \section compiling Compiling - * The library uses c++14 and requires <a target="_blank" href="http://www.boost.org/">Boost</a> ≥ 1.56.0 - * and <a target="_blank" href="https://www.cmake.org/">CMake</a> ≥ 3.5. - * It is a multi-platform library and compiles on Linux, Mac OSX and Visual Studio 2015. + * The library uses c++17 and requires <a target="_blank" href="https://www.boost.org/">Boost</a> ≥ 1.66.0 + * and <a target="_blank" href="https://cmake.org/">CMake</a> ≥ 3.5. + * It is a multi-platform library and compiles on Linux, Mac OSX and Visual Studio 2017. * * \subsection utilities Utilities and examples * To build the utilities, run the following commands in a terminal: @@ -30,21 +30,29 @@ make \endverbatim * This action may require to be in the sudoer or administrator of the machine in function of the operating system and * of <a href="https://cmake.org/cmake/help/latest/variable/CMAKE_INSTALL_PREFIX.html">CMAKE_INSTALL_PREFIX</a>. * + * \note Python module will be compiled by the `make` command, but `make install` will not install it. Please refer to + * the <a href="https://gudhi.inria.fr/python/latest/installation.html#gudhi-python-module-installation">Python + * module installation documentation</a>. + * * \subsection testsuites Test suites * To test your build, run the following command in a terminal: * \verbatim make test \endverbatim * `make test` is using <a href="https://cmake.org/cmake/help/latest/manual/ctest.1.html">Ctest</a> (CMake test driver * program). If some of the tests are failing, please send us the result of the following command: * \verbatim ctest --output-on-failure \endverbatim + * Testing fetching datasets feature requires the use of the internet and is disabled by default. If you want to include this test, set WITH_GUDHI_REMOTE_TEST to ON when building in the previous step (note that this test is included in the python module): + * \verbatim cmake -DCMAKE_BUILD_TYPE=Release -DWITH_GUDHI_TEST=ON -DWITH_GUDHI_REMOTE_TEST=ON --DWITH_GUDHI_PYTHON=ON .. \endverbatim * - * \subsection documentationgeneration Documentation - * To generate the documentation, <a target="_blank" href="http://www.doxygen.org/">Doxygen</a> is required. - * Run the following command in a terminal: -\verbatim -make doxygen -# Documentation will be generated in the folder YYYY-MM-DD-hh-mm-ss_GUDHI_X.Y.Z/doc/html/ -# You can customize the directory name by calling `cmake -DUSER_VERSION_DIR=/my/custom/folder` -\endverbatim + * \subsection documentationgeneration C++ documentation + * To generate the C++ documentation, the <a target="_blank" href="http://www.doxygen.org/">doxygen</a> program + * is required (version ≥ 1.9.5 is advised). Run the following command in a terminal: + * \verbatim make doxygen \endverbatim + * Documentation will be generated in a folder named <code>html</code>. + * + * In case there is not a full setup present and only the documentation should be build the following command sequence + * can be used: +\verbatim cmake -DWITH_GUDHI_THIRD_PARTY=OFF .. +make doxygen\endverbatim * * \subsection helloworld Hello world ! * The <a target="_blank" href="https://github.com/GUDHI/hello-gudhi-world">Hello world for GUDHI</a> @@ -55,10 +63,9 @@ make doxygen * The multi-field persistent homology algorithm requires GMP which is a free library for arbitrary-precision * arithmetic, operating on signed integers, rational numbers, and floating point numbers. * - * The following example requires the <a target="_blank" href="http://gmplib.org/">GNU Multiple Precision Arithmetic + * The following example requires the <a target="_blank" href="https://gmplib.org/">GNU Multiple Precision Arithmetic * Library</a> (GMP) and will not be built if GMP is not installed: - * \li <a href="_persistent_cohomology_2rips_multifield_persistence_8cpp-example.html"> - * Persistent_cohomology/rips_multifield_persistence.cpp</a> + * \li \gudhi_example_link{Persistent_cohomology,rips_multifield_persistence.cpp} * * Having GMP version 4.2 or higher installed is recommended. * @@ -75,177 +82,109 @@ make doxygen * * The following examples/utilities require the <a target="_blank" href="http://www.cgal.org/">Computational Geometry Algorithms * Library</a> (CGAL \cite cgal:eb-19b) and will not be built if CGAL version 4.11.0 or higher is not installed: - * \li <a href="_simplex_tree_2example_alpha_shapes_3_simplex_tree_from_off_file_8cpp-example.html"> - * Simplex_tree/example_alpha_shapes_3_simplex_tree_from_off_file.cpp</a> - * \li <a href="_witness_complex_2strong_witness_persistence_8cpp-example.html"> - * Witness_complex/strong_witness_persistence.cpp</a> - * \li <a href="_witness_complex_2weak_witness_persistence_8cpp-example.html"> - * Witness_complex/weak_witness_persistence.cpp</a> - * \li <a href="_witness_complex_2example_strong_witness_complex_off_8cpp-example.html"> - * Witness_complex/example_strong_witness_complex_off.cpp</a> - * \li <a href="_witness_complex_2example_witness_complex_off_8cpp-example.html"> - * Witness_complex/example_witness_complex_off.cpp</a> - * \li <a href="_witness_complex_2example_witness_complex_sphere_8cpp-example.html"> - * Witness_complex/example_witness_complex_sphere.cpp</a> - * \li <a href="_alpha_complex_2_alpha_complex_from_off_8cpp-example.html"> - * Alpha_complex/Alpha_complex_from_off.cpp</a> - * \li <a href="_alpha_complex_2_alpha_complex_from_points_8cpp-example.html"> - * Alpha_complex/Alpha_complex_from_points.cpp</a> - * \li <a href="_alpha_complex_2alpha_complex_persistence_8cpp-example.html"> - * Alpha_complex/alpha_complex_persistence.cpp</a> - * \li <a href="_persistent_cohomology_2custom_persistence_sort_8cpp-example.html"> - * Persistent_cohomology/custom_persistence_sort.cpp</a> - * \li <a href="_bottleneck_distance_2alpha_rips_persistence_bottleneck_distance_8cpp-example.html"> - * Bottleneck_distance/alpha_rips_persistence_bottleneck_distance.cpp.cpp</a> - * \li <a href="_bottleneck_distance_2bottleneck_basic_example_8cpp-example.html"> - * Bottleneck_distance/bottleneck_basic_example.cpp</a> - * \li <a href="_bottleneck_distance_2bottleneck_read_file_8cpp-example.html"> - * Bottleneck_distance/bottleneck_distance.cpp</a> - * \li <a href="_nerve__g_i_c_2_coord_g_i_c_8cpp-example.html"> - * Nerve_GIC/CoordGIC.cpp</a> - * \li <a href="_nerve__g_i_c_2_func_g_i_c_8cpp-example.html"> - * Nerve_GIC/FuncGIC.cpp</a> - * \li <a href="_nerve__g_i_c_2_nerve_8cpp-example.html"> - * Nerve_GIC/Nerve.cpp</a> - * \li <a href="_nerve__g_i_c_2_voronoi_g_i_c_8cpp-example.html"> - * Nerve_GIC/VoronoiGIC.cpp</a> - * \li <a href="_spatial_searching_2example_spatial_searching_8cpp-example.html"> - * Spatial_searching/example_spatial_searching.cpp</a> - * \li <a href="_subsampling_2example_choose_n_farthest_points_8cpp-example.html"> - * Subsampling/example_choose_n_farthest_points.cpp</a> - * \li <a href="_subsampling_2example_pick_n_random_points_8cpp-example.html"> - * Subsampling/example_pick_n_random_points.cpp</a> - * \li <a href="_subsampling_2example_sparsify_point_set_8cpp-example.html"> - * Subsampling/example_sparsify_point_set.cpp</a> - * \li <a href="_tangential_complex_2example_basic_8cpp-example.html"> - * Tangential_complex/example_basic.cpp</a> - * \li <a href="_tangential_complex_2example_with_perturb_8cpp-example.html"> - * Tangential_complex/example_with_perturb.cpp</a> - * \li <a href="_alpha_complex_2_weighted_alpha_complex_3d_from_points_8cpp-example.html"> - * Alpha_complex/Weighted_alpha_complex_3d_from_points.cpp</a> - * \li <a href="_alpha_complex_2alpha_complex_3d_persistence_8cpp-example.html"> - * Alpha_complex/alpha_complex_3d_persistence.cpp</a> + * \li \gudhi_example_link{Simplex_tree,example_alpha_shapes_3_simplex_tree_from_off_file.cpp} + * \li \gudhi_example_link{Witness_complex,strong_witness_persistence.cpp} + * \li \gudhi_example_link{Witness_complex,weak_witness_persistence.cpp} + * \li \gudhi_example_link{Witness_complex,example_strong_witness_complex_off.cpp} + * \li \gudhi_example_link{Witness_complex,example_witness_complex_off.cpp} + * \li \gudhi_example_link{Witness_complex,example_witness_complex_sphere.cpp} + * \li \gudhi_example_link{Alpha_complex,Alpha_complex_from_off.cpp} + * \li \gudhi_example_link{Alpha_complex,Alpha_complex_from_points.cpp} + * \li \gudhi_example_link{Alpha_complex,alpha_complex_persistence.cpp} + * \li \gudhi_example_link{Persistent_cohomology,custom_persistence_sort.cpp} + * \li \gudhi_example_link{Bottleneck_distance,alpha_rips_persistence_bottleneck_distance.cpp} + * \li \gudhi_example_link{Bottleneck_distance,bottleneck_basic_example.cpp} + * \li \gudhi_example_link{Bottleneck_distance,bottleneck_distance.cpp} + * \li \gudhi_example_link{Nerve_GIC,CoordGIC.cpp} + * \li \gudhi_example_link{Nerve_GIC,FuncGIC.cpp} + * \li \gudhi_example_link{Nerve_GIC,Nerve.cpp} + * \li \gudhi_example_link{Nerve_GIC,VoronoiGIC.cpp} + * \li \gudhi_example_link{Spatial_searching,example_spatial_searching.cpp} + * \li \gudhi_example_link{Subsampling,example_choose_n_farthest_points.cpp} + * \li \gudhi_example_link{Subsampling,example_pick_n_random_points.cpp} + * \li \gudhi_example_link{Subsampling,example_sparsify_point_set.cpp} + * \li \gudhi_example_link{Tangential_complex,example_basic.cpp} + * \li \gudhi_example_link{Tangential_complex,example_with_perturb.cpp} + * \li \gudhi_example_link{Alpha_complex,Weighted_alpha_complex_3d_from_points.cpp} + * \li \gudhi_example_link{Alpha_complex,alpha_complex_3d_persistence.cpp} + * \li \gudhi_example_link{Coxeter_triangulation,manifold_tracing_flat_torus_with_boundary.cpp} * * \subsection eigen Eigen * Some GUDHI modules (cf. \ref main_page "modules list"), and few examples require - * <a target="_blank" href="http://eigen.tuxfamily.org/">Eigen</a> is a C++ template library for linear algebra: + * <a target="_blank" href="https://eigen.tuxfamily.org">Eigen</a> is a C++ template library for linear algebra: * matrices, vectors, numerical solvers, and related algorithms. * - * The following examples/utilities require the <a target="_blank" href="http://eigen.tuxfamily.org/">Eigen</a> and will not be + * The following examples/utilities require the <a target="_blank" href="https://eigen.tuxfamily.org">Eigen</a> and will not be * built if Eigen is not installed: - * \li <a href="_alpha_complex_2_alpha_complex_from_off_8cpp-example.html"> - * Alpha_complex/Alpha_complex_from_off.cpp</a> - * \li <a href="_alpha_complex_2_alpha_complex_from_points_8cpp-example.html"> - * Alpha_complex/Alpha_complex_from_points.cpp</a> - * \li <a href="_alpha_complex_2alpha_complex_persistence_8cpp-example.html"> - * Alpha_complex/alpha_complex_persistence.cpp</a> - * \li <a href="_alpha_complex_2alpha_complex_3d_persistence_8cpp-example.html"> - * Alpha_complex/alpha_complex_3d_persistence.cpp</a> - * \li <a href="_alpha_complex_2_weighted_alpha_complex_3d_from_points_8cpp-example.html"> - * Alpha_complex/Weighted_alpha_complex_3d_from_points.cpp</a> - * \li <a href="_bottleneck_distance_2alpha_rips_persistence_bottleneck_distance_8cpp-example.html"> - * Bottleneck_distance/alpha_rips_persistence_bottleneck_distance.cpp.cpp</a> - * \li <a href="_persistent_cohomology_2custom_persistence_sort_8cpp-example.html"> - * Persistent_cohomology/custom_persistence_sort.cpp</a> - * \li <a href="_spatial_searching_2example_spatial_searching_8cpp-example.html"> - * Spatial_searching/example_spatial_searching.cpp</a> - * \li <a href="_subsampling_2example_choose_n_farthest_points_8cpp-example.html"> - * Subsampling/example_choose_n_farthest_points.cpp</a> - * \li <a href="_subsampling_2example_pick_n_random_points_8cpp-example.html"> - * Subsampling/example_pick_n_random_points.cpp</a> - * \li <a href="_subsampling_2example_sparsify_point_set_8cpp-example.html"> - * Subsampling/example_sparsify_point_set.cpp</a> - * \li <a href="_tangential_complex_2example_basic_8cpp-example.html"> - * Tangential_complex/example_basic.cpp</a> - * \li <a href="_tangential_complex_2example_with_perturb_8cpp-example.html"> - * Tangential_complex/example_with_perturb.cpp</a> - * \li <a href="_witness_complex_2strong_witness_persistence_8cpp-example.html"> - * Witness_complex/strong_witness_persistence.cpp</a> - * \li <a href="_witness_complex_2weak_witness_persistence_8cpp-example.html"> - * Witness_complex/weak_witness_persistence.cpp</a> - * \li <a href="_witness_complex_2example_strong_witness_complex_off_8cpp-example.html"> - * Witness_complex/example_strong_witness_complex_off.cpp</a> - * \li <a href="_witness_complex_2example_witness_complex_off_8cpp-example.html"> - * Witness_complex/example_witness_complex_off.cpp</a> - * \li <a href="_witness_complex_2example_witness_complex_sphere_8cpp-example.html"> - * Witness_complex/example_witness_complex_sphere.cpp</a> + * \li \gudhi_example_link{Alpha_complex,Alpha_complex_from_off.cpp} + * \li \gudhi_example_link{Alpha_complex,Alpha_complex_from_points.cpp} + * \li \gudhi_example_link{Alpha_complex,alpha_complex_persistence.cpp} + * \li \gudhi_example_link{Alpha_complex,alpha_complex_3d_persistence.cpp} + * \li \gudhi_example_link{Alpha_complex,Weighted_alpha_complex_3d_from_points.cpp} + * \li \gudhi_example_link{Bottleneck_distance,alpha_rips_persistence_bottleneck_distance.cpp} + * \li \gudhi_example_link{Persistent_cohomology,custom_persistence_sort.cpp} + * \li \gudhi_example_link{Spatial_searching,example_spatial_searching.cpp} + * \li \gudhi_example_link{Subsampling,example_choose_n_farthest_points.cpp} + * \li \gudhi_example_link{Subsampling,example_pick_n_random_points.cpp} + * \li \gudhi_example_link{Subsampling,example_sparsify_point_set.cpp} + * \li \gudhi_example_link{Tangential_complex,example_basic.cpp} + * \li \gudhi_example_link{Tangential_complex,example_with_perturb.cpp} + * \li \gudhi_example_link{Witness_complex,strong_witness_persistence.cpp} + * \li \gudhi_example_link{Witness_complex,weak_witness_persistence.cpp} + * \li \gudhi_example_link{Witness_complex,example_strong_witness_complex_off.cpp} + * \li \gudhi_example_link{Witness_complex,example_witness_complex_off.cpp} + * \li \gudhi_example_link{Witness_complex,example_witness_complex_sphere.cpp} + * \li \gudhi_example_link{Coxeter_triangulation,cell_complex_from_basic_circle_manifold.cpp} + * \li \gudhi_example_link{Coxeter_triangulation,manifold_tracing_custom_function.cpp} + * \li \gudhi_example_link{Coxeter_triangulation,manifold_tracing_flat_torus_with_boundary.cpp} * * \subsection tbb Threading Building Blocks - * <a target="_blank" href="https://www.threadingbuildingblocks.org/">Intel® TBB</a> lets you easily write parallel + * <a target="_blank" href="https://github.com/oneapi-src/oneTBB">Intel® TBB</a> lets you easily write parallel * C++ programs that take full advantage of multicore performance, that are portable and composable, and that have * future-proof scalability. * * Having Intel® TBB installed is recommended to parallelize and accelerate some GUDHI computations. * * The following examples/utilities are using Intel® TBB if installed: - * \li <a href="_alpha_complex_2_alpha_complex_from_off_8cpp-example.html"> - * Alpha_complex/Alpha_complex_from_off.cpp</a> - * \li <a href="_alpha_complex_2_alpha_complex_from_points_8cpp-example.html"> - * Alpha_complex/Alpha_complex_from_points.cpp</a> - * \li <a href="_alpha_complex_2alpha_complex_3d_persistence_8cpp-example.html"> - * Alpha_complex/alpha_complex_3d_persistence.cpp</a> - * \li <a href="_alpha_complex_2alpha_complex_persistence_8cpp-example.html"> - * Alpha_complex/alpha_complex_persistence.cpp</a> - * \li <a href="_bitmap_cubical_complex_2_bitmap_cubical_complex_8cpp-example.html"> - * Bitmap_cubical_complex/cubical_complex_persistence.cpp</a> - * \li <a href="_bitmap_cubical_complex_2_bitmap_cubical_complex_periodic_boundary_conditions_8cpp-example.html"> - * Bitmap_cubical_complex/periodic_cubical_complex_persistence.cpp</a> - * \li <a href="_bitmap_cubical_complex_2_random_bitmap_cubical_complex_8cpp-example.html"> - * Bitmap_cubical_complex/Random_bitmap_cubical_complex.cpp</a> - * \li <a href="_nerve__g_i_c_2_coord_g_i_c_8cpp-example.html"> - * Nerve_GIC/CoordGIC.cpp</a> - * \li <a href="_nerve__g_i_c_2_func_g_i_c_8cpp-example.html"> - * Nerve_GIC/FuncGIC.cpp</a> - * \li <a href="_nerve__g_i_c_2_nerve_8cpp-example.html"> - * Nerve_GIC/Nerve.cpp</a> - * \li <a href="_nerve__g_i_c_2_voronoi_g_i_c_8cpp-example.html"> - * Nerve_GIC/VoronoiGIC.cpp</a> - * \li <a href="_simplex_tree_2simple_simplex_tree_8cpp-example.html"> - * Simplex_tree/simple_simplex_tree.cpp</a> - * \li <a href="_simplex_tree_2example_alpha_shapes_3_simplex_tree_from_off_file_8cpp-example.html"> - * Simplex_tree/example_alpha_shapes_3_simplex_tree_from_off_file.cpp</a> - * \li <a href="_simplex_tree_2simplex_tree_from_cliques_of_graph_8cpp-example.html"> - * Simplex_tree/simplex_tree_from_cliques_of_graph.cpp</a> - * \li <a href="_simplex_tree_2graph_expansion_with_blocker_8cpp-example.html"> - * Simplex_tree/graph_expansion_with_blocker.cpp</a> - * \li <a href="_persistent_cohomology_2alpha_complex_3d_persistence_8cpp-example.html"> - * Persistent_cohomology/alpha_complex_3d_persistence.cpp</a> - * \li <a href="_persistent_cohomology_2alpha_complex_persistence_8cpp-example.html"> - * Persistent_cohomology/alpha_complex_persistence.cpp</a> - * \li <a href="_persistent_cohomology_2rips_persistence_via_boundary_matrix_8cpp-example.html"> - * Persistent_cohomology/rips_persistence_via_boundary_matrix.cpp</a> - * \li <a href="_persistent_cohomology_2persistence_from_file_8cpp-example.html"> - * Persistent_cohomology/persistence_from_file.cpp</a> - * \li <a href="_persistent_cohomology_2persistence_from_simple_simplex_tree_8cpp-example.html"> - * Persistent_cohomology/persistence_from_simple_simplex_tree.cpp</a> - * \li <a href="_persistent_cohomology_2plain_homology_8cpp-example.html"> - * Persistent_cohomology/plain_homology.cpp</a> - * \li <a href="_persistent_cohomology_2rips_multifield_persistence_8cpp-example.html"> - * Persistent_cohomology/rips_multifield_persistence.cpp</a> - * \li <a href="_persistent_cohomology_2rips_persistence_step_by_step_8cpp-example.html"> - * Persistent_cohomology/rips_persistence_step_by_step.cpp</a> - * \li <a href="_persistent_cohomology_2custom_persistence_sort_8cpp-example.html"> - * Persistent_cohomology/custom_persistence_sort.cpp</a> - * \li <a href="_rips_complex_2example_one_skeleton_rips_from_points_8cpp-example.html"> - * Rips_complex/example_one_skeleton_rips_from_points.cpp</a> - * \li <a href="_rips_complex_2example_rips_complex_from_off_file_8cpp-example.html"> - * Rips_complex/example_rips_complex_from_off_file.cpp</a> - * \li <a href="_rips_complex_2rips_distance_matrix_persistence_8cpp-example.html"> - * Rips_complex/rips_distance_matrix_persistence.cpp</a> - * \li <a href="_rips_complex_2rips_persistence_8cpp-example.html"> - * Rips_complex/rips_persistence.cpp</a> - * \li <a href="_witness_complex_2strong_witness_persistence_8cpp-example.html"> - * Witness_complex/strong_witness_persistence.cpp</a> - * \li <a href="_witness_complex_2weak_witness_persistence_8cpp-example.html"> - * Witness_complex/weak_witness_persistence.cpp</a> - * \li <a href="_witness_complex_2example_nearest_landmark_table_8cpp-example.html"> - * Witness_complex/example_nearest_landmark_table.cpp</a> + * \li \gudhi_example_link{Alpha_complex,Alpha_complex_from_off.cpp} + * \li \gudhi_example_link{Alpha_complex,Alpha_complex_from_points.cpp} + * \li \gudhi_example_link{Alpha_complex,alpha_complex_3d_persistence.cpp} + * \li \gudhi_example_link{Alpha_complex,alpha_complex_persistence.cpp} + * \li \gudhi_example_link{Bitmap_cubical_complex,cubical_complex_persistence.cpp} + * \li \gudhi_example_link{Bitmap_cubical_complex,periodic_cubical_complex_persistence.cpp} + * \li \gudhi_example_link{Bitmap_cubical_complex,Random_bitmap_cubical_complex.cpp} + * \li \gudhi_example_link{Nerve_GIC,CoordGIC.cpp} + * \li \gudhi_example_link{Nerve_GIC,FuncGIC.cpp} + * \li \gudhi_example_link{Nerve_GIC,Nerve.cpp} + * \li \gudhi_example_link{Nerve_GIC,VoronoiGIC.cpp} + * \li \gudhi_example_link{Simplex_tree,simple_simplex_tree.cpp} + * \li \gudhi_example_link{Simplex_tree,example_alpha_shapes_3_simplex_tree_from_off_file.cpp} + * \li \gudhi_example_link{Simplex_tree,simplex_tree_from_cliques_of_graph.cpp} + * \li \gudhi_example_link{Simplex_tree,graph_expansion_with_blocker.cpp} + * \li \gudhi_example_link{Persistent_cohomology,alpha_complex_3d_persistence.cpp} + * \li \gudhi_example_link{Persistent_cohomology,alpha_complex_persistence.cpp} + * \li \gudhi_example_link{Persistent_cohomology,rips_persistence_via_boundary_matrix.cpp} + * \li \gudhi_example_link{Persistent_cohomology,persistence_from_file.cpp} + * \li \gudhi_example_link{Persistent_cohomology,persistence_from_simple_simplex_tree.cpp} + * \li \gudhi_example_link{Persistent_cohomology,plain_homology.cpp} + * \li \gudhi_example_link{Persistent_cohomology,rips_multifield_persistence.cpp} + * \li \gudhi_example_link{Persistent_cohomology,rips_persistence_step_by_step.cpp} + * \li \gudhi_example_link{Persistent_cohomology,custom_persistence_sort.cpp} + * \li \gudhi_example_link{Rips_complex,example_one_skeleton_rips_from_points.cpp} + * \li \gudhi_example_link{Rips_complex,example_rips_complex_from_off_file.cpp} + * \li \gudhi_example_link{Rips_complex,rips_distance_matrix_persistence.cpp} + * \li \gudhi_example_link{Rips_complex,rips_persistence.cpp} + * \li \gudhi_example_link{Witness_complex,strong_witness_persistence.cpp} + * \li \gudhi_example_link{Witness_complex,weak_witness_persistence.cpp} + * \li \gudhi_example_link{Witness_complex,example_nearest_landmark_table.cpp} * * \section Contributions Bug reports and contributions - * Please help us improving the quality of the GUDHI library. You may report bugs or suggestions to: - * \verbatim Contact: gudhi-users@lists.gforge.inria.fr \endverbatim + * Please help us improving the quality of the GUDHI library. + * You may <a href="https://github.com/GUDHI/gudhi-devel/issues">report bugs</a> or + * <a href="https://gudhi.inria.fr/contact/">contact us</a> for any suggestions. * - * GUDHI is open to external contributions. If you want to join our development team, please contact us. + * GUDHI is open to external contributions. If you want to join our development team, please take some time to read our + * <a href="https://github.com/GUDHI/gudhi-devel/blob/master/.github/CONTRIBUTING.md">contributing guide</a>. * */ diff --git a/src/common/doc/main_page.md b/src/common/doc/main_page.md index e19af537..9b7c2853 100644 --- a/src/common/doc/main_page.md +++ b/src/common/doc/main_page.md @@ -135,7 +135,7 @@ </tr> </table> -## Filtrations and reconstructions {#FiltrationsReconstructions} +## Filtrations ### Alpha complex <table> @@ -178,10 +178,10 @@ The set of all simplices is filtered by the radius of their minimal enclosing ball. </td> <td width="15%"> - <b>Author:</b> Vincent Rouvreau<br> + <b>Author:</b> Vincent Rouvreau, Hind Montassif<br> <b>Introduced in:</b> GUDHI 2.2.0<br> - <b>Copyright:</b> MIT [(GPL v3)](../../licensing/)<br> - <b>Includes:</b> [Miniball](https://people.inf.ethz.ch/gaertner/subdir/software/miniball.html)<br> + <b>Copyright:</b> MIT [(LGPL v3)](../../licensing/)<br> + <b>Requires:</b> \ref cgal </td> </tr> <tr> @@ -231,13 +231,12 @@ homology of the input sequence. The resulting method is simple and extremely efficient. Computation of edge collapse and persistent homology of a filtered flag complex via edge collapse as described in - \cite edgecollapsesocg2020. + \cite edgecollapsearxiv. </td> <td width="15%"> - <b>Author:</b> Siddharth Pritam<br> + <b>Author:</b> Siddharth Pritam, Marc Glisse<br> <b>Introduced in:</b> GUDHI 3.3.0<br> - <b>Copyright:</b> MIT<br> - <b>Requires:</b> \ref eigen + <b>Copyright:</b> MIT </td> </tr> <tr> @@ -298,6 +297,32 @@ </tr> </table> +## Manifold reconstructions +### Coxeter triangulation + +<table> + <tr> + <td width="35%" rowspan=2> + \image html "manifold_tracing_on_custom_function_example.png" + </td> + <td width="50%"> + Coxeter triangulation module is designed to provide tools for constructing a piecewise-linear approximation of an + \f$m\f$-dimensional smooth manifold embedded in \f$ \mathbb{R}^d \f$ using an ambient triangulation. + </td> + <td width="15%"> + <b>Author:</b> Siargey Kachanovich<br> + <b>Introduced in:</b> GUDHI 3.4.0<br> + <b>Copyright:</b> MIT [(LGPL v3)](../../licensing/)<br> + <b>Requires:</b> \ref eigen ≥ 3.1.0 + </td> + </tr> + <tr> + <td colspan=2 height="25"> + <b>User manual:</b> \ref coxeter_triangulation + </td> + </tr> +</table> + ### Tangential complex <table> diff --git a/src/common/doc/stylesheet.css b/src/common/doc/stylesheet.css index 1df177a4..fb030e1f 100644..100755 --- a/src/common/doc/stylesheet.css +++ b/src/common/doc/stylesheet.css @@ -1,1367 +1,28 @@ -/* The standard CSS for doxygen 1.8.6 */ - -body, table, div, p, dl { - font: 400 14px/22px Roboto,sans-serif; -} - -/* @group Heading Levels */ - -h1.groupheader { - font-size: 150%; -} - -.title { - font: 400 14px/28px Roboto,sans-serif; - font-size: 150%; - font-weight: bold; - margin: 10px 2px; -} - -h2.groupheader { - border-bottom: 1px solid #879ECB; - color: #354C7B; - font-size: 150%; - font-weight: normal; - margin-top: 1.75em; - padding-top: 8px; - padding-bottom: 4px; - width: 100%; -} - -h3.groupheader { - font-size: 100%; -} - -h1, h2, h3, h4, h5, h6 { - -webkit-transition: text-shadow 0.5s linear; - -moz-transition: text-shadow 0.5s linear; - -ms-transition: text-shadow 0.5s linear; - -o-transition: text-shadow 0.5s linear; - transition: text-shadow 0.5s linear; - margin-right: 15px; -} - -h1.glow, h2.glow, h3.glow, h4.glow, h5.glow, h6.glow { - text-shadow: 0 0 15px cyan; -} - -dt { - font-weight: bold; -} - -div.multicol { - -moz-column-gap: 1em; - -webkit-column-gap: 1em; - -moz-column-count: 3; - -webkit-column-count: 3; -} - -p.startli, p.startdd { - margin-top: 2px; -} - -p.starttd { - margin-top: 0px; -} - -p.endli { - margin-bottom: 0px; -} - -p.enddd { - margin-bottom: 4px; -} - -p.endtd { - margin-bottom: 2px; -} - -/* @end */ - -caption { - font-weight: bold; -} - -span.legend { - font-size: 70%; - text-align: center; -} - -h3.version { - font-size: 90%; - text-align: center; -} - -div.qindex, div.navtab{ - background-color: #EBEFF6; - border: 1px solid #A3B4D7; - text-align: center; -} - -div.qindex, div.navpath { - width: 100%; - line-height: 140%; -} - -div.navtab { - margin-right: 15px; -} - -/* @group Link Styling */ - -a { - color: #3D578C; - font-weight: normal; - text-decoration: none; -} - -.contents a:visited { - color: #4665A2; -} - -a:hover { - text-decoration: underline; -} - -a.qindex { - font-weight: bold; -} - -a.qindexHL { - font-weight: bold; - background-color: #9CAFD4; - color: #ffffff; - border: 1px double #869DCA; -} - -.contents a.qindexHL:visited { - color: #ffffff; -} - -a.el { - font-weight: bold; -} - -a.elRef { -} - -a.code, a.code:visited, a.line, a.line:visited { - color: #4665A2; -} - -a.codeRef, a.codeRef:visited, a.lineRef, a.lineRef:visited { - color: #4665A2; -} - -/* @end */ - -dl.el { - margin-left: -1cm; -} - -pre.fragment { - border: 1px solid #C4CFE5; - background-color: #FBFCFD; - padding: 4px 6px; - margin: 4px 8px 4px 2px; - overflow: auto; - word-wrap: break-word; - font-size: 9pt; - line-height: 125%; - font-family: monospace, fixed; - font-size: 105%; -} - -div.fragment { - padding: 4px 6px; - margin: 4px 8px 4px 2px; - background-color: #FBFCFD; - border: 1px solid #C4CFE5; -} - -div.line { - font-family: monospace, fixed; - font-size: 13px; - min-height: 13px; - line-height: 1.0; - text-wrap: unrestricted; - white-space: -moz-pre-wrap; /* Moz */ - white-space: -pre-wrap; /* Opera 4-6 */ - white-space: -o-pre-wrap; /* Opera 7 */ - white-space: pre-wrap; /* CSS3 */ - word-wrap: break-word; /* IE 5.5+ */ - text-indent: -53px; - padding-left: 53px; - padding-bottom: 0px; - margin: 0px; - -webkit-transition-property: background-color, box-shadow; - -webkit-transition-duration: 0.5s; - -moz-transition-property: background-color, box-shadow; - -moz-transition-duration: 0.5s; - -ms-transition-property: background-color, box-shadow; - -ms-transition-duration: 0.5s; - -o-transition-property: background-color, box-shadow; - -o-transition-duration: 0.5s; - transition-property: background-color, box-shadow; - transition-duration: 0.5s; -} - -div.line.glow { - background-color: cyan; - box-shadow: 0 0 10px cyan; -} - - -span.lineno { - padding-right: 4px; - text-align: right; - border-right: 2px solid #0F0; - background-color: #E8E8E8; - white-space: pre; -} -span.lineno a { - background-color: #D8D8D8; -} - -span.lineno a:hover { - background-color: #C8C8C8; -} - -div.ah { - background-color: black; - font-weight: bold; - color: #ffffff; - margin-bottom: 3px; - margin-top: 3px; - padding: 0.2em; - border: solid thin #333; - border-radius: 0.5em; - -webkit-border-radius: .5em; - -moz-border-radius: .5em; - box-shadow: 2px 2px 3px #999; - -webkit-box-shadow: 2px 2px 3px #999; - -moz-box-shadow: rgba(0, 0, 0, 0.15) 2px 2px 2px; - background-image: -webkit-gradient(linear, left top, left bottom, from(#eee), to(#000),color-stop(0.3, #444)); - background-image: -moz-linear-gradient(center top, #eee 0%, #444 40%, #000); -} - -div.groupHeader { - margin-left: 16px; - margin-top: 12px; - font-weight: bold; -} - -div.groupText { - margin-left: 16px; - font-style: italic; -} - -body { - background-color: white; - color: black; - margin: 0; -} - -div.contents { - margin-top: 10px; - margin-left: 12px; - margin-right: 8px; -} - -td.indexkey { - background-color: #EBEFF6; - font-weight: bold; - border: 1px solid #C4CFE5; - margin: 2px 0px 2px 0; - padding: 2px 10px; - white-space: nowrap; - vertical-align: top; -} - -td.indexvalue { - background-color: #EBEFF6; - border: 1px solid #C4CFE5; - padding: 2px 10px; - margin: 2px 0px; -} - -tr.memlist { - background-color: #EEF1F7; -} - -p.formulaDsp { - text-align: center; -} - -img.formulaDsp { - -} - -img.formulaInl { - vertical-align: middle; -} - -div.center { - text-align: center; - margin-top: 0px; - margin-bottom: 0px; - padding: 0px; -} - -div.center img { - border: 0px; -} - -address.footer { - text-align: right; - padding-right: 12px; -} - -img.footer { - border: 0px; - vertical-align: middle; -} - -/* @group Code Colorization */ - -span.keyword { - color: #008000 -} - -span.keywordtype { - color: #604020 -} - -span.keywordflow { - color: #e08000 -} - -span.comment { - color: #800000 -} - -span.preprocessor { - color: #806020 -} - -span.stringliteral { - color: #002080 -} - -span.charliteral { - color: #008080 -} - -span.vhdldigit { - color: #ff00ff -} - -span.vhdlchar { - color: #000000 -} - -span.vhdlkeyword { - color: #700070 -} - -span.vhdllogic { - color: #ff0000 -} - -blockquote { - background-color: #F7F8FB; - border-left: 2px solid #9CAFD4; - margin: 0 24px 0 4px; - padding: 0 12px 0 16px; -} - -/* @end */ - -/* -.search { - color: #003399; - font-weight: bold; -} - -form.search { - margin-bottom: 0px; - margin-top: 0px; -} - -input.search { - font-size: 75%; - color: #000080; - font-weight: normal; - background-color: #e8eef2; -} -*/ - -td.tiny { - font-size: 75%; -} - -.dirtab { - padding: 4px; - border-collapse: collapse; - border: 1px solid #A3B4D7; -} - -th.dirtab { - background: #EBEFF6; - font-weight: bold; -} - -hr { - height: 0px; - border: none; - border-top: 1px solid #4A6AAA; -} - -hr.footer { - height: 1px; -} - -/* @group Member Descriptions */ - -table.memberdecls { - border-spacing: 0px; - padding: 0px; -} - -.memberdecls td, .fieldtable tr { - -webkit-transition-property: background-color, box-shadow; - -webkit-transition-duration: 0.5s; - -moz-transition-property: background-color, box-shadow; - -moz-transition-duration: 0.5s; - -ms-transition-property: background-color, box-shadow; - -ms-transition-duration: 0.5s; - -o-transition-property: background-color, box-shadow; - -o-transition-duration: 0.5s; - transition-property: background-color, box-shadow; - transition-duration: 0.5s; -} - -.memberdecls td.glow, .fieldtable tr.glow { - background-color: cyan; - box-shadow: 0 0 15px cyan; -} - -.mdescLeft, .mdescRight, -.memItemLeft, .memItemRight, -.memTemplItemLeft, .memTemplItemRight, .memTemplParams { - background-color: #F9FAFC; - border: none; - margin: 4px; - padding: 1px 0 0 8px; -} - -.mdescLeft, .mdescRight { - padding: 0px 8px 4px 8px; - color: #555; -} - -.memSeparator { - border-bottom: 1px solid #DEE4F0; - line-height: 1px; - margin: 0px; - padding: 0px; -} - -.memItemLeft, .memTemplItemLeft { - white-space: nowrap; -} - -.memItemRight { - width: 100%; -} - -.memTemplParams { - color: #4665A2; - white-space: nowrap; - font-size: 80%; -} - -/* @end */ - -/* @group Member Details */ - -/* Styles for detailed member documentation */ - -.memtemplate { - font-size: 80%; - color: #4665A2; - font-weight: normal; - margin-left: 9px; -} - -.memnav { - background-color: #EBEFF6; - border: 1px solid #A3B4D7; - text-align: center; - margin: 2px; - margin-right: 15px; - padding: 2px; -} - -.mempage { - width: 100%; -} - -.memitem { - padding: 0; - margin-bottom: 10px; - margin-right: 5px; - -webkit-transition: box-shadow 0.5s linear; - -moz-transition: box-shadow 0.5s linear; - -ms-transition: box-shadow 0.5s linear; - -o-transition: box-shadow 0.5s linear; - transition: box-shadow 0.5s linear; - display: table !important; - width: 100%; -} - -.memitem.glow { - box-shadow: 0 0 15px cyan; -} - -.memname { - font-weight: bold; - margin-left: 6px; -} - -.memname td { - vertical-align: bottom; -} - -.memproto, dl.reflist dt { - border-top: 1px solid #A8B8D9; - border-left: 1px solid #A8B8D9; - border-right: 1px solid #A8B8D9; - padding: 6px 0px 6px 0px; - color: #253555; - font-weight: bold; - text-shadow: 0px 1px 1px rgba(255, 255, 255, 0.9); - background-image:url('nav_f.png'); - background-repeat:repeat-x; - background-color: #E2E8F2; - /* opera specific markup */ - box-shadow: 5px 5px 5px rgba(0, 0, 0, 0.15); - border-top-right-radius: 4px; - border-top-left-radius: 4px; - /* firefox specific markup */ - -moz-box-shadow: rgba(0, 0, 0, 0.15) 5px 5px 5px; - -moz-border-radius-topright: 4px; - -moz-border-radius-topleft: 4px; - /* webkit specific markup */ - -webkit-box-shadow: 5px 5px 5px rgba(0, 0, 0, 0.15); - -webkit-border-top-right-radius: 4px; - -webkit-border-top-left-radius: 4px; - -} - -.memdoc, dl.reflist dd { - border-bottom: 1px solid #A8B8D9; - border-left: 1px solid #A8B8D9; - border-right: 1px solid #A8B8D9; - padding: 6px 10px 2px 10px; - background-color: #FBFCFD; - border-top-width: 0; - background-image:url('nav_g.png'); - background-repeat:repeat-x; - background-color: #FFFFFF; - /* opera specific markup */ - border-bottom-left-radius: 4px; - border-bottom-right-radius: 4px; - box-shadow: 5px 5px 5px rgba(0, 0, 0, 0.15); - /* firefox specific markup */ - -moz-border-radius-bottomleft: 4px; - -moz-border-radius-bottomright: 4px; - -moz-box-shadow: rgba(0, 0, 0, 0.15) 5px 5px 5px; - /* webkit specific markup */ - -webkit-border-bottom-left-radius: 4px; - -webkit-border-bottom-right-radius: 4px; - -webkit-box-shadow: 5px 5px 5px rgba(0, 0, 0, 0.15); -} - -dl.reflist dt { - padding: 5px; -} - -dl.reflist dd { - margin: 0px 0px 10px 0px; - padding: 5px; -} - -.paramkey { - text-align: right; -} - -.paramtype { - white-space: nowrap; -} - -.paramname { - color: #602020; - white-space: nowrap; -} -.paramname em { - font-style: normal; -} -.paramname code { - line-height: 14px; -} - -.params, .retval, .exception, .tparams { - margin-left: 0px; - padding-left: 0px; -} - -.params .paramname, .retval .paramname { - font-weight: bold; - vertical-align: top; -} - -.params .paramtype { - font-style: italic; - vertical-align: top; -} - -.params .paramdir { - font-family: "courier new",courier,monospace; - vertical-align: top; -} - -table.mlabels { - border-spacing: 0px; -} - -td.mlabels-left { - width: 100%; - padding: 0px; -} - -td.mlabels-right { - vertical-align: bottom; - padding: 0px; - white-space: nowrap; -} - -span.mlabels { - margin-left: 8px; -} - -span.mlabel { - background-color: #728DC1; - border-top:1px solid #5373B4; - border-left:1px solid #5373B4; - border-right:1px solid #C4CFE5; - border-bottom:1px solid #C4CFE5; - text-shadow: none; - color: white; - margin-right: 4px; - padding: 2px 3px; - border-radius: 3px; - font-size: 7pt; - white-space: nowrap; - vertical-align: middle; -} - - - -/* @end */ - -/* these are for tree view when not used as main index */ - -div.directory { - margin: 10px 0px; - border-top: 1px solid #A8B8D9; - border-bottom: 1px solid #A8B8D9; - width: 100%; -} - -.directory table { - border-collapse:collapse; -} - -.directory td { - margin: 0px; - padding: 0px; - vertical-align: top; -} - -.directory td.entry { - white-space: nowrap; - padding-right: 6px; - padding-top: 3px; -} - -.directory td.entry a { - outline:none; -} - -.directory td.entry a img { - border: none; -} - -.directory td.desc { - width: 100%; - padding-left: 6px; - padding-right: 6px; - padding-top: 3px; - border-left: 1px solid rgba(0,0,0,0.05); -} - -.directory tr.even { - padding-left: 6px; - background-color: #F7F8FB; -} - -.directory img { - vertical-align: -30%; -} - -.directory .levels { - white-space: nowrap; - width: 100%; - text-align: right; - font-size: 9pt; -} - -.directory .levels span { - cursor: pointer; - padding-left: 2px; - padding-right: 2px; - color: #3D578C; -} - -div.dynheader { - margin-top: 8px; - -webkit-touch-callout: none; - -webkit-user-select: none; - -khtml-user-select: none; - -moz-user-select: none; - -ms-user-select: none; - user-select: none; -} - -address { - font-style: normal; - color: #2A3D61; -} - -table.doxtable { - border-collapse:collapse; - margin-top: 4px; - margin-bottom: 4px; -} - -table.doxtable td, table.doxtable th { - border: 1px solid #2D4068; - padding: 3px 7px 2px; -} - -table.doxtable th { - background-color: #374F7F; - color: #FFFFFF; - font-size: 110%; - padding-bottom: 4px; - padding-top: 5px; -} - -table.fieldtable { - /*width: 100%;*/ - margin-bottom: 10px; - border: 1px solid #A8B8D9; - border-spacing: 0px; - -moz-border-radius: 4px; - -webkit-border-radius: 4px; - border-radius: 4px; - -moz-box-shadow: rgba(0, 0, 0, 0.15) 2px 2px 2px; - -webkit-box-shadow: 2px 2px 2px rgba(0, 0, 0, 0.15); - box-shadow: 2px 2px 2px rgba(0, 0, 0, 0.15); -} - -.fieldtable td, .fieldtable th { - padding: 3px 7px 2px; -} - -.fieldtable td.fieldtype, .fieldtable td.fieldname { - white-space: nowrap; - border-right: 1px solid #A8B8D9; - border-bottom: 1px solid #A8B8D9; - vertical-align: top; -} - -.fieldtable td.fieldname { - padding-top: 3px; -} - -.fieldtable td.fielddoc { - border-bottom: 1px solid #A8B8D9; - /*width: 100%;*/ -} - -.fieldtable td.fielddoc p:first-child { - margin-top: 0px; -} - -.fieldtable td.fielddoc p:last-child { - margin-bottom: 2px; -} - -.fieldtable tr:last-child td { - border-bottom: none; -} - -.fieldtable th { - background-image:url('nav_f.png'); - background-repeat:repeat-x; - background-color: #E2E8F2; - font-size: 90%; - color: #253555; - padding-bottom: 4px; - padding-top: 5px; - text-align:left; - -moz-border-radius-topleft: 4px; - -moz-border-radius-topright: 4px; - -webkit-border-top-left-radius: 4px; - -webkit-border-top-right-radius: 4px; - border-top-left-radius: 4px; - border-top-right-radius: 4px; - border-bottom: 1px solid #A8B8D9; -} - - -.tabsearch { - top: 0px; - left: 10px; - height: 36px; - background-image: url('tab_b.png'); - z-index: 101; - overflow: hidden; - font-size: 13px; -} - -.navpath ul -{ - font-size: 11px; - background-image:url('tab_b.png'); - background-repeat:repeat-x; - background-position: 0 -5px; - height:30px; - line-height:30px; - color:#8AA0CC; - border:solid 1px #C2CDE4; - overflow:hidden; - margin:0px; - padding:0px; -} - -.navpath li -{ - list-style-type:none; - float:left; - padding-left:10px; - padding-right:15px; - background-image:url('bc_s.png'); - background-repeat:no-repeat; - background-position:right; - color:#364D7C; -} - -.navpath li.navelem a -{ - height:32px; - display:block; - text-decoration: none; - outline: none; - color: #283A5D; - font-family: 'Lucida Grande',Geneva,Helvetica,Arial,sans-serif; - text-shadow: 0px 1px 1px rgba(255, 255, 255, 0.9); - text-decoration: none; -} - -.navpath li.navelem a:hover -{ - color:#6884BD; -} - -.navpath li.footer -{ - list-style-type:none; - float:right; - padding-left:10px; - padding-right:15px; - background-image:none; - background-repeat:no-repeat; - background-position:right; - color:#364D7C; - font-size: 8pt; -} - - -div.summary -{ - float: right; - font-size: 8pt; - padding-right: 5px; - width: 50%; - text-align: right; -} - -div.summary a -{ - white-space: nowrap; -} - -div.ingroups -{ - font-size: 8pt; - width: 50%; - text-align: left; -} - -div.ingroups a -{ - white-space: nowrap; -} - -div.header -{ - background-image:url('nav_h.png'); - background-repeat:repeat-x; - background-color: #F9FAFC; - margin: 0px; - border-bottom: 1px solid #C4CFE5; -} - -div.headertitle -{ - padding: 5px 5px 5px 10px; -} - -dl -{ - padding: 0 0 0 10px; -} - -/* dl.note, dl.warning, dl.attention, dl.pre, dl.post, dl.invariant, dl.deprecated, dl.todo, dl.test, dl.bug */ -dl.section -{ - margin-left: 0px; - padding-left: 0px; -} - -dl.note -{ - margin-left:-7px; - padding-left: 3px; - border-left:4px solid; - border-color: #D0C000; -} - -dl.warning, dl.attention -{ - margin-left:-7px; - padding-left: 3px; - border-left:4px solid; - border-color: #FF0000; -} - -dl.pre, dl.post, dl.invariant -{ - margin-left:-7px; - padding-left: 3px; - border-left:4px solid; - border-color: #00D000; -} - -dl.deprecated -{ - margin-left:-7px; - padding-left: 3px; - border-left:4px solid; - border-color: #505050; -} - -dl.todo -{ - margin-left:-7px; - padding-left: 3px; - border-left:4px solid; - border-color: #00C0E0; -} - -dl.test -{ - margin-left:-7px; - padding-left: 3px; - border-left:4px solid; - border-color: #3030E0; -} - -dl.bug -{ - margin-left:-7px; - padding-left: 3px; - border-left:4px solid; - border-color: #C08050; -} - -dl.section dd { - margin-bottom: 6px; -} - - -#projectlogo -{ - text-align: center; - vertical-align: bottom; - border-collapse: separate; -} - -#projectlogo img -{ - border: 0px none; -} - #projectname { - border: 0px none; - font: 300% Tahoma, Arial,sans-serif; - margin: 0px; - padding: 2px 0px; + border: 0px none; } - #projectbrief { - font: 60% Tahoma, Arial,sans-serif; - margin: 0px; - padding: 0px; + font: 60% Tahoma, Arial,sans-serif; } - #projectnumber { - font: 80% Tahoma, Arial,sans-serif; - margin: 0px; - padding: 0px; -} - -#titlearea -{ - padding: 0px; - margin: 0px; - width: 100%; - border-bottom: 1px solid #5373B4; -} - -.image -{ - text-align: center; -} - -.dotgraph -{ - text-align: center; + font: 80% Tahoma, Arial,sans-serif; } - -.mscgraph +.arrow { - text-align: center; -} - -.diagraph -{ - text-align: center; -} - -.caption -{ - font-weight: bold; -} - -div.zoom -{ - border: 1px solid #90A5CE; -} - -dl.citelist { - margin-bottom:50px; -} - -dl.citelist dt { - color:#334975; - float:left; - font-weight:bold; - margin-right:10px; - padding:5px; -} - -dl.citelist dd { - margin:2px 0; - padding:5px 0; -} - -div.toc { - padding: 14px 25px; - background-color: #F4F6FA; - border: 1px solid #D8DFEE; - border-radius: 7px 7px 7px 7px; - float: right; - height: auto; - margin: 0 20px 10px 10px; - width: 200px; -} - -div.toc li { - background: url("bdwn.png") no-repeat scroll 0 5px transparent; - font: 10px/1.2 Verdana,DejaVu Sans,Geneva,sans-serif; - margin-top: 5px; - padding-left: 10px; - padding-top: 2px; -} - -div.toc h3 { - font: bold 12px/1.2 Arial,FreeSans,sans-serif; - color: #4665A2; - border-bottom: 0 none; - margin: 0; -} - -div.toc ul { - list-style: none outside none; - border: medium none; - padding: 0px; -} - -div.toc li.level1 { - margin-left: 0px; -} - -div.toc li.level2 { - margin-left: 15px; -} - -div.toc li.level3 { - margin-left: 30px; -} - -div.toc li.level4 { - margin-left: 45px; -} - -.inherit_header { - font-weight: bold; - color: gray; - cursor: pointer; - -webkit-touch-callout: none; - -webkit-user-select: none; - -khtml-user-select: none; - -moz-user-select: none; - -ms-user-select: none; - user-select: none; -} - -.inherit_header td { - padding: 6px 0px 2px 5px; -} - -.inherit { - display: none; -} - -tr.heading h2 { - margin-top: 12px; - margin-bottom: 4px; -} - -/* tooltip related style info */ - -.ttc { - position: absolute; - display: none; -} - -#powerTip { - cursor: default; - white-space: nowrap; - background-color: white; - border: 1px solid gray; - border-radius: 4px 4px 4px 4px; - box-shadow: 1px 1px 7px gray; - display: none; - font-size: smaller; - max-width: 80%; - opacity: 0.9; - padding: 1ex 1em 1em; - position: absolute; - z-index: 2147483647; + width: auto; + height: auto; + padding-left: 16px; } - -#powerTip div.ttdoc { - color: grey; - font-style: italic; -} - -#powerTip div.ttname a { - font-weight: bold; -} - -#powerTip div.ttname { - font-weight: bold; -} - -#powerTip div.ttdeci { - color: #006318; -} - -#powerTip div { - margin: 0px; - padding: 0px; - font: 12px/16px Roboto,sans-serif; -} - -#powerTip:before, #powerTip:after { - content: ""; - position: absolute; - margin: 0px; -} - -#powerTip.n:after, #powerTip.n:before, -#powerTip.s:after, #powerTip.s:before, -#powerTip.w:after, #powerTip.w:before, -#powerTip.e:after, #powerTip.e:before, -#powerTip.ne:after, #powerTip.ne:before, -#powerTip.se:after, #powerTip.se:before, -#powerTip.nw:after, #powerTip.nw:before, -#powerTip.sw:after, #powerTip.sw:before { - border: solid transparent; - content: " "; - height: 0; - width: 0; - position: absolute; -} - -#powerTip.n:after, #powerTip.s:after, -#powerTip.w:after, #powerTip.e:after, -#powerTip.nw:after, #powerTip.ne:after, -#powerTip.sw:after, #powerTip.se:after { - border-color: rgba(255, 255, 255, 0); -} - -#powerTip.n:before, #powerTip.s:before, -#powerTip.w:before, #powerTip.e:before, -#powerTip.nw:before, #powerTip.ne:before, -#powerTip.sw:before, #powerTip.se:before { - border-color: rgba(128, 128, 128, 0); -} - -#powerTip.n:after, #powerTip.n:before, -#powerTip.ne:after, #powerTip.ne:before, -#powerTip.nw:after, #powerTip.nw:before { - top: 100%; -} - -#powerTip.n:after, #powerTip.ne:after, #powerTip.nw:after { - border-top-color: #ffffff; - border-width: 10px; - margin: 0px -10px; -} -#powerTip.n:before { - border-top-color: #808080; - border-width: 11px; - margin: 0px -11px; -} -#powerTip.n:after, #powerTip.n:before { - left: 50%; -} - -#powerTip.nw:after, #powerTip.nw:before { - right: 14px; -} - -#powerTip.ne:after, #powerTip.ne:before { - left: 14px; -} - -#powerTip.s:after, #powerTip.s:before, -#powerTip.se:after, #powerTip.se:before, -#powerTip.sw:after, #powerTip.sw:before { - bottom: 100%; -} - -#powerTip.s:after, #powerTip.se:after, #powerTip.sw:after { - border-bottom-color: #ffffff; - border-width: 10px; - margin: 0px -10px; -} - -#powerTip.s:before, #powerTip.se:before, #powerTip.sw:before { - border-bottom-color: #808080; - border-width: 11px; - margin: 0px -11px; -} - -#powerTip.s:after, #powerTip.s:before { - left: 50%; -} - -#powerTip.sw:after, #powerTip.sw:before { - right: 14px; -} - -#powerTip.se:after, #powerTip.se:before { - left: 14px; -} - -#powerTip.e:after, #powerTip.e:before { - left: 100%; -} -#powerTip.e:after { - border-left-color: #ffffff; - border-width: 10px; - top: 50%; - margin-top: -10px; -} -#powerTip.e:before { - border-left-color: #808080; - border-width: 11px; - top: 50%; - margin-top: -11px; -} - -#powerTip.w:after, #powerTip.w:before { - right: 100%; -} -#powerTip.w:after { - border-right-color: #ffffff; - border-width: 10px; - top: 50%; - margin-top: -10px; -} -#powerTip.w:before { - border-right-color: #808080; - border-width: 11px; - top: 50%; - margin-top: -11px; -} - -@media print -{ - #top { display: none; } - #side-nav { display: none; } - #nav-path { display: none; } - body { overflow:visible; } - h1, h2, h3, h4, h5, h6 { page-break-after: avoid; } - .summary { display: none; } - .memitem { page-break-inside: avoid; } - #doc-content - { - margin-left:0 !important; - height:auto !important; - width:auto !important; - overflow:inherit; - display:inline; - } +// With the doxygen versions <= 1.9.2 the default setting 'overflow: hidden;' causes problems. +// With the commit: +// Commit: 590198b416cd53313d150428d2f912586065ea0d [590198b] +// Date: Wednesday, December 1, 2021 1:37:26 PM +// issue #8924 Horizontal scroll bar missing in HTML for wide class="dotgraph" objects +// for the doxygen 1.9.3 version this has already been corrected but to run properly with the <= 1.9.2 version +// this setting is required +ul { + overflow: visible; } - diff --git a/src/common/include/gudhi/Points_3D_off_io.h b/src/common/include/gudhi/Points_3D_off_io.h index 39b79c96..4f74fd4b 100644 --- a/src/common/include/gudhi/Points_3D_off_io.h +++ b/src/common/include/gudhi/Points_3D_off_io.h @@ -125,7 +125,7 @@ class Points_3D_off_visitor_reader { * This example loads points from an OFF file and builds a vector of CGAL points in dimension 3. * Then, it is asked to display the points. * - * @include common/example_CGAL_3D_points_off_reader.cpp + * @include example_CGAL_3D_points_off_reader.cpp * * When launching: * @@ -134,7 +134,7 @@ class Points_3D_off_visitor_reader { * * the program output is: * - * @include common/cgal3Doffreader_result.txt + * @include cgal3Doffreader_result.txt */ template<typename Point_3> class Points_3D_off_reader { diff --git a/src/common/include/gudhi/Points_off_io.h b/src/common/include/gudhi/Points_off_io.h index 9dc40568..3aa8afd8 100644 --- a/src/common/include/gudhi/Points_off_io.h +++ b/src/common/include/gudhi/Points_off_io.h @@ -107,7 +107,7 @@ class Points_off_visitor_reader { * This example loads points from an OFF file and builds a vector of points (vector of double). * Then, it is asked to display the points. * - * \include common/example_vector_double_points_off_reader.cpp + * \include example_vector_double_points_off_reader.cpp * * When launching: * @@ -116,7 +116,7 @@ class Points_off_visitor_reader { * * the program outputs a file ../../data/points/alphacomplexdoc.off.txt: * - * \include common/vectordoubleoffreader_result.txt + * \include vectordoubleoffreader_result.txt */ template<typename Point_d> class Points_off_reader { diff --git a/src/common/include/gudhi/distance_functions.h b/src/common/include/gudhi/distance_functions.h index 9bbc62b7..5e5a1e31 100644 --- a/src/common/include/gudhi/distance_functions.h +++ b/src/common/include/gudhi/distance_functions.h @@ -13,8 +13,6 @@ #include <gudhi/Debug_utils.h> -#include <gudhi/Miniball.hpp> - #include <boost/range/metafunctions.hpp> #include <boost/range/size.hpp> @@ -59,53 +57,6 @@ class Euclidean_distance { } }; -/** @brief Compute the radius of the minimal enclosing ball between Points given by a range of coordinates. - * The points are assumed to have the same dimension. */ -class Minimal_enclosing_ball_radius { - public: - /** \brief Minimal_enclosing_ball_radius from two points. - * - * @param[in] point_1 First point. - * @param[in] point_2 second point. - * @return The minimal enclosing ball radius for the two points (aka. Euclidean distance / 2.). - * - * \tparam Point must be a range of Cartesian coordinates. - * - */ - template< typename Point > - typename std::iterator_traits<typename boost::range_iterator<Point>::type>::value_type - operator()(const Point& point_1, const Point& point_2) const { - return Euclidean_distance()(point_1, point_2) / 2.; - } - /** \brief Minimal_enclosing_ball_radius from a point cloud. - * - * @param[in] point_cloud The points. - * @return The minimal enclosing ball radius for the points. - * - * \tparam Point_cloud must be a range of points with Cartesian coordinates. - * Point_cloud is a range over a range of Coordinate. - * - */ - template< typename Point_cloud, - typename Point_iterator = typename boost::range_const_iterator<Point_cloud>::type, - typename Point = typename std::iterator_traits<Point_iterator>::value_type, - typename Coordinate_iterator = typename boost::range_const_iterator<Point>::type, - typename Coordinate = typename std::iterator_traits<Coordinate_iterator>::value_type> - Coordinate - operator()(const Point_cloud& point_cloud) const { - using Min_sphere = Miniball::Miniball<Miniball::CoordAccessor<Point_iterator, Coordinate_iterator>>; - - Min_sphere ms(boost::size(*point_cloud.begin()), point_cloud.begin(), point_cloud.end()); -#ifdef DEBUG_TRACES - std::clog << "Minimal_enclosing_ball_radius = " << std::sqrt(ms.squared_radius()) << " | nb points = " - << boost::size(point_cloud) << " | dimension = " - << boost::size(*point_cloud.begin()) << std::endl; -#endif // DEBUG_TRACES - - return std::sqrt(ms.squared_radius()); - } -}; - } // namespace Gudhi #endif // DISTANCE_FUNCTIONS_H_ diff --git a/src/common/include/gudhi/random_point_generators.h b/src/common/include/gudhi/random_point_generators.h index 9dd88ac4..25a7392d 100644 --- a/src/common/include/gudhi/random_point_generators.h +++ b/src/common/include/gudhi/random_point_generators.h @@ -18,6 +18,7 @@ #include <CGAL/version.h> // for CGAL_VERSION_NR #include <vector> // for vector<> +#include <boost/math/constants/constants.hpp> // for pi constant // Make compilation fail - required for external projects - https://github.com/GUDHI/gudhi-devel/issues/10 #if CGAL_VERSION_NR < 1041101000 @@ -149,6 +150,8 @@ std::vector<typename Kernel::Point_d> generate_points_on_moment_curve(std::size_ template <typename Kernel/*, typename TC_basis*/> std::vector<typename Kernel::Point_d> generate_points_on_torus_3D(std::size_t num_points, double R, double r, bool uniform = false) { + using namespace boost::math::double_constants; + typedef typename Kernel::Point_d Point; typedef typename Kernel::FT FT; Kernel k; @@ -164,11 +167,11 @@ std::vector<typename Kernel::Point_d> generate_points_on_torus_3D(std::size_t nu if (uniform) { std::size_t k1 = i / num_lines; std::size_t k2 = i % num_lines; - u = 6.2832 * k1 / num_lines; - v = 6.2832 * k2 / num_lines; + u = two_pi * k1 / num_lines; + v = two_pi * k2 / num_lines; } else { - u = rng.get_double(0, 6.2832); - v = rng.get_double(0, 6.2832); + u = rng.get_double(0, two_pi); + v = rng.get_double(0, two_pi); } Point p = construct_point(k, (R + r * std::cos(u)) * std::cos(v), @@ -182,11 +185,13 @@ std::vector<typename Kernel::Point_d> generate_points_on_torus_3D(std::size_t nu // "Private" function used by generate_points_on_torus_d template <typename Kernel, typename OutputIterator> -static void generate_uniform_points_on_torus_d(const Kernel &k, int dim, std::size_t num_slices, +static void generate_grid_points_on_torus_d(const Kernel &k, int dim, std::size_t num_slices, OutputIterator out, double radius_noise_percentage = 0., std::vector<typename Kernel::FT> current_point = std::vector<typename Kernel::FT>()) { + using namespace boost::math::double_constants; + CGAL::Random rng; int point_size = static_cast<int>(current_point.size()); if (point_size == 2 * dim) { @@ -200,18 +205,20 @@ static void generate_uniform_points_on_torus_d(const Kernel &k, int dim, std::si (100. + radius_noise_percentage) / 100.); } std::vector<typename Kernel::FT> cp2 = current_point; - double alpha = 6.2832 * slice_idx / num_slices; + double alpha = two_pi * slice_idx / num_slices; cp2.push_back(radius_noise_ratio * std::cos(alpha)); cp2.push_back(radius_noise_ratio * std::sin(alpha)); - generate_uniform_points_on_torus_d( + generate_grid_points_on_torus_d( k, dim, num_slices, out, radius_noise_percentage, cp2); } } } template <typename Kernel> -std::vector<typename Kernel::Point_d> generate_points_on_torus_d(std::size_t num_points, int dim, bool uniform = false, +std::vector<typename Kernel::Point_d> generate_points_on_torus_d(std::size_t num_points, int dim, std::string sample = "random", double radius_noise_percentage = 0.) { + using namespace boost::math::double_constants; + typedef typename Kernel::Point_d Point; typedef typename Kernel::FT FT; Kernel k; @@ -219,9 +226,9 @@ std::vector<typename Kernel::Point_d> generate_points_on_torus_d(std::size_t num std::vector<Point> points; points.reserve(num_points); - if (uniform) { - std::size_t num_slices = (std::size_t)std::pow(num_points, 1. / dim); - generate_uniform_points_on_torus_d( + if (sample == "grid") { + std::size_t num_slices = (std::size_t)std::pow(num_points + .5, 1. / dim); // add .5 to avoid rounding down with numerical approximations + generate_grid_points_on_torus_d( k, dim, num_slices, std::back_inserter(points), radius_noise_percentage); } else { for (std::size_t i = 0; i < num_points;) { @@ -234,7 +241,7 @@ std::vector<typename Kernel::Point_d> generate_points_on_torus_d(std::size_t num std::vector<typename Kernel::FT> pt; pt.reserve(dim * 2); for (int curdim = 0; curdim < dim; ++curdim) { - FT alpha = rng.get_double(0, 6.2832); + FT alpha = rng.get_double(0, two_pi); pt.push_back(radius_noise_ratio * std::cos(alpha)); pt.push_back(radius_noise_ratio * std::sin(alpha)); } @@ -357,6 +364,8 @@ std::vector<typename Kernel::Point_d> generate_points_on_two_spheres_d(std::size template <typename Kernel> std::vector<typename Kernel::Point_d> generate_points_on_3sphere_and_circle(std::size_t num_points, double sphere_radius) { + using namespace boost::math::double_constants; + typedef typename Kernel::FT FT; typedef typename Kernel::Point_d Point; Kernel k; @@ -370,7 +379,7 @@ std::vector<typename Kernel::Point_d> generate_points_on_3sphere_and_circle(std: for (std::size_t i = 0; i < num_points;) { Point p_sphere = *generator++; // First 3 coords - FT alpha = rng.get_double(0, 6.2832); + FT alpha = rng.get_double(0, two_pi); std::vector<FT> pt(5); pt[0] = k_coord(p_sphere, 0); pt[1] = k_coord(p_sphere, 1); @@ -388,6 +397,8 @@ std::vector<typename Kernel::Point_d> generate_points_on_3sphere_and_circle(std: template <typename Kernel> std::vector<typename Kernel::Point_d> generate_points_on_klein_bottle_3D(std::size_t num_points, double a, double b, bool uniform = false) { + using namespace boost::math::double_constants; + typedef typename Kernel::Point_d Point; typedef typename Kernel::FT FT; Kernel k; @@ -403,11 +414,11 @@ std::vector<typename Kernel::Point_d> generate_points_on_klein_bottle_3D(std::si if (uniform) { std::size_t k1 = i / num_lines; std::size_t k2 = i % num_lines; - u = 6.2832 * k1 / num_lines; - v = 6.2832 * k2 / num_lines; + u = two_pi * k1 / num_lines; + v = two_pi * k2 / num_lines; } else { - u = rng.get_double(0, 6.2832); - v = rng.get_double(0, 6.2832); + u = rng.get_double(0, two_pi); + v = rng.get_double(0, two_pi); } double tmp = cos(u / 2) * sin(v) - sin(u / 2) * sin(2. * v); Point p = construct_point(k, @@ -424,6 +435,8 @@ std::vector<typename Kernel::Point_d> generate_points_on_klein_bottle_3D(std::si template <typename Kernel> std::vector<typename Kernel::Point_d> generate_points_on_klein_bottle_4D(std::size_t num_points, double a, double b, double noise = 0., bool uniform = false) { + using namespace boost::math::double_constants; + typedef typename Kernel::Point_d Point; typedef typename Kernel::FT FT; Kernel k; @@ -439,11 +452,11 @@ std::vector<typename Kernel::Point_d> generate_points_on_klein_bottle_4D(std::si if (uniform) { std::size_t k1 = i / num_lines; std::size_t k2 = i % num_lines; - u = 6.2832 * k1 / num_lines; - v = 6.2832 * k2 / num_lines; + u = two_pi * k1 / num_lines; + v = two_pi * k2 / num_lines; } else { - u = rng.get_double(0, 6.2832); - v = rng.get_double(0, 6.2832); + u = rng.get_double(0, two_pi); + v = rng.get_double(0, two_pi); } Point p = construct_point(k, (a + b * cos(v)) * cos(u) + (noise == 0. ? 0. : rng.get_double(0, noise)), @@ -463,6 +476,8 @@ template <typename Kernel> std::vector<typename Kernel::Point_d> generate_points_on_klein_bottle_variant_5D( std::size_t num_points, double a, double b, bool uniform = false) { + using namespace boost::math::double_constants; + typedef typename Kernel::Point_d Point; typedef typename Kernel::FT FT; Kernel k; @@ -478,11 +493,11 @@ generate_points_on_klein_bottle_variant_5D( if (uniform) { std::size_t k1 = i / num_lines; std::size_t k2 = i % num_lines; - u = 6.2832 * k1 / num_lines; - v = 6.2832 * k2 / num_lines; + u = two_pi * k1 / num_lines; + v = two_pi * k2 / num_lines; } else { - u = rng.get_double(0, 6.2832); - v = rng.get_double(0, 6.2832); + u = rng.get_double(0, two_pi); + v = rng.get_double(0, two_pi); } FT x1 = (a + b * cos(v)) * cos(u); FT x2 = (a + b * cos(v)) * sin(u); diff --git a/src/common/include/gudhi/reader_utils.h b/src/common/include/gudhi/reader_utils.h index 0938f5c1..a7d82541 100644 --- a/src/common/include/gudhi/reader_utils.h +++ b/src/common/include/gudhi/reader_utils.h @@ -14,7 +14,7 @@ #include <gudhi/graph_simplicial_complex.h> #include <gudhi/Debug_utils.h> -#include <boost/function_output_iterator.hpp> +# include <boost/iterator/function_output_iterator.hpp> #include <boost/graph/adjacency_list.hpp> #include <iostream> @@ -231,7 +231,7 @@ std::vector<std::vector<Filtration_value>> read_lower_triangular_matrix_from_csv std::string line; - // the first line is emtpy, so we ignore it: + // the first line is empty, so we ignore it: std::getline(in, line); std::vector<Filtration_value> values_in_this_line; result.push_back(values_in_this_line); diff --git a/src/common/include/gudhi/writing_persistence_to_file.h b/src/common/include/gudhi/writing_persistence_to_file.h index 2e36b831..3a0df1a8 100644 --- a/src/common/include/gudhi/writing_persistence_to_file.h +++ b/src/common/include/gudhi/writing_persistence_to_file.h @@ -48,7 +48,7 @@ class Persistence_interval_common { : birth_(birth), death_(death), dimension_(dim), arith_element_(field) {} /** - * Operator to compare two persistence pairs. During the comparision all the + * Operator to compare two persistence pairs. During the comparison all the * fields: birth, death, dimensiona and arith_element_ are taken into account * and they all have to be equal for two pairs to be equal. **/ @@ -65,7 +65,7 @@ class Persistence_interval_common { /** * Operator to compare objects of a type Persistence_interval_common. * One intervals is smaller than the other if it has lower persistence. - * Note that this operator do not take Arith_element into account when doing comparisions. + * Note that this operator do not take Arith_element into account when doing comparisons. **/ bool operator<(const Persistence_interval_common& i2) const { return fabs(this->death_ - this->birth_) < fabs(i2.death_ - i2.birth_); diff --git a/src/common/test/test_distance_matrix_reader.cpp b/src/common/test/test_distance_matrix_reader.cpp index 73be8104..92e899b8 100644 --- a/src/common/test/test_distance_matrix_reader.cpp +++ b/src/common/test/test_distance_matrix_reader.cpp @@ -57,7 +57,7 @@ BOOST_AUTO_TEST_CASE( full_square_distance_matrix ) { Distance_matrix from_full_square; // Read full_square_distance_matrix.csv file where the separator is the default one ';' - from_full_square = Gudhi::read_lower_triangular_matrix_from_csv_file<double>("full_square_distance_matrix.csv"); + from_full_square = Gudhi::read_lower_triangular_matrix_from_csv_file<double>("full_square_distance_matrix.csv", ';'); for (auto& i : from_full_square) { for (auto j : i) { std::clog << j << " "; diff --git a/src/common/utilities/off_file_from_shape_generator.cpp b/src/common/utilities/off_file_from_shape_generator.cpp index 6efef4fc..71ede434 100644 --- a/src/common/utilities/off_file_from_shape_generator.cpp +++ b/src/common/utilities/off_file_from_shape_generator.cpp @@ -135,7 +135,7 @@ int main(int argc, char **argv) { if (dimension == 3) points = Gudhi::generate_points_on_torus_3D<K>(points_number, dimension, radius, radius/2.); else - points = Gudhi::generate_points_on_torus_d<K>(points_number, dimension, true); + points = Gudhi::generate_points_on_torus_d<K>(points_number, dimension, "grid"); break; case Data_shape::klein: switch (dimension) { diff --git a/src/python/CMakeLists.txt b/src/python/CMakeLists.txt index 5c1402a6..39e2acd4 100644 --- a/src/python/CMakeLists.txt +++ b/src/python/CMakeLists.txt @@ -14,13 +14,16 @@ function( add_GUDHI_PYTHON_lib THE_LIB ) endif(EXISTS ${THE_LIB}) endfunction( add_GUDHI_PYTHON_lib ) -function( add_GUDHI_PYTHON_lib_dir THE_LIB_DIR ) - # deals when it is not set - error on windows - if(EXISTS ${THE_LIB_DIR}) - set(GUDHI_PYTHON_LIBRARY_DIRS "${GUDHI_PYTHON_LIBRARY_DIRS}'${THE_LIB_DIR}', " PARENT_SCOPE) - else() - message("add_GUDHI_PYTHON_lib_dir - '${THE_LIB_DIR}' does not exist") - endif() +function( add_GUDHI_PYTHON_lib_dir) + # Argument may be a list (specifically on windows with release/debug paths) + foreach(THE_LIB_DIR IN LISTS ARGN) + # deals when it is not set - error on windows + if(EXISTS ${THE_LIB_DIR}) + set(GUDHI_PYTHON_LIBRARY_DIRS "${GUDHI_PYTHON_LIBRARY_DIRS}'${THE_LIB_DIR}', " PARENT_SCOPE) + else() + message("add_GUDHI_PYTHON_lib_dir - '${THE_LIB_DIR}' does not exist") + endif() + endforeach() endfunction( add_GUDHI_PYTHON_lib_dir ) # THE_TEST is the python test file name (without .py extension) containing tests functions @@ -41,14 +44,16 @@ function( add_gudhi_debug_info DEBUG_INFO ) endfunction( add_gudhi_debug_info ) if(PYTHONINTERP_FOUND) - if(PYBIND11_FOUND) + if(NUMPY_FOUND AND PYBIND11_FOUND AND CYTHON_FOUND) add_gudhi_debug_info("Pybind11 version ${PYBIND11_VERSION}") + # PyBind11 modules set(GUDHI_PYTHON_MODULES "${GUDHI_PYTHON_MODULES}'bottleneck', ") set(GUDHI_PYTHON_MODULES_EXTRA "${GUDHI_PYTHON_MODULES_EXTRA}'hera', ") set(GUDHI_PYTHON_MODULES_EXTRA "${GUDHI_PYTHON_MODULES_EXTRA}'clustering', ") - endif() - if(CYTHON_FOUND) - set(GUDHI_PYTHON_MODULES "${GUDHI_PYTHON_MODULES}'off_reader', ") + set(GUDHI_PYTHON_MODULES_EXTRA "${GUDHI_PYTHON_MODULES_EXTRA}'datasets', ") + + # Cython modules + set(GUDHI_PYTHON_MODULES "${GUDHI_PYTHON_MODULES}'off_utils', ") set(GUDHI_PYTHON_MODULES "${GUDHI_PYTHON_MODULES}'simplex_tree', ") set(GUDHI_PYTHON_MODULES "${GUDHI_PYTHON_MODULES}'rips_complex', ") set(GUDHI_PYTHON_MODULES "${GUDHI_PYTHON_MODULES}'cubical_complex', ") @@ -65,6 +70,7 @@ if(PYTHONINTERP_FOUND) set(GUDHI_PYTHON_MODULES "${GUDHI_PYTHON_MODULES}'euclidean_strong_witness_complex', ") # Modules that should not be auto-imported in __init__.py set(GUDHI_PYTHON_MODULES_EXTRA "${GUDHI_PYTHON_MODULES_EXTRA}'representations', ") + set(GUDHI_PYTHON_MODULES_EXTRA "${GUDHI_PYTHON_MODULES_EXTRA}'tensorflow', ") set(GUDHI_PYTHON_MODULES_EXTRA "${GUDHI_PYTHON_MODULES_EXTRA}'wasserstein', ") set(GUDHI_PYTHON_MODULES_EXTRA "${GUDHI_PYTHON_MODULES_EXTRA}'point_cloud', ") set(GUDHI_PYTHON_MODULES_EXTRA "${GUDHI_PYTHON_MODULES_EXTRA}'weighted_rips_complex', ") @@ -106,6 +112,16 @@ if(PYTHONINTERP_FOUND) if(TENSORFLOW_FOUND) add_gudhi_debug_info("TensorFlow version ${TENSORFLOW_VERSION}") endif() + if(SPHINX_FOUND) + add_gudhi_debug_info("Sphinx version ${SPHINX_VERSION}") + endif() + if(SPHINX_PARAMLINKS_FOUND) + add_gudhi_debug_info("Sphinx-paramlinks version ${SPHINX_PARAMLINKS_VERSION}") + endif() + if(PYTHON_DOCS_THEME_FOUND) + # Does not have a version number... + add_gudhi_debug_info("python_docs_theme found") + endif() set(GUDHI_PYTHON_EXTRA_COMPILE_ARGS "${GUDHI_PYTHON_EXTRA_COMPILE_ARGS}'-DBOOST_RESULT_OF_USE_DECLTYPE', ") set(GUDHI_PYTHON_EXTRA_COMPILE_ARGS "${GUDHI_PYTHON_EXTRA_COMPILE_ARGS}'-DBOOST_ALL_NO_LIB', ") @@ -113,9 +129,10 @@ if(PYTHONINTERP_FOUND) # Gudhi and CGAL compilation option if(MSVC) + set(GUDHI_PYTHON_EXTRA_COMPILE_ARGS "${GUDHI_PYTHON_EXTRA_COMPILE_ARGS}'/std:c++17', ") set(GUDHI_PYTHON_EXTRA_COMPILE_ARGS "${GUDHI_PYTHON_EXTRA_COMPILE_ARGS}'/fp:strict', ") else(MSVC) - set(GUDHI_PYTHON_EXTRA_COMPILE_ARGS "${GUDHI_PYTHON_EXTRA_COMPILE_ARGS}'-std=c++14', ") + set(GUDHI_PYTHON_EXTRA_COMPILE_ARGS "${GUDHI_PYTHON_EXTRA_COMPILE_ARGS}'-std=c++17', ") endif(MSVC) if(CMAKE_COMPILER_IS_GNUCXX) set(GUDHI_PYTHON_EXTRA_COMPILE_ARGS "${GUDHI_PYTHON_EXTRA_COMPILE_ARGS}'-frounding-math', ") @@ -133,13 +150,9 @@ if(PYTHONINTERP_FOUND) add_gudhi_debug_info("Eigen3 version ${EIGEN3_VERSION}") # No problem, even if no CGAL found set(GUDHI_PYTHON_EXTRA_COMPILE_ARGS "${GUDHI_PYTHON_EXTRA_COMPILE_ARGS}'-DCGAL_EIGEN3_ENABLED', ") - set(GUDHI_PYTHON_EXTRA_COMPILE_ARGS "${GUDHI_PYTHON_EXTRA_COMPILE_ARGS}'-DGUDHI_USE_EIGEN3', ") - set(GUDHI_USE_EIGEN3 "True") - else (EIGEN3_FOUND) - set(GUDHI_USE_EIGEN3 "False") endif (EIGEN3_FOUND) - set(GUDHI_CYTHON_MODULES "${GUDHI_CYTHON_MODULES}'off_reader', ") + set(GUDHI_CYTHON_MODULES "${GUDHI_CYTHON_MODULES}'off_utils', ") set(GUDHI_CYTHON_MODULES "${GUDHI_CYTHON_MODULES}'simplex_tree', ") set(GUDHI_CYTHON_MODULES "${GUDHI_CYTHON_MODULES}'rips_complex', ") set(GUDHI_CYTHON_MODULES "${GUDHI_CYTHON_MODULES}'cubical_complex', ") @@ -150,19 +163,36 @@ if(PYTHONINTERP_FOUND) set(GUDHI_PYBIND11_MODULES "${GUDHI_PYBIND11_MODULES}'clustering/_tomato', ") set(GUDHI_PYBIND11_MODULES "${GUDHI_PYBIND11_MODULES}'hera/wasserstein', ") set(GUDHI_PYBIND11_MODULES "${GUDHI_PYBIND11_MODULES}'hera/bottleneck', ") + set(GUDHI_CYTHON_MODULES "${GUDHI_CYTHON_MODULES}'nerve_gic', ") if (NOT CGAL_VERSION VERSION_LESS 4.11.0) + set(GUDHI_PYBIND11_MODULES "${GUDHI_PYBIND11_MODULES}'datasets/generators/_points', ") set(GUDHI_PYBIND11_MODULES "${GUDHI_PYBIND11_MODULES}'bottleneck', ") - set(GUDHI_CYTHON_MODULES "${GUDHI_CYTHON_MODULES}'nerve_gic', ") endif () if (NOT CGAL_WITH_EIGEN3_VERSION VERSION_LESS 4.11.0) - set(GUDHI_CYTHON_MODULES "${GUDHI_CYTHON_MODULES}'alpha_complex', ") set(GUDHI_CYTHON_MODULES "${GUDHI_CYTHON_MODULES}'subsampling', ") set(GUDHI_CYTHON_MODULES "${GUDHI_CYTHON_MODULES}'tangential_complex', ") set(GUDHI_CYTHON_MODULES "${GUDHI_CYTHON_MODULES}'euclidean_witness_complex', ") set(GUDHI_CYTHON_MODULES "${GUDHI_CYTHON_MODULES}'euclidean_strong_witness_complex', ") endif () + if (NOT CGAL_WITH_EIGEN3_VERSION VERSION_LESS 5.1.0) + set(GUDHI_CYTHON_MODULES "${GUDHI_CYTHON_MODULES}'alpha_complex', ") + endif () + # from windows vcpkg eigen 3.4.0#2 : build fails with + # error C2440: '<function-style-cast>': cannot convert from 'Eigen::EigenBase<Derived>::Index' to '__gmp_expr<mpq_t,mpq_t>' + # cf. https://gitlab.com/libeigen/eigen/-/issues/2476 + # Workaround is to compile with '-DEIGEN_DEFAULT_DENSE_INDEX_TYPE=int' + if (FORCE_EIGEN_DEFAULT_DENSE_INDEX_TYPE_TO_INT) + set(GUDHI_PYTHON_EXTRA_COMPILE_ARGS "${GUDHI_PYTHON_EXTRA_COMPILE_ARGS}'-DEIGEN_DEFAULT_DENSE_INDEX_TYPE=int', ") + endif() + + + add_gudhi_debug_info("Boost version ${Boost_VERSION}") if(CGAL_FOUND) + if(NOT CGAL_VERSION VERSION_LESS 5.3.0) + # CGAL_HEADER_ONLY has been dropped for CGAL >= 5.3. Only the header-only version is supported. + set(CGAL_HEADER_ONLY True) + endif(NOT CGAL_VERSION VERSION_LESS 5.3.0) # Add CGAL compilation args if(CGAL_HEADER_ONLY) add_gudhi_debug_info("CGAL header only version ${CGAL_VERSION}") @@ -170,7 +200,7 @@ if(PYTHONINTERP_FOUND) else(CGAL_HEADER_ONLY) add_gudhi_debug_info("CGAL version ${CGAL_VERSION}") add_GUDHI_PYTHON_lib("${CGAL_LIBRARY}") - add_GUDHI_PYTHON_lib_dir("${CGAL_LIBRARIES_DIR}") + add_GUDHI_PYTHON_lib_dir(${CGAL_LIBRARIES_DIR}) message("** Add CGAL ${CGAL_LIBRARIES_DIR}") # If CGAL is not header only, CGAL library may link with boost system, if(CMAKE_BUILD_TYPE MATCHES Debug) @@ -178,7 +208,7 @@ if(PYTHONINTERP_FOUND) else() add_GUDHI_PYTHON_lib("${Boost_SYSTEM_LIBRARY_RELEASE}") endif() - add_GUDHI_PYTHON_lib_dir("${Boost_LIBRARY_DIRS}") + add_GUDHI_PYTHON_lib_dir(${Boost_LIBRARY_DIRS}) message("** Add Boost ${Boost_LIBRARY_DIRS}") endif(CGAL_HEADER_ONLY) # GMP and GMPXX are not required, but if present, CGAL will link with them. @@ -190,15 +220,16 @@ if(PYTHONINTERP_FOUND) get_filename_component(GMP_LIBRARIES_DIR ${GMP_LIBRARIES} PATH) message("GMP_LIBRARIES_DIR from GMP_LIBRARIES set to ${GMP_LIBRARIES_DIR}") endif(NOT GMP_LIBRARIES_DIR) - add_GUDHI_PYTHON_lib_dir("${GMP_LIBRARIES_DIR}") + add_GUDHI_PYTHON_lib_dir(${GMP_LIBRARIES_DIR}) message("** Add gmp ${GMP_LIBRARIES_DIR}") + # When FORCE_CGAL_NOT_TO_BUILD_WITH_GMPXX is set, not defining CGAL_USE_GMPXX is sufficient enough if(GMPXX_FOUND) add_gudhi_debug_info("GMPXX_LIBRARIES = ${GMPXX_LIBRARIES}") set(GUDHI_PYTHON_EXTRA_COMPILE_ARGS "${GUDHI_PYTHON_EXTRA_COMPILE_ARGS}'-DCGAL_USE_GMPXX', ") add_GUDHI_PYTHON_lib("${GMPXX_LIBRARIES}") - add_GUDHI_PYTHON_lib_dir("${GMPXX_LIBRARIES_DIR}") + add_GUDHI_PYTHON_lib_dir(${GMPXX_LIBRARIES_DIR}) message("** Add gmpxx ${GMPXX_LIBRARIES_DIR}") - endif(GMPXX_FOUND) + endif() endif(GMP_FOUND) if(MPFR_FOUND) add_gudhi_debug_info("MPFR_LIBRARIES = ${MPFR_LIBRARIES}") @@ -209,15 +240,15 @@ if(PYTHONINTERP_FOUND) get_filename_component(MPFR_LIBRARIES_DIR ${MPFR_LIBRARIES} PATH) message("MPFR_LIBRARIES_DIR from MPFR_LIBRARIES set to ${MPFR_LIBRARIES_DIR}") endif(NOT MPFR_LIBRARIES_DIR) - add_GUDHI_PYTHON_lib_dir("${MPFR_LIBRARIES_DIR}") + add_GUDHI_PYTHON_lib_dir(${MPFR_LIBRARIES_DIR}) message("** Add mpfr ${MPFR_LIBRARIES_DIR}") endif(MPFR_FOUND) endif(CGAL_FOUND) # Specific for Mac if (${CMAKE_SYSTEM_NAME} MATCHES "Darwin") - set(GUDHI_PYTHON_EXTRA_COMPILE_ARGS "${GUDHI_PYTHON_EXTRA_COMPILE_ARGS}'-mmacosx-version-min=10.12', ") - set(GUDHI_PYTHON_EXTRA_LINK_ARGS "${GUDHI_PYTHON_EXTRA_LINK_ARGS}'-mmacosx-version-min=10.12', ") + set(GUDHI_PYTHON_EXTRA_COMPILE_ARGS "${GUDHI_PYTHON_EXTRA_COMPILE_ARGS}'-mmacosx-version-min=10.14', ") + set(GUDHI_PYTHON_EXTRA_LINK_ARGS "${GUDHI_PYTHON_EXTRA_LINK_ARGS}'-mmacosx-version-min=10.14', ") endif(${CMAKE_SYSTEM_NAME} MATCHES "Darwin") # Loop on INCLUDE_DIRECTORIES PROPERTY @@ -230,18 +261,22 @@ if(PYTHONINTERP_FOUND) if (TBB_FOUND AND WITH_GUDHI_USE_TBB) add_gudhi_debug_info("TBB version ${TBB_INTERFACE_VERSION} found and used") set(GUDHI_PYTHON_EXTRA_COMPILE_ARGS "${GUDHI_PYTHON_EXTRA_COMPILE_ARGS}'-DGUDHI_USE_TBB', ") - if(CMAKE_BUILD_TYPE MATCHES Debug) + if((CMAKE_BUILD_TYPE MATCHES Debug) AND TBB_DEBUG_LIBRARY) add_GUDHI_PYTHON_lib("${TBB_DEBUG_LIBRARY}") add_GUDHI_PYTHON_lib("${TBB_MALLOC_DEBUG_LIBRARY}") else() add_GUDHI_PYTHON_lib("${TBB_RELEASE_LIBRARY}") add_GUDHI_PYTHON_lib("${TBB_MALLOC_RELEASE_LIBRARY}") endif() - add_GUDHI_PYTHON_lib_dir("${TBB_LIBRARY_DIRS}") + add_GUDHI_PYTHON_lib_dir(${TBB_LIBRARY_DIRS}) message("** Add tbb ${TBB_LIBRARY_DIRS}") set(GUDHI_PYTHON_INCLUDE_DIRS "${GUDHI_PYTHON_INCLUDE_DIRS}'${TBB_INCLUDE_DIRS}', ") endif() + if(DEBUG_TRACES) + set(GUDHI_PYTHON_EXTRA_COMPILE_ARGS "${GUDHI_PYTHON_EXTRA_COMPILE_ARGS}'-DDEBUG_TRACES', ") + endif(DEBUG_TRACES) + if(UNIX AND WITH_GUDHI_PYTHON_RUNTIME_LIBRARY_DIRS) set( GUDHI_PYTHON_RUNTIME_LIBRARY_DIRS "${GUDHI_PYTHON_LIBRARY_DIRS}") endif(UNIX AND WITH_GUDHI_PYTHON_RUNTIME_LIBRARY_DIRS) @@ -256,15 +291,20 @@ if(PYTHONINTERP_FOUND) # Other .py files file(COPY "gudhi/persistence_graphical_tools.py" DESTINATION "${CMAKE_CURRENT_BINARY_DIR}/gudhi") file(COPY "gudhi/representations" DESTINATION "${CMAKE_CURRENT_BINARY_DIR}/gudhi/") - file(COPY "gudhi/wasserstein" DESTINATION "${CMAKE_CURRENT_BINARY_DIR}/gudhi") + file(COPY "gudhi/wasserstein" DESTINATION "${CMAKE_CURRENT_BINARY_DIR}/gudhi") + file(COPY "gudhi/tensorflow" DESTINATION "${CMAKE_CURRENT_BINARY_DIR}/gudhi") file(COPY "gudhi/point_cloud" DESTINATION "${CMAKE_CURRENT_BINARY_DIR}/gudhi") file(COPY "gudhi/clustering" DESTINATION "${CMAKE_CURRENT_BINARY_DIR}/gudhi" FILES_MATCHING PATTERN "*.py") file(COPY "gudhi/weighted_rips_complex.py" DESTINATION "${CMAKE_CURRENT_BINARY_DIR}/gudhi") file(COPY "gudhi/dtm_rips_complex.py" DESTINATION "${CMAKE_CURRENT_BINARY_DIR}/gudhi") file(COPY "gudhi/hera/__init__.py" DESTINATION "${CMAKE_CURRENT_BINARY_DIR}/gudhi/hera") + file(COPY "gudhi/datasets" DESTINATION "${CMAKE_CURRENT_BINARY_DIR}/gudhi" FILES_MATCHING PATTERN "*.py") + file(COPY "gudhi/sklearn" DESTINATION "${CMAKE_CURRENT_BINARY_DIR}/gudhi/") + # Some files for pip package file(COPY "introduction.rst" DESTINATION "${CMAKE_CURRENT_BINARY_DIR}/") + file(COPY "pyproject.toml" DESTINATION "${CMAKE_CURRENT_BINARY_DIR}/") add_custom_command( OUTPUT gudhi.so @@ -274,67 +314,74 @@ if(PYTHONINTERP_FOUND) add_custom_target(python ALL DEPENDS gudhi.so COMMENT "Do not forget to add ${CMAKE_CURRENT_BINARY_DIR}/ to your PYTHONPATH before using examples or tests") - install(CODE "execute_process(COMMAND ${PYTHON_EXECUTABLE} ${CMAKE_CURRENT_BINARY_DIR}/setup.py install)") - + # Path separator management for windows + if (WIN32) + set(GUDHI_PYTHON_PATH_ENV "PYTHONPATH=${CMAKE_CURRENT_BINARY_DIR};$ENV{PYTHONPATH}") + else(WIN32) + set(GUDHI_PYTHON_PATH_ENV "PYTHONPATH=${CMAKE_CURRENT_BINARY_DIR}:$ENV{PYTHONPATH}") + endif(WIN32) # Documentation generation is available through sphinx - requires all modules # Make it first as sphinx test is by far the longest test which is nice when testing in parallel if(SPHINX_PATH) - if(MATPLOTLIB_FOUND) - if(NUMPY_FOUND) - if(SCIPY_FOUND) - if(SKLEARN_FOUND) - if(OT_FOUND) - if(PYBIND11_FOUND) - if(NOT CGAL_WITH_EIGEN3_VERSION VERSION_LESS 4.11.0) - set (GUDHI_SPHINX_MESSAGE "Generating API documentation with Sphinx in ${CMAKE_CURRENT_BINARY_DIR}/sphinx/") - # User warning - Sphinx is a static pages generator, and configured to work fine with user_version - # Images and biblio warnings because not found on developper version - if (GUDHI_PYTHON_PATH STREQUAL "src/python") - set (GUDHI_SPHINX_MESSAGE "${GUDHI_SPHINX_MESSAGE} \n WARNING : Sphinx is configured for user version, you run it on developper version. Images and biblio will miss") - endif() - # sphinx target requires gudhi.so, because conf.py reads gudhi version from it - add_custom_target(sphinx - WORKING_DIRECTORY ${CMAKE_CURRENT_SOURCE_DIR}/doc - COMMAND ${CMAKE_COMMAND} -E env "PYTHONPATH=${CMAKE_CURRENT_BINARY_DIR}" - ${SPHINX_PATH} -b html ${CMAKE_CURRENT_SOURCE_DIR}/doc ${CMAKE_CURRENT_BINARY_DIR}/sphinx - DEPENDS "${CMAKE_CURRENT_BINARY_DIR}/gudhi.so" - COMMENT "${GUDHI_SPHINX_MESSAGE}" VERBATIM) - - add_test(NAME sphinx_py_test - WORKING_DIRECTORY ${CMAKE_CURRENT_BINARY_DIR} - COMMAND ${CMAKE_COMMAND} -E env "PYTHONPATH=${CMAKE_CURRENT_BINARY_DIR}" - ${SPHINX_PATH} -b doctest ${CMAKE_CURRENT_SOURCE_DIR}/doc ${CMAKE_CURRENT_BINARY_DIR}/doctest) - - # Set missing or not modules - set(GUDHI_MODULES ${GUDHI_MODULES} "python-documentation" CACHE INTERNAL "GUDHI_MODULES") - else(NOT CGAL_WITH_EIGEN3_VERSION VERSION_LESS 4.11.0) - message("++ Python documentation module will not be compiled because it requires a Eigen3 and CGAL version >= 4.11.0") + if(SPHINX_PARAMLINKS_FOUND) + if(PYTHON_DOCS_THEME_FOUND) + if(MATPLOTLIB_FOUND) + if(NUMPY_FOUND) + if(SCIPY_FOUND) + if(SKLEARN_FOUND) + if(OT_FOUND) + if(NOT CGAL_WITH_EIGEN3_VERSION VERSION_LESS 5.1.0) + set (GUDHI_SPHINX_MESSAGE "Generating API documentation with Sphinx in ${CMAKE_CURRENT_BINARY_DIR}/sphinx/") + # User warning - Sphinx is a static pages generator, and configured to work fine with user_version + # Images and biblio warnings because not found on developer version + if (GUDHI_PYTHON_PATH STREQUAL "src/python") + set (GUDHI_SPHINX_MESSAGE "${GUDHI_SPHINX_MESSAGE} \n WARNING : Sphinx is configured for user version, you run it on developer version. Images and biblio will miss") + endif() + # sphinx target requires gudhi.so, because conf.py reads gudhi version from it + add_custom_target(sphinx + WORKING_DIRECTORY ${CMAKE_CURRENT_SOURCE_DIR}/doc + COMMAND ${CMAKE_COMMAND} -E env "${GUDHI_PYTHON_PATH_ENV}" + ${SPHINX_PATH} -b html ${CMAKE_CURRENT_SOURCE_DIR}/doc ${CMAKE_CURRENT_BINARY_DIR}/sphinx + DEPENDS "${CMAKE_CURRENT_BINARY_DIR}/gudhi.so" + COMMENT "${GUDHI_SPHINX_MESSAGE}" VERBATIM) + add_test(NAME sphinx_py_test + WORKING_DIRECTORY ${CMAKE_CURRENT_BINARY_DIR} + COMMAND ${CMAKE_COMMAND} -E env "${GUDHI_PYTHON_PATH_ENV}" + ${SPHINX_PATH} -b doctest ${CMAKE_CURRENT_SOURCE_DIR}/doc ${CMAKE_CURRENT_BINARY_DIR}/doctest) + # Set missing or not modules + set(GUDHI_MODULES ${GUDHI_MODULES} "python-documentation" CACHE INTERNAL "GUDHI_MODULES") + else(NOT CGAL_WITH_EIGEN3_VERSION VERSION_LESS 5.1.0) + message("++ Python documentation module will not be compiled because it requires a Eigen3 and CGAL version >= 5.1.0") + set(GUDHI_MISSING_MODULES ${GUDHI_MISSING_MODULES} "python-documentation" CACHE INTERNAL "GUDHI_MISSING_MODULES") + endif(NOT CGAL_WITH_EIGEN3_VERSION VERSION_LESS 5.1.0) + else(OT_FOUND) + message("++ Python documentation module will not be compiled because POT was not found") set(GUDHI_MISSING_MODULES ${GUDHI_MISSING_MODULES} "python-documentation" CACHE INTERNAL "GUDHI_MISSING_MODULES") - endif(NOT CGAL_WITH_EIGEN3_VERSION VERSION_LESS 4.11.0) - else(PYBIND11_FOUND) - message("++ Python documentation module will not be compiled because pybind11 was not found") + endif(OT_FOUND) + else(SKLEARN_FOUND) + message("++ Python documentation module will not be compiled because scikit-learn was not found") set(GUDHI_MISSING_MODULES ${GUDHI_MISSING_MODULES} "python-documentation" CACHE INTERNAL "GUDHI_MISSING_MODULES") - endif(PYBIND11_FOUND) - else(OT_FOUND) - message("++ Python documentation module will not be compiled because POT was not found") + endif(SKLEARN_FOUND) + else(SCIPY_FOUND) + message("++ Python documentation module will not be compiled because scipy was not found") set(GUDHI_MISSING_MODULES ${GUDHI_MISSING_MODULES} "python-documentation" CACHE INTERNAL "GUDHI_MISSING_MODULES") - endif(OT_FOUND) - else(SKLEARN_FOUND) - message("++ Python documentation module will not be compiled because scikit-learn was not found") + endif(SCIPY_FOUND) + else(NUMPY_FOUND) + message("++ Python documentation module will not be compiled because numpy was not found") set(GUDHI_MISSING_MODULES ${GUDHI_MISSING_MODULES} "python-documentation" CACHE INTERNAL "GUDHI_MISSING_MODULES") - endif(SKLEARN_FOUND) - else(SCIPY_FOUND) - message("++ Python documentation module will not be compiled because scipy was not found") + endif(NUMPY_FOUND) + else(MATPLOTLIB_FOUND) + message("++ Python documentation module will not be compiled because matplotlib was not found") set(GUDHI_MISSING_MODULES ${GUDHI_MISSING_MODULES} "python-documentation" CACHE INTERNAL "GUDHI_MISSING_MODULES") - endif(SCIPY_FOUND) - else(NUMPY_FOUND) - message("++ Python documentation module will not be compiled because numpy was not found") + endif(MATPLOTLIB_FOUND) + else(PYTHON_DOCS_THEME_FOUND) + message("++ Python documentation module will not be compiled because python-docs-theme was not found") set(GUDHI_MISSING_MODULES ${GUDHI_MISSING_MODULES} "python-documentation" CACHE INTERNAL "GUDHI_MISSING_MODULES") - endif(NUMPY_FOUND) - else(MATPLOTLIB_FOUND) - message("++ Python documentation module will not be compiled because matplotlib was not found") + endif(PYTHON_DOCS_THEME_FOUND) + else(SPHINX_PARAMLINKS_FOUND) + message("++ Python documentation module will not be compiled because sphinxcontrib-paramlinks was not found") set(GUDHI_MISSING_MODULES ${GUDHI_MISSING_MODULES} "python-documentation" CACHE INTERNAL "GUDHI_MISSING_MODULES") - endif(MATPLOTLIB_FOUND) + endif(SPHINX_PARAMLINKS_FOUND) else(SPHINX_PATH) message("++ Python documentation module will not be compiled because sphinx and sphinxcontrib-bibtex were not found") set(GUDHI_MISSING_MODULES ${GUDHI_MISSING_MODULES} "python-documentation" CACHE INTERNAL "GUDHI_MISSING_MODULES") @@ -342,17 +389,19 @@ if(PYTHONINTERP_FOUND) # Test examples - if (NOT CGAL_WITH_EIGEN3_VERSION VERSION_LESS 4.11.0) + if (NOT CGAL_WITH_EIGEN3_VERSION VERSION_LESS 5.1.0) # Bottleneck and Alpha add_test(NAME alpha_rips_persistence_bottleneck_distance_py_test WORKING_DIRECTORY ${CMAKE_CURRENT_BINARY_DIR} - COMMAND ${CMAKE_COMMAND} -E env "PYTHONPATH=${CMAKE_CURRENT_BINARY_DIR}" + COMMAND ${CMAKE_COMMAND} -E env "${GUDHI_PYTHON_PATH_ENV}" ${PYTHON_EXECUTABLE} "${CMAKE_CURRENT_SOURCE_DIR}/example/alpha_rips_persistence_bottleneck_distance.py" -f ${CMAKE_SOURCE_DIR}/data/points/tore3D_300.off -t 0.15 -d 3) + endif (NOT CGAL_WITH_EIGEN3_VERSION VERSION_LESS 5.1.0) + if (NOT CGAL_WITH_EIGEN3_VERSION VERSION_LESS 4.11.0) # Tangential add_test(NAME tangential_complex_plain_homology_from_off_file_example_py_test WORKING_DIRECTORY ${CMAKE_CURRENT_BINARY_DIR} - COMMAND ${CMAKE_COMMAND} -E env "PYTHONPATH=${CMAKE_CURRENT_BINARY_DIR}" + COMMAND ${CMAKE_COMMAND} -E env "${GUDHI_PYTHON_PATH_ENV}" ${PYTHON_EXECUTABLE} "${CMAKE_CURRENT_SOURCE_DIR}/example/tangential_complex_plain_homology_from_off_file_example.py" --no-diagram -i 2 -f ${CMAKE_SOURCE_DIR}/data/points/tore3D_300.off) @@ -361,13 +410,13 @@ if(PYTHONINTERP_FOUND) # Witness complex add_test(NAME euclidean_strong_witness_complex_diagram_persistence_from_off_file_example_py_test WORKING_DIRECTORY ${CMAKE_CURRENT_BINARY_DIR} - COMMAND ${CMAKE_COMMAND} -E env "PYTHONPATH=${CMAKE_CURRENT_BINARY_DIR}" + COMMAND ${CMAKE_COMMAND} -E env "${GUDHI_PYTHON_PATH_ENV}" ${PYTHON_EXECUTABLE} "${CMAKE_CURRENT_SOURCE_DIR}/example/euclidean_strong_witness_complex_diagram_persistence_from_off_file_example.py" --no-diagram -f ${CMAKE_SOURCE_DIR}/data/points/tore3D_300.off -a 1.0 -n 20 -d 2) add_test(NAME euclidean_witness_complex_diagram_persistence_from_off_file_example_py_test WORKING_DIRECTORY ${CMAKE_CURRENT_BINARY_DIR} - COMMAND ${CMAKE_COMMAND} -E env "PYTHONPATH=${CMAKE_CURRENT_BINARY_DIR}" + COMMAND ${CMAKE_COMMAND} -E env "${GUDHI_PYTHON_PATH_ENV}" ${PYTHON_EXECUTABLE} "${CMAKE_CURRENT_SOURCE_DIR}/example/euclidean_witness_complex_diagram_persistence_from_off_file_example.py" --no-diagram -f ${CMAKE_SOURCE_DIR}/data/points/tore3D_300.off -a 1.0 -n 20 -d 2) @@ -379,75 +428,80 @@ if(PYTHONINTERP_FOUND) # Bottleneck add_test(NAME bottleneck_basic_example_py_test WORKING_DIRECTORY ${CMAKE_CURRENT_BINARY_DIR} - COMMAND ${CMAKE_COMMAND} -E env "PYTHONPATH=${CMAKE_CURRENT_BINARY_DIR}" + COMMAND ${CMAKE_COMMAND} -E env "${GUDHI_PYTHON_PATH_ENV}" ${PYTHON_EXECUTABLE} "${CMAKE_CURRENT_SOURCE_DIR}/example/bottleneck_basic_example.py") - if (PYBIND11_FOUND) - add_gudhi_py_test(test_bottleneck_distance) - endif() + add_gudhi_py_test(test_bottleneck_distance) + endif (NOT CGAL_VERSION VERSION_LESS 4.11.0) - # Cover complex - file(COPY ${CMAKE_SOURCE_DIR}/data/points/human.off DESTINATION ${CMAKE_CURRENT_BINARY_DIR}/) - file(COPY ${CMAKE_SOURCE_DIR}/data/points/COIL_database/lucky_cat.off DESTINATION ${CMAKE_CURRENT_BINARY_DIR}/) - file(COPY ${CMAKE_SOURCE_DIR}/data/points/COIL_database/lucky_cat_PCA1 DESTINATION ${CMAKE_CURRENT_BINARY_DIR}/) - add_test(NAME cover_complex_nerve_example_py_test - WORKING_DIRECTORY ${CMAKE_CURRENT_BINARY_DIR} - COMMAND ${CMAKE_COMMAND} -E env "PYTHONPATH=${CMAKE_CURRENT_BINARY_DIR}" - ${PYTHON_EXECUTABLE} "${CMAKE_CURRENT_SOURCE_DIR}/example/nerve_of_a_covering.py" - -f human.off -c 2 -r 10 -g 0.3) + # Cover complex + file(COPY ${CMAKE_SOURCE_DIR}/data/points/human.off DESTINATION ${CMAKE_CURRENT_BINARY_DIR}/) + file(COPY ${CMAKE_SOURCE_DIR}/data/points/COIL_database/lucky_cat.off DESTINATION ${CMAKE_CURRENT_BINARY_DIR}/) + file(COPY ${CMAKE_SOURCE_DIR}/data/points/COIL_database/lucky_cat_PCA1 DESTINATION ${CMAKE_CURRENT_BINARY_DIR}/) + add_test(NAME cover_complex_nerve_example_py_test + WORKING_DIRECTORY ${CMAKE_CURRENT_BINARY_DIR} + COMMAND ${CMAKE_COMMAND} -E env "${GUDHI_PYTHON_PATH_ENV}" + ${PYTHON_EXECUTABLE} "${CMAKE_CURRENT_SOURCE_DIR}/example/nerve_of_a_covering.py" + -f human.off -c 2 -r 10 -g 0.3) - add_test(NAME cover_complex_coordinate_gic_example_py_test - WORKING_DIRECTORY ${CMAKE_CURRENT_BINARY_DIR} - COMMAND ${CMAKE_COMMAND} -E env "PYTHONPATH=${CMAKE_CURRENT_BINARY_DIR}" - ${PYTHON_EXECUTABLE} "${CMAKE_CURRENT_SOURCE_DIR}/example/coordinate_graph_induced_complex.py" - -f human.off -c 0 -v) + add_test(NAME cover_complex_coordinate_gic_example_py_test + WORKING_DIRECTORY ${CMAKE_CURRENT_BINARY_DIR} + COMMAND ${CMAKE_COMMAND} -E env "${GUDHI_PYTHON_PATH_ENV}" + ${PYTHON_EXECUTABLE} "${CMAKE_CURRENT_SOURCE_DIR}/example/coordinate_graph_induced_complex.py" + -f human.off -c 0 -v) - add_test(NAME cover_complex_functional_gic_example_py_test - WORKING_DIRECTORY ${CMAKE_CURRENT_BINARY_DIR} - COMMAND ${CMAKE_COMMAND} -E env "PYTHONPATH=${CMAKE_CURRENT_BINARY_DIR}" - ${PYTHON_EXECUTABLE} "${CMAKE_CURRENT_SOURCE_DIR}/example/functional_graph_induced_complex.py" - -o lucky_cat.off - -f lucky_cat_PCA1 -v) + add_test(NAME cover_complex_functional_gic_example_py_test + WORKING_DIRECTORY ${CMAKE_CURRENT_BINARY_DIR} + COMMAND ${CMAKE_COMMAND} -E env "${GUDHI_PYTHON_PATH_ENV}" + ${PYTHON_EXECUTABLE} "${CMAKE_CURRENT_SOURCE_DIR}/example/functional_graph_induced_complex.py" + -o lucky_cat.off + -f lucky_cat_PCA1 -v) - add_test(NAME cover_complex_voronoi_gic_example_py_test - WORKING_DIRECTORY ${CMAKE_CURRENT_BINARY_DIR} - COMMAND ${CMAKE_COMMAND} -E env "PYTHONPATH=${CMAKE_CURRENT_BINARY_DIR}" - ${PYTHON_EXECUTABLE} "${CMAKE_CURRENT_SOURCE_DIR}/example/voronoi_graph_induced_complex.py" - -f human.off -n 700 -v) + add_test(NAME cover_complex_voronoi_gic_example_py_test + WORKING_DIRECTORY ${CMAKE_CURRENT_BINARY_DIR} + COMMAND ${CMAKE_COMMAND} -E env "${GUDHI_PYTHON_PATH_ENV}" + ${PYTHON_EXECUTABLE} "${CMAKE_CURRENT_SOURCE_DIR}/example/voronoi_graph_induced_complex.py" + -f human.off -n 700 -v) - add_gudhi_py_test(test_cover_complex) - endif (NOT CGAL_VERSION VERSION_LESS 4.11.0) + add_gudhi_py_test(test_cover_complex) - if (NOT CGAL_WITH_EIGEN3_VERSION VERSION_LESS 4.11.0) + if (NOT CGAL_WITH_EIGEN3_VERSION VERSION_LESS 5.1.0) # Alpha add_test(NAME alpha_complex_from_points_example_py_test WORKING_DIRECTORY ${CMAKE_CURRENT_BINARY_DIR} - COMMAND ${CMAKE_COMMAND} -E env "PYTHONPATH=${CMAKE_CURRENT_BINARY_DIR}" + COMMAND ${CMAKE_COMMAND} -E env "${GUDHI_PYTHON_PATH_ENV}" ${PYTHON_EXECUTABLE} "${CMAKE_CURRENT_SOURCE_DIR}/example/alpha_complex_from_points_example.py") + add_test(NAME alpha_complex_from_generated_points_on_sphere_example_py_test + WORKING_DIRECTORY ${CMAKE_CURRENT_BINARY_DIR} + COMMAND ${CMAKE_COMMAND} -E env "${GUDHI_PYTHON_PATH_ENV}" + ${PYTHON_EXECUTABLE} "${CMAKE_CURRENT_SOURCE_DIR}/example/alpha_complex_from_generated_points_on_sphere_example.py") add_test(NAME alpha_complex_diagram_persistence_from_off_file_example_py_test WORKING_DIRECTORY ${CMAKE_CURRENT_BINARY_DIR} - COMMAND ${CMAKE_COMMAND} -E env "PYTHONPATH=${CMAKE_CURRENT_BINARY_DIR}" + COMMAND ${CMAKE_COMMAND} -E env "${GUDHI_PYTHON_PATH_ENV}" ${PYTHON_EXECUTABLE} "${CMAKE_CURRENT_SOURCE_DIR}/example/alpha_complex_diagram_persistence_from_off_file_example.py" - --no-diagram -f ${CMAKE_SOURCE_DIR}/data/points/tore3D_300.off -a 0.6) + --no-diagram -f ${CMAKE_SOURCE_DIR}/data/points/tore3D_300.off) add_gudhi_py_test(test_alpha_complex) - endif (NOT CGAL_WITH_EIGEN3_VERSION VERSION_LESS 4.11.0) + endif (NOT CGAL_WITH_EIGEN3_VERSION VERSION_LESS 5.1.0) if (NOT CGAL_WITH_EIGEN3_VERSION VERSION_LESS 4.11.0) # Euclidean witness add_gudhi_py_test(test_euclidean_witness_complex) + # Datasets generators + add_gudhi_py_test(test_datasets_generators) # TODO separate full python datasets generators in another test file independent from CGAL ? + endif (NOT CGAL_WITH_EIGEN3_VERSION VERSION_LESS 4.11.0) # Cubical add_test(NAME periodic_cubical_complex_barcode_persistence_from_perseus_file_example_py_test WORKING_DIRECTORY ${CMAKE_CURRENT_BINARY_DIR} - COMMAND ${CMAKE_COMMAND} -E env "PYTHONPATH=${CMAKE_CURRENT_BINARY_DIR}" + COMMAND ${CMAKE_COMMAND} -E env "${GUDHI_PYTHON_PATH_ENV}" ${PYTHON_EXECUTABLE} "${CMAKE_CURRENT_SOURCE_DIR}/example/periodic_cubical_complex_barcode_persistence_from_perseus_file_example.py" --no-barcode -f ${CMAKE_SOURCE_DIR}/data/bitmap/CubicalTwoSphere.txt) add_test(NAME random_cubical_complex_persistence_example_py_test WORKING_DIRECTORY ${CMAKE_CURRENT_BINARY_DIR} - COMMAND ${CMAKE_COMMAND} -E env "PYTHONPATH=${CMAKE_CURRENT_BINARY_DIR}" + COMMAND ${CMAKE_COMMAND} -E env "${GUDHI_PYTHON_PATH_ENV}" ${PYTHON_EXECUTABLE} "${CMAKE_CURRENT_SOURCE_DIR}/example/random_cubical_complex_persistence_example.py" 10 10 10) @@ -456,19 +510,19 @@ if(PYTHONINTERP_FOUND) # Rips add_test(NAME rips_complex_diagram_persistence_from_distance_matrix_file_example_py_test WORKING_DIRECTORY ${CMAKE_CURRENT_BINARY_DIR} - COMMAND ${CMAKE_COMMAND} -E env "PYTHONPATH=${CMAKE_CURRENT_BINARY_DIR}" + COMMAND ${CMAKE_COMMAND} -E env "${GUDHI_PYTHON_PATH_ENV}" ${PYTHON_EXECUTABLE} "${CMAKE_CURRENT_SOURCE_DIR}/example/rips_complex_diagram_persistence_from_distance_matrix_file_example.py" - --no-diagram -f ${CMAKE_SOURCE_DIR}/data/distance_matrix/lower_triangular_distance_matrix.csv -e 12.0 -d 3) + --no-diagram -f ${CMAKE_SOURCE_DIR}/data/distance_matrix/lower_triangular_distance_matrix.csv -s , -e 12.0 -d 3) add_test(NAME rips_complex_diagram_persistence_from_off_file_example_py_test WORKING_DIRECTORY ${CMAKE_CURRENT_BINARY_DIR} - COMMAND ${CMAKE_COMMAND} -E env "PYTHONPATH=${CMAKE_CURRENT_BINARY_DIR}" + COMMAND ${CMAKE_COMMAND} -E env "${GUDHI_PYTHON_PATH_ENV}" ${PYTHON_EXECUTABLE} ${CMAKE_CURRENT_SOURCE_DIR}/example/rips_complex_diagram_persistence_from_off_file_example.py --no-diagram -f ${CMAKE_SOURCE_DIR}/data/points/tore3D_300.off -e 0.25 -d 3) add_test(NAME rips_complex_from_points_example_py_test WORKING_DIRECTORY ${CMAKE_CURRENT_BINARY_DIR} - COMMAND ${CMAKE_COMMAND} -E env "PYTHONPATH=${CMAKE_CURRENT_BINARY_DIR}" + COMMAND ${CMAKE_COMMAND} -E env "${GUDHI_PYTHON_PATH_ENV}" ${PYTHON_EXECUTABLE} ${CMAKE_CURRENT_SOURCE_DIR}/example/rips_complex_from_points_example.py) add_gudhi_py_test(test_rips_complex) @@ -476,7 +530,7 @@ if(PYTHONINTERP_FOUND) # Simplex tree add_test(NAME simplex_tree_example_py_test WORKING_DIRECTORY ${CMAKE_CURRENT_BINARY_DIR} - COMMAND ${CMAKE_COMMAND} -E env "PYTHONPATH=${CMAKE_CURRENT_BINARY_DIR}" + COMMAND ${CMAKE_COMMAND} -E env "${GUDHI_PYTHON_PATH_ENV}" ${PYTHON_EXECUTABLE} ${CMAKE_CURRENT_SOURCE_DIR}/example/simplex_tree_example.py) add_gudhi_py_test(test_simplex_tree) @@ -485,23 +539,24 @@ if(PYTHONINTERP_FOUND) # Witness add_test(NAME witness_complex_from_nearest_landmark_table_py_test WORKING_DIRECTORY ${CMAKE_CURRENT_BINARY_DIR} - COMMAND ${CMAKE_COMMAND} -E env "PYTHONPATH=${CMAKE_CURRENT_BINARY_DIR}" + COMMAND ${CMAKE_COMMAND} -E env "${GUDHI_PYTHON_PATH_ENV}" ${PYTHON_EXECUTABLE} ${CMAKE_CURRENT_SOURCE_DIR}/example/witness_complex_from_nearest_landmark_table.py) add_gudhi_py_test(test_witness_complex) # Reader utils add_gudhi_py_test(test_reader_utils) + add_gudhi_py_test(test_off) # Wasserstein - if(OT_FOUND AND PYBIND11_FOUND) + if(OT_FOUND) # EagerPy dependency because of enable_autodiff=True if(EAGERPY_FOUND) add_gudhi_py_test(test_wasserstein_distance) endif() + add_gudhi_py_test(test_wasserstein_barycenter) - endif() - if(OT_FOUND) + if(TORCH_FOUND AND TENSORFLOW_FOUND AND EAGERPY_FOUND) add_gudhi_py_test(test_wasserstein_with_tensors) endif() @@ -512,6 +567,21 @@ if(PYTHONINTERP_FOUND) add_gudhi_py_test(test_representations) endif() + # Differentiation + if(TENSORFLOW_FOUND) + add_gudhi_py_test(test_diff) + endif() + + # Betti curves + if(SKLEARN_FOUND AND SCIPY_FOUND) + add_gudhi_py_test(test_betti_curve_representations) + endif() + + # Representations preprocessing + if(SKLEARN_FOUND) + add_gudhi_py_test(test_representations_preprocessing) + endif() + # Time Delay add_gudhi_py_test(test_time_delay) @@ -522,7 +592,7 @@ if(PYTHONINTERP_FOUND) endif() # Tomato - if(SCIPY_FOUND AND SKLEARN_FOUND AND PYBIND11_FOUND) + if(SCIPY_FOUND AND SKLEARN_FOUND) add_gudhi_py_test(test_tomato) endif() @@ -536,13 +606,27 @@ if(PYTHONINTERP_FOUND) add_gudhi_py_test(test_dtm_rips_complex) endif() + # Fetch remote datasets + if(WITH_GUDHI_REMOTE_TEST) + add_gudhi_py_test(test_remote_datasets) + endif() + + # sklearn + if(SKLEARN_FOUND) + add_gudhi_py_test(test_sklearn_cubical_persistence) + endif() + + # persistence graphical tools + if(MATPLOTLIB_FOUND) + add_gudhi_py_test(test_persistence_graphical_tools) + endif() # Set missing or not modules set(GUDHI_MODULES ${GUDHI_MODULES} "python" CACHE INTERNAL "GUDHI_MODULES") - else(CYTHON_FOUND) - message("++ Python module will not be compiled because cython was not found") + else(NUMPY_FOUND AND PYBIND11_FOUND AND CYTHON_FOUND) + message("++ Python module will not be compiled because numpy and/or cython and/or pybind11 was/were not found") set(GUDHI_MISSING_MODULES ${GUDHI_MISSING_MODULES} "python" CACHE INTERNAL "GUDHI_MISSING_MODULES") - endif(CYTHON_FOUND) + endif(NUMPY_FOUND AND PYBIND11_FOUND AND CYTHON_FOUND) else(PYTHONINTERP_FOUND) message("++ Python module will not be compiled because no Python interpreter was found") set(GUDHI_MISSING_MODULES ${GUDHI_MISSING_MODULES} "python" CACHE INTERNAL "GUDHI_MISSING_MODULES") diff --git a/src/python/doc/_templates/layout.html b/src/python/doc/_templates/layout.html index cd40a51b..e074b6c7 100644 --- a/src/python/doc/_templates/layout.html +++ b/src/python/doc/_templates/layout.html @@ -194,6 +194,7 @@ <li><a href="/relatedprojects/">Related projects</a></li> <li><a href="/theyaretalkingaboutus/">They are talking about us</a></li> <li><a href="/inaction/">GUDHI in action</a></li> + <li><a href="/etymology/">Etymology</a></li> </ul> </li> <li class="divider"></li> diff --git a/src/python/doc/alpha_complex_ref.rst b/src/python/doc/alpha_complex_ref.rst index 7da79543..eaa72551 100644 --- a/src/python/doc/alpha_complex_ref.rst +++ b/src/python/doc/alpha_complex_ref.rst @@ -9,6 +9,5 @@ Alpha complex reference manual .. autoclass:: gudhi.AlphaComplex :members: :undoc-members: - :show-inheritance: .. automethod:: gudhi.AlphaComplex.__init__ diff --git a/src/python/doc/alpha_complex_sum.inc b/src/python/doc/alpha_complex_sum.inc index aeab493f..5c76fd54 100644 --- a/src/python/doc/alpha_complex_sum.inc +++ b/src/python/doc/alpha_complex_sum.inc @@ -1,15 +1,15 @@ .. table:: :widths: 30 40 30 - +----------------------------------------------------------------+-------------------------------------------------------------------------+---------------------------------------------------------------------------------------------------------------------------+ - | .. figure:: | Alpha complex is a simplicial complex constructed from the finite | :Author: Vincent Rouvreau | - | ../../doc/Alpha_complex/alpha_complex_representation.png | cells of a Delaunay Triangulation. It has the same persistent homology | | - | :alt: Alpha complex representation | as the Čech complex and is significantly smaller. | :Since: GUDHI 2.0.0 | - | :figclass: align-center | | | - | | | :License: MIT (`GPL v3 </licensing/>`_) | - | | | | - | | | :Requires: `Eigen <installation.html#eigen>`_ :math:`\geq` 3.1.0 and `CGAL <installation.html#cgal>`_ :math:`\geq` 4.11.0 | - | | | | - +----------------------------------------------------------------+-------------------------------------------------------------------------+---------------------------------------------------------------------------------------------------------------------------+ - | * :doc:`alpha_complex_user` | * :doc:`alpha_complex_ref` | - +----------------------------------------------------------------+-----------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------+ + +----------------------------------------------------------------+-------------------------------------------------------------------------+------------------------------------------------------------------------------------------------------------------------+ + | .. figure:: | Alpha complex is a simplicial complex constructed from the finite | :Author: Vincent Rouvreau | + | ../../doc/Alpha_complex/alpha_complex_representation.png | cells of a Delaunay Triangulation. It has the same persistent homology | | + | :alt: Alpha complex representation | as the Čech complex and is significantly smaller. | :Since: GUDHI 2.0.0 | + | :figclass: align-center | | | + | | | :License: MIT (`GPL v3 </licensing/>`_) | + | | | | + | | | :Requires: `Eigen <installation.html#eigen>`_ :math:`\geq` 3.1.0 and `CGAL <installation.html#cgal>`_ :math:`\geq` 5.1 | + | | | | + +----------------------------------------------------------------+-------------------------------------------------------------------------+------------------------------------------------------------------------------------------------------------------------+ + | * :doc:`alpha_complex_user` | * :doc:`alpha_complex_ref` | + +----------------------------------------------------------------+--------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------------+ diff --git a/src/python/doc/alpha_complex_user.rst b/src/python/doc/alpha_complex_user.rst index fffcb3db..9e67d38a 100644 --- a/src/python/doc/alpha_complex_user.rst +++ b/src/python/doc/alpha_complex_user.rst @@ -9,7 +9,7 @@ Definition .. include:: alpha_complex_sum.inc -:doc:`AlphaComplex <alpha_complex_ref>` is constructing a :doc:`SimplexTree <simplex_tree_ref>` using +:class:`~gudhi.AlphaComplex` is constructing a :doc:`SimplexTree <simplex_tree_ref>` using `Delaunay Triangulation <http://doc.cgal.org/latest/Triangulation/index.html#Chapter_Triangulations>`_ :cite:`cgal:hdj-t-19b` from the `Computational Geometry Algorithms Library <http://www.cgal.org/>`_ :cite:`cgal:eb-19b`. @@ -27,15 +27,13 @@ Remarks If you pass :code:`precision = 'exact'` to :func:`~gudhi.AlphaComplex.__init__`, the filtration values are the exact ones converted to float. This can be very slow. If you pass :code:`precision = 'safe'` (the default), the filtration values are only - guaranteed to have a small multiplicative error compared to the exact value. + guaranteed to have a small multiplicative error compared to the exact value, see + :func:`~gudhi.AlphaComplex.set_float_relative_precision` to modify the precision. A drawback, when computing persistence, is that an empty exact interval [10^12,10^12] may become a non-empty approximate interval [10^12,10^12+10^6]. Using :code:`precision = 'fast'` makes the computations slightly faster, and the combinatorics are still exact, but the computation of filtration values can exceptionally be arbitrarily bad. In all cases, we still guarantee that the output is a valid filtration (faces have a filtration value no larger than their cofaces). -* For performances reasons, it is advised to use Alpha_complex with `CGAL <installation.html#cgal>`_ :math:`\geq` 5.0.0. -* The vertices in the output simplex tree are not guaranteed to match the order of the input points. One can use - :func:`~gudhi.AlphaComplex.get_point` to get the initial point back. Example from points ------------------- @@ -44,23 +42,22 @@ This example builds the alpha-complex from the given points: .. testcode:: - import gudhi - alpha_complex = gudhi.AlphaComplex(points=[[1, 1], [7, 0], [4, 6], [9, 6], [0, 14], [2, 19], [9, 17]]) + from gudhi import AlphaComplex + ac = AlphaComplex(points=[[1, 1], [7, 0], [4, 6], [9, 6], [0, 14], [2, 19], [9, 17]]) + + stree = ac.create_simplex_tree() + print('Alpha complex is of dimension ', stree.dimension(), ' - ', + stree.num_simplices(), ' simplices - ', stree.num_vertices(), ' vertices.') - simplex_tree = alpha_complex.create_simplex_tree() - result_str = 'Alpha complex is of dimension ' + repr(simplex_tree.dimension()) + ' - ' + \ - repr(simplex_tree.num_simplices()) + ' simplices - ' + \ - repr(simplex_tree.num_vertices()) + ' vertices.' - print(result_str) fmt = '%s -> %.2f' - for filtered_value in simplex_tree.get_filtration(): + for filtered_value in stree.get_filtration(): print(fmt % tuple(filtered_value)) The output is: .. testoutput:: - Alpha complex is of dimension 2 - 25 simplices - 7 vertices. + Alpha complex is of dimension 2 - 25 simplices - 7 vertices. [0] -> 0.00 [1] -> 0.00 [2] -> 0.00 @@ -163,7 +160,10 @@ As the squared radii computed by CGAL are an approximation, it might happen that :math:`\alpha^2` values do not quite define a proper filtration (i.e. non-decreasing with respect to inclusion). We fix that up by calling :func:`~gudhi.SimplexTree.make_filtration_non_decreasing` (cf. -`C++ version <http://gudhi.gforge.inria.fr/doc/latest/index.html>`_). +`C++ version <https://gudhi.inria.fr/doc/latest/class_gudhi_1_1_simplex__tree.html>`_). + +.. note:: + This is not the case in `exact` version, this is the reason why it is not called in this case. Prune above given filtration value ^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^^ @@ -174,11 +174,75 @@ of speed-up, since we always first build the full filtered complex, so it is rec :paramref:`~gudhi.AlphaComplex.create_simplex_tree.max_alpha_square`. In the following example, a threshold of :math:`\alpha^2 = 32.0` is used. +Weighted version +^^^^^^^^^^^^^^^^ + +A weighted version for Alpha complex is available. It is like a usual Alpha complex, but based on a +`CGAL regular triangulation <https://doc.cgal.org/latest/Triangulation/index.html#TriangulationSecRT>`_. + +This example builds the weighted alpha-complex of a small molecule, where atoms have different sizes. +It is taken from +`CGAL 3d weighted alpha shapes <https://doc.cgal.org/latest/Alpha_shapes_3/index.html#AlphaShape_3DExampleforWeightedAlphaShapes>`_. + +Then, it is asked to display information about the alpha complex. + +.. testcode:: + + from gudhi import AlphaComplex + wgt_ac = AlphaComplex(points=[[ 1., -1., -1.], + [-1., 1., -1.], + [-1., -1., 1.], + [ 1., 1., 1.], + [ 2., 2., 2.]], + weights = [4., 4., 4., 4., 1.]) + + stree = wgt_ac.create_simplex_tree() + print('Weighted alpha complex is of dimension ', stree.dimension(), ' - ', + stree.num_simplices(), ' simplices - ', stree.num_vertices(), ' vertices.') + fmt = '%s -> %.2f' + for simplex in stree.get_simplices(): + print(fmt % tuple(simplex)) + +The output is: + +.. testoutput:: + + Weighted alpha complex is of dimension 3 - 29 simplices - 5 vertices. + [0, 1, 2, 3] -> -1.00 + [0, 1, 2] -> -1.33 + [0, 1, 3, 4] -> 95.00 + [0, 1, 3] -> -1.33 + [0, 1, 4] -> 95.00 + [0, 1] -> -2.00 + [0, 2, 3, 4] -> 95.00 + [0, 2, 3] -> -1.33 + [0, 2, 4] -> 95.00 + [0, 2] -> -2.00 + [0, 3, 4] -> 23.00 + [0, 3] -> -2.00 + [0, 4] -> 23.00 + [0] -> -4.00 + [1, 2, 3, 4] -> 95.00 + [1, 2, 3] -> -1.33 + [1, 2, 4] -> 95.00 + [1, 2] -> -2.00 + [1, 3, 4] -> 23.00 + [1, 3] -> -2.00 + [1, 4] -> 23.00 + [1] -> -4.00 + [2, 3, 4] -> 23.00 + [2, 3] -> -2.00 + [2, 4] -> 23.00 + [2] -> -4.00 + [3, 4] -> -1.00 + [3] -> -4.00 + [4] -> -1.00 Example from OFF file ^^^^^^^^^^^^^^^^^^^^^ -This example builds the alpha complex from 300 random points on a 2-torus. +This example builds the alpha complex from 300 random points on a 2-torus, given by an +`OFF file <fileformats.html#off-file-format>`_. Then, it computes the persistence diagram and displays it: @@ -186,14 +250,10 @@ Then, it computes the persistence diagram and displays it: :include-source: import matplotlib.pyplot as plt - import gudhi - alpha_complex = gudhi.AlphaComplex(off_file=gudhi.__root_source_dir__ + \ - '/data/points/tore3D_300.off') - simplex_tree = alpha_complex.create_simplex_tree() - result_str = 'Alpha complex is of dimension ' + repr(simplex_tree.dimension()) + ' - ' + \ - repr(simplex_tree.num_simplices()) + ' simplices - ' + \ - repr(simplex_tree.num_vertices()) + ' vertices.' - print(result_str) - diag = simplex_tree.persistence() - gudhi.plot_persistence_diagram(diag) + import gudhi as gd + off_file = gd.__root_source_dir__ + '/data/points/tore3D_300.off' + points = gd.read_points_from_off_file(off_file = off_file) + stree = gd.AlphaComplex(points = points).create_simplex_tree() + dgm = stree.persistence() + gd.plot_persistence_diagram(dgm, legend = True) plt.show() diff --git a/src/python/doc/clustering.rst b/src/python/doc/clustering.rst index c5a57d3c..62422682 100644 --- a/src/python/doc/clustering.rst +++ b/src/python/doc/clustering.rst @@ -17,9 +17,8 @@ As a by-product, we produce the persistence diagram of the merge tree of the ini :include-source: import gudhi - f = open(gudhi.__root_source_dir__ + '/data/points/spiral_2d.csv', 'r') - import numpy as np - data = np.loadtxt(f) + from gudhi.datasets.remote import fetch_spiral_2d + data = fetch_spiral_2d() import matplotlib.pyplot as plt plt.scatter(data[:,0],data[:,1],marker='.',s=1) plt.show() diff --git a/src/python/doc/conf.py b/src/python/doc/conf.py index b06baf9c..e69e2751 100755 --- a/src/python/doc/conf.py +++ b/src/python/doc/conf.py @@ -120,15 +120,12 @@ pygments_style = 'sphinx' # The theme to use for HTML and HTML Help pages. See the documentation for # a list of builtin themes. -html_theme = 'classic' +html_theme = 'python_docs_theme' # Theme options are theme-specific and customize the look and feel of a theme # further. For a list of options available for each theme, see the # documentation. html_theme_options = { - "sidebarbgcolor": "#A1ADCD", - "sidebartextcolor": "black", - "sidebarlinkcolor": "#334D5C", "body_max_width": "100%", } diff --git a/src/python/doc/cubical_complex_sklearn_itf_ref.rst b/src/python/doc/cubical_complex_sklearn_itf_ref.rst new file mode 100644 index 00000000..90ae9ccd --- /dev/null +++ b/src/python/doc/cubical_complex_sklearn_itf_ref.rst @@ -0,0 +1,102 @@ +:orphan: + +.. To get rid of WARNING: document isn't included in any toctree + +Cubical complex persistence scikit-learn like interface +####################################################### + +.. list-table:: + :width: 100% + :header-rows: 0 + + * - :Since: GUDHI 3.6.0 + - :License: MIT + - :Requires: `Scikit-learn <installation.html#scikit-learn>`_ + +Cubical complex persistence scikit-learn like interface example +--------------------------------------------------------------- + +In this example, hand written digits are used as an input. +a TDA scikit-learn pipeline is constructed and is composed of: + +#. :class:`~gudhi.sklearn.cubical_persistence.CubicalPersistence` that builds a cubical complex from the inputs and + returns its persistence diagrams +#. :class:`~gudhi.representations.preprocessing.DiagramSelector` that removes non-finite persistence diagrams values +#. :class:`~gudhi.representations.vector_methods.PersistenceImage` that builds the persistence images from persistence diagrams +#. `SVC <https://scikit-learn.org/stable/modules/generated/sklearn.svm.SVC.html>`_ which is a scikit-learn support + vector classifier. + +This ML pipeline is trained to detect if the hand written digit is an '8' or not, thanks to the fact that an '8' has +two holes in :math:`\mathbf{H}_1`, or, like in this example, three connected components in :math:`\mathbf{H}_0`. + +.. code-block:: python + + # Standard scientific Python imports + import numpy as np + + # Standard scikit-learn imports + from sklearn.datasets import fetch_openml + from sklearn.pipeline import Pipeline + from sklearn.model_selection import train_test_split + from sklearn.svm import SVC + from sklearn import metrics + + # Import TDA pipeline requirements + from gudhi.sklearn.cubical_persistence import CubicalPersistence + from gudhi.representations import PersistenceImage, DiagramSelector + + X, y = fetch_openml("mnist_784", version=1, return_X_y=True, as_frame=False) + + # Target is: "is an eight ?" + y = (y == "8") * 1 + print("There are", np.sum(y), "eights out of", len(y), "numbers.") + + X_train, X_test, y_train, y_test = train_test_split(X, y, test_size=0.4, random_state=0) + pipe = Pipeline( + [ + ("cub_pers", CubicalPersistence(homology_dimensions=0, newshape=[-1, 28, 28], n_jobs=-2)), + # Or for multiple persistence dimension computation + # ("cub_pers", CubicalPersistence(homology_dimensions=[0, 1], newshape=[-1, 28, 28])), + # ("H0_diags", DimensionSelector(index=0), # where index is the index in homology_dimensions array + ("finite_diags", DiagramSelector(use=True, point_type="finite")), + ( + "pers_img", + PersistenceImage(bandwidth=50, weight=lambda x: x[1] ** 2, im_range=[0, 256, 0, 256], resolution=[20, 20]), + ), + ("svc", SVC()), + ] + ) + + # Learn from the train subset + pipe.fit(X_train, y_train) + # Predict from the test subset + predicted = pipe.predict(X_test) + + print(f"Classification report for TDA pipeline {pipe}:\n" f"{metrics.classification_report(y_test, predicted)}\n") + +.. code-block:: none + + There are 6825 eights out of 70000 numbers. + Classification report for TDA pipeline Pipeline(steps=[('cub_pers', + CubicalPersistence(newshape=[28, 28], n_jobs=-2)), + ('finite_diags', DiagramSelector(use=True)), + ('pers_img', + PersistenceImage(bandwidth=50, im_range=[0, 256, 0, 256], + weight=<function <lambda> at 0x7f3e54137ae8>)), + ('svc', SVC())]): + precision recall f1-score support + + 0 0.97 0.99 0.98 25284 + 1 0.92 0.68 0.78 2716 + + accuracy 0.96 28000 + macro avg 0.94 0.84 0.88 28000 + weighted avg 0.96 0.96 0.96 28000 + +Cubical complex persistence scikit-learn like interface reference +----------------------------------------------------------------- + +.. autoclass:: gudhi.sklearn.cubical_persistence.CubicalPersistence + :members: + :special-members: __init__ + :show-inheritance:
\ No newline at end of file diff --git a/src/python/doc/cubical_complex_sum.inc b/src/python/doc/cubical_complex_sum.inc index 87db184d..b27843e5 100644 --- a/src/python/doc/cubical_complex_sum.inc +++ b/src/python/doc/cubical_complex_sum.inc @@ -1,14 +1,22 @@ .. table:: :widths: 30 40 30 - +--------------------------------------------------------------------------+----------------------------------------------------------------------+-----------------------------+ - | .. figure:: | The cubical complex represents a grid as a cell complex with | :Author: Pawel Dlotko | - | ../../doc/Bitmap_cubical_complex/Cubical_complex_representation.png | cells of all dimensions. | | - | :alt: Cubical complex representation | | :Since: GUDHI 2.0.0 | - | :figclass: align-center | | | - | | | :License: MIT | - | | | | - +--------------------------------------------------------------------------+----------------------------------------------------------------------+-----------------------------+ - | * :doc:`cubical_complex_user` | * :doc:`cubical_complex_ref` | - | | * :doc:`periodic_cubical_complex_ref` | - +--------------------------------------------------------------------------+----------------------------------------------------------------------------------------------------+ + +--------------------------------------------------------------------------+--------------------------------------------------------------+-------------------------------------------------------------+ + | .. figure:: | The cubical complex represents a grid as a cell complex with | :Author: Pawel Dlotko | + | ../../doc/Bitmap_cubical_complex/Cubical_complex_representation.png | cells of all dimensions. | :Since: GUDHI 2.0.0 | + | :alt: Cubical complex representation | | :License: MIT | + | :figclass: align-center | | | + +--------------------------------------------------------------------------+--------------------------------------------------------------+-------------------------------------------------------------+ + | * :doc:`cubical_complex_user` | * :doc:`cubical_complex_ref` | + | | * :doc:`periodic_cubical_complex_ref` | + +--------------------------------------------------------------------------+--------------------------------------------------------------+-------------------------------------------------------------+ + | .. image:: | * :doc:`cubical_complex_tflow_itf_ref` | :requires: `TensorFlow <installation.html#tensorflow>`_ | + | img/tensorflow.png | | | + | :target: https://www.tensorflow.org | | | + | :height: 30 | | | + +--------------------------------------------------------------------------+--------------------------------------------------------------+-------------------------------------------------------------+ + | .. image:: | * :doc:`cubical_complex_sklearn_itf_ref` | :Requires: `Scikit-learn <installation.html#scikit-learn>`_ | + | img/sklearn.png | | | + | :target: https://scikit-learn.org | | | + | :height: 30 | | | + +--------------------------------------------------------------------------+--------------------------------------------------------------+-------------------------------------------------------------+ diff --git a/src/python/doc/cubical_complex_tflow_itf_ref.rst b/src/python/doc/cubical_complex_tflow_itf_ref.rst new file mode 100644 index 00000000..b32f5e47 --- /dev/null +++ b/src/python/doc/cubical_complex_tflow_itf_ref.rst @@ -0,0 +1,40 @@ +:orphan: + +.. To get rid of WARNING: document isn't included in any toctree + +TensorFlow layer for cubical persistence +######################################## + +.. include:: differentiation_sum.inc + +Example of gradient computed from cubical persistence +----------------------------------------------------- + +.. testcode:: + + from gudhi.tensorflow import CubicalLayer + import tensorflow as tf + + X = tf.Variable([[0.,2.,2.],[2.,2.,2.],[2.,2.,1.]], dtype=tf.float32, trainable=True) + cl = CubicalLayer(homology_dimensions=[0]) + + with tf.GradientTape() as tape: + dgm = cl.call(X)[0][0] + loss = tf.math.reduce_sum(tf.square(.5*(dgm[:,1]-dgm[:,0]))) + + grads = tape.gradient(loss, [X]) + print(grads[0].numpy()) + +.. testoutput:: + + [[ 0. 0. 0. ] + [ 0. 0.5 0. ] + [ 0. 0. -0.5]] + +Documentation for CubicalLayer +------------------------------ + +.. autoclass:: gudhi.tensorflow.CubicalLayer + :members: + :special-members: __init__ + :show-inheritance: diff --git a/src/python/doc/cubical_complex_user.rst b/src/python/doc/cubical_complex_user.rst index 6a211347..42a23875 100644 --- a/src/python/doc/cubical_complex_user.rst +++ b/src/python/doc/cubical_complex_user.rst @@ -7,14 +7,7 @@ Cubical complex user manual Definition ---------- -===================================== ===================================== ===================================== -:Author: Pawel Dlotko :Since: GUDHI PYTHON 2.0.0 :License: GPL v3 -===================================== ===================================== ===================================== - -+---------------------------------------------+----------------------------------------------------------------------+ -| :doc:`cubical_complex_user` | * :doc:`cubical_complex_ref` | -| | * :doc:`periodic_cubical_complex_ref` | -+---------------------------------------------+----------------------------------------------------------------------+ +.. include:: cubical_complex_sum.inc The cubical complex is an example of a structured complex useful in computational mathematics (specially rigorous numerics) and image analysis. @@ -163,4 +156,4 @@ Tutorial -------- This `notebook <https://github.com/GUDHI/TDA-tutorial/blob/master/Tuto-GUDHI-cubical-complexes.ipynb>`_ -explains how to represent sublevels sets of functions using cubical complexes.
\ No newline at end of file +explains how to represent sublevels sets of functions using cubical complexes. diff --git a/src/python/doc/datasets.inc b/src/python/doc/datasets.inc new file mode 100644 index 00000000..95a87678 --- /dev/null +++ b/src/python/doc/datasets.inc @@ -0,0 +1,14 @@ +.. table:: + :widths: 30 40 30 + + +-----------------------------------+--------------------------------------------+--------------------------------------------------------------------------------------+ + | .. figure:: | Datasets either generated or fetched. | :Authors: Hind Montassif | + | img/sphere_3d.png | | | + | | | :Since: GUDHI 3.5.0 | + | | | | + | | | :License: MIT (`LGPL v3 </licensing/>`_) | + | | | | + | | | :Requires: `CGAL <installation.html#cgal>`_ | + +-----------------------------------+--------------------------------------------+--------------------------------------------------------------------------------------+ + | * :doc:`datasets` | + +-----------------------------------+-----------------------------------------------------------------------------------------------------------------------------------+ diff --git a/src/python/doc/datasets.rst b/src/python/doc/datasets.rst new file mode 100644 index 00000000..2d11a19d --- /dev/null +++ b/src/python/doc/datasets.rst @@ -0,0 +1,133 @@ + +:orphan: + +.. To get rid of WARNING: document isn't included in any toctree + +================ +Datasets manual +================ + +Datasets generators +=================== + +We provide the generation of different customizable datasets to use as inputs for Gudhi complexes and data structures. + +Points generators +------------------ + +The module **points** enables the generation of random points on a sphere, random points on a torus and as a grid. + +Points on sphere +^^^^^^^^^^^^^^^^ + +The function **sphere** enables the generation of random i.i.d. points uniformly on a (d-1)-sphere in :math:`R^d`. +The user should provide the number of points to be generated on the sphere :code:`n_samples` and the ambient dimension :code:`ambient_dim`. +The :code:`radius` of sphere is optional and is equal to **1** by default. +Only random points generation is currently available. + +The generated points are given as an array of shape :math:`(n\_samples, ambient\_dim)`. + +Example +""""""" + +.. code-block:: python + + from gudhi.datasets.generators import points + from gudhi import AlphaComplex + + # Generate 50 points on a sphere in R^2 + gen_points = points.sphere(n_samples = 50, ambient_dim = 2, radius = 1, sample = "random") + + # Create an alpha complex from the generated points + alpha_complex = AlphaComplex(points = gen_points) + +.. autofunction:: gudhi.datasets.generators.points.sphere + +Points on a flat torus +^^^^^^^^^^^^^^^^^^^^^^ + +You can also generate points on a torus. + +Two functions are available and give the same output: the first one depends on **CGAL** and the second does not and consists of full python code. + +On another hand, two sample types are provided: you can either generate i.i.d. points on a d-torus in :math:`R^{2d}` *randomly* or on a *grid*. + +First function: **ctorus** +""""""""""""""""""""""""""" + +The user should provide the number of points to be generated on the torus :code:`n_samples`, and the dimension :code:`dim` of the torus on which points would be generated in :math:`R^{2dim}`. +The :code:`sample` argument is optional and is set to **'random'** by default. +In this case, the returned generated points would be an array of shape :math:`(n\_samples, 2*dim)`. +Otherwise, if set to **'grid'**, the points are generated on a grid and would be given as an array of shape: + +.. math:: + + ( ⌊n\_samples^{1 \over {dim}}⌋^{dim}, 2*dim ) + +**Note 1:** The output array first shape is rounded down to the closest perfect :math:`dim^{th}` power. + +**Note 2:** This version is recommended when the user wishes to use **'grid'** as sample type, or **'random'** with a relatively small number of samples (~ less than 150). + +Example +""""""" +.. code-block:: python + + from gudhi.datasets.generators import points + + # Generate 50 points randomly on a torus in R^6 + gen_points = points.ctorus(n_samples = 50, dim = 3) + + # Generate 27 points on a torus as a grid in R^6 + gen_points = points.ctorus(n_samples = 50, dim = 3, sample = 'grid') + +.. autofunction:: gudhi.datasets.generators.points.ctorus + +Second function: **torus** +""""""""""""""""""""""""""" + +The user should provide the number of points to be generated on the torus :code:`n_samples` and the dimension :code:`dim` of the torus on which points would be generated in :math:`R^{2dim}`. +The :code:`sample` argument is optional and is set to **'random'** by default. +The other allowed value of sample type is **'grid'**. + +**Note:** This version is recommended when the user wishes to use **'random'** as sample type with a great number of samples and a low dimension. + +Example +""""""" +.. code-block:: python + + from gudhi.datasets.generators import points + + # Generate 50 points randomly on a torus in R^6 + gen_points = points.torus(n_samples = 50, dim = 3) + + # Generate 27 points on a torus as a grid in R^6 + gen_points = points.torus(n_samples = 50, dim = 3, sample = 'grid') + + +.. autofunction:: gudhi.datasets.generators.points.torus + + +Fetching datasets +================= + +We provide some ready-to-use datasets that are not available by default when getting GUDHI, and need to be fetched explicitly. + +By **default**, the fetched datasets directory is set to a folder named **'gudhi_data'** in the **user home folder**. +Alternatively, it can be set using the **'GUDHI_DATA'** environment variable. + +.. autofunction:: gudhi.datasets.remote.fetch_bunny + +.. figure:: ./img/bunny.png + :figclass: align-center + + 3D Stanford bunny with 35947 vertices. + + +.. autofunction:: gudhi.datasets.remote.fetch_spiral_2d + +.. figure:: ./img/spiral_2d.png + :figclass: align-center + + 2D spiral with 114562 vertices. + +.. autofunction:: gudhi.datasets.remote.clear_data_home diff --git a/src/python/doc/differentiation_sum.inc b/src/python/doc/differentiation_sum.inc new file mode 100644 index 00000000..140cf180 --- /dev/null +++ b/src/python/doc/differentiation_sum.inc @@ -0,0 +1,12 @@ +.. list-table:: + :width: 100% + :header-rows: 0 + + * - :Since: GUDHI 3.6.0 + - :License: MIT + - :Requires: `TensorFlow <installation.html#tensorflow>`_ + +We provide TensorFlow 2 models that can handle automatic differentiation for the computation of persistence diagrams from complexes available in the Gudhi library. +This includes simplex trees, cubical complexes and Vietoris-Rips complexes. Detailed example on how to use these layers in practice are available +in the following `notebook <https://github.com/GUDHI/TDA-tutorial/blob/master/Tuto-GUDHI-optimization.ipynb>`_. Note that even if TensorFlow GPU is enabled, all +internal computations using Gudhi will be done on CPU. diff --git a/src/python/doc/examples.rst b/src/python/doc/examples.rst index 76e5d4c7..1442f185 100644 --- a/src/python/doc/examples.rst +++ b/src/python/doc/examples.rst @@ -8,6 +8,7 @@ Examples .. only:: builder_html * :download:`alpha_complex_diagram_persistence_from_off_file_example.py <../example/alpha_complex_diagram_persistence_from_off_file_example.py>` + * :download:`alpha_complex_from_generated_points_on_sphere_example.py <../example/alpha_complex_from_generated_points_on_sphere_example.py>` * :download:`alpha_complex_from_points_example.py <../example/alpha_complex_from_points_example.py>` * :download:`alpha_rips_persistence_bottleneck_distance.py <../example/alpha_rips_persistence_bottleneck_distance.py>` * :download:`bottleneck_basic_example.py <../example/bottleneck_basic_example.py>` diff --git a/src/python/doc/img/sklearn.png b/src/python/doc/img/sklearn.png Binary files differnew file mode 100644 index 00000000..d1fecbbf --- /dev/null +++ b/src/python/doc/img/sklearn.png diff --git a/src/python/doc/img/sphere_3d.png b/src/python/doc/img/sphere_3d.png Binary files differnew file mode 100644 index 00000000..70f3184f --- /dev/null +++ b/src/python/doc/img/sphere_3d.png diff --git a/src/python/doc/img/spiral_2d.png b/src/python/doc/img/spiral_2d.png Binary files differnew file mode 100644 index 00000000..abd247cd --- /dev/null +++ b/src/python/doc/img/spiral_2d.png diff --git a/src/python/doc/index.rst b/src/python/doc/index.rst index 040e57a4..35f4ba46 100644 --- a/src/python/doc/index.rst +++ b/src/python/doc/index.rst @@ -91,3 +91,8 @@ Clustering ********** .. include:: clustering.inc + +Datasets +******** + +.. include:: datasets.inc diff --git a/src/python/doc/installation.rst b/src/python/doc/installation.rst index 66efe45a..5491542f 100644 --- a/src/python/doc/installation.rst +++ b/src/python/doc/installation.rst @@ -33,25 +33,19 @@ Compiling These instructions are for people who want to compile gudhi from source, they are unnecessary if you installed a binary package of Gudhi as above. They assume that you have downloaded a `release <https://github.com/GUDHI/gudhi-devel/releases>`_, -with a name like `gudhi.3.2.0.tar.gz`, then run `tar xf gudhi.3.2.0.tar.gz`, which -created a directory `gudhi.3.2.0`, hereinafter referred to as `/path-to-gudhi/`. +with a name like `gudhi.3.X.Y.tar.gz`, then run `tar xf gudhi.3.X.Y.tar.gz`, which +created a directory `gudhi.3.X.Y`, hereinafter referred to as `/path-to-gudhi/`. If you are instead using a git checkout, beware that the paths are a bit different, and in particular the `python/` subdirectory is actually `src/python/` there. -The library uses c++14 and requires `Boost <https://www.boost.org/>`_ :math:`\geq` 1.56.0, +The library uses c++17 and requires `Boost <https://www.boost.org/>`_ :math:`\geq` 1.66.0, `CMake <https://www.cmake.org/>`_ :math:`\geq` 3.5 to generate makefiles, -`NumPy <http://numpy.org>`_, `Cython <https://www.cython.org/>`_ and -`pybind11 <https://github.com/pybind/pybind11>`_ to compile -the GUDHI Python module. -It is a multi-platform library and compiles on Linux, Mac OSX and Visual -Studio 2017 or later. +Python :math:`\geq` 3.5, `NumPy <http://numpy.org>`_ :math:`\geq` 1.15.0, `Cython <https://www.cython.org/>`_ +:math:`\geq` 0.27 and `pybind11 <https://github.com/pybind/pybind11>`_ to compile the GUDHI Python module. +It is a multi-platform library and compiles on Linux, Mac OSX and Visual Studio 2017 or later. -On `Windows <https://wiki.python.org/moin/WindowsCompilers>`_ , only Python -:math:`\geq` 3.5 are available because of the required Visual Studio version. - -On other systems, if you have several Python/python installed, the version 2.X -will be used by default, but you can force it by adding +If you have several Python/python installed, the version 2.X may be used by default, but you can force it by adding :code:`-DPython_ADDITIONAL_VERSIONS=3` to the cmake command. GUDHI Python module compilation @@ -99,20 +93,14 @@ Or install it definitely in your Python packages folder: .. code-block:: bash cd /path-to-gudhi/build/python - # May require sudo or administrator privileges - make install + python setup.py install # add --user to the command if you do not have the permission + # Or 'pip install .' .. note:: - :code:`make install` is only a - `CMake custom targets <https://cmake.org/cmake/help/latest/command/add_custom_target.html>`_ - to shortcut :code:`python setup.py install` command. It does not take into account :code:`CMAKE_INSTALL_PREFIX`. - But one can use :code:`python setup.py install ...` specific options in the python directory: - -.. code-block:: bash - - python setup.py install --prefix /home/gudhi # Install in /home/gudhi directory + But one can use + `alternate location installation <https://docs.python.org/3/install/#alternate-installation>`_. Test suites =========== @@ -148,60 +136,71 @@ If :code:`import gudhi` succeeds, please have a look to debug information: .. code-block:: python - import gudhi - print(gudhi.__debug_info__) + import gudhi as gd + print(gd.__debug_info__) + print("+ Installed modules are: " + gd.__available_modules) + print("+ Missing modules are: " + gd.__missing_modules) You shall have something like: .. code-block:: none - Python version 2.7.15 - Cython version 0.26.1 - Numpy version 1.14.1 - Eigen3 version 3.1.1 - Installed modules are: off_reader;simplex_tree;rips_complex; - cubical_complex;periodic_cubical_complex;reader_utils;witness_complex; - strong_witness_complex;alpha_complex; - Missing modules are: bottleneck_distance;nerve_gic;subsampling; - tangential_complex;persistence_graphical_tools; - euclidean_witness_complex;euclidean_strong_witness_complex; - CGAL version 4.7.1000 - GMP_LIBRARIES = /usr/lib/x86_64-linux-gnu/libgmp.so - GMPXX_LIBRARIES = /usr/lib/x86_64-linux-gnu/libgmpxx.so - TBB version 9107 found and used + Pybind11 version 2.8.1 + Python version 3.7.12 + Cython version 0.29.25 + Numpy version 1.21.4 + Boost version 1.77.0 + + Installed modules are: off_utils;simplex_tree;rips_complex;cubical_complex;periodic_cubical_complex; + persistence_graphical_tools;reader_utils;witness_complex;strong_witness_complex; + + Missing modules are: bottleneck;nerve_gic;subsampling;tangential_complex;alpha_complex;euclidean_witness_complex; + euclidean_strong_witness_complex; -Here, you can see that bottleneck_distance, nerve_gic, subsampling and -tangential_complex are missing because of the CGAL version. -persistence_graphical_tools is not available as matplotlib is not -available. +Here, you can see that the modules that need CGAL are missing, because CGAL is not installed. +:code:`persistence_graphical_tools` is installed, but +`its functions <https://gudhi.inria.fr/python/latest/persistence_graphical_tools_ref.html>`_ will produce an error as +matplotlib is not available. Unitary tests cannot be run as pytest is missing. A complete configuration would be : .. code-block:: none - Python version 3.6.5 - Cython version 0.28.2 - Pytest version 3.3.2 - Matplotlib version 2.2.2 - Numpy version 1.14.5 - Eigen3 version 3.3.4 - Installed modules are: off_reader;simplex_tree;rips_complex; - cubical_complex;periodic_cubical_complex;persistence_graphical_tools; - reader_utils;witness_complex;strong_witness_complex; - persistence_graphical_tools;bottleneck_distance;nerve_gic;subsampling; - tangential_complex;alpha_complex;euclidean_witness_complex; - euclidean_strong_witness_complex; - CGAL header only version 4.11.0 + Pybind11 version 2.8.1 + Python version 3.9.7 + Cython version 0.29.24 + Pytest version 6.2.5 + Matplotlib version 3.5.0 + Numpy version 1.21.4 + Scipy version 1.7.3 + Scikit-learn version 1.0.1 + POT version 0.8.0 + HNSWlib found + PyKeOps version [pyKeOps]: 2.1 + EagerPy version 0.30.0 + TensorFlow version 2.7.0 + Sphinx version 4.3.0 + Sphinx-paramlinks version 0.5.2 + python_docs_theme found + Eigen3 version 3.4.0 + Boost version 1.74.0 + CGAL version 5.3 GMP_LIBRARIES = /usr/lib/x86_64-linux-gnu/libgmp.so GMPXX_LIBRARIES = /usr/lib/x86_64-linux-gnu/libgmpxx.so + MPFR_LIBRARIES = /usr/lib/x86_64-linux-gnu/libmpfr.so TBB version 9107 found and used + + Installed modules are: bottleneck;off_utils;simplex_tree;rips_complex;cubical_complex;periodic_cubical_complex; + persistence_graphical_tools;reader_utils;witness_complex;strong_witness_complex;nerve_gic;subsampling; + tangential_complex;alpha_complex;euclidean_witness_complex;euclidean_strong_witness_complex; + + Missing modules are: + Documentation ============= -To build the documentation, `sphinx-doc <http://www.sphinx-doc.org>`_ and -`sphinxcontrib-bibtex <https://sphinxcontrib-bibtex.readthedocs.io>`_ are +To build the documentation, `sphinx-doc <http://www.sphinx-doc.org>`_, +`sphinxcontrib-bibtex <https://sphinxcontrib-bibtex.readthedocs.io>`_, +`sphinxcontrib-paramlinks <https://github.com/sqlalchemyorg/sphinx-paramlinks>`_ and +`python-docs-theme <https://github.com/python/python-docs-theme>`_ are required. As the documentation is auto-tested, `CGAL`_, `Eigen`_, `Matplotlib`_, `NumPy`_, `POT`_, `Scikit-learn`_ and `SciPy`_ are also mandatory to build the documentation. @@ -349,8 +348,8 @@ You can still deactivate LaTeX rendering by saying: .. code-block:: python - import gudhi - gudhi.persistence_graphical_tools._gudhi_matplotlib_use_tex=False + import gudhi as gd + gd.persistence_graphical_tools._gudhi_matplotlib_use_tex=False PyKeOps ------- @@ -363,7 +362,7 @@ Python Optimal Transport ------------------------ The :doc:`Wasserstein distance </wasserstein_distance_user>` -module requires `POT <https://pot.readthedocs.io/>`_, a library that provides +module requires `POT <https://pythonot.github.io/>`_, a library that provides several solvers for optimization problems related to Optimal Transport. PyTorch @@ -392,18 +391,23 @@ The :doc:`persistence graphical tools </persistence_graphical_tools_user>` and mathematics, science, and engineering. :class:`~gudhi.point_cloud.knn.KNearestNeighbors` can use the Python package -`SciPy <http://scipy.org>`_ as a backend if explicitly requested. +`SciPy <http://scipy.org>`_ :math:`\geq` 1.6.0 as a backend if explicitly requested. TensorFlow ---------- -`TensorFlow <https://www.tensorflow.org>`_ is currently only used in some automatic differentiation tests. +The :doc:`cubical complex </cubical_complex_tflow_itf_ref>`, :doc:`simplex tree </ls_simplex_tree_tflow_itf_ref>` +and :doc:`Rips complex </rips_complex_tflow_itf_ref>` modules require `TensorFlow <https://www.tensorflow.org>`_ +for incorporating them in neural nets. + +`TensorFlow <https://www.tensorflow.org>`_ is also used in some automatic differentiation tests. Bug reports and contributions ***************************** -Please help us improving the quality of the GUDHI library. You may report bugs or suggestions to: - - Contact: gudhi-users@lists.gforge.inria.fr +Please help us improving the quality of the GUDHI library. +You may `report bugs <https://github.com/GUDHI/gudhi-devel/issues>`_ or +`contact us <https://gudhi.inria.fr/contact/>`_ for any suggestions. -GUDHI is open to external contributions. If you want to join our development team, please contact us. +GUDHI is open to external contributions. If you want to join our development team, please take some time to read our +`contributing guide <https://github.com/GUDHI/gudhi-devel/blob/master/.github/CONTRIBUTING.md>`_. diff --git a/src/python/doc/ls_simplex_tree_tflow_itf_ref.rst b/src/python/doc/ls_simplex_tree_tflow_itf_ref.rst new file mode 100644 index 00000000..9d7d633f --- /dev/null +++ b/src/python/doc/ls_simplex_tree_tflow_itf_ref.rst @@ -0,0 +1,53 @@ +:orphan: + +.. To get rid of WARNING: document isn't included in any toctree + +TensorFlow layer for lower-star persistence on simplex trees +############################################################ + +.. include:: differentiation_sum.inc + +Example of gradient computed from lower-star filtration of a simplex tree +------------------------------------------------------------------------- + +.. testcode:: + + from gudhi.tensorflow import LowerStarSimplexTreeLayer + import tensorflow as tf + import gudhi as gd + + st = gd.SimplexTree() + st.insert([0, 1]) + st.insert([1, 2]) + st.insert([2, 3]) + st.insert([3, 4]) + st.insert([4, 5]) + st.insert([5, 6]) + st.insert([6, 7]) + st.insert([7, 8]) + st.insert([8, 9]) + st.insert([9, 10]) + + F = tf.Variable([6.,4.,3.,4.,5.,4.,3.,2.,3.,4.,5.], dtype=tf.float32, trainable=True) + sl = LowerStarSimplexTreeLayer(simplextree=st, homology_dimensions=[0]) + + with tf.GradientTape() as tape: + dgm = sl.call(F)[0][0] + loss = tf.math.reduce_sum(tf.square(.5*(dgm[:,1]-dgm[:,0]))) + + grads = tape.gradient(loss, [F]) + print(grads[0].indices.numpy()) + print(grads[0].values.numpy()) + +.. testoutput:: + + [2 4] + [-1. 1.] + +Documentation for LowerStarSimplexTreeLayer +------------------------------------------- + +.. autoclass:: gudhi.tensorflow.LowerStarSimplexTreeLayer + :members: + :special-members: __init__ + :show-inheritance: diff --git a/src/python/doc/nerve_gic_complex_user.rst b/src/python/doc/nerve_gic_complex_user.rst index 0b820abf..8633cadb 100644 --- a/src/python/doc/nerve_gic_complex_user.rst +++ b/src/python/doc/nerve_gic_complex_user.rst @@ -12,7 +12,7 @@ Definition Visualizations of the simplicial complexes can be done with either neato (from `graphviz <http://www.graphviz.org/>`_), `geomview <http://www.geomview.org/>`_, -`KeplerMapper <https://github.com/MLWave/kepler-mapper>`_. +`KeplerMapper <https://github.com/scikit-tda/kepler-mapper>`_. Input point clouds are assumed to be OFF files (cf. `OFF file format <fileformats.html#off-file-format>`_). Covers diff --git a/src/python/doc/persistence_graphical_tools_user.rst b/src/python/doc/persistence_graphical_tools_user.rst index d95b9d2b..e1d28c71 100644 --- a/src/python/doc/persistence_graphical_tools_user.rst +++ b/src/python/doc/persistence_graphical_tools_user.rst @@ -60,7 +60,7 @@ of shape (N x 2) encoding a persistence diagram (in a given dimension). import matplotlib.pyplot as plt import gudhi import numpy as np - d = np.array([[0, 1], [1, 2], [1, np.inf]]) + d = np.array([[0., 1.], [1., 2.], [1., np.inf]]) gudhi.plot_persistence_diagram(d) plt.show() diff --git a/src/python/doc/persistent_cohomology_user.rst b/src/python/doc/persistent_cohomology_user.rst index a3f294b2..39744b95 100644 --- a/src/python/doc/persistent_cohomology_user.rst +++ b/src/python/doc/persistent_cohomology_user.rst @@ -6,19 +6,24 @@ Persistent cohomology user manual ================================= Definition ---------- -===================================== ===================================== ===================================== -:Author: Clément Maria :Since: GUDHI PYTHON 2.0.0 :License: GPL v3 -===================================== ===================================== ===================================== - -+-----------------------------------------------------------------+-----------------------------------------------------------------------+ -| :doc:`persistent_cohomology_user` | Please refer to each data structure that contains persistence | -| | feature for reference: | -| | | -| | * :doc:`simplex_tree_ref` | -| | * :doc:`cubical_complex_ref` | -| | * :doc:`periodic_cubical_complex_ref` | -+-----------------------------------------------------------------+-----------------------------------------------------------------------+ +.. list-table:: + :width: 100% + :header-rows: 0 + + * - :Author: Clément Maria + - :Since: GUDHI 2.0.0 + - :License: MIT + +.. list-table:: + :width: 100% + :header-rows: 0 + + * - :doc:`persistent_cohomology_user` + - Please refer to each data structure that contains persistence feature for reference: + * :doc:`simplex_tree_ref` + * :doc:`cubical_complex_ref` + * :doc:`periodic_cubical_complex_ref` Computation of persistent cohomology using the algorithm of :cite:`DBLP:journals/dcg/SilvaMV11` and :cite:`DBLP:conf/compgeom/DeyFW14` and the Compressed Annotation Matrix implementation of diff --git a/src/python/doc/point_cloud.rst b/src/python/doc/point_cloud.rst index ffd8f85b..473b303f 100644 --- a/src/python/doc/point_cloud.rst +++ b/src/python/doc/point_cloud.rst @@ -13,6 +13,11 @@ File Readers .. autofunction:: gudhi.read_lower_triangular_matrix_from_csv_file +File Writers +------------ + +.. autofunction:: gudhi.write_points_to_off_file + Subsampling ----------- diff --git a/src/python/doc/representations_sum.inc b/src/python/doc/representations_sum.inc index 4298aea9..9515f044 100644 --- a/src/python/doc/representations_sum.inc +++ b/src/python/doc/representations_sum.inc @@ -1,14 +1,14 @@ .. table:: :widths: 30 40 30 - +------------------------------------------------------------------+----------------------------------------------------------------+-------------------------------------------------------------+ - | .. figure:: | Vectorizations, distances and kernels that work on persistence | :Author: Mathieu Carrière, Martin Royer | - | img/sklearn-tda.png | diagrams, compatible with scikit-learn. | | - | | | :Since: GUDHI 3.1.0 | - | | | | - | | | :License: MIT | - | | | | - | | | :Requires: `Scikit-learn <installation.html#scikit-learn>`_ | - +------------------------------------------------------------------+----------------------------------------------------------------+-------------------------------------------------------------+ - | * :doc:`representations` | - +------------------------------------------------------------------+------------------------------------------------------------------------------------------------------------------------------+ + +------------------------------------------------------------------+----------------------------------------------------------------+-------------------------------------------------------------------------+ + | .. figure:: | Vectorizations, distances and kernels that work on persistence | :Author: Mathieu Carrière, Martin Royer, Gard Spreemann, Wojciech Reise | + | img/sklearn-tda.png | diagrams, compatible with scikit-learn. | | + | | | :Since: GUDHI 3.1.0 | + | | | | + | | | :License: MIT | + | | | | + | | | :Requires: `Scikit-learn <installation.html#scikit-learn>`_ | + +------------------------------------------------------------------+----------------------------------------------------------------+-------------------------------------------------------------------------+ + | * :doc:`representations` | + +------------------------------------------------------------------+------------------------------------------------------------------------------------------------------------------------------------------+ diff --git a/src/python/doc/rips_complex_sum.inc b/src/python/doc/rips_complex_sum.inc index 2cb24990..2b125e54 100644 --- a/src/python/doc/rips_complex_sum.inc +++ b/src/python/doc/rips_complex_sum.inc @@ -11,4 +11,9 @@ | | | | +----------------------------------------------------------------+------------------------------------------------------------------------+----------------------------------------------------------------------------------+ | * :doc:`rips_complex_user` | * :doc:`rips_complex_ref` | - +----------------------------------------------------------------+-----------------------------------------------------------------------------------------------------------------------------------------------------------+ + +----------------------------------------------------------------+------------------------------------------------------------------------+----------------------------------------------------------------------------------+ + | .. image:: | * :doc:`rips_complex_tflow_itf_ref` | :requires: `TensorFlow <installation.html#tensorflow>`_ | + | img/tensorflow.png | | | + | :target: https://www.tensorflow.org | | | + | :height: 30 | | | + +----------------------------------------------------------------+------------------------------------------------------------------------+----------------------------------------------------------------------------------+ diff --git a/src/python/doc/rips_complex_tflow_itf_ref.rst b/src/python/doc/rips_complex_tflow_itf_ref.rst new file mode 100644 index 00000000..3ce75868 --- /dev/null +++ b/src/python/doc/rips_complex_tflow_itf_ref.rst @@ -0,0 +1,48 @@ +:orphan: + +.. To get rid of WARNING: document isn't included in any toctree + +TensorFlow layer for Vietoris-Rips persistence +############################################## + +.. include:: differentiation_sum.inc + +Example of gradient computed from Vietoris-Rips persistence +----------------------------------------------------------- + +.. testsetup:: + + import numpy + numpy.set_printoptions(precision=4) + +.. testcode:: + + from gudhi.tensorflow import RipsLayer + import tensorflow as tf + + X = tf.Variable([[1.,1.],[2.,2.]], dtype=tf.float32, trainable=True) + rl = RipsLayer(maximum_edge_length=2., homology_dimensions=[0]) + + with tf.GradientTape() as tape: + dgm = rl.call(X)[0][0] + loss = tf.math.reduce_sum(tf.square(.5*(dgm[:,1]-dgm[:,0]))) + + grads = tape.gradient(loss, [X]) + print(grads[0].numpy()) + +.. testcleanup:: + + numpy.set_printoptions(precision=8) + +.. testoutput:: + + [[-0.5 -0.5] + [ 0.5 0.5]] + +Documentation for RipsLayer +--------------------------- + +.. autoclass:: gudhi.tensorflow.RipsLayer + :members: + :special-members: __init__ + :show-inheritance: diff --git a/src/python/doc/rips_complex_user.rst b/src/python/doc/rips_complex_user.rst index 27d218d4..a4e83462 100644 --- a/src/python/doc/rips_complex_user.rst +++ b/src/python/doc/rips_complex_user.rst @@ -7,13 +7,7 @@ Rips complex user manual Definition ---------- -================================================================================ ================================ ====================== -:Authors: Clément Maria, Pawel Dlotko, Vincent Rouvreau, Marc Glisse, Yuichi Ike :Since: GUDHI 2.0.0 :License: GPL v3 -================================================================================ ================================ ====================== - -+-------------------------------------------+----------------------------------------------------------------------+ -| :doc:`rips_complex_user` | :doc:`rips_complex_ref` | -+-------------------------------------------+----------------------------------------------------------------------+ +.. include:: rips_complex_sum.inc The `Rips complex <https://en.wikipedia.org/wiki/Vietoris%E2%80%93Rips_complex>`_ is a simplicial complex that generalizes proximity (:math:`\varepsilon`-ball) graphs to higher dimensions. The vertices correspond to the input @@ -40,9 +34,6 @@ A vertex name corresponds to the index of the point in the given range (aka. the On this example, as edges (4,5), (4,6) and (5,6) are in the complex, simplex (4,5,6) is added with the filtration value set with :math:`max(filtration(4,5), filtration(4,6), filtration(5,6))`. And so on for simplex (0,1,2,3). -If the :doc:`RipsComplex <rips_complex_ref>` interfaces are not detailed enough for your need, please refer to -rips_persistence_step_by_step.cpp C++ example, where the graph construction over the Simplex_tree is more detailed. - A Rips complex can easily become huge, even if we limit the length of the edges and the dimension of the simplices. One easy trick, before building a Rips complex on a point cloud, is to call :func:`~gudhi.sparsify_point_set` which removes points @@ -61,6 +52,13 @@ construction of a :class:`~gudhi.RipsComplex` object asks it to build a sparse R parameter :math:`\varepsilon=0.3`, while the default `sparse=None` builds the regular Rips complex. +Another option which is especially useful if you want to compute persistent homology in "high" dimension (2 or more, +sometimes even 1), is to build the Rips complex only up to dimension 1 (a graph), then use +:func:`~gudhi.SimplexTree.collapse_edges` to reduce the size of this graph, and finally call +:func:`~gudhi.SimplexTree.expansion` to get a simplicial complex of a suitable dimension to compute its homology. This +trick gives the same persistence diagram as one would get with a plain use of `RipsComplex`, with a complex that is +often significantly smaller and thus faster to process. + Point cloud ----------- @@ -123,54 +121,44 @@ Notice that if we use asking for a very sparse version (theory only gives some guarantee on the meaning of the output if `sparse<1`), 2 to 5 edges disappear, depending on the random vertex used to start the sparsification. -Example from OFF file -^^^^^^^^^^^^^^^^^^^^^ +Example step by step +^^^^^^^^^^^^^^^^^^^^ -This example builds the :doc:`RipsComplex <rips_complex_ref>` from the given -points in an OFF file, and max_edge_length value. -Then it creates a :doc:`SimplexTree <simplex_tree_ref>` with it. +While :doc:`RipsComplex <rips_complex_ref>` is convenient, for instance to build a simplicial complex in one line + +.. testcode:: -Finally, it is asked to display information about the Rips complex. + import gudhi + points = [[1, 1], [7, 0], [4, 6], [9, 6], [0, 14], [2, 19], [9, 17]] + cplx = gudhi.RipsComplex(points=points, max_edge_length=12.0).create_simplex_tree(max_dimension=2) +you can achieve the same result without this class for more flexibility .. testcode:: - import gudhi - off_file = gudhi.__root_source_dir__ + '/data/points/alphacomplexdoc.off' - point_cloud = gudhi.read_points_from_off_file(off_file = off_file) - rips_complex = gudhi.RipsComplex(points=point_cloud, max_edge_length=12.0) - simplex_tree = rips_complex.create_simplex_tree(max_dimension=1) - result_str = 'Rips complex is of dimension ' + repr(simplex_tree.dimension()) + ' - ' + \ - repr(simplex_tree.num_simplices()) + ' simplices - ' + \ - repr(simplex_tree.num_vertices()) + ' vertices.' - print(result_str) - fmt = '%s -> %.2f' - for filtered_value in simplex_tree.get_filtration(): - print(fmt % tuple(filtered_value)) + import gudhi + from scipy.spatial.distance import cdist + points = [[1, 1], [7, 0], [4, 6], [9, 6], [0, 14], [2, 19], [9, 17]] + distance_matrix = cdist(points, points) + cplx = gudhi.SimplexTree.create_from_array(distance_matrix, max_filtration=12.0) + cplx.expansion(2) -the program output is: +or -.. testoutput:: +.. testcode:: + + import gudhi + from scipy.spatial import cKDTree + points = [[1, 1], [7, 0], [4, 6], [9, 6], [0, 14], [2, 19], [9, 17]] + tree = cKDTree(points) + edges = tree.sparse_distance_matrix(tree, max_distance=12.0, output_type="coo_matrix") + cplx = gudhi.SimplexTree() + cplx.insert_edges_from_coo_matrix(edges) + cplx.expansion(2) - Rips complex is of dimension 1 - 18 simplices - 7 vertices. - [0] -> 0.00 - [1] -> 0.00 - [2] -> 0.00 - [3] -> 0.00 - [4] -> 0.00 - [5] -> 0.00 - [6] -> 0.00 - [2, 3] -> 5.00 - [4, 5] -> 5.39 - [0, 2] -> 5.83 - [0, 1] -> 6.08 - [1, 3] -> 6.32 - [1, 2] -> 6.71 - [5, 6] -> 7.28 - [2, 4] -> 8.94 - [0, 3] -> 9.43 - [4, 6] -> 9.49 - [3, 6] -> 11.00 + +This way, you can easily add a call to :func:`~gudhi.SimplexTree.collapse_edges` before the expansion, +use a different metric to compute the matrix, or other variations. Distance matrix --------------- @@ -229,54 +217,7 @@ until dimension 1 - one skeleton graph in other words), the output is: [4, 6] -> 9.49 [3, 6] -> 11.00 -Example from csv file -^^^^^^^^^^^^^^^^^^^^^ - -This example builds the :doc:`RipsComplex <rips_complex_ref>` from the given -distance matrix in a csv file, and max_edge_length value. -Then it creates a :doc:`SimplexTree <simplex_tree_ref>` with it. - -Finally, it is asked to display information about the Rips complex. - - -.. testcode:: - - import gudhi - distance_matrix = gudhi.read_lower_triangular_matrix_from_csv_file(csv_file=gudhi.__root_source_dir__ + \ - '/data/distance_matrix/full_square_distance_matrix.csv') - rips_complex = gudhi.RipsComplex(distance_matrix=distance_matrix, max_edge_length=12.0) - simplex_tree = rips_complex.create_simplex_tree(max_dimension=1) - result_str = 'Rips complex is of dimension ' + repr(simplex_tree.dimension()) + ' - ' + \ - repr(simplex_tree.num_simplices()) + ' simplices - ' + \ - repr(simplex_tree.num_vertices()) + ' vertices.' - print(result_str) - fmt = '%s -> %.2f' - for filtered_value in simplex_tree.get_filtration(): - print(fmt % tuple(filtered_value)) - -the program output is: - -.. testoutput:: - - Rips complex is of dimension 1 - 18 simplices - 7 vertices. - [0] -> 0.00 - [1] -> 0.00 - [2] -> 0.00 - [3] -> 0.00 - [4] -> 0.00 - [5] -> 0.00 - [6] -> 0.00 - [2, 3] -> 5.00 - [4, 5] -> 5.39 - [0, 2] -> 5.83 - [0, 1] -> 6.08 - [1, 3] -> 6.32 - [1, 2] -> 6.71 - [5, 6] -> 7.28 - [2, 4] -> 8.94 - [0, 3] -> 9.43 - [4, 6] -> 9.49 - [3, 6] -> 11.00 +In case this lower triangular matrix is stored in a CSV file, like `data/distance_matrix/full_square_distance_matrix.csv` in the Gudhi distribution, you can read it with :func:`~gudhi.read_lower_triangular_matrix_from_csv_file`. Correlation matrix ------------------ diff --git a/src/python/doc/simplex_tree_sum.inc b/src/python/doc/simplex_tree_sum.inc index a8858f16..6b534c9e 100644 --- a/src/python/doc/simplex_tree_sum.inc +++ b/src/python/doc/simplex_tree_sum.inc @@ -1,13 +1,18 @@ .. table:: :widths: 30 40 30 - +----------------------------------------------------------------+------------------------------------------------------------------------+-----------------------------+ - | .. figure:: | The simplex tree is an efficient and flexible data structure for | :Author: Clément Maria | - | ../../doc/Simplex_tree/Simplex_tree_representation.png | representing general (filtered) simplicial complexes. | | - | :alt: Simplex tree representation | | :Since: GUDHI 2.0.0 | - | :figclass: align-center | The data structure is described in | | - | | :cite:`boissonnatmariasimplextreealgorithmica` | :License: MIT | - | | | | - +----------------------------------------------------------------+------------------------------------------------------------------------+-----------------------------+ - | * :doc:`simplex_tree_user` | * :doc:`simplex_tree_ref` | - +----------------------------------------------------------------+------------------------------------------------------------------------------------------------------+ + +----------------------------------------------------------------+------------------------------------------------------------------------+---------------------------------------------------------+ + | .. figure:: | The simplex tree is an efficient and flexible data structure for | :Author: Clément Maria | + | ../../doc/Simplex_tree/Simplex_tree_representation.png | representing general (filtered) simplicial complexes. | | + | :alt: Simplex tree representation | | :Since: GUDHI 2.0.0 | + | :figclass: align-center | The data structure is described in | | + | | :cite:`boissonnatmariasimplextreealgorithmica` | :License: MIT | + | | | | + +----------------------------------------------------------------+------------------------------------------------------------------------+---------------------------------------------------------+ + | * :doc:`simplex_tree_user` | * :doc:`simplex_tree_ref` | + +----------------------------------------------------------------+------------------------------------------------------------------------+---------------------------------------------------------+ + | .. image:: | * :doc:`ls_simplex_tree_tflow_itf_ref` | :requires: `TensorFlow <installation.html#tensorflow>`_ | + | img/tensorflow.png | | | + | :target: https://www.tensorflow.org | | | + | :height: 30 | | | + +----------------------------------------------------------------+------------------------------------------------------------------------+---------------------------------------------------------+ diff --git a/src/python/doc/wasserstein_distance_user.rst b/src/python/doc/wasserstein_distance_user.rst index 9ffc2759..76eb1469 100644 --- a/src/python/doc/wasserstein_distance_user.rst +++ b/src/python/doc/wasserstein_distance_user.rst @@ -44,7 +44,7 @@ Basic example ************* This example computes the 1-Wasserstein distance from 2 persistence diagrams with Euclidean ground metric. -Note that persistence diagrams must be submitted as (n x 2) numpy arrays and must not contain inf values. +Note that persistence diagrams must be submitted as (n x 2) numpy arrays. .. testcode:: @@ -67,14 +67,16 @@ We can also have access to the optimal matching by letting `matching=True`. It is encoded as a list of indices (i,j), meaning that the i-th point in X is mapped to the j-th point in Y. An index of -1 represents the diagonal. +It handles essential parts (points with infinite coordinates). However if the cardinalities of the essential parts differ, +any matching has a cost +inf and thus can be considered to be optimal. In such a case, the function returns `(np.inf, None)`. .. testcode:: import gudhi.wasserstein import numpy as np - dgm1 = np.array([[2.7, 3.7],[9.6, 14.],[34.2, 34.974]]) - dgm2 = np.array([[2.8, 4.45], [5, 6], [9.5, 14.1]]) + dgm1 = np.array([[2.7, 3.7],[9.6, 14.],[34.2, 34.974], [3, np.inf]]) + dgm2 = np.array([[2.8, 4.45], [5, 6], [9.5, 14.1], [4, np.inf]]) cost, matchings = gudhi.wasserstein.wasserstein_distance(dgm1, dgm2, matching=True, order=1, internal_p=2) message_cost = "Wasserstein distance value = %.2f" %cost @@ -90,16 +92,31 @@ An index of -1 represents the diagonal. for j in dgm2_to_diagonal: print("point %s in dgm2 is matched to the diagonal" %j) -The output is: + # An example where essential part cardinalities differ + dgm3 = np.array([[1, 2], [0, np.inf]]) + dgm4 = np.array([[1, 2], [0, np.inf], [1, np.inf]]) + cost, matchings = gudhi.wasserstein.wasserstein_distance(dgm3, dgm4, matching=True, order=1, internal_p=2) + print("\nSecond example:") + print("cost:", cost) + print("matchings:", matchings) + + +The output is: .. testoutput:: - Wasserstein distance value = 2.15 + Wasserstein distance value = 3.15 point 0 in dgm1 is matched to point 0 in dgm2 point 1 in dgm1 is matched to point 2 in dgm2 + point 3 in dgm1 is matched to point 3 in dgm2 point 2 in dgm1 is matched to the diagonal point 1 in dgm2 is matched to the diagonal + Second example: + cost: inf + matchings: None + + Barycenters ----------- @@ -181,4 +198,4 @@ Tutorial This `notebook <https://github.com/GUDHI/TDA-tutorial/blob/master/Tuto-GUDHI-Barycenters-of-persistence-diagrams.ipynb>`_ -presents the concept of barycenter, or Fréchet mean, of a family of persistence diagrams.
\ No newline at end of file +presents the concept of barycenter, or Fréchet mean, of a family of persistence diagrams. diff --git a/src/python/example/alpha_complex_diagram_persistence_from_off_file_example.py b/src/python/example/alpha_complex_diagram_persistence_from_off_file_example.py index 1e0273b3..c96121a6 100755 --- a/src/python/example/alpha_complex_diagram_persistence_from_off_file_example.py +++ b/src/python/example/alpha_complex_diagram_persistence_from_off_file_example.py @@ -1,9 +1,7 @@ #!/usr/bin/env python import argparse -import errno -import os -import gudhi +import gudhi as gd """ This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. @@ -25,12 +23,12 @@ parser = argparse.ArgumentParser( description="AlphaComplex creation from " "points read in a OFF file.", epilog="Example: " "example/alpha_complex_diagram_persistence_from_off_file_example.py " - "-f ../data/points/tore3D_300.off -a 0.6" + "-f ../data/points/tore3D_300.off" "- Constructs a alpha complex with the " "points from the given OFF file.", ) parser.add_argument("-f", "--file", type=str, required=True) -parser.add_argument("-a", "--max_alpha_square", type=float, default=0.5) +parser.add_argument("-a", "--max_alpha_square", type=float, required=False) parser.add_argument("-b", "--band", type=float, default=0.0) parser.add_argument( "--no-diagram", @@ -41,34 +39,24 @@ parser.add_argument( args = parser.parse_args() -with open(args.file, "r") as f: - first_line = f.readline() - if (first_line == "OFF\n") or (first_line == "nOFF\n"): - print("##############################################################") - print("AlphaComplex creation from points read in a OFF file") - - message = "AlphaComplex with max_edge_length=" + repr(args.max_alpha_square) - print(message) - - alpha_complex = gudhi.AlphaComplex(off_file=args.file) - simplex_tree = alpha_complex.create_simplex_tree( - max_alpha_square=args.max_alpha_square - ) - - message = "Number of simplices=" + repr(simplex_tree.num_simplices()) - print(message) - - diag = simplex_tree.persistence() - - print("betti_numbers()=") - print(simplex_tree.betti_numbers()) - - if args.no_diagram == False: - import matplotlib.pyplot as plot - gudhi.plot_persistence_diagram(diag, band=args.band) - plot.show() - else: - raise FileNotFoundError(errno.ENOENT, os.strerror(errno.ENOENT), - args.file) - - f.close() +print("##############################################################") +print("AlphaComplex creation from points read in a OFF file") + +points = gd.read_points_from_off_file(off_file = args.file) +alpha_complex = gd.AlphaComplex(points = points) +if args.max_alpha_square is not None: + print("with max_edge_length=", args.max_alpha_square) + simplex_tree = alpha_complex.create_simplex_tree( + max_alpha_square=args.max_alpha_square + ) +else: + simplex_tree = alpha_complex.create_simplex_tree() + +print("Number of simplices=", simplex_tree.num_simplices()) + +diag = simplex_tree.persistence() +print("betti_numbers()=", simplex_tree.betti_numbers()) +if args.no_diagram == False: + import matplotlib.pyplot as plot + gd.plot_persistence_diagram(diag, band=args.band) + plot.show() diff --git a/src/python/example/alpha_complex_from_generated_points_on_sphere_example.py b/src/python/example/alpha_complex_from_generated_points_on_sphere_example.py new file mode 100644 index 00000000..3558077e --- /dev/null +++ b/src/python/example/alpha_complex_from_generated_points_on_sphere_example.py @@ -0,0 +1,35 @@ +#!/usr/bin/env python + +from gudhi.datasets.generators import _points +from gudhi import AlphaComplex + + +""" This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + Author(s): Hind Montassif + + Copyright (C) 2021 Inria + + Modification(s): + - YYYY/MM Author: Description of the modification +""" + +__author__ = "Hind Montassif" +__copyright__ = "Copyright (C) 2021 Inria" +__license__ = "MIT" + +print("#####################################################################") +print("AlphaComplex creation from generated points on sphere") + + +gen_points = _points.sphere(n_samples = 50, ambient_dim = 2, radius = 1, sample = "random") + +# Create an alpha complex +alpha_complex = AlphaComplex(points = gen_points) +simplex_tree = alpha_complex.create_simplex_tree() + +result_str = 'Alpha complex is of dimension ' + repr(simplex_tree.dimension()) + ' - ' + \ + repr(simplex_tree.num_simplices()) + ' simplices - ' + \ + repr(simplex_tree.num_vertices()) + ' vertices.' +print(result_str) + diff --git a/src/python/example/alpha_complex_from_points_example.py b/src/python/example/alpha_complex_from_points_example.py index 465632eb..5d5ca66a 100755 --- a/src/python/example/alpha_complex_from_points_example.py +++ b/src/python/example/alpha_complex_from_points_example.py @@ -19,7 +19,7 @@ __license__ = "MIT" print("#####################################################################") print("AlphaComplex creation from points") alpha_complex = AlphaComplex(points=[[0, 0], [1, 0], [0, 1], [1, 1]]) -simplex_tree = alpha_complex.create_simplex_tree(max_alpha_square=60.0) +simplex_tree = alpha_complex.create_simplex_tree() if simplex_tree.find([0, 1]): print("[0, 1] Found !!") diff --git a/src/python/example/alpha_rips_persistence_bottleneck_distance.py b/src/python/example/alpha_rips_persistence_bottleneck_distance.py index 3e12b0d5..6b97fb3b 100755 --- a/src/python/example/alpha_rips_persistence_bottleneck_distance.py +++ b/src/python/example/alpha_rips_persistence_bottleneck_distance.py @@ -1,10 +1,8 @@ #!/usr/bin/env python -import gudhi +import gudhi as gd import argparse import math -import errno -import os import numpy as np """ This file is part of the Gudhi Library - https://gudhi.inria.fr/ - @@ -37,70 +35,60 @@ parser.add_argument("-t", "--threshold", type=float, default=0.5) parser.add_argument("-d", "--max_dimension", type=int, default=1) args = parser.parse_args() -with open(args.file, "r") as f: - first_line = f.readline() - if (first_line == "OFF\n") or (first_line == "nOFF\n"): - point_cloud = gudhi.read_points_from_off_file(off_file=args.file) - print("##############################################################") - print("RipsComplex creation from points read in a OFF file") +point_cloud = gd.read_points_from_off_file(off_file=args.file) +print("##############################################################") +print("RipsComplex creation from points read in a OFF file") - message = "RipsComplex with max_edge_length=" + repr(args.threshold) - print(message) +message = "RipsComplex with max_edge_length=" + repr(args.threshold) +print(message) - rips_complex = gudhi.RipsComplex( - points=point_cloud, max_edge_length=args.threshold - ) - - rips_stree = rips_complex.create_simplex_tree( - max_dimension=args.max_dimension) - - message = "Number of simplices=" + repr(rips_stree.num_simplices()) - print(message) - - rips_stree.compute_persistence() - - print("##############################################################") - print("AlphaComplex creation from points read in a OFF file") - - message = "AlphaComplex with max_edge_length=" + repr(args.threshold) - print(message) - - alpha_complex = gudhi.AlphaComplex(points=point_cloud) - alpha_stree = alpha_complex.create_simplex_tree( - max_alpha_square=(args.threshold * args.threshold) - ) - - message = "Number of simplices=" + repr(alpha_stree.num_simplices()) - print(message) +rips_complex = gd.RipsComplex( + points=point_cloud, max_edge_length=args.threshold +) - alpha_stree.compute_persistence() +rips_stree = rips_complex.create_simplex_tree( + max_dimension=args.max_dimension) - max_b_distance = 0.0 - for dim in range(args.max_dimension): - # Alpha persistence values needs to be transform because filtration - # values are alpha square values - alpha_intervals = np.sqrt(alpha_stree.persistence_intervals_in_dimension(dim)) +message = "Number of simplices=" + repr(rips_stree.num_simplices()) +print(message) - rips_intervals = rips_stree.persistence_intervals_in_dimension(dim) - bottleneck_distance = gudhi.bottleneck_distance( - rips_intervals, alpha_intervals - ) - message = ( - "In dimension " - + repr(dim) - + ", bottleneck distance = " - + repr(bottleneck_distance) - ) - print(message) - max_b_distance = max(bottleneck_distance, max_b_distance) +rips_stree.compute_persistence() - print("==============================================================") - message = "Bottleneck distance is " + repr(max_b_distance) - print(message) +print("##############################################################") +print("AlphaComplex creation from points read in a OFF file") - else: - raise FileNotFoundError(errno.ENOENT, os.strerror(errno.ENOENT), - args.file) +message = "AlphaComplex with max_edge_length=" + repr(args.threshold) +print(message) +alpha_complex = gd.AlphaComplex(points=point_cloud) +alpha_stree = alpha_complex.create_simplex_tree( + max_alpha_square=(args.threshold * args.threshold) +) - f.close() +message = "Number of simplices=" + repr(alpha_stree.num_simplices()) +print(message) + +alpha_stree.compute_persistence() + +max_b_distance = 0.0 +for dim in range(args.max_dimension): + # Alpha persistence values needs to be transform because filtration + # values are alpha square values + alpha_intervals = np.sqrt(alpha_stree.persistence_intervals_in_dimension(dim)) + + rips_intervals = rips_stree.persistence_intervals_in_dimension(dim) + bottleneck_distance = gd.bottleneck_distance( + rips_intervals, alpha_intervals + ) + message = ( + "In dimension " + + repr(dim) + + ", bottleneck distance = " + + repr(bottleneck_distance) + ) + print(message) + max_b_distance = max(bottleneck_distance, max_b_distance) + +print("==============================================================") +message = "Bottleneck distance is " + repr(max_b_distance) +print(message) diff --git a/src/python/example/plot_alpha_complex.py b/src/python/example/plot_alpha_complex.py index 99c18a7c..0924619b 100755 --- a/src/python/example/plot_alpha_complex.py +++ b/src/python/example/plot_alpha_complex.py @@ -1,8 +1,9 @@ #!/usr/bin/env python import numpy as np -import gudhi -ac = gudhi.AlphaComplex(off_file='../../data/points/tore3D_1307.off') +import gudhi as gd +points = gd.read_points_from_off_file(off_file = '../../data/points/tore3D_1307.off') +ac = gd.AlphaComplex(points = points) st = ac.create_simplex_tree() points = np.array([ac.get_point(i) for i in range(st.num_vertices())]) # We want to plot the alpha-complex with alpha=0.1. diff --git a/src/python/example/rips_complex_diagram_persistence_from_correlation_matrix_file_example.py b/src/python/example/rips_complex_diagram_persistence_from_correlation_matrix_file_example.py index ea2eb7e1..0b35dbc5 100755 --- a/src/python/example/rips_complex_diagram_persistence_from_correlation_matrix_file_example.py +++ b/src/python/example/rips_complex_diagram_persistence_from_correlation_matrix_file_example.py @@ -40,7 +40,7 @@ parser.add_argument( args = parser.parse_args() if not (-1.0 < args.min_edge_correlation < 1.0): - print("Wrong value of the treshold corelation (should be between -1 and 1).") + print("Wrong value of the threshold corelation (should be between -1 and 1).") sys.exit(1) print("#####################################################################") diff --git a/src/python/example/rips_complex_diagram_persistence_from_distance_matrix_file_example.py b/src/python/example/rips_complex_diagram_persistence_from_distance_matrix_file_example.py index 236d085d..8a9cc857 100755 --- a/src/python/example/rips_complex_diagram_persistence_from_distance_matrix_file_example.py +++ b/src/python/example/rips_complex_diagram_persistence_from_distance_matrix_file_example.py @@ -21,11 +21,12 @@ parser = argparse.ArgumentParser( description="RipsComplex creation from " "a distance matrix read in a csv file.", epilog="Example: " "example/rips_complex_diagram_persistence_from_distance_matrix_file_example.py " - "-f ../data/distance_matrix/lower_triangular_distance_matrix.csv -e 12.0 -d 3" + "-f ../data/distance_matrix/lower_triangular_distance_matrix.csv -s , -e 12.0 -d 3" "- Constructs a Rips complex with the " "distance matrix from the given csv file.", ) parser.add_argument("-f", "--file", type=str, required=True) +parser.add_argument("-s", "--separator", type=str, required=True) parser.add_argument("-e", "--max_edge_length", type=float, default=0.5) parser.add_argument("-d", "--max_dimension", type=int, default=1) parser.add_argument("-b", "--band", type=float, default=0.0) @@ -44,7 +45,7 @@ print("RipsComplex creation from distance matrix read in a csv file") message = "RipsComplex with max_edge_length=" + repr(args.max_edge_length) print(message) -distance_matrix = gudhi.read_lower_triangular_matrix_from_csv_file(csv_file=args.file) +distance_matrix = gudhi.read_lower_triangular_matrix_from_csv_file(csv_file=args.file, separator=args.separator) rips_complex = gudhi.RipsComplex( distance_matrix=distance_matrix, max_edge_length=args.max_edge_length ) diff --git a/src/python/gudhi/__init__.py.in b/src/python/gudhi/__init__.py.in index 3043201a..79e12fbc 100644 --- a/src/python/gudhi/__init__.py.in +++ b/src/python/gudhi/__init__.py.in @@ -23,10 +23,6 @@ __all__ = [@GUDHI_PYTHON_MODULES@ @GUDHI_PYTHON_MODULES_EXTRA@] __available_modules = '' __missing_modules = '' -# For unitary tests purpose -# could use "if 'collapse_edges' in gudhi.__all__" when collapse edges will have a python module -__GUDHI_USE_EIGEN3 = @GUDHI_USE_EIGEN3@ - # Try to import * from gudhi.__module_name for default modules. # Extra modules require an explicit import by the user (mostly because of # unusual dependencies, but also to avoid cluttering namespace gudhi and diff --git a/src/python/gudhi/alpha_complex.pyx b/src/python/gudhi/alpha_complex.pyx index ea128743..375e1561 100644 --- a/src/python/gudhi/alpha_complex.pyx +++ b/src/python/gudhi/alpha_complex.pyx @@ -16,7 +16,7 @@ from libcpp.utility cimport pair from libcpp.string cimport string from libcpp cimport bool from libc.stdint cimport intptr_t -import os +import warnings from gudhi.simplex_tree cimport * from gudhi.simplex_tree import SimplexTree @@ -28,66 +28,76 @@ __license__ = "GPL v3" cdef extern from "Alpha_complex_interface.h" namespace "Gudhi": cdef cppclass Alpha_complex_interface "Gudhi::alpha_complex::Alpha_complex_interface": - Alpha_complex_interface(vector[vector[double]] points, bool fast_version, bool exact_version) nogil except + + Alpha_complex_interface(vector[vector[double]] points, vector[double] weights, bool fast_version, bool exact_version) nogil except + vector[double] get_point(int vertex) nogil except + void create_simplex_tree(Simplex_tree_interface_full_featured* simplex_tree, double max_alpha_square, bool default_filtration_value) nogil except + + @staticmethod + void set_float_relative_precision(double precision) nogil + @staticmethod + double get_float_relative_precision() nogil # AlphaComplex python interface cdef class AlphaComplex: - """AlphaComplex is a simplicial complex constructed from the finite cells - of a Delaunay Triangulation. + """AlphaComplex is a simplicial complex constructed from the finite cells of a Delaunay Triangulation. - The filtration value of each simplex is computed as the square of the - circumradius of the simplex if the circumsphere is empty (the simplex is - then said to be Gabriel), and as the minimum of the filtration values of - the codimension 1 cofaces that make it not Gabriel otherwise. + The filtration value of each simplex is computed as the square of the circumradius of the simplex if the + circumsphere is empty (the simplex is then said to be Gabriel), and as the minimum of the filtration values of the + codimension 1 cofaces that make it not Gabriel otherwise. - All simplices that have a filtration value strictly greater than a given - alpha squared value are not inserted into the complex. + All simplices that have a filtration value strictly greater than a given alpha squared value are not inserted into + the complex. .. note:: - When Alpha_complex is constructed with an infinite value of alpha, the - complex is a Delaunay complex. - + When Alpha_complex is constructed with an infinite value of alpha, the complex is a Delaunay complex. """ cdef Alpha_complex_interface * this_ptr # Fake constructor that does nothing but documenting the constructor - def __init__(self, points=None, off_file='', precision='safe'): + def __init__(self, points=[], off_file='', weights=None, precision='safe'): """AlphaComplex constructor. :param points: A list of points in d-Dimension. - :type points: list of list of double - - Or + :type points: Iterable[Iterable[float]] - :param off_file: An OFF file style name. + :param off_file: **[deprecated]** An `OFF file style <fileformats.html#off-file-format>`_ name. + If an `off_file` is given with `points` as arguments, only points from the file are taken into account. :type off_file: string + :param weights: A list of weights. If set, the number of weights must correspond to the number of points. + :type weights: Iterable[float] + :param precision: Alpha complex precision can be 'fast', 'safe' or 'exact'. Default is 'safe'. :type precision: string + + :raises FileNotFoundError: **[deprecated]** If `off_file` is set but not found. + :raises ValueError: In case of inconsistency between the number of points and weights. """ # The real cython constructor - def __cinit__(self, points = None, off_file = '', precision = 'safe'): + def __cinit__(self, points = [], off_file = '', weights=None, precision = 'safe'): assert precision in ['fast', 'safe', 'exact'], "Alpha complex precision can only be 'fast', 'safe' or 'exact'" cdef bool fast = precision == 'fast' cdef bool exact = precision == 'exact' - cdef vector[vector[double]] pts if off_file: - if os.path.isfile(off_file): - points = read_points_from_off_file(off_file = off_file) - else: - print("file " + off_file + " not found.") - if points is None: - # Empty Alpha construction - points=[] + warnings.warn("off_file is a deprecated parameter, please consider using gudhi.read_points_from_off_file", + DeprecationWarning) + points = read_points_from_off_file(off_file = off_file) + + # weights are set but is inconsistent with the number of points + if weights != None and len(weights) != len(points): + raise ValueError("Inconsistency between the number of points and weights") + + # need to copy the points to use them without the gil + cdef vector[vector[double]] pts + cdef vector[double] wgts pts = points + if weights != None: + wgts = weights with nogil: - self.this_ptr = new Alpha_complex_interface(pts, fast, exact) + self.this_ptr = new Alpha_complex_interface(pts, wgts, fast, exact) def __dealloc__(self): if self.this_ptr != NULL: @@ -127,3 +137,28 @@ cdef class AlphaComplex: self.this_ptr.create_simplex_tree(<Simplex_tree_interface_full_featured*>stree_int_ptr, mas, compute_filtration) return stree + + @staticmethod + def set_float_relative_precision(precision): + """ + :param precision: When the AlphaComplex is constructed with :code:`precision = 'safe'` (the default), + one can set the float relative precision of filtration values computed in + :func:`~gudhi.AlphaComplex.create_simplex_tree`. + Default is :code:`1e-5` (cf. :func:`~gudhi.AlphaComplex.get_float_relative_precision`). + For more details, please refer to + `CGAL::Lazy_exact_nt<NT>::set_relative_precision_of_to_double <https://doc.cgal.org/latest/Number_types/classCGAL_1_1Lazy__exact__nt.html>`_ + :type precision: float + """ + if precision <=0. or precision >= 1.: + raise ValueError("Relative precision value must be strictly greater than 0 and strictly lower than 1") + Alpha_complex_interface.set_float_relative_precision(precision) + + @staticmethod + def get_float_relative_precision(): + """ + :returns: The float relative precision of filtration values computation in + :func:`~gudhi.AlphaComplex.create_simplex_tree` when the AlphaComplex is constructed with + :code:`precision = 'safe'` (the default). + :rtype: float + """ + return Alpha_complex_interface.get_float_relative_precision() diff --git a/src/python/gudhi/clustering/tomato.py b/src/python/gudhi/clustering/tomato.py index fbba3cc8..d0e9995c 100644 --- a/src/python/gudhi/clustering/tomato.py +++ b/src/python/gudhi/clustering/tomato.py @@ -271,7 +271,7 @@ class Tomato: l = self.max_weight_per_cc_.min() r = self.max_weight_per_cc_.max() if self.diagram_.size > 0: - plt.plot(self.diagram_[:, 0], self.diagram_[:, 1], "ro") + plt.plot(self.diagram_[:, 0], self.diagram_[:, 1], "o", color="red") l = min(l, self.diagram_[:, 1].min()) r = max(r, self.diagram_[:, 0].max()) if l == r: @@ -283,7 +283,7 @@ class Tomato: l, r = -1.0, 1.0 plt.plot([l, r], [l, r]) plt.plot( - self.max_weight_per_cc_, numpy.full(self.max_weight_per_cc_.shape, 1.1 * l - 0.1 * r), "ro", color="green" + self.max_weight_per_cc_, numpy.full(self.max_weight_per_cc_.shape, 1.1 * l - 0.1 * r), "o", color="green" ) plt.show() diff --git a/src/python/gudhi/cubical_complex.pyx b/src/python/gudhi/cubical_complex.pyx index 28fbe3af..8e244bb8 100644 --- a/src/python/gudhi/cubical_complex.pyx +++ b/src/python/gudhi/cubical_complex.pyx @@ -35,7 +35,7 @@ cdef extern from "Cubical_complex_interface.h" namespace "Gudhi": cdef extern from "Persistent_cohomology_interface.h" namespace "Gudhi": cdef cppclass Cubical_complex_persistence_interface "Gudhi::Persistent_cohomology_interface<Gudhi::Cubical_complex::Cubical_complex_interface<>>": Cubical_complex_persistence_interface(Bitmap_cubical_complex_base_interface * st, bool persistence_dim_max) nogil - void compute_persistence(int homology_coeff_field, double min_persistence) nogil + void compute_persistence(int homology_coeff_field, double min_persistence) nogil except+ vector[pair[int, pair[double, double]]] get_persistence() nogil vector[vector[int]] cofaces_of_cubical_persistence_pairs() nogil vector[int] betti_numbers() nogil @@ -147,7 +147,7 @@ cdef class CubicalComplex: :func:`persistence` returns. :param homology_coeff_field: The homology coefficient field. Must be a - prime number + prime number. Default value is 11. Max is 46337. :type homology_coeff_field: int. :param min_persistence: The minimum persistence value to take into account (strictly greater than min_persistence). Default value is @@ -169,7 +169,7 @@ cdef class CubicalComplex: """This function computes and returns the persistence of the complex. :param homology_coeff_field: The homology coefficient field. Must be a - prime number + prime number. Default value is 11. Max is 46337. :type homology_coeff_field: int. :param min_persistence: The minimum persistence value to take into account (strictly greater than min_persistence). Default value is @@ -281,4 +281,8 @@ cdef class CubicalComplex: launched first. """ assert self.pcohptr != NULL, "compute_persistence() must be called before persistence_intervals_in_dimension()" - return np.array(self.pcohptr.intervals_in_dimension(dimension)) + piid = np.array(self.pcohptr.intervals_in_dimension(dimension)) + # Workaround https://github.com/GUDHI/gudhi-devel/issues/507 + if len(piid) == 0: + return np.empty(shape = [0, 2]) + return piid diff --git a/src/python/gudhi/datasets/__init__.py b/src/python/gudhi/datasets/__init__.py new file mode 100644 index 00000000..e69de29b --- /dev/null +++ b/src/python/gudhi/datasets/__init__.py diff --git a/src/python/gudhi/datasets/generators/__init__.py b/src/python/gudhi/datasets/generators/__init__.py new file mode 100644 index 00000000..e69de29b --- /dev/null +++ b/src/python/gudhi/datasets/generators/__init__.py diff --git a/src/python/gudhi/datasets/generators/_points.cc b/src/python/gudhi/datasets/generators/_points.cc new file mode 100644 index 00000000..82fea25b --- /dev/null +++ b/src/python/gudhi/datasets/generators/_points.cc @@ -0,0 +1,121 @@ +/* This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + * See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + * Author(s): Hind Montassif + * + * Copyright (C) 2021 Inria + * + * Modification(s): + * - YYYY/MM Author: Description of the modification + */ + +#include <pybind11/pybind11.h> +#include <pybind11/numpy.h> + +#include <gudhi/random_point_generators.h> +#include <gudhi/Debug_utils.h> + +#include <CGAL/Epick_d.h> + +namespace py = pybind11; + + +typedef CGAL::Epick_d< CGAL::Dynamic_dimension_tag > Kern; + +py::array_t<double> generate_points_on_sphere(size_t n_samples, int ambient_dim, double radius, std::string sample) { + + if (sample != "random") { + throw pybind11::value_error("This sample type is not supported"); + } + + py::array_t<double> points({n_samples, (size_t)ambient_dim}); + + py::buffer_info buf = points.request(); + double *ptr = static_cast<double *>(buf.ptr); + + GUDHI_CHECK(n_samples == buf.shape[0], "Py array first dimension not matching n_samples on sphere"); + GUDHI_CHECK(ambient_dim == buf.shape[1], "Py array second dimension not matching the ambient space dimension"); + + + std::vector<typename Kern::Point_d> points_generated; + + { + py::gil_scoped_release release; + points_generated = Gudhi::generate_points_on_sphere_d<Kern>(n_samples, ambient_dim, radius); + } + + for (size_t i = 0; i < n_samples; i++) + for (int j = 0; j < ambient_dim; j++) + ptr[i*ambient_dim+j] = points_generated[i][j]; + + return points; +} + +py::array_t<double> generate_points_on_torus(size_t n_samples, int dim, std::string sample) { + + if ( (sample != "random") && (sample != "grid")) { + throw pybind11::value_error("This sample type is not supported"); + } + + std::vector<typename Kern::Point_d> points_generated; + + { + py::gil_scoped_release release; + points_generated = Gudhi::generate_points_on_torus_d<Kern>(n_samples, dim, sample); + } + + size_t npoints = points_generated.size(); + + GUDHI_CHECK(2*dim == points_generated[0].size(), "Py array second dimension not matching the double torus dimension"); + + py::array_t<double> points({npoints, (size_t)2*dim}); + + py::buffer_info buf = points.request(); + double *ptr = static_cast<double *>(buf.ptr); + + for (size_t i = 0; i < npoints; i++) + for (int j = 0; j < 2*dim; j++) + ptr[i*(2*dim)+j] = points_generated[i][j]; + + return points; +} + +PYBIND11_MODULE(_points, m) { + m.attr("__license__") = "LGPL v3"; + + m.def("sphere", &generate_points_on_sphere, + py::arg("n_samples"), py::arg("ambient_dim"), + py::arg("radius") = 1., py::arg("sample") = "random", + R"pbdoc( + Generate random i.i.d. points uniformly on a (d-1)-sphere in R^d + + :param n_samples: The number of points to be generated. + :type n_samples: integer + :param ambient_dim: The ambient dimension d. + :type ambient_dim: integer + :param radius: The radius. Default value is `1.`. + :type radius: float + :param sample: The sample type. Default and only available value is `"random"`. + :type sample: string + :returns: the generated points on a sphere. + )pbdoc"); + + m.def("ctorus", &generate_points_on_torus, + py::arg("n_samples"), py::arg("dim"), py::arg("sample") = "random", + R"pbdoc( + Generate random i.i.d. points on a d-torus in R^2d or as a grid + + :param n_samples: The number of points to be generated. + :type n_samples: integer + :param dim: The dimension of the torus on which points would be generated in R^2*dim. + :type dim: integer + :param sample: The sample type. Available values are: `"random"` and `"grid"`. Default value is `"random"`. + :type sample: string + :returns: the generated points on a torus. + + The shape of returned numpy array is: + + If sample is 'random': (n_samples, 2*dim). + + If sample is 'grid': (⌊n_samples**(1./dim)⌋**dim, 2*dim), where shape[0] is rounded down to the closest perfect 'dim'th power. + )pbdoc"); +} diff --git a/src/python/gudhi/datasets/generators/points.py b/src/python/gudhi/datasets/generators/points.py new file mode 100644 index 00000000..9bb2799d --- /dev/null +++ b/src/python/gudhi/datasets/generators/points.py @@ -0,0 +1,59 @@ +# This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. +# See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. +# Author(s): Hind Montassif +# +# Copyright (C) 2021 Inria +# +# Modification(s): +# - YYYY/MM Author: Description of the modification + +import numpy as np + +from ._points import ctorus +from ._points import sphere + +def _generate_random_points_on_torus(n_samples, dim): + + # Generate random angles of size n_samples*dim + alpha = 2*np.pi*np.random.rand(n_samples*dim) + + # Based on angles, construct points of size n_samples*dim on a circle and reshape the result in a n_samples*2*dim array + array_points = np.column_stack([np.cos(alpha), np.sin(alpha)]).reshape(-1, 2*dim) + + return array_points + +def _generate_grid_points_on_torus(n_samples, dim): + + # Generate points on a dim-torus as a grid + n_samples_grid = int((n_samples+.5)**(1./dim)) # add .5 to avoid rounding down with numerical approximations + alpha = np.linspace(0, 2*np.pi, n_samples_grid, endpoint=False) + + array_points = np.column_stack([np.cos(alpha), np.sin(alpha)]) + array_points_idx = np.empty([n_samples_grid]*dim + [dim], dtype=int) + for i, x in enumerate(np.ix_(*([np.arange(n_samples_grid)]*dim))): + array_points_idx[...,i] = x + return array_points[array_points_idx].reshape(-1, 2*dim) + +def torus(n_samples, dim, sample='random'): + """ + Generate points on a flat dim-torus in R^2dim either randomly or on a grid + + :param n_samples: The number of points to be generated. + :param dim: The dimension of the torus on which points would be generated in R^2*dim. + :param sample: The sample type of the generated points. Can be 'random' or 'grid'. + :returns: numpy array containing the generated points on a torus. + + The shape of returned numpy array is: + + If sample is 'random': (n_samples, 2*dim). + + If sample is 'grid': (⌊n_samples**(1./dim)⌋**dim, 2*dim), where shape[0] is rounded down to the closest perfect 'dim'th power. + """ + if sample == 'random': + # Generate points randomly + return _generate_random_points_on_torus(n_samples, dim) + elif sample == 'grid': + # Generate points on a grid + return _generate_grid_points_on_torus(n_samples, dim) + else: + raise ValueError("Sample type '{}' is not supported".format(sample)) diff --git a/src/python/gudhi/datasets/remote.py b/src/python/gudhi/datasets/remote.py new file mode 100644 index 00000000..f6d3fe56 --- /dev/null +++ b/src/python/gudhi/datasets/remote.py @@ -0,0 +1,223 @@ +# This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. +# See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. +# Author(s): Hind Montassif +# +# Copyright (C) 2021 Inria +# +# Modification(s): +# - YYYY/MM Author: Description of the modification + +from os.path import join, split, exists, expanduser +from os import makedirs, remove, environ + +from urllib.request import urlretrieve +import hashlib +import shutil + +import numpy as np + +def _get_data_home(data_home = None): + """ + Return the path of the remote datasets directory. + This folder is used to store remotely fetched datasets. + By default the datasets directory is set to a folder named 'gudhi_data' in the user home folder. + Alternatively, it can be set by the 'GUDHI_DATA' environment variable. + The '~' symbol is expanded to the user home folder. + If the folder does not already exist, it is automatically created. + + Parameters + ---------- + data_home : string + The path to remote datasets directory. + Default is `None`, meaning that the data home directory will be set to "~/gudhi_data", + if the 'GUDHI_DATA' environment variable does not exist. + + Returns + ------- + data_home: string + The path to remote datasets directory. + """ + if data_home is None: + data_home = environ.get("GUDHI_DATA", join("~", "gudhi_data")) + data_home = expanduser(data_home) + makedirs(data_home, exist_ok=True) + return data_home + + +def clear_data_home(data_home = None): + """ + Delete the data home cache directory and all its content. + + Parameters + ---------- + data_home : string, default is None. + The path to remote datasets directory. + If `None` and the 'GUDHI_DATA' environment variable does not exist, + the default directory to be removed is set to "~/gudhi_data". + """ + data_home = _get_data_home(data_home) + shutil.rmtree(data_home) + +def _checksum_sha256(file_path): + """ + Compute the file checksum using sha256. + + Parameters + ---------- + file_path: string + Full path of the created file including filename. + + Returns + ------- + The hex digest of file_path. + """ + sha256_hash = hashlib.sha256() + chunk_size = 4096 + with open(file_path,"rb") as f: + # Read and update hash string value in blocks of 4K + while True: + buffer = f.read(chunk_size) + if not buffer: + break + sha256_hash.update(buffer) + return sha256_hash.hexdigest() + +def _fetch_remote(url, file_path, file_checksum = None): + """ + Fetch the wanted dataset from the given url and save it in file_path. + + Parameters + ---------- + url : string + The url to fetch the dataset from. + file_path : string + Full path of the downloaded file including filename. + file_checksum : string + The file checksum using sha256 to check against the one computed on the downloaded file. + Default is 'None', which means the checksum is not checked. + + Raises + ------ + IOError + If the computed SHA256 checksum of file does not match the one given by the user. + """ + + # Get the file + urlretrieve(url, file_path) + + if file_checksum is not None: + checksum = _checksum_sha256(file_path) + if file_checksum != checksum: + # Remove file and raise error + remove(file_path) + raise IOError("{} has a SHA256 checksum : {}, " + "different from expected : {}." + "The file may be corrupted or the given url may be wrong !".format(file_path, checksum, file_checksum)) + +def _get_archive_path(file_path, label): + """ + Get archive path based on file_path given by user and label. + + Parameters + ---------- + file_path: string + Full path of the file to get including filename, or None. + label: string + Label used along with 'data_home' to get archive path, in case 'file_path' is None. + + Returns + ------- + Full path of archive including filename. + """ + if file_path is None: + archive_path = join(_get_data_home(), label) + dirname = split(archive_path)[0] + makedirs(dirname, exist_ok=True) + else: + archive_path = file_path + dirname = split(archive_path)[0] + makedirs(dirname, exist_ok=True) + + return archive_path + +def fetch_spiral_2d(file_path = None): + """ + Load the spiral_2d dataset. + + Note that if the dataset already exists in the target location, it is not downloaded again, + and the corresponding array is returned from cache. + + Parameters + ---------- + file_path : string + Full path of the downloaded file including filename. + + Default is None, meaning that it's set to "data_home/points/spiral_2d/spiral_2d.npy". + + The "data_home" directory is set by default to "~/gudhi_data", + unless the 'GUDHI_DATA' environment variable is set. + + Returns + ------- + points: numpy array + Array of shape (114562, 2). + """ + file_url = "https://raw.githubusercontent.com/GUDHI/gudhi-data/main/points/spiral_2d/spiral_2d.npy" + file_checksum = '2226024da76c073dd2f24b884baefbfd14928b52296df41ad2d9b9dc170f2401' + + archive_path = _get_archive_path(file_path, "points/spiral_2d/spiral_2d.npy") + + if not exists(archive_path): + _fetch_remote(file_url, archive_path, file_checksum) + + return np.load(archive_path, mmap_mode='r') + +def fetch_bunny(file_path = None, accept_license = False): + """ + Load the Stanford bunny dataset. + + This dataset contains 35947 vertices. + + Note that if the dataset already exists in the target location, it is not downloaded again, + and the corresponding array is returned from cache. + + Parameters + ---------- + file_path : string + Full path of the downloaded file including filename. + + Default is None, meaning that it's set to "data_home/points/bunny/bunny.npy". + In this case, the LICENSE file would be downloaded as "data_home/points/bunny/bunny.LICENSE". + + The "data_home" directory is set by default to "~/gudhi_data", + unless the 'GUDHI_DATA' environment variable is set. + + accept_license : boolean + Flag to specify if user accepts the file LICENSE and prevents from printing the corresponding license terms. + + Default is False. + + Returns + ------- + points: numpy array + Array of shape (35947, 3). + """ + + file_url = "https://raw.githubusercontent.com/GUDHI/gudhi-data/main/points/bunny/bunny.npy" + file_checksum = 'f382482fd89df8d6444152dc8fd454444fe597581b193fd139725a85af4a6c6e' + license_url = "https://raw.githubusercontent.com/GUDHI/gudhi-data/main/points/bunny/bunny.LICENSE" + license_checksum = 'b763dbe1b2fc6015d05cbf7bcc686412a2eb100a1f2220296e3b4a644c69633a' + + archive_path = _get_archive_path(file_path, "points/bunny/bunny.npy") + + if not exists(archive_path): + _fetch_remote(file_url, archive_path, file_checksum) + license_path = join(split(archive_path)[0], "bunny.LICENSE") + _fetch_remote(license_url, license_path, license_checksum) + # Print license terms unless accept_license is set to True + if not accept_license: + if exists(license_path): + with open(license_path, 'r') as f: + print(f.read()) + + return np.load(archive_path, mmap_mode='r') diff --git a/src/python/gudhi/hera/bottleneck.cc b/src/python/gudhi/hera/bottleneck.cc index 0cb562ce..ec461f7c 100644 --- a/src/python/gudhi/hera/bottleneck.cc +++ b/src/python/gudhi/hera/bottleneck.cc @@ -16,7 +16,7 @@ using py::ssize_t; #endif -#include <bottleneck.h> // Hera +#include <hera/bottleneck.h> // Hera double bottleneck_distance(Dgm d1, Dgm d2, double delta) { diff --git a/src/python/gudhi/hera/wasserstein.cc b/src/python/gudhi/hera/wasserstein.cc index 1a21f02f..3516352e 100644 --- a/src/python/gudhi/hera/wasserstein.cc +++ b/src/python/gudhi/hera/wasserstein.cc @@ -8,10 +8,16 @@ * - YYYY/MM Author: Description of the modification */ -#include <wasserstein.h> // Hera - #include <pybind11_diagram_utils.h> +#ifdef _MSC_VER +// https://github.com/grey-narn/hera/issues/3 +// ssize_t is a non-standard type (well, posix) +using py::ssize_t; +#endif + +#include <hera/wasserstein.h> // Hera + double wasserstein_distance( Dgm d1, Dgm d2, double wasserstein_power, double internal_p, @@ -29,7 +35,7 @@ double wasserstein_distance( if(std::isinf(internal_p)) internal_p = hera::get_infinity<double>(); params.internal_p = internal_p; params.delta = delta; - // The extra parameters are purposedly not exposed for now. + // The extra parameters are purposely not exposed for now. return hera::wasserstein_dist(diag1, diag2, params); } diff --git a/src/python/gudhi/off_reader.pyx b/src/python/gudhi/off_utils.pyx index a3200704..9276c7b0 100644 --- a/src/python/gudhi/off_reader.pyx +++ b/src/python/gudhi/off_utils.pyx @@ -13,8 +13,10 @@ from __future__ import print_function from cython cimport numeric from libcpp.vector cimport vector from libcpp.string cimport string +cimport cython import errno import os +import numpy as np __author__ = "Vincent Rouvreau" __copyright__ = "Copyright (C) 2016 Inria" @@ -24,7 +26,7 @@ cdef extern from "Off_reader_interface.h" namespace "Gudhi": vector[vector[double]] read_points_from_OFF_file(string off_file) def read_points_from_off_file(off_file=''): - """Read points from OFF file. + """Read points from an `OFF file <fileformats.html#off-file-format>`_. :param off_file: An OFF file style name. :type off_file: string @@ -39,3 +41,22 @@ def read_points_from_off_file(off_file=''): raise FileNotFoundError(errno.ENOENT, os.strerror(errno.ENOENT), off_file) +@cython.embedsignature(True) +def write_points_to_off_file(fname, points): + """Write points to an `OFF file <fileformats.html#off-file-format>`_. + + A simple wrapper for `numpy.savetxt`. + + :param fname: Name of the OFF file. + :type fname: str or file handle + :param points: Point coordinates. + :type points: numpy array of shape (n, dim) + """ + points = np.array(points, copy=False) + assert len(points.shape) == 2 + dim = points.shape[1] + if dim == 3: + head = 'OFF\n{} 0 0'.format(points.shape[0]) + else: + head = 'nOFF\n{} {} 0 0'.format(dim, points.shape[0]) + np.savetxt(fname, points, header=head, comments='') diff --git a/src/python/gudhi/periodic_cubical_complex.pyx b/src/python/gudhi/periodic_cubical_complex.pyx index d353d2af..6c21e902 100644 --- a/src/python/gudhi/periodic_cubical_complex.pyx +++ b/src/python/gudhi/periodic_cubical_complex.pyx @@ -32,7 +32,7 @@ cdef extern from "Cubical_complex_interface.h" namespace "Gudhi": cdef extern from "Persistent_cohomology_interface.h" namespace "Gudhi": cdef cppclass Periodic_cubical_complex_persistence_interface "Gudhi::Persistent_cohomology_interface<Gudhi::Cubical_complex::Cubical_complex_interface<Gudhi::cubical_complex::Bitmap_cubical_complex_periodic_boundary_conditions_base<double>>>": Periodic_cubical_complex_persistence_interface(Periodic_cubical_complex_base_interface * st, bool persistence_dim_max) nogil - void compute_persistence(int homology_coeff_field, double min_persistence) nogil + void compute_persistence(int homology_coeff_field, double min_persistence) nogil except + vector[pair[int, pair[double, double]]] get_persistence() nogil vector[vector[int]] cofaces_of_cubical_persistence_pairs() nogil vector[int] betti_numbers() nogil @@ -148,7 +148,7 @@ cdef class PeriodicCubicalComplex: :func:`persistence` returns. :param homology_coeff_field: The homology coefficient field. Must be a - prime number + prime number. Default value is 11. Max is 46337. :type homology_coeff_field: int. :param min_persistence: The minimum persistence value to take into account (strictly greater than min_persistence). Default value is @@ -170,7 +170,7 @@ cdef class PeriodicCubicalComplex: """This function computes and returns the persistence of the complex. :param homology_coeff_field: The homology coefficient field. Must be a - prime number + prime number. Default value is 11. Max is 46337. :type homology_coeff_field: int. :param min_persistence: The minimum persistence value to take into account (strictly greater than min_persistence). Default value is @@ -280,4 +280,8 @@ cdef class PeriodicCubicalComplex: launched first. """ assert self.pcohptr != NULL, "compute_persistence() must be called before persistence_intervals_in_dimension()" - return np.array(self.pcohptr.intervals_in_dimension(dimension)) + piid = np.array(self.pcohptr.intervals_in_dimension(dimension)) + # Workaround https://github.com/GUDHI/gudhi-devel/issues/507 + if len(piid) == 0: + return np.empty(shape = [0, 2]) + return piid diff --git a/src/python/gudhi/persistence_graphical_tools.py b/src/python/gudhi/persistence_graphical_tools.py index 848dc03e..e438aa66 100644 --- a/src/python/gudhi/persistence_graphical_tools.py +++ b/src/python/gudhi/persistence_graphical_tools.py @@ -12,6 +12,9 @@ from os import path from math import isfinite import numpy as np from functools import lru_cache +import warnings +import errno +import os from gudhi.reader_utils import read_persistence_intervals_in_dimension from gudhi.reader_utils import read_persistence_intervals_grouped_by_dimension @@ -22,6 +25,7 @@ __license__ = "MIT" _gudhi_matplotlib_use_tex = True + def __min_birth_max_death(persistence, band=0.0): """This function returns (min_birth, max_death) from the persistence. @@ -44,20 +48,46 @@ def __min_birth_max_death(persistence, band=0.0): min_birth = float(interval[1][0]) if band > 0.0: max_death += band + # can happen if only points at inf death + if min_birth == max_death: + max_death = max_death + 1.0 return (min_birth, max_death) def _array_handler(a): - ''' + """ :param a: if array, assumes it is a (n x 2) np.array and return a persistence-compatible list (padding with 0), so that the plot can be performed seamlessly. - ''' - if isinstance(a[0][1], np.float64) or isinstance(a[0][1], float): + """ + if isinstance(a[0][1], (np.floating, float)): return [[0, x] for x in a] else: return a + +def _limit_to_max_intervals(persistence, max_intervals, key): + """This function returns truncated persistence if length is bigger than max_intervals. + :param persistence: Persistence intervals values list. Can be grouped by dimension or not. + :type persistence: an array of (dimension, array of (birth, death)) or an array of (birth, death). + :param max_intervals: maximal number of intervals to display. + Selected intervals are those with the longest life time. Set it + to 0 to see all. Default value is 1000. + :type max_intervals: int. + :param key: key function for sort algorithm. + :type key: function or lambda. + """ + if max_intervals > 0 and max_intervals < len(persistence): + warnings.warn( + "There are %s intervals given as input, whereas max_intervals is set to %s." + % (len(persistence), max_intervals) + ) + # Sort by life time, then takes only the max_intervals elements + return sorted(persistence, key=key, reverse=True)[:max_intervals] + else: + return persistence + + @lru_cache(maxsize=1) def _matplotlib_can_use_tex(): """This function returns True if matplotlib can deal with LaTeX, False otherwise. @@ -65,17 +95,17 @@ def _matplotlib_can_use_tex(): """ try: from matplotlib import checkdep_usetex + return checkdep_usetex(True) - except ImportError: - print("This function is not available, you may be missing matplotlib.") + except ImportError as import_error: + warnings.warn(f"This function is not available.\nModuleNotFoundError: No module named '{import_error.name}'.") def plot_persistence_barcode( persistence=[], persistence_file="", alpha=0.6, - max_intervals=1000, - max_barcodes=1000, + max_intervals=20000, inf_delta=0.1, legend=False, colormap=None, @@ -97,7 +127,7 @@ def plot_persistence_barcode( :type alpha: float. :param max_intervals: maximal number of intervals to display. Selected intervals are those with the longest life time. Set it - to 0 to see all. Default value is 1000. + to 0 to see all. Default value is 20000. :type max_intervals: int. :param inf_delta: Infinity is placed at :code:`((max_death - min_birth) x inf_delta)` above :code:`max_death` value. A reasonable value is @@ -119,99 +149,70 @@ def plot_persistence_barcode( import matplotlib.pyplot as plt import matplotlib.patches as mpatches from matplotlib import rc + if _gudhi_matplotlib_use_tex and _matplotlib_can_use_tex(): - plt.rc('text', usetex=True) - plt.rc('font', family='serif') + plt.rc("text", usetex=True) + plt.rc("font", family="serif") else: - plt.rc('text', usetex=False) - plt.rc('font', family='DejaVu Sans') + plt.rc("text", usetex=False) + plt.rc("font", family="DejaVu Sans") if persistence_file != "": if path.isfile(persistence_file): # Reset persistence persistence = [] - diag = read_persistence_intervals_grouped_by_dimension( - persistence_file=persistence_file - ) + diag = read_persistence_intervals_grouped_by_dimension(persistence_file=persistence_file) for key in diag.keys(): for persistence_interval in diag[key]: persistence.append((key, persistence_interval)) else: - print("file " + persistence_file + " not found.") - return None - - persistence = _array_handler(persistence) - - if max_barcodes != 1000: - print("Deprecated parameter. It has been replaced by max_intervals") - max_intervals = max_barcodes - - if max_intervals > 0 and max_intervals < len(persistence): - # Sort by life time, then takes only the max_intervals elements - persistence = sorted( - persistence, - key=lambda life_time: life_time[1][1] - life_time[1][0], - reverse=True, - )[:max_intervals] - - if colormap == None: - colormap = plt.cm.Set1.colors - if axes == None: - fig, axes = plt.subplots(1, 1) + raise FileNotFoundError(errno.ENOENT, os.strerror(errno.ENOENT), persistence_file) - persistence = sorted(persistence, key=lambda birth: birth[1][0]) + try: + persistence = _array_handler(persistence) + persistence = _limit_to_max_intervals( + persistence, max_intervals, key=lambda life_time: life_time[1][1] - life_time[1][0] + ) + (min_birth, max_death) = __min_birth_max_death(persistence) + persistence = sorted(persistence, key=lambda birth: birth[1][0]) + except IndexError: + min_birth, max_death = 0.0, 1.0 + pass - (min_birth, max_death) = __min_birth_max_death(persistence) - ind = 0 delta = (max_death - min_birth) * inf_delta # Replace infinity values with max_death + delta for bar code to be more # readable infinity = max_death + delta axis_start = min_birth - delta - # Draw horizontal bars in loop - for interval in reversed(persistence): - if float(interval[1][1]) != float("inf"): - # Finite death case - axes.barh( - ind, - (interval[1][1] - interval[1][0]), - height=0.8, - left=interval[1][0], - alpha=alpha, - color=colormap[interval[0]], - linewidth=0, - ) - else: - # Infinite death case for diagram to be nicer - axes.barh( - ind, - (infinity - interval[1][0]), - height=0.8, - left=interval[1][0], - alpha=alpha, - color=colormap[interval[0]], - linewidth=0, - ) - ind = ind + 1 + + if axes == None: + _, axes = plt.subplots(1, 1) + if colormap == None: + colormap = plt.cm.Set1.colors + + x=[birth for (dim,(birth,death)) in persistence] + y=[(death - birth) if death != float("inf") else (infinity - birth) for (dim,(birth,death)) in persistence] + c=[colormap[dim] for (dim,(birth,death)) in persistence] + + axes.barh(range(len(x)), y, left=x, alpha=alpha, color=c, linewidth=0) if legend: - dimensions = list(set(item[0] for item in persistence)) + dimensions = set(item[0] for item in persistence) axes.legend( - handles=[ - mpatches.Patch(color=colormap[dim], label=str(dim)) - for dim in dimensions - ], - loc="lower right", + handles=[mpatches.Patch(color=colormap[dim], label=str(dim)) for dim in dimensions], loc="lower right", ) axes.set_title("Persistence barcode", fontsize=fontsize) + axes.set_yticks([]) + axes.invert_yaxis() # Ends plot on infinity value and starts a little bit before min_birth - axes.axis([axis_start, infinity, 0, ind]) + if len(x) != 0: + axes.set_xlim((axis_start, infinity)) return axes - except ImportError: - print("This function is not available, you may be missing matplotlib.") + except ImportError as import_error: + warnings.warn(f"This function is not available.\nModuleNotFoundError: No module named '{import_error.name}'.") def plot_persistence_diagram( @@ -219,14 +220,13 @@ def plot_persistence_diagram( persistence_file="", alpha=0.6, band=0.0, - max_intervals=1000, - max_plots=1000, + max_intervals=1000000, inf_delta=0.1, legend=False, colormap=None, axes=None, fontsize=16, - greyblock=True + greyblock=True, ): """This function plots the persistence diagram from persistence values list, a np.array of shape (N x 2) representing a diagram in a single @@ -244,7 +244,7 @@ def plot_persistence_diagram( :type band: float. :param max_intervals: maximal number of intervals to display. Selected intervals are those with the longest life time. Set it - to 0 to see all. Default value is 1000. + to 0 to see all. Default value is 1000000. :type max_intervals: int. :param inf_delta: Infinity is placed at :code:`((max_death - min_birth) x inf_delta)` above :code:`max_death` value. A reasonable value is @@ -268,47 +268,35 @@ def plot_persistence_diagram( import matplotlib.pyplot as plt import matplotlib.patches as mpatches from matplotlib import rc + if _gudhi_matplotlib_use_tex and _matplotlib_can_use_tex(): - plt.rc('text', usetex=True) - plt.rc('font', family='serif') + plt.rc("text", usetex=True) + plt.rc("font", family="serif") else: - plt.rc('text', usetex=False) - plt.rc('font', family='DejaVu Sans') + plt.rc("text", usetex=False) + plt.rc("font", family="DejaVu Sans") if persistence_file != "": if path.isfile(persistence_file): # Reset persistence persistence = [] - diag = read_persistence_intervals_grouped_by_dimension( - persistence_file=persistence_file - ) + diag = read_persistence_intervals_grouped_by_dimension(persistence_file=persistence_file) for key in diag.keys(): for persistence_interval in diag[key]: persistence.append((key, persistence_interval)) else: - print("file " + persistence_file + " not found.") - return None + raise FileNotFoundError(errno.ENOENT, os.strerror(errno.ENOENT), persistence_file) - persistence = _array_handler(persistence) - - if max_plots != 1000: - print("Deprecated parameter. It has been replaced by max_intervals") - max_intervals = max_plots - - if max_intervals > 0 and max_intervals < len(persistence): - # Sort by life time, then takes only the max_intervals elements - persistence = sorted( - persistence, - key=lambda life_time: life_time[1][1] - life_time[1][0], - reverse=True, - )[:max_intervals] - - if colormap == None: - colormap = plt.cm.Set1.colors - if axes == None: - fig, axes = plt.subplots(1, 1) + try: + persistence = _array_handler(persistence) + persistence = _limit_to_max_intervals( + persistence, max_intervals, key=lambda life_time: life_time[1][1] - life_time[1][0] + ) + min_birth, max_death = __min_birth_max_death(persistence, band) + except IndexError: + min_birth, max_death = 0.0, 1.0 + pass - (min_birth, max_death) = __min_birth_max_death(persistence, band) delta = (max_death - min_birth) * inf_delta # Replace infinity values with max_death + delta for diagram to be more # readable @@ -316,61 +304,56 @@ def plot_persistence_diagram( axis_end = max_death + delta / 2 axis_start = min_birth - delta + if axes == None: + _, axes = plt.subplots(1, 1) + if colormap == None: + colormap = plt.cm.Set1.colors # bootstrap band if band > 0.0: x = np.linspace(axis_start, infinity, 1000) axes.fill_between(x, x, x + band, alpha=alpha, facecolor="red") # lower diag patch if greyblock: - axes.add_patch(mpatches.Polygon([[axis_start, axis_start], [axis_end, axis_start], [axis_end, axis_end]], fill=True, color='lightgrey')) - # Draw points in loop - pts_at_infty = False # Records presence of pts at infty - for interval in reversed(persistence): - if float(interval[1][1]) != float("inf"): - # Finite death case - axes.scatter( - interval[1][0], - interval[1][1], - alpha=alpha, - color=colormap[interval[0]], - ) - else: - pts_at_infty = True - # Infinite death case for diagram to be nicer - axes.scatter( - interval[1][0], infinity, alpha=alpha, color=colormap[interval[0]] + axes.add_patch( + mpatches.Polygon( + [[axis_start, axis_start], [axis_end, axis_start], [axis_end, axis_end]], + fill=True, + color="lightgrey", ) - if pts_at_infty: + ) + # line display of equation : birth = death + axes.plot([axis_start, axis_end], [axis_start, axis_end], linewidth=1.0, color="k") + + x=[birth for (dim,(birth,death)) in persistence] + y=[death if death != float("inf") else infinity for (dim,(birth,death)) in persistence] + c=[colormap[dim] for (dim,(birth,death)) in persistence] + + axes.scatter(x,y,alpha=alpha,color=c) + if float("inf") in (death for (dim,(birth,death)) in persistence): # infinity line and text - axes.plot([axis_start, axis_end], [axis_start, axis_end], linewidth=1.0, color="k") axes.plot([axis_start, axis_end], [infinity, infinity], linewidth=1.0, color="k", alpha=alpha) # Infinity label yt = axes.get_yticks() - yt = yt[np.where(yt < axis_end)] # to avoid ploting ticklabel higher than infinity + yt = yt[np.where(yt < axis_end)] # to avoid plotting ticklabel higher than infinity yt = np.append(yt, infinity) ytl = ["%.3f" % e for e in yt] # to avoid float precision error - ytl[-1] = r'$+\infty$' + ytl[-1] = r"$+\infty$" axes.set_yticks(yt) axes.set_yticklabels(ytl) if legend: dimensions = list(set(item[0] for item in persistence)) - axes.legend( - handles=[ - mpatches.Patch(color=colormap[dim], label=str(dim)) - for dim in dimensions - ] - ) + axes.legend(handles=[mpatches.Patch(color=colormap[dim], label=str(dim)) for dim in dimensions]) axes.set_xlabel("Birth", fontsize=fontsize) axes.set_ylabel("Death", fontsize=fontsize) axes.set_title("Persistence diagram", fontsize=fontsize) # Ends plot on infinity value and starts a little bit before min_birth - axes.axis([axis_start, axis_end, axis_start, infinity + delta/2]) + axes.axis([axis_start, axis_end, axis_start, infinity + delta / 2]) return axes - except ImportError: - print("This function is not available, you may be missing matplotlib.") + except ImportError as import_error: + warnings.warn(f"This function is not available.\nModuleNotFoundError: No module named '{import_error.name}'.") def plot_persistence_density( @@ -384,7 +367,7 @@ def plot_persistence_density( legend=False, axes=None, fontsize=16, - greyblock=False + greyblock=False, ): """This function plots the persistence density from persistence values list, np.array of shape (N x 2) representing a diagram @@ -444,12 +427,13 @@ def plot_persistence_density( import matplotlib.patches as mpatches from scipy.stats import kde from matplotlib import rc + if _gudhi_matplotlib_use_tex and _matplotlib_can_use_tex(): - plt.rc('text', usetex=True) - plt.rc('font', family='serif') + plt.rc("text", usetex=True) + plt.rc("font", family="serif") else: - plt.rc('text', usetex=False) - plt.rc('font', family='DejaVu Sans') + plt.rc("text", usetex=False) + plt.rc("font", family="DejaVu Sans") if persistence_file != "": if dimension is None: @@ -460,10 +444,16 @@ def plot_persistence_density( persistence_file=persistence_file, only_this_dim=dimension ) else: - print("file " + persistence_file + " not found.") - return None + raise FileNotFoundError(errno.ENOENT, os.strerror(errno.ENOENT), persistence_file) + + # default cmap value cannot be done at argument definition level as matplotlib is not yet defined. + if cmap is None: + cmap = plt.cm.hot_r + if axes == None: + _, axes = plt.subplots(1, 1) - if len(persistence) > 0: + try: + # if not read from file but given by an argument persistence = _array_handler(persistence) persistence_dim = np.array( [ @@ -472,47 +462,54 @@ def plot_persistence_density( if (dim_interval[0] == dimension) or (dimension is None) ] ) - - persistence_dim = persistence_dim[np.isfinite(persistence_dim[:, 1])] - if max_intervals > 0 and max_intervals < len(persistence_dim): - # Sort by life time, then takes only the max_intervals elements + persistence_dim = persistence_dim[np.isfinite(persistence_dim[:, 1])] persistence_dim = np.array( - sorted( - persistence_dim, - key=lambda life_time: life_time[1] - life_time[0], - reverse=True, - )[:max_intervals] + _limit_to_max_intervals( + persistence_dim, max_intervals, key=lambda life_time: life_time[1] - life_time[0] + ) ) - # Set as numpy array birth and death (remove undefined values - inf and NaN) - birth = persistence_dim[:, 0] - death = persistence_dim[:, 1] - - # default cmap value cannot be done at argument definition level as matplotlib is not yet defined. - if cmap is None: - cmap = plt.cm.hot_r - if axes == None: - fig, axes = plt.subplots(1, 1) + # Set as numpy array birth and death (remove undefined values - inf and NaN) + birth = persistence_dim[:, 0] + death = persistence_dim[:, 1] + birth_min = birth.min() + birth_max = birth.max() + death_min = death.min() + death_max = death.max() + + # Evaluate a gaussian kde on a regular grid of nbins x nbins over data extents + k = kde.gaussian_kde([birth, death], bw_method=bw_method) + xi, yi = np.mgrid[ + birth_min : birth_max : nbins * 1j, death_min : death_max : nbins * 1j, + ] + zi = k(np.vstack([xi.flatten(), yi.flatten()])) + # Make the plot + img = axes.pcolormesh(xi, yi, zi.reshape(xi.shape), cmap=cmap, shading="auto") + plot_success = True + + # IndexError on empty diagrams, ValueError on only inf death values + except (IndexError, ValueError): + birth_min = 0.0 + birth_max = 1.0 + death_min = 0.0 + death_max = 1.0 + plot_success = False + pass # line display of equation : birth = death - x = np.linspace(death.min(), birth.max(), 1000) + x = np.linspace(death_min, birth_max, 1000) axes.plot(x, x, color="k", linewidth=1.0) - # Evaluate a gaussian kde on a regular grid of nbins x nbins over data extents - k = kde.gaussian_kde([birth, death], bw_method=bw_method) - xi, yi = np.mgrid[ - birth.min() : birth.max() : nbins * 1j, - death.min() : death.max() : nbins * 1j, - ] - zi = k(np.vstack([xi.flatten(), yi.flatten()])) - - # Make the plot - img = axes.pcolormesh(xi, yi, zi.reshape(xi.shape), cmap=cmap) - if greyblock: - axes.add_patch(mpatches.Polygon([[birth.min(), birth.min()], [death.max(), birth.min()], [death.max(), death.max()]], fill=True, color='lightgrey')) + axes.add_patch( + mpatches.Polygon( + [[birth_min, birth_min], [death_max, birth_min], [death_max, death_max]], + fill=True, + color="lightgrey", + ) + ) - if legend: + if plot_success and legend: plt.colorbar(img, ax=axes) axes.set_xlabel("Birth", fontsize=fontsize) @@ -521,7 +518,5 @@ def plot_persistence_density( return axes - except ImportError: - print( - "This function is not available, you may be missing matplotlib and/or scipy." - ) + except ImportError as import_error: + warnings.warn(f"This function is not available.\nModuleNotFoundError: No module named '{import_error.name}'.") diff --git a/src/python/gudhi/point_cloud/knn.py b/src/python/gudhi/point_cloud/knn.py index 994be3b6..7dc83817 100644 --- a/src/python/gudhi/point_cloud/knn.py +++ b/src/python/gudhi/point_cloud/knn.py @@ -8,6 +8,7 @@ # - YYYY/MM Author: Description of the modification import numpy +import warnings # TODO: https://github.com/facebookresearch/faiss @@ -111,7 +112,7 @@ class KNearestNeighbors: nargs = { k: v for k, v in self.params.items() if k in {"p", "n_jobs", "metric_params", "algorithm", "leaf_size"} } - self.nn = NearestNeighbors(self.k, metric=self.metric, **nargs) + self.nn = NearestNeighbors(n_neighbors=self.k, metric=self.metric, **nargs) self.nn.fit(X) if self.params["implementation"] == "hnsw": @@ -257,6 +258,9 @@ class KNearestNeighbors: if ef is not None: self.graph.set_ef(ef) neighbors, distances = self.graph.knn_query(X, k, num_threads=self.params["num_threads"]) + with warnings.catch_warnings(): + if not(numpy.all(numpy.isfinite(distances))): + warnings.warn("Overflow/infinite value encountered while computing 'distances'", RuntimeWarning) # The k nearest neighbors are always sorted. I couldn't find it in the doc, but the code calls searchKnn, # which returns a priority_queue, and then fills the return array backwards with top/pop on the queue. if self.return_index: @@ -290,6 +294,9 @@ class KNearestNeighbors: if self.return_index: if self.return_distance: distances, neighbors = mat.Kmin_argKmin(k, dim=1) + with warnings.catch_warnings(): + if not(torch.isfinite(distances).all()): + warnings.warn("Overflow/infinite value encountered while computing 'distances'", RuntimeWarning) if p != numpy.inf: distances = distances ** (1.0 / p) return neighbors, distances @@ -298,13 +305,18 @@ class KNearestNeighbors: return neighbors if self.return_distance: distances = mat.Kmin(k, dim=1) + with warnings.catch_warnings(): + if not(torch.isfinite(distances).all()): + warnings.warn("Overflow/infinite value encountered while computing 'distances'", RuntimeWarning) if p != numpy.inf: distances = distances ** (1.0 / p) return distances return None if self.params["implementation"] == "ckdtree": - qargs = {key: val for key, val in self.params.items() if key in {"p", "eps", "n_jobs"}} + qargs = {key: val for key, val in self.params.items() if key in {"p", "eps"}} + # SciPy renamed n_jobs to workers + qargs["workers"] = self.params.get("workers") or self.params.get("n_jobs") or 1 distances, neighbors = self.kdtree.query(X, k=self.k, **qargs) if k == 1: # SciPy decided to squeeze the last dimension for k=1 diff --git a/src/python/gudhi/representations/preprocessing.py b/src/python/gudhi/representations/preprocessing.py index a8545349..8722e162 100644 --- a/src/python/gudhi/representations/preprocessing.py +++ b/src/python/gudhi/representations/preprocessing.py @@ -1,10 +1,11 @@ # This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. # See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. -# Author(s): Mathieu Carrière +# Author(s): Mathieu Carrière, Vincent Rouvreau # # Copyright (C) 2018-2019 Inria # # Modification(s): +# - 2021/10 Vincent Rouvreau: Add DimensionSelector # - YYYY/MM Author: Description of the modification import numpy as np @@ -75,7 +76,7 @@ class Clamping(BaseEstimator, TransformerMixin): Constructor for the Clamping class. Parameters: - limit (double): clamping value (default np.inf). + limit (float): clamping value (default np.inf). """ self.minimum = minimum self.maximum = maximum @@ -234,7 +235,7 @@ class ProminentPoints(BaseEstimator, TransformerMixin): use (bool): whether to use the class or not (default False). location (string): either "upper" or "lower" (default "upper"). Whether to keep the points that are far away ("upper") or close ("lower") to the diagonal. num_pts (int): cardinality threshold (default 10). If location == "upper", keep the top **num_pts** points that are the farthest away from the diagonal. If location == "lower", keep the top **num_pts** points that are the closest to the diagonal. - threshold (double): distance-to-diagonal threshold (default -1). If location == "upper", keep the points that are at least at a distance **threshold** from the diagonal. If location == "lower", keep the points that are at most at a distance **threshold** from the diagonal. + threshold (float): distance-to-diagonal threshold (default -1). If location == "upper", keep the points that are at least at a distance **threshold** from the diagonal. If location == "lower", keep the points that are at most at a distance **threshold** from the diagonal. """ self.num_pts = num_pts self.threshold = threshold @@ -317,7 +318,7 @@ class DiagramSelector(BaseEstimator, TransformerMixin): Parameters: use (bool): whether to use the class or not (default False). - limit (double): second coordinate value that is the criterion for being an essential point (default numpy.inf). + limit (float): second coordinate value that is the criterion for being an essential point (default numpy.inf). point_type (string): either "finite" or "essential". The type of the points that are going to be extracted. """ self.use, self.limit, self.point_type = use, limit, point_type @@ -363,3 +364,51 @@ class DiagramSelector(BaseEstimator, TransformerMixin): n x 2 numpy array: extracted persistence diagram. """ return self.fit_transform([diag])[0] + + +# Mermaid sequence diagram - https://mermaid-js.github.io/mermaid-live-editor/ +# sequenceDiagram +# USER->>DimensionSelector: fit_transform(<br/>[[array( Hi(X0) ), array( Hj(X0) ), ...],<br/> [array( Hi(X1) ), array( Hj(X1) ), ...],<br/> ...]) +# DimensionSelector->>thread1: _transform([array( Hi(X0) ), array( Hj(X0) )], ...) +# DimensionSelector->>thread2: _transform([array( Hi(X1) ), array( Hj(X1) )], ...) +# Note right of DimensionSelector: ... +# thread1->>DimensionSelector: array( Hn(X0) ) +# thread2->>DimensionSelector: array( Hn(X1) ) +# Note right of DimensionSelector: ... +# DimensionSelector->>USER: [array( Hn(X0) ), <br/> array( Hn(X1) ), <br/> ...] + +class DimensionSelector(BaseEstimator, TransformerMixin): + """ + This is a class to select persistence diagrams in a specific dimension from its index. + """ + + def __init__(self, index=0): + """ + Constructor for the DimensionSelector class. + + Parameters: + index (int): The returned persistence diagrams dimension index. Default value is `0`. + """ + self.index = index + + def fit(self, X, Y=None): + """ + Nothing to be done, but useful when included in a scikit-learn Pipeline. + """ + return self + + def transform(self, X, Y=None): + """ + Select persistence diagrams from its dimension. + + Parameters: + X (list of list of tuple): List of list of persistence pairs, i.e. + `[[array( Hi(X0) ), array( Hj(X0) ), ...], [array( Hi(X1) ), array( Hj(X1) ), ...], ...]` + + Returns: + list of tuple: + Persistence diagrams in a specific dimension. i.e. if `index` was set to `m` and `Hn` is at index `m` of + the input, it returns `[array( Hn(X0) ), array( Hn(X1), ...]` + """ + + return [persistence[self.index] for persistence in X] diff --git a/src/python/gudhi/representations/vector_methods.py b/src/python/gudhi/representations/vector_methods.py index 84bc99a2..ce74aee5 100644 --- a/src/python/gudhi/representations/vector_methods.py +++ b/src/python/gudhi/representations/vector_methods.py @@ -1,17 +1,25 @@ # This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. # See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. -# Author(s): Mathieu Carrière, Martin Royer +# Author(s): Mathieu Carrière, Martin Royer, Gard Spreemann # # Copyright (C) 2018-2020 Inria # # Modification(s): # - 2020/06 Martin: ATOL integration +# - 2020/12 Gard: A more flexible Betti curve class capable of computing exact curves. +# - 2021/11 Vincent Rouvreau: factorize _automatic_sample_range import numpy as np from sklearn.base import BaseEstimator, TransformerMixin +from sklearn.exceptions import NotFittedError from sklearn.preprocessing import MinMaxScaler, MaxAbsScaler -from sklearn.neighbors import DistanceMetric from sklearn.metrics import pairwise +try: + # New location since 1.0 + from sklearn.metrics import DistanceMetric +except ImportError: + # Will be removed in 1.3 + from sklearn.neighbors import DistanceMetric from .preprocessing import DiagramScaler, BirthPersistenceTransform @@ -45,10 +53,14 @@ class PersistenceImage(BaseEstimator, TransformerMixin): y (n x 1 array): persistence diagram labels (unused). """ if np.isnan(np.array(self.im_range)).any(): - new_X = BirthPersistenceTransform().fit_transform(X) - pre = DiagramScaler(use=True, scalers=[([0], MinMaxScaler()), ([1], MinMaxScaler())]).fit(new_X,y) - [mx,my],[Mx,My] = [pre.scalers[0][1].data_min_[0], pre.scalers[1][1].data_min_[0]], [pre.scalers[0][1].data_max_[0], pre.scalers[1][1].data_max_[0]] - self.im_range = np.where(np.isnan(np.array(self.im_range)), np.array([mx, Mx, my, My]), np.array(self.im_range)) + try: + new_X = BirthPersistenceTransform().fit_transform(X) + pre = DiagramScaler(use=True, scalers=[([0], MinMaxScaler()), ([1], MinMaxScaler())]).fit(new_X,y) + [mx,my],[Mx,My] = [pre.scalers[0][1].data_min_[0], pre.scalers[1][1].data_min_[0]], [pre.scalers[0][1].data_max_[0], pre.scalers[1][1].data_max_[0]] + self.im_range = np.where(np.isnan(np.array(self.im_range)), np.array([mx, Mx, my, My]), np.array(self.im_range)) + except ValueError: + # Empty persistence diagram case - https://github.com/GUDHI/gudhi-devel/issues/507 + pass return self def transform(self, X): @@ -78,7 +90,7 @@ class PersistenceImage(BaseEstimator, TransformerMixin): Xfit.append(image.flatten()[np.newaxis,:]) - Xfit = np.concatenate(Xfit,0) + Xfit = np.concatenate(Xfit, 0) return Xfit @@ -94,11 +106,57 @@ class PersistenceImage(BaseEstimator, TransformerMixin): """ return self.fit_transform([diag])[0,:] +def _automatic_sample_range(sample_range, X): + """ + Compute and returns sample range from the persistence diagrams if one of the sample_range values is numpy.nan. + + Parameters: + sample_range (a numpy array of 2 float): minimum and maximum of all piecewise-linear function domains, of + the form [x_min, x_max]. + X (list of n x 2 numpy arrays): input persistence diagrams. + y (n x 1 array): persistence diagram labels (unused). + """ + nan_in_range = np.isnan(sample_range) + if nan_in_range.any(): + try: + pre = DiagramScaler(use=True, scalers=[([0], MinMaxScaler()), ([1], MinMaxScaler())]).fit(X) + [mx,my] = [pre.scalers[0][1].data_min_[0], pre.scalers[1][1].data_min_[0]] + [Mx,My] = [pre.scalers[0][1].data_max_[0], pre.scalers[1][1].data_max_[0]] + return np.where(nan_in_range, np.array([mx, My]), sample_range) + except ValueError: + # Empty persistence diagram case - https://github.com/GUDHI/gudhi-devel/issues/507 + pass + return sample_range + + +def _trim_endpoints(x, are_endpoints_nan): + if are_endpoints_nan[0]: + x = x[1:] + if are_endpoints_nan[1]: + x = x[:-1] + return x + + +def _grid_from_sample_range(self, X): + sample_range = np.array(self.sample_range) + self.nan_in_range = np.isnan(sample_range) + self.new_resolution = self.resolution + if not self.keep_endpoints: + self.new_resolution += self.nan_in_range.sum() + self.sample_range_fixed = _automatic_sample_range(sample_range, X) + self.grid_ = np.linspace(self.sample_range_fixed[0], self.sample_range_fixed[1], self.new_resolution) + if not self.keep_endpoints: + self.grid_ = _trim_endpoints(self.grid_, self.nan_in_range) + + class Landscape(BaseEstimator, TransformerMixin): """ This is a class for computing persistence landscapes from a list of persistence diagrams. A persistence landscape is a collection of 1D piecewise-linear functions computed from the rank function associated to the persistence diagram. These piecewise-linear functions are then sampled evenly on a given range and the corresponding vectors of samples are concatenated and returned. See http://jmlr.org/papers/v16/bubenik15a.html for more details. + + Attributes: + grid_ (1d array): The grid on which the landscapes are computed. """ - def __init__(self, num_landscapes=5, resolution=100, sample_range=[np.nan, np.nan]): + def __init__(self, num_landscapes=5, resolution=100, sample_range=[np.nan, np.nan], *, keep_endpoints=False): """ Constructor for the Landscape class. @@ -106,10 +164,10 @@ class Landscape(BaseEstimator, TransformerMixin): num_landscapes (int): number of piecewise-linear functions to output (default 5). resolution (int): number of sample for all piecewise-linear functions (default 100). sample_range ([double, double]): minimum and maximum of all piecewise-linear function domains, of the form [x_min, x_max] (default [numpy.nan, numpy.nan]). It is the interval on which samples will be drawn evenly. If one of the values is numpy.nan, it can be computed from the persistence diagrams with the fit() method. + keep_endpoints (bool): when computing `sample_range`, use the exact extremities (where the value is always 0). This is mostly useful for plotting, the default is to use a slightly smaller range. """ self.num_landscapes, self.resolution, self.sample_range = num_landscapes, resolution, sample_range - self.nan_in_range = np.isnan(np.array(self.sample_range)) - self.new_resolution = self.resolution + self.nan_in_range.sum() + self.keep_endpoints = keep_endpoints def fit(self, X, y=None): """ @@ -119,10 +177,7 @@ class Landscape(BaseEstimator, TransformerMixin): X (list of n x 2 numpy arrays): input persistence diagrams. y (n x 1 array): persistence diagram labels (unused). """ - if self.nan_in_range.any(): - pre = DiagramScaler(use=True, scalers=[([0], MinMaxScaler()), ([1], MinMaxScaler())]).fit(X,y) - [mx,my],[Mx,My] = [pre.scalers[0][1].data_min_[0], pre.scalers[1][1].data_min_[0]], [pre.scalers[0][1].data_max_[0], pre.scalers[1][1].data_max_[0]] - self.sample_range = np.where(self.nan_in_range, np.array([mx, My]), np.array(self.sample_range)) + _grid_from_sample_range(self, X) return self def transform(self, X): @@ -135,53 +190,26 @@ class Landscape(BaseEstimator, TransformerMixin): Returns: numpy array with shape (number of diagrams) x (number of samples = **num_landscapes** x **resolution**): output persistence landscapes. """ - num_diag, Xfit = len(X), [] - x_values = np.linspace(self.sample_range[0], self.sample_range[1], self.new_resolution) - step_x = x_values[1] - x_values[0] - - for i in range(num_diag): - - diagram, num_pts_in_diag = X[i], X[i].shape[0] - - ls = np.zeros([self.num_landscapes, self.new_resolution]) - - events = [] - for j in range(self.new_resolution): - events.append([]) - - for j in range(num_pts_in_diag): - [px,py] = diagram[j,:2] - min_idx = np.clip(np.ceil((px - self.sample_range[0]) / step_x).astype(int), 0, self.new_resolution) - mid_idx = np.clip(np.ceil((0.5*(py+px) - self.sample_range[0]) / step_x).astype(int), 0, self.new_resolution) - max_idx = np.clip(np.ceil((py - self.sample_range[0]) / step_x).astype(int), 0, self.new_resolution) - - if min_idx < self.new_resolution and max_idx > 0: - - landscape_value = self.sample_range[0] + min_idx * step_x - px - for k in range(min_idx, mid_idx): - events[k].append(landscape_value) - landscape_value += step_x - - landscape_value = py - self.sample_range[0] - mid_idx * step_x - for k in range(mid_idx, max_idx): - events[k].append(landscape_value) - landscape_value -= step_x - - for j in range(self.new_resolution): - events[j].sort(reverse=True) - for k in range( min(self.num_landscapes, len(events[j])) ): - ls[k,j] = events[j][k] - - if self.nan_in_range[0]: - ls = ls[:,1:] - if self.nan_in_range[1]: - ls = ls[:,:-1] - ls = np.sqrt(2)*np.reshape(ls,[1,-1]) - Xfit.append(ls) - Xfit = np.concatenate(Xfit,0) - - return Xfit + Xfit = [] + x_values = self.grid_ + for diag in X: + midpoints, heights = (diag[:, 0] + diag[:, 1]) / 2., (diag[:, 1] - diag[:, 0]) / 2. + tent_functions = np.maximum(heights[None, :] - np.abs(x_values[:, None] - midpoints[None, :]), 0) + n_points = diag.shape[0] + # Complete the array with zeros to get the right number of landscapes + if self.num_landscapes > n_points: + tent_functions = np.concatenate( + [tent_functions, np.zeros((tent_functions.shape[0], self.num_landscapes-n_points))], + axis=1 + ) + tent_functions.partition(tent_functions.shape[1]-self.num_landscapes, axis=1) + landscapes = np.sort(tent_functions[:, -self.num_landscapes:], axis=1)[:, ::-1].T + + landscapes = np.sqrt(2) * np.ravel(landscapes) + Xfit.append(landscapes) + + return np.stack(Xfit, axis=0) def __call__(self, diag): """ @@ -193,13 +221,16 @@ class Landscape(BaseEstimator, TransformerMixin): Returns: numpy array with shape (number of samples = **num_landscapes** x **resolution**): output persistence landscape. """ - return self.fit_transform([diag])[0,:] + return self.fit_transform([diag])[0, :] class Silhouette(BaseEstimator, TransformerMixin): """ This is a class for computing persistence silhouettes from a list of persistence diagrams. A persistence silhouette is computed by taking a weighted average of the collection of 1D piecewise-linear functions given by the persistence landscapes, and then by evenly sampling this average on a given range. Finally, the corresponding vector of samples is returned. See https://arxiv.org/abs/1312.0308 for more details. + + Attributes: + grid_ (1d array): The grid on which the silhouette is computed. """ - def __init__(self, weight=lambda x: 1, resolution=100, sample_range=[np.nan, np.nan]): + def __init__(self, weight=lambda x: 1, resolution=100, sample_range=[np.nan, np.nan], *, keep_endpoints=False): """ Constructor for the Silhouette class. @@ -207,8 +238,10 @@ class Silhouette(BaseEstimator, TransformerMixin): weight (function): weight function for the persistence diagram points (default constant function, ie lambda x: 1). This function must be defined on 2D points, ie on lists or numpy arrays of the form [p_x,p_y]. resolution (int): number of samples for the weighted average (default 100). sample_range ([double, double]): minimum and maximum for the weighted average domain, of the form [x_min, x_max] (default [numpy.nan, numpy.nan]). It is the interval on which samples will be drawn evenly. If one of the values is numpy.nan, it can be computed from the persistence diagrams with the fit() method. + keep_endpoints (bool): when computing `sample_range`, use the exact extremities (where the value is always 0). This is mostly useful for plotting, the default is to use a slightly smaller range. """ self.weight, self.resolution, self.sample_range = weight, resolution, sample_range + self.keep_endpoints = keep_endpoints def fit(self, X, y=None): """ @@ -218,10 +251,7 @@ class Silhouette(BaseEstimator, TransformerMixin): X (list of n x 2 numpy arrays): input persistence diagrams. y (n x 1 array): persistence diagram labels (unused). """ - if np.isnan(np.array(self.sample_range)).any(): - pre = DiagramScaler(use=True, scalers=[([0], MinMaxScaler()), ([1], MinMaxScaler())]).fit(X,y) - [mx,my],[Mx,My] = [pre.scalers[0][1].data_min_[0], pre.scalers[1][1].data_min_[0]], [pre.scalers[0][1].data_max_[0], pre.scalers[1][1].data_max_[0]] - self.sample_range = np.where(np.isnan(np.array(self.sample_range)), np.array([mx, My]), np.array(self.sample_range)) + _grid_from_sample_range(self, X) return self def transform(self, X): @@ -234,44 +264,19 @@ class Silhouette(BaseEstimator, TransformerMixin): Returns: numpy array with shape (number of diagrams) x (**resolution**): output persistence silhouettes. """ - num_diag, Xfit = len(X), [] - x_values = np.linspace(self.sample_range[0], self.sample_range[1], self.resolution) - step_x = x_values[1] - x_values[0] - - for i in range(num_diag): - - diagram, num_pts_in_diag = X[i], X[i].shape[0] + Xfit = [] + x_values = self.grid_ - sh, weights = np.zeros(self.resolution), np.zeros(num_pts_in_diag) - for j in range(num_pts_in_diag): - weights[j] = self.weight(diagram[j,:]) + for diag in X: + midpoints, heights = (diag[:, 0] + diag[:, 1]) / 2., (diag[:, 1] - diag[:, 0]) / 2. + weights = np.array([self.weight(pt) for pt in diag]) total_weight = np.sum(weights) - for j in range(num_pts_in_diag): - - [px,py] = diagram[j,:2] - weight = weights[j] / total_weight - min_idx = np.clip(np.ceil((px - self.sample_range[0]) / step_x).astype(int), 0, self.resolution) - mid_idx = np.clip(np.ceil((0.5*(py+px) - self.sample_range[0]) / step_x).astype(int), 0, self.resolution) - max_idx = np.clip(np.ceil((py - self.sample_range[0]) / step_x).astype(int), 0, self.resolution) - - if min_idx < self.resolution and max_idx > 0: - - silhouette_value = self.sample_range[0] + min_idx * step_x - px - for k in range(min_idx, mid_idx): - sh[k] += weight * silhouette_value - silhouette_value += step_x - - silhouette_value = py - self.sample_range[0] - mid_idx * step_x - for k in range(mid_idx, max_idx): - sh[k] += weight * silhouette_value - silhouette_value -= step_x - - Xfit.append(np.reshape(np.sqrt(2) * sh, [1,-1])) + tent_functions = np.maximum(heights[None, :] - np.abs(x_values[:, None] - midpoints[None, :]), 0) + silhouette = np.sum(weights[None, :] / total_weight * tent_functions, axis=1) + Xfit.append(silhouette * np.sqrt(2)) - Xfit = np.concatenate(Xfit, 0) - - return Xfit + return np.stack(Xfit, axis=0) def __call__(self, diag): """ @@ -285,76 +290,174 @@ class Silhouette(BaseEstimator, TransformerMixin): """ return self.fit_transform([diag])[0,:] + class BettiCurve(BaseEstimator, TransformerMixin): """ - This is a class for computing Betti curves from a list of persistence diagrams. A Betti curve is a 1D piecewise-constant function obtained from the rank function. It is sampled evenly on a given range and the vector of samples is returned. See https://www.researchgate.net/publication/316604237_Time_Series_Classification_via_Topological_Data_Analysis for more details. + Compute Betti curves from persistence diagrams. There are several modes of operation: with a given resolution (with or without a sample_range), with a predefined grid, and with none of the previous. With a predefined grid, the class computes the Betti numbers at those grid points. Without a predefined grid, if the resolution is set to None, it can be fit to a list of persistence diagrams and produce a grid that consists of (at least) the filtration values at which at least one of those persistence diagrams changes Betti numbers, and then compute the Betti numbers at those grid points. In the latter mode, the exact Betti curve is computed for the entire real line. Otherwise, if the resolution is given, the Betti curve is obtained by sampling evenly using either the given sample_range or based on the persistence diagrams. + + Examples + -------- + If pd is a persistence diagram and xs is a nonempty grid of finite values such that xs[0] >= pd.min(), then the results of: + + >>> bc = BettiCurve(predefined_grid=xs) # doctest: +SKIP + >>> result = bc(pd) # doctest: +SKIP + + and + + >>> from scipy.interpolate import interp1d # doctest: +SKIP + >>> bc = BettiCurve(resolution=None, predefined_grid=None) # doctest: +SKIP + >>> bettis = bc.fit_transform([pd]) # doctest: +SKIP + >>> interp = interp1d(bc.grid_, bettis[0, :], kind="previous", fill_value="extrapolate") # doctest: +SKIP + >>> result = np.array(interp(xs), dtype=int) # doctest: +SKIP + + are the same. + + Attributes + ---------- + grid_ : 1d array + The grid on which the Betti numbers are computed. If predefined_grid was specified, `grid_` will always be that grid, independently of data. If not and resolution is None, the grid is fitted to capture all filtration values at which the Betti numbers change. """ - def __init__(self, resolution=100, sample_range=[np.nan, np.nan]): + + def __init__(self, resolution=100, sample_range=[np.nan, np.nan], predefined_grid=None, *, keep_endpoints=False): """ Constructor for the BettiCurve class. Parameters: - resolution (int): number of sample for the piecewise-constant function (default 100). + resolution (int): number of samples for the piecewise-constant function (default 100), or None for the exact curve. sample_range ([double, double]): minimum and maximum of the piecewise-constant function domain, of the form [x_min, x_max] (default [numpy.nan, numpy.nan]). It is the interval on which samples will be drawn evenly. If one of the values is numpy.nan, it can be computed from the persistence diagrams with the fit() method. + predefined_grid (1d array or None, default=None): Predefined filtration grid points at which to compute the Betti curves. Must be strictly ordered. Infinities are ok. If None (default), and resolution is given, the grid will be uniform from x_min to x_max in 'resolution' steps, otherwise a grid will be computed that captures all changes in Betti numbers in the provided data. + keep_endpoints (bool): when computing `sample_range` (fixed `resolution`, no `predefined_grid`), use the exact extremities. This is mostly useful for plotting, the default is to use a slightly smaller range. """ - self.resolution, self.sample_range = resolution, sample_range - def fit(self, X, y=None): + if (predefined_grid is not None) and (not isinstance(predefined_grid, np.ndarray)): + raise ValueError("Expected predefined_grid as array or None.") + + self.predefined_grid = predefined_grid + self.resolution = resolution + self.sample_range = sample_range + self.keep_endpoints = keep_endpoints + + def is_fitted(self): + return hasattr(self, "grid_") + + def fit(self, X, y = None): """ - Fit the BettiCurve class on a list of persistence diagrams: if any of the values in **sample_range** is numpy.nan, replace it with the corresponding value computed on the given list of persistence diagrams. + Fit the BettiCurve class on a list of persistence diagrams: if any of the values in **sample_range** is numpy.nan, replace it with the corresponding value computed on the given list of persistence diagrams. When no predefined grid is provided and resolution set to None, compute a filtration grid that captures all changes in Betti numbers for all the given persistence diagrams. Parameters: - X (list of n x 2 numpy arrays): input persistence diagrams. - y (n x 1 array): persistence diagram labels (unused). + X (list of 2d arrays): Persistence diagrams. + y (None): Ignored. """ - if np.isnan(np.array(self.sample_range)).any(): - pre = DiagramScaler(use=True, scalers=[([0], MinMaxScaler()), ([1], MinMaxScaler())]).fit(X,y) - [mx,my],[Mx,My] = [pre.scalers[0][1].data_min_[0], pre.scalers[1][1].data_min_[0]], [pre.scalers[0][1].data_max_[0], pre.scalers[1][1].data_max_[0]] - self.sample_range = np.where(np.isnan(np.array(self.sample_range)), np.array([mx, My]), np.array(self.sample_range)) + + if self.predefined_grid is None: + if self.resolution is None: # Flexible/exact version + events = np.unique(np.concatenate([pd.flatten() for pd in X] + [[-np.inf]], axis=0)) + self.grid_ = np.array(events) + else: + _grid_from_sample_range(self, X) + else: + self.grid_ = self.predefined_grid # Get the predefined grid from user + return self def transform(self, X): """ - Compute the Betti curve for each persistence diagram individually and concatenate the results. + Compute Betti curves. Parameters: - X (list of n x 2 numpy arrays): input persistence diagrams. - + X (list of 2d arrays): Persistence diagrams. + Returns: - numpy array with shape (number of diagrams) x (**resolution**): output Betti curves. + `len(X).len(self.grid_)` array of ints: Betti numbers of the given persistence diagrams at the grid points given in `self.grid_` """ - Xfit = [] - x_values = np.linspace(self.sample_range[0], self.sample_range[1], self.resolution) - step_x = x_values[1] - x_values[0] - for diagram in X: - diagram_int = np.clip(np.ceil((diagram[:,:2] - self.sample_range[0]) / step_x), 0, self.resolution).astype(int) - bc = np.zeros(self.resolution) - for interval in diagram_int: - bc[interval[0]:interval[1]] += 1 - Xfit.append(np.reshape(bc,[1,-1])) + if not self.is_fitted(): + raise NotFittedError("Not fitted.") - Xfit = np.concatenate(Xfit, 0) + if not X: + X = [np.zeros((0, 2))] + + N = len(X) - return Xfit + events = np.concatenate([pd.flatten(order="F") for pd in X], axis=0) + sorting = np.argsort(events) + offsets = np.zeros(1 + N, dtype=int) + for i in range(0, N): + offsets[i+1] = offsets[i] + 2*X[i].shape[0] + starts = offsets[0:N] + ends = offsets[1:N + 1] - 1 - def __call__(self, diag): + bettis = [[0] for i in range(0, N)] + + i = 0 + for x in self.grid_: + while i < len(sorting) and events[sorting[i]] <= x: + j = np.searchsorted(ends, sorting[i]) + delta = 1 if sorting[i] - starts[j] < len(X[j]) else -1 + bettis[j][-1] += delta + i += 1 + for k in range(0, N): + bettis[k].append(bettis[k][-1]) + + return np.array(bettis, dtype=int)[:, 0:-1] + + def fit_transform(self, X): + """ + The result is the same as fit(X) followed by transform(X), but potentially faster. """ - Apply BettiCurve on a single persistence diagram and outputs the result. - Parameters: - diag (n x 2 numpy array): input persistence diagram. + if self.predefined_grid is None and self.resolution is None: + if not X: + X = [np.zeros((0, 2))] - Returns: - numpy array with shape (**resolution**): output Betti curve. + N = len(X) + + events = np.concatenate([pd.flatten(order="F") for pd in X], axis=0) + sorting = np.argsort(events) + offsets = np.zeros(1 + N, dtype=int) + for i in range(0, N): + offsets[i+1] = offsets[i] + 2*X[i].shape[0] + starts = offsets[0:N] + ends = offsets[1:N + 1] - 1 + + xs = [-np.inf] + bettis = [[0] for i in range(0, N)] + + for i in sorting: + j = np.searchsorted(ends, i) + delta = 1 if i - starts[j] < len(X[j]) else -1 + if events[i] == xs[-1]: + bettis[j][-1] += delta + else: + xs.append(events[i]) + for k in range(0, j): + bettis[k].append(bettis[k][-1]) + bettis[j].append(bettis[j][-1] + delta) + for k in range(j+1, N): + bettis[k].append(bettis[k][-1]) + + self.grid_ = np.array(xs) + return np.array(bettis, dtype=int) + + else: + return self.fit(X).transform(X) + + def __call__(self, diag): """ - return self.fit_transform([diag])[0,:] + Shorthand for transform on a single persistence diagram. + """ + return self.fit_transform([diag])[0, :] + + class Entropy(BaseEstimator, TransformerMixin): """ This is a class for computing persistence entropy. Persistence entropy is a statistic for persistence diagrams inspired from Shannon entropy. This statistic can also be used to compute a feature vector, called the entropy summary function. See https://arxiv.org/pdf/1803.08304.pdf for more details. Note that a previous implementation was contributed by Manuel Soriano-Trigueros. + + Attributes: + grid_ (1d array): In vector mode, the grid on which the entropy summary function is computed. """ - def __init__(self, mode="scalar", normalized=True, resolution=100, sample_range=[np.nan, np.nan]): + def __init__(self, mode="scalar", normalized=True, resolution=100, sample_range=[np.nan, np.nan], *, keep_endpoints=False): """ Constructor for the Entropy class. @@ -363,8 +466,10 @@ class Entropy(BaseEstimator, TransformerMixin): normalized (bool): whether to normalize the entropy summary function (default True). Used only if **mode** = "vector". resolution (int): number of sample for the entropy summary function (default 100). Used only if **mode** = "vector". sample_range ([double, double]): minimum and maximum of the entropy summary function domain, of the form [x_min, x_max] (default [numpy.nan, numpy.nan]). It is the interval on which samples will be drawn evenly. If one of the values is numpy.nan, it can be computed from the persistence diagrams with the fit() method. Used only if **mode** = "vector". + keep_endpoints (bool): when computing `sample_range`, use the exact extremities. This is mostly useful for plotting, the default is to use a slightly smaller range. """ self.mode, self.normalized, self.resolution, self.sample_range = mode, normalized, resolution, sample_range + self.keep_endpoints = keep_endpoints def fit(self, X, y=None): """ @@ -374,10 +479,9 @@ class Entropy(BaseEstimator, TransformerMixin): X (list of n x 2 numpy arrays): input persistence diagrams. y (n x 1 array): persistence diagram labels (unused). """ - if np.isnan(np.array(self.sample_range)).any(): - pre = DiagramScaler(use=True, scalers=[([0], MinMaxScaler()), ([1], MinMaxScaler())]).fit(X,y) - [mx,my],[Mx,My] = [pre.scalers[0][1].data_min_[0], pre.scalers[1][1].data_min_[0]], [pre.scalers[0][1].data_max_[0], pre.scalers[1][1].data_max_[0]] - self.sample_range = np.where(np.isnan(np.array(self.sample_range)), np.array([mx, My]), np.array(self.sample_range)) + if self.mode == "vector": + _grid_from_sample_range(self, X) + self.step_ = self.grid_[1] - self.grid_[0] return self def transform(self, X): @@ -391,33 +495,28 @@ class Entropy(BaseEstimator, TransformerMixin): numpy array with shape (number of diagrams) x (1 if **mode** = "scalar" else **resolution**): output entropy. """ num_diag, Xfit = len(X), [] - x_values = np.linspace(self.sample_range[0], self.sample_range[1], self.resolution) - step_x = x_values[1] - x_values[0] new_X = BirthPersistenceTransform().fit_transform(X) for i in range(num_diag): - - orig_diagram, diagram, num_pts_in_diag = X[i], new_X[i], X[i].shape[0] - new_diagram = DiagramScaler(use=True, scalers=[([1], MaxAbsScaler())]).fit_transform([diagram])[0] - + orig_diagram, new_diagram, num_pts_in_diag = X[i], new_X[i], X[i].shape[0] + + p = new_diagram[:,1] + p = p/np.sum(p) if self.mode == "scalar": - ent = - np.sum( np.multiply(new_diagram[:,1], np.log(new_diagram[:,1])) ) + ent = -np.dot(p, np.log(p)) Xfit.append(np.array([[ent]])) - else: ent = np.zeros(self.resolution) for j in range(num_pts_in_diag): [px,py] = orig_diagram[j,:2] - min_idx = np.clip(np.ceil((px - self.sample_range[0]) / step_x).astype(int), 0, self.resolution) - max_idx = np.clip(np.ceil((py - self.sample_range[0]) / step_x).astype(int), 0, self.resolution) - for k in range(min_idx, max_idx): - ent[k] += (-1) * new_diagram[j,1] * np.log(new_diagram[j,1]) - if self.normalized: - ent = ent / np.linalg.norm(ent, ord=1) - Xfit.append(np.reshape(ent,[1,-1])) - - Xfit = np.concatenate(Xfit, 0) - + min_idx = np.clip(np.ceil((px - self.sample_range_fixed[0]) / self.step_).astype(int), 0, self.resolution) + max_idx = np.clip(np.ceil((py - self.sample_range_fixed[0]) / self.step_).astype(int), 0, self.resolution) + ent[min_idx:max_idx]-=p[j]*np.log(p[j]) + if self.normalized: + ent = ent / np.linalg.norm(ent, ord=1) + Xfit.append(np.reshape(ent,[1,-1])) + + Xfit = np.concatenate(Xfit, axis=0) return Xfit def __call__(self, diag): @@ -478,7 +577,13 @@ class TopologicalVector(BaseEstimator, TransformerMixin): diagram, num_pts_in_diag = X[i], X[i].shape[0] pers = 0.5 * (diagram[:,1]-diagram[:,0]) min_pers = np.minimum(pers,np.transpose(pers)) - distances = DistanceMetric.get_metric("chebyshev").pairwise(diagram) + # Works fine with sklearn 1.0, but an ValueError exception is thrown on past versions + try: + distances = DistanceMetric.get_metric("chebyshev").pairwise(diagram) + except ValueError: + # Empty persistence diagram case - https://github.com/GUDHI/gudhi-devel/issues/507 + assert len(diagram) == 0 + distances = np.empty(shape = [0, 0]) vect = np.flip(np.sort(np.triu(np.minimum(distances, min_pers)), axis=None), 0) dim = min(len(vect), thresh) Xfit[i, :dim] = vect[:dim] @@ -605,17 +710,17 @@ class Atol(BaseEstimator, TransformerMixin): >>> b = np.array([[4, 2, 0], [4, 4, 0], [4, 0, 2]]) >>> c = np.array([[3, 2, -1], [1, 2, -1]]) >>> atol_vectoriser = Atol(quantiser=KMeans(n_clusters=2, random_state=202006)) - >>> atol_vectoriser.fit(X=[a, b, c]).centers # doctest: +SKIP - >>> # array([[ 2. , 0.66666667, 3.33333333], - >>> # [ 2.6 , 2.8 , -0.4 ]]) + >>> atol_vectoriser.fit(X=[a, b, c]).centers + array([[ 2.6 , 2.8 , -0.4 ], + [ 2. , 0.66666667, 3.33333333]]) >>> atol_vectoriser(a) - >>> # array([1.18168665, 0.42375966]) # doctest: +SKIP + array([0.42375966, 1.18168665]) >>> atol_vectoriser(c) - >>> # array([0.02062512, 1.25157463]) # doctest: +SKIP - >>> atol_vectoriser.transform(X=[a, b, c]) # doctest: +SKIP - >>> # array([[1.18168665, 0.42375966], - >>> # [0.29861028, 1.06330156], - >>> # [0.02062512, 1.25157463]]) + array([1.25157463, 0.02062512]) + >>> atol_vectoriser.transform(X=[a, b, c]) + array([[0.42375966, 1.18168665], + [1.06330156, 0.29861028], + [1.25157463, 0.02062512]]) """ # Note the example above must be up to date with the one in tests called test_atol_doc def __init__(self, quantiser, weighting_method="cloud", contrast="gaussian"): @@ -666,6 +771,8 @@ class Atol(BaseEstimator, TransformerMixin): measures_concat = np.concatenate(X) self.quantiser.fit(X=measures_concat, sample_weight=sample_weight) self.centers = self.quantiser.cluster_centers_ + # Hack, but some people are unhappy if the order depends on the version of sklearn + self.centers = self.centers[np.lexsort(self.centers.T)] if self.quantiser.n_clusters == 1: dist_centers = pairwise.pairwise_distances(measures_concat) np.fill_diagonal(dist_centers, 0) diff --git a/src/python/gudhi/rips_complex.pyx b/src/python/gudhi/rips_complex.pyx index c3470292..d748f91e 100644 --- a/src/python/gudhi/rips_complex.pyx +++ b/src/python/gudhi/rips_complex.pyx @@ -41,31 +41,30 @@ cdef class RipsComplex: cdef Rips_complex_interface thisref # Fake constructor that does nothing but documenting the constructor - def __init__(self, points=None, distance_matrix=None, + def __init__(self, *, points=None, distance_matrix=None, max_edge_length=float('inf'), sparse=None): """RipsComplex constructor. - :param max_edge_length: Rips value. - :type max_edge_length: float - :param points: A list of points in d-Dimension. - :type points: list of list of float + :type points: List[List[float]] Or :param distance_matrix: A distance matrix (full square or lower triangular). - :type points: list of list of float + :type distance_matrix: List[List[float]] And in both cases + :param max_edge_length: Rips value. + :type max_edge_length: float :param sparse: If this is not None, it switches to building a sparse Rips and represents the approximation parameter epsilon. :type sparse: float """ # The real cython constructor - def __cinit__(self, points=None, distance_matrix=None, + def __cinit__(self, *, points=None, distance_matrix=None, max_edge_length=float('inf'), sparse=None): if sparse is not None: if distance_matrix is not None: diff --git a/src/python/gudhi/simplex_tree.pxd b/src/python/gudhi/simplex_tree.pxd index 000323af..5309c6fa 100644 --- a/src/python/gudhi/simplex_tree.pxd +++ b/src/python/gudhi/simplex_tree.pxd @@ -44,7 +44,8 @@ cdef extern from "Simplex_tree_interface.h" namespace "Gudhi": cdef cppclass Simplex_tree_interface_full_featured "Gudhi::Simplex_tree_interface<Gudhi::Simplex_tree_options_full_featured>": - Simplex_tree() nogil + Simplex_tree_interface_full_featured() nogil + Simplex_tree_interface_full_featured(Simplex_tree_interface_full_featured&) nogil double simplex_filtration(vector[int] simplex) nogil void assign_simplex_filtration(vector[int] simplex, double filtration) nogil void initialize_filtration() nogil @@ -55,6 +56,8 @@ cdef extern from "Simplex_tree_interface.h" namespace "Gudhi": int upper_bound_dimension() nogil bool find_simplex(vector[int] simplex) nogil bool insert(vector[int] simplex, double filtration) nogil + void insert_matrix(double* filtrations, int n, int stride0, int stride1, double max_filtration) nogil except + + void insert_batch_vertices(vector[int] v, double f) nogil except + vector[pair[vector[int], double]] get_star(vector[int] simplex) nogil vector[pair[vector[int], double]] get_cofaces(vector[int] simplex, int dimension) nogil void expansion(int max_dim) nogil except + @@ -62,9 +65,9 @@ cdef extern from "Simplex_tree_interface.h" namespace "Gudhi": bool prune_above_filtration(double filtration) nogil bool make_filtration_non_decreasing() nogil void compute_extended_filtration() nogil - vector[vector[pair[int, pair[double, double]]]] compute_extended_persistence_subdiagrams(vector[pair[int, pair[double, double]]] dgm, double min_persistence) nogil Simplex_tree_interface_full_featured* collapse_edges(int nb_collapse_iteration) nogil except + void reset_filtration(double filtration, int dimension) nogil + bint operator==(Simplex_tree_interface_full_featured) nogil # Iterators over Simplex tree pair[vector[int], double] get_simplex_and_filtration(Simplex_tree_simplex_handle f_simplex) nogil Simplex_tree_simplices_iterator get_simplices_iterator_begin() nogil @@ -74,11 +77,14 @@ cdef extern from "Simplex_tree_interface.h" namespace "Gudhi": Simplex_tree_skeleton_iterator get_skeleton_iterator_begin(int dimension) nogil Simplex_tree_skeleton_iterator get_skeleton_iterator_end(int dimension) nogil pair[Simplex_tree_boundary_iterator, Simplex_tree_boundary_iterator] get_boundary_iterators(vector[int] simplex) nogil except + + # Expansion with blockers + ctypedef bool (*blocker_func_t)(vector[int], void *user_data) + void expansion_with_blockers_callback(int dimension, blocker_func_t user_func, void *user_data) cdef extern from "Persistent_cohomology_interface.h" namespace "Gudhi": - cdef cppclass Simplex_tree_persistence_interface "Gudhi::Persistent_cohomology_interface<Gudhi::Simplex_tree<Gudhi::Simplex_tree_options_full_featured>>": + cdef cppclass Simplex_tree_persistence_interface "Gudhi::Persistent_cohomology_interface<Gudhi::Simplex_tree_interface<Gudhi::Simplex_tree_options_full_featured>>": Simplex_tree_persistence_interface(Simplex_tree_interface_full_featured * st, bool persistence_dim_max) nogil - void compute_persistence(int homology_coeff_field, double min_persistence) nogil + void compute_persistence(int homology_coeff_field, double min_persistence) nogil except + vector[pair[int, pair[double, double]]] get_persistence() nogil vector[int] betti_numbers() nogil vector[int] persistent_betti_numbers(double from_value, double to_value) nogil @@ -87,3 +93,4 @@ cdef extern from "Persistent_cohomology_interface.h" namespace "Gudhi": vector[pair[vector[int], vector[int]]] persistence_pairs() nogil pair[vector[vector[int]], vector[vector[int]]] lower_star_generators() nogil pair[vector[vector[int]], vector[vector[int]]] flag_generators() nogil + vector[vector[pair[int, pair[double, double]]]] compute_extended_persistence_subdiagrams(double min_persistence) nogil diff --git a/src/python/gudhi/simplex_tree.pyx b/src/python/gudhi/simplex_tree.pyx index d7991417..4cf176f5 100644 --- a/src/python/gudhi/simplex_tree.pyx +++ b/src/python/gudhi/simplex_tree.pyx @@ -8,15 +8,27 @@ # - YYYY/MM Author: Description of the modification from cython.operator import dereference, preincrement -from libc.stdint cimport intptr_t -import numpy -from numpy import array as np_array -cimport simplex_tree +from libc.stdint cimport intptr_t, int32_t, int64_t +import numpy as np +cimport gudhi.simplex_tree +cimport cython +from numpy.math cimport INFINITY __author__ = "Vincent Rouvreau" __copyright__ = "Copyright (C) 2016 Inria" __license__ = "MIT" +ctypedef fused some_int: + int32_t + int64_t + +ctypedef fused some_float: + float + double + +cdef bool callback(vector[int] simplex, void *blocker_func): + return (<object>blocker_func)(simplex) + # SimplexTree python interface cdef class SimplexTree: """The simplex tree is an efficient and flexible data structure for @@ -39,13 +51,29 @@ cdef class SimplexTree: cdef Simplex_tree_persistence_interface * pcohptr # Fake constructor that does nothing but documenting the constructor - def __init__(self): + def __init__(self, other = None): """SimplexTree constructor. + + :param other: If `other` is `None` (default value), an empty `SimplexTree` is created. + If `other` is a `SimplexTree`, the `SimplexTree` is constructed from a deep copy of `other`. + :type other: SimplexTree (Optional) + :returns: An empty or a copy simplex tree. + :rtype: SimplexTree + + :raises TypeError: In case `other` is neither `None`, nor a `SimplexTree`. + :note: If the `SimplexTree` is a copy, the persistence information is not copied. If you need it in the clone, + you have to call :func:`compute_persistence` on it even if you had already computed it in the original. """ # The real cython constructor - def __cinit__(self): - self.thisptr = <intptr_t>(new Simplex_tree_interface_full_featured()) + def __cinit__(self, other = None): + if other: + if isinstance(other, SimplexTree): + self.thisptr = _get_copy_intptr(other) + else: + raise TypeError("`other` argument requires to be of type `SimplexTree`, or `None`.") + else: + self.thisptr = <intptr_t>(new Simplex_tree_interface_full_featured()) def __dealloc__(self): cdef Simplex_tree_interface_full_featured* ptr = self.get_ptr() @@ -64,6 +92,21 @@ cdef class SimplexTree: """ return self.pcohptr != NULL + def copy(self): + """ + :returns: A simplex tree that is a deep copy of itself. + :rtype: SimplexTree + + :note: The persistence information is not copied. If you need it in the clone, you have to call + :func:`compute_persistence` on it even if you had already computed it in the original. + """ + stree = SimplexTree() + stree.thisptr = _get_copy_intptr(self) + return stree + + def __deepcopy__(self): + return self.copy() + def filtration(self, simplex): """This function returns the filtration value for a given N-simplex in this simplicial complex, or +infinity if it is not in the complex. @@ -195,6 +238,91 @@ cdef class SimplexTree: """ return self.get_ptr().insert(simplex, <double>filtration) + @staticmethod + @cython.boundscheck(False) + def create_from_array(filtrations, double max_filtration=INFINITY): + """Creates a new, empty complex and inserts vertices and edges. The vertices are numbered from 0 to n-1, and + the filtration values are encoded in the array, with the diagonal representing the vertices. It is the + caller's responsibility to ensure that this defines a filtration, which can be achieved with either:: + + filtrations[np.diag_indices_from(filtrations)] = filtrations.min(axis=1) + + or:: + + diag = filtrations.diagonal() + filtrations = np.fmax(np.fmax(filtrations, diag[:, None]), diag[None, :]) + + :param filtrations: the filtration values of the vertices and edges to insert. The matrix is assumed to be symmetric. + :type filtrations: numpy.ndarray of shape (n,n) + :param max_filtration: only insert vertices and edges with filtration values no larger than max_filtration + :type max_filtration: float + :returns: the new complex + :rtype: SimplexTree + """ + # TODO: document which half of the matrix is actually read? + filtrations = np.asanyarray(filtrations, dtype=float) + cdef double[:,:] F = filtrations + ret = SimplexTree() + cdef int n = F.shape[0] + assert n == F.shape[1], 'create_from_array() expects a square array' + with nogil: + ret.get_ptr().insert_matrix(&F[0,0], n, F.strides[0], F.strides[1], max_filtration) + return ret + + def insert_edges_from_coo_matrix(self, edges): + """Inserts edges given by a sparse matrix in `COOrdinate format + <https://docs.scipy.org/doc/scipy/reference/generated/scipy.sparse.coo_matrix.html>`_. + If an edge is repeated, the smallest filtration value is used. Missing entries are not inserted. + Diagonal entries are currently interpreted as vertices, although we do not guarantee this behavior + in the future, and this is only useful if you want to insert vertices with a smaller filtration value + than the smallest edge containing it, since vertices are implicitly inserted together with the edges. + + :param edges: the edges to insert and their filtration values. + :type edges: scipy.sparse.coo_matrix of shape (n,n) + + .. seealso:: :func:`insert_batch` + """ + # Without this, it could be slow if we end up inserting vertices in a bad order (flat_map). + self.get_ptr().insert_batch_vertices(np.unique(np.stack((edges.row, edges.col))), INFINITY) + # TODO: optimize this? + for edge in zip(edges.row, edges.col, edges.data): + self.get_ptr().insert((edge[0], edge[1]), edge[2]) + + @cython.boundscheck(False) + @cython.wraparound(False) + def insert_batch(self, some_int[:,:] vertex_array, some_float[:] filtrations): + """Inserts k-simplices given by a sparse array in a format similar + to `torch.sparse <https://pytorch.org/docs/stable/sparse.html>`_. + The n-th simplex has vertices `vertex_array[0,n]`, ..., + `vertex_array[k,n]` and filtration value `filtrations[n]`. + If a simplex is repeated, the smallest filtration value is used. + Simplices with a repeated vertex are currently interpreted as lower + dimensional simplices, but we do not guarantee this behavior in the + future. Any time a simplex is inserted, its faces are inserted as well + if needed to preserve a simplicial complex. + + :param vertex_array: the k-simplices to insert. + :type vertex_array: numpy.array of shape (k+1,n) + :param filtrations: the filtration values. + :type filtrations: numpy.array of shape (n,) + """ + cdef vector[int] vertices = np.unique(vertex_array) + cdef Py_ssize_t k = vertex_array.shape[0] + cdef Py_ssize_t n = vertex_array.shape[1] + assert filtrations.shape[0] == n, 'inconsistent sizes for vertex_array and filtrations' + cdef Py_ssize_t i + cdef Py_ssize_t j + cdef vector[int] v + with nogil: + # Without this, it could be slow if we end up inserting vertices in a bad order (flat_map). + # NaN currently does the wrong thing + self.get_ptr().insert_batch_vertices(vertices, INFINITY) + for i in range(n): + for j in range(k): + v.push_back(vertex_array[j, i]) + self.get_ptr().insert(v, filtrations[i]) + v.clear() + def get_simplices(self): """This function returns a generator with simplices and their given filtration values. @@ -343,7 +471,7 @@ cdef class SimplexTree: """ return self.get_ptr().prune_above_filtration(filtration) - def expansion(self, max_dim): + def expansion(self, max_dimension): """Expands the simplex tree containing only its one skeleton until dimension max_dim. @@ -357,10 +485,10 @@ cdef class SimplexTree: The simplex tree must contain no simplex of dimension bigger than 1 when calling the method. - :param max_dim: The maximal dimension. - :type max_dim: int + :param max_dimension: The maximal dimension. + :type max_dimension: int """ - cdef int maxdim = max_dim + cdef int maxdim = max_dimension with nogil: self.get_ptr().expansion(maxdim) @@ -412,7 +540,7 @@ cdef class SimplexTree: """This function retrieves good values for extended persistence, and separate the diagrams into the Ordinary, Relative, Extended+ and Extended- subdiagrams. - :param homology_coeff_field: The homology coefficient field. Must be a prime number. Default value is 11. + :param homology_coeff_field: The homology coefficient field. Must be a prime number. Default value is 11. Max is 46337. :type homology_coeff_field: int :param min_persistence: The minimum persistence value (i.e., the absolute value of the difference between the persistence diagram point coordinates) to take into account (strictly greater than min_persistence). @@ -441,15 +569,35 @@ cdef class SimplexTree: del self.pcohptr self.pcohptr = new Simplex_tree_persistence_interface(self.get_ptr(), False) self.pcohptr.compute_persistence(homology_coeff_field, -1.) - persistence_result = self.pcohptr.get_persistence() - return self.get_ptr().compute_extended_persistence_subdiagrams(persistence_result, min_persistence) + return self.pcohptr.compute_extended_persistence_subdiagrams(min_persistence) + + def expansion_with_blocker(self, max_dim, blocker_func): + """Expands the Simplex_tree containing only a graph. Simplices corresponding to cliques in the graph are added + incrementally, faces before cofaces, unless the simplex has dimension larger than `max_dim` or `blocker_func` + returns `True` for this simplex. + + The function identifies a candidate simplex whose faces are all already in the complex, inserts it with a + filtration value corresponding to the maximum of the filtration values of the faces, then calls `blocker_func` + with this new simplex (represented as a list of int). If `blocker_func` returns `True`, the simplex is removed, + otherwise it is kept. The algorithm then proceeds with the next candidate. + .. warning:: + Several candidates of the same dimension may be inserted simultaneously before calling `blocker_func`, so + if you examine the complex in `blocker_func`, you may hit a few simplices of the same dimension that have + not been vetted by `blocker_func` yet, or have already been rejected but not yet removed. + + :param max_dim: Expansion maximal dimension value. + :type max_dim: int + :param blocker_func: Blocker oracle. + :type blocker_func: Callable[[List[int]], bool] + """ + self.get_ptr().expansion_with_blockers_callback(max_dim, callback, <void*>blocker_func) def persistence(self, homology_coeff_field=11, min_persistence=0, persistence_dim_max = False): """This function computes and returns the persistence of the simplicial complex. :param homology_coeff_field: The homology coefficient field. Must be a - prime number. Default value is 11. + prime number. Default value is 11. Max is 46337. :type homology_coeff_field: int :param min_persistence: The minimum persistence value to take into account (strictly greater than min_persistence). Default value is @@ -472,7 +620,7 @@ cdef class SimplexTree: when you do not want the list :func:`persistence` returns. :param homology_coeff_field: The homology coefficient field. Must be a - prime number. Default value is 11. + prime number. Default value is 11. Max is 46337. :type homology_coeff_field: int :param min_persistence: The minimum persistence value to take into account (strictly greater than min_persistence). Default value is @@ -542,7 +690,11 @@ cdef class SimplexTree: function to be launched first. """ assert self.pcohptr != NULL, "compute_persistence() must be called before persistence_intervals_in_dimension()" - return np_array(self.pcohptr.intervals_in_dimension(dimension)) + piid = np.array(self.pcohptr.intervals_in_dimension(dimension)) + # Workaround https://github.com/GUDHI/gudhi-devel/issues/507 + if len(piid) == 0: + return np.empty(shape = [0, 2]) + return piid def persistence_pairs(self): """This function returns a list of persistence birth and death simplices pairs. @@ -583,8 +735,8 @@ cdef class SimplexTree: """ assert self.pcohptr != NULL, "lower_star_persistence_generators() requires that persistence() be called first." gen = self.pcohptr.lower_star_generators() - normal = [np_array(d).reshape(-1,2) for d in gen.first] - infinite = [np_array(d) for d in gen.second] + normal = [np.array(d).reshape(-1,2) for d in gen.first] + infinite = [np.array(d) for d in gen.second] return (normal, infinite) def flag_persistence_generators(self): @@ -602,34 +754,33 @@ cdef class SimplexTree: assert self.pcohptr != NULL, "flag_persistence_generators() requires that persistence() be called first." gen = self.pcohptr.flag_generators() if len(gen.first) == 0: - normal0 = numpy.empty((0,3)) + normal0 = np.empty((0,3)) normals = [] else: l = iter(gen.first) - normal0 = np_array(next(l)).reshape(-1,3) - normals = [np_array(d).reshape(-1,4) for d in l] + normal0 = np.array(next(l)).reshape(-1,3) + normals = [np.array(d).reshape(-1,4) for d in l] if len(gen.second) == 0: - infinite0 = numpy.empty(0) + infinite0 = np.empty(0) infinites = [] else: l = iter(gen.second) - infinite0 = np_array(next(l)) - infinites = [np_array(d).reshape(-1,2) for d in l] + infinite0 = np.array(next(l)) + infinites = [np.array(d).reshape(-1,2) for d in l] return (normal0, normals, infinite0, infinites) def collapse_edges(self, nb_iterations = 1): - """Assuming the simplex tree is a 1-skeleton graph, this method collapse edges (simplices of higher dimension - are ignored) and resets the simplex tree from the remaining edges. - A good candidate is to build a simplex tree on top of a :class:`~gudhi.RipsComplex` of dimension 1 before - collapsing edges + """Assuming the complex is a graph (simplices of higher dimension are ignored), this method implicitly + interprets it as the 1-skeleton of a flag complex, and replaces it with another (smaller) graph whose + expansion has the same persistent homology, using a technique known as edge collapses + (see :cite:`edgecollapsearxiv`). + + A natural application is to get a simplex tree of dimension 1 from :class:`~gudhi.RipsComplex`, + then collapse edges, perform :meth:`expansion()` and finally compute persistence (cf. :download:`rips_complex_edge_collapse_example.py <../example/rips_complex_edge_collapse_example.py>`). - For implementation details, please refer to :cite:`edgecollapsesocg2020`. :param nb_iterations: The number of edge collapse iterations to perform. Default is 1. :type nb_iterations: int - - :note: collapse_edges method requires `Eigen <installation.html#eigen>`_ >= 3.1.0 and an exception is thrown - if this method is not available. """ # Backup old pointer cdef Simplex_tree_interface_full_featured* ptr = self.get_ptr() @@ -639,3 +790,13 @@ cdef class SimplexTree: self.thisptr = <intptr_t>(ptr.collapse_edges(nb_iter)) # Delete old pointer del ptr + + def __eq__(self, other:SimplexTree): + """Test for structural equality + :returns: True if the 2 simplex trees are equal, False otherwise. + :rtype: bool + """ + return dereference(self.get_ptr()) == dereference(other.get_ptr()) + +cdef intptr_t _get_copy_intptr(SimplexTree stree) nogil: + return <intptr_t>(new Simplex_tree_interface_full_featured(dereference(stree.get_ptr()))) diff --git a/src/python/gudhi/sklearn/__init__.py b/src/python/gudhi/sklearn/__init__.py new file mode 100644 index 00000000..e69de29b --- /dev/null +++ b/src/python/gudhi/sklearn/__init__.py diff --git a/src/python/gudhi/sklearn/cubical_persistence.py b/src/python/gudhi/sklearn/cubical_persistence.py new file mode 100644 index 00000000..672af278 --- /dev/null +++ b/src/python/gudhi/sklearn/cubical_persistence.py @@ -0,0 +1,110 @@ +# This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. +# See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. +# Author(s): Vincent Rouvreau +# +# Copyright (C) 2021 Inria +# +# Modification(s): +# - YYYY/MM Author: Description of the modification + +from .. import CubicalComplex +from sklearn.base import BaseEstimator, TransformerMixin + +import numpy as np +# joblib is required by scikit-learn +from joblib import Parallel, delayed + +# Mermaid sequence diagram - https://mermaid-js.github.io/mermaid-live-editor/ +# sequenceDiagram +# USER->>CubicalPersistence: fit_transform(X) +# CubicalPersistence->>thread1: _tranform(X[0]) +# CubicalPersistence->>thread2: _tranform(X[1]) +# Note right of CubicalPersistence: ... +# thread1->>CubicalPersistence: [array( H0(X[0]) ), array( H1(X[0]) )] +# thread2->>CubicalPersistence: [array( H0(X[1]) ), array( H1(X[1]) )] +# Note right of CubicalPersistence: ... +# CubicalPersistence->>USER: [[array( H0(X[0]) ), array( H1(X[0]) )],<br/> [array( H0(X[1]) ), array( H1(X[1]) )],<br/> ...] + + +class CubicalPersistence(BaseEstimator, TransformerMixin): + """ + This is a class for computing the persistence diagrams from a cubical complex. + """ + + def __init__( + self, + homology_dimensions, + newshape=None, + homology_coeff_field=11, + min_persistence=0.0, + n_jobs=None, + ): + """ + Constructor for the CubicalPersistence class. + + Parameters: + homology_dimensions (int or list of int): The returned persistence diagrams dimension(s). + Short circuit the use of :class:`~gudhi.representations.preprocessing.DimensionSelector` when only one + dimension matters (in other words, when `homology_dimensions` is an int). + newshape (tuple of ints): If cells filtration values require to be reshaped + (cf. :func:`~gudhi.sklearn.cubical_persistence.CubicalPersistence.transform`), set `newshape` + to perform `numpy.reshape(X, newshape, order='C')` in + :func:`~gudhi.sklearn.cubical_persistence.CubicalPersistence.transform` method. + homology_coeff_field (int): The homology coefficient field. Must be a prime number. Default value is 11. + min_persistence (float): The minimum persistence value to take into account (strictly greater than + `min_persistence`). Default value is `0.0`. Set `min_persistence` to `-1.0` to see all values. + n_jobs (int): cf. https://joblib.readthedocs.io/en/latest/generated/joblib.Parallel.html + """ + self.homology_dimensions = homology_dimensions + self.newshape = newshape + self.homology_coeff_field = homology_coeff_field + self.min_persistence = min_persistence + self.n_jobs = n_jobs + + def fit(self, X, Y=None): + """ + Nothing to be done, but useful when included in a scikit-learn Pipeline. + """ + return self + + def __transform(self, cells): + cubical_complex = CubicalComplex(top_dimensional_cells=cells) + cubical_complex.compute_persistence( + homology_coeff_field=self.homology_coeff_field, min_persistence=self.min_persistence + ) + return [ + cubical_complex.persistence_intervals_in_dimension(dim) for dim in self.homology_dimensions + ] + + def __transform_only_this_dim(self, cells): + cubical_complex = CubicalComplex(top_dimensional_cells=cells) + cubical_complex.compute_persistence( + homology_coeff_field=self.homology_coeff_field, min_persistence=self.min_persistence + ) + return cubical_complex.persistence_intervals_in_dimension(self.homology_dimensions) + + def transform(self, X, Y=None): + """Compute all the cubical complexes and their associated persistence diagrams. + + :param X: List of cells filtration values (`numpy.reshape(X, newshape, order='C'` if `newshape` is set with a tuple of ints). + :type X: list of list of float OR list of numpy.ndarray + + :return: Persistence diagrams in the format: + + - If `homology_dimensions` was set to `n`: `[array( Hn(X[0]) ), array( Hn(X[1]) ), ...]` + - If `homology_dimensions` was set to `[i, j]`: `[[array( Hi(X[0]) ), array( Hj(X[0]) )], [array( Hi(X[1]) ), array( Hj(X[1]) )], ...]` + :rtype: list of (,2) array_like or list of list of (,2) array_like + """ + if self.newshape is not None: + X = np.reshape(X, self.newshape, order='C') + + # Depends on homology_dimensions is an integer or a list of integer (else case) + if isinstance(self.homology_dimensions, int): + # threads is preferred as cubical construction and persistence computation releases the GIL + return Parallel(n_jobs=self.n_jobs, prefer="threads")( + delayed(self.__transform_only_this_dim)(cells) for cells in X + ) + else: + # threads is preferred as cubical construction and persistence computation releases the GIL + return Parallel(n_jobs=self.n_jobs, prefer="threads")(delayed(self.__transform)(cells) for cells in X) + diff --git a/src/python/gudhi/tensorflow/__init__.py b/src/python/gudhi/tensorflow/__init__.py new file mode 100644 index 00000000..1599cf52 --- /dev/null +++ b/src/python/gudhi/tensorflow/__init__.py @@ -0,0 +1,5 @@ +from .cubical_layer import CubicalLayer +from .lower_star_simplex_tree_layer import LowerStarSimplexTreeLayer +from .rips_layer import RipsLayer + +__all__ = ["LowerStarSimplexTreeLayer", "RipsLayer", "CubicalLayer"] diff --git a/src/python/gudhi/tensorflow/cubical_layer.py b/src/python/gudhi/tensorflow/cubical_layer.py new file mode 100644 index 00000000..5df2c370 --- /dev/null +++ b/src/python/gudhi/tensorflow/cubical_layer.py @@ -0,0 +1,82 @@ +import numpy as np +import tensorflow as tf +from ..cubical_complex import CubicalComplex + +###################### +# Cubical filtration # +###################### + +# The parameters of the model are the pixel values. + +def _Cubical(Xflat, Xdim, dimensions, homology_coeff_field): + # Parameters: Xflat (flattened image), + # Xdim (shape of non-flattened image) + # dimensions (homology dimensions) + + # Compute the persistence pairs with Gudhi + # We reverse the dimensions because CubicalComplex uses Fortran ordering + cc = CubicalComplex(dimensions=Xdim[::-1], top_dimensional_cells=Xflat) + cc.compute_persistence(homology_coeff_field=homology_coeff_field) + + # Retrieve and output image indices/pixels corresponding to positive and negative simplices + cof_pp = cc.cofaces_of_persistence_pairs() + + L_cofs = [] + for dim in dimensions: + + try: + cof = cof_pp[0][dim] + except IndexError: + cof = np.array([]) + + L_cofs.append(np.array(cof, dtype=np.int32)) + + return L_cofs + +class CubicalLayer(tf.keras.layers.Layer): + """ + TensorFlow layer for computing the persistent homology of a cubical complex + """ + def __init__(self, homology_dimensions, min_persistence=None, homology_coeff_field=11, **kwargs): + """ + Constructor for the CubicalLayer class + + Parameters: + homology_dimensions (List[int]): list of homology dimensions + min_persistence (List[float]): minimum distance-to-diagonal of the points in the output persistence diagrams (default None, in which case 0. is used for all dimensions) + homology_coeff_field (int): homology field coefficient. Must be a prime number. Default value is 11. Max is 46337. + """ + super().__init__(dynamic=True, **kwargs) + self.dimensions = homology_dimensions + self.min_persistence = min_persistence if min_persistence != None else [0.] * len(self.dimensions) + self.hcf = homology_coeff_field + assert len(self.min_persistence) == len(self.dimensions) + + def call(self, X): + """ + Compute persistence diagram associated to a cubical complex filtered by some pixel values + + Parameters: + X (TensorFlow variable): pixel values of the cubical complex + + Returns: + List[Tuple[tf.Tensor,tf.Tensor]]: List of cubical persistence diagrams. The length of this list is the same than that of dimensions, i.e., there is one persistence diagram per homology dimension provided in the input list dimensions. Moreover, the finite and essential parts of the persistence diagrams are provided separately: each element of this list is a tuple of size two that contains the finite and essential parts of the corresponding persistence diagram, of shapes [num_finite_points, 2] and [num_essential_points, 1] respectively. Note that the essential part is always empty in cubical persistence diagrams, except in homology dimension zero, where the essential part always contains a single point, with abscissa equal to the smallest value in the complex, and infinite ordinate + """ + # Compute pixels associated to positive and negative simplices + # Don't compute gradient for this operation + Xflat = tf.reshape(X, [-1]) + Xdim, Xflat_numpy = X.shape, Xflat.numpy() + indices_list = _Cubical(Xflat_numpy, Xdim, self.dimensions, self.hcf) + index_essential = np.argmin(Xflat_numpy) # index of minimum pixel value for essential persistence diagram + # Get persistence diagram by simply picking the corresponding entries in the image + self.dgms = [] + for idx_dim, dimension in enumerate(self.dimensions): + finite_dgm = tf.reshape(tf.gather(Xflat, indices_list[idx_dim]), [-1,2]) + essential_dgm = tf.reshape(tf.gather(Xflat, index_essential), [-1,1]) if dimension == 0 else tf.zeros([0, 1]) + min_pers = self.min_persistence[idx_dim] + if min_pers >= 0: + persistent_indices = tf.where(tf.math.abs(finite_dgm[:,1]-finite_dgm[:,0]) > min_pers) + self.dgms.append((tf.reshape(tf.gather(finite_dgm, indices=persistent_indices), [-1,2]), essential_dgm)) + else: + self.dgms.append((finite_dgm, essential_dgm)) + return self.dgms diff --git a/src/python/gudhi/tensorflow/lower_star_simplex_tree_layer.py b/src/python/gudhi/tensorflow/lower_star_simplex_tree_layer.py new file mode 100644 index 00000000..5a8e5b75 --- /dev/null +++ b/src/python/gudhi/tensorflow/lower_star_simplex_tree_layer.py @@ -0,0 +1,87 @@ +import numpy as np +import tensorflow as tf + +######################################### +# Lower star filtration on simplex tree # +######################################### + +# The parameters of the model are the vertex function values of the simplex tree. + +def _LowerStarSimplexTree(simplextree, filtration, dimensions, homology_coeff_field): + # Parameters: simplextree (simplex tree on which to compute persistence) + # filtration (function values on the vertices of st), + # dimensions (homology dimensions), + # homology_coeff_field (homology field coefficient) + + simplextree.reset_filtration(-np.inf, 0) + + # Assign new filtration values + for i in range(simplextree.num_vertices()): + simplextree.assign_filtration([i], filtration[i]) + simplextree.make_filtration_non_decreasing() + + # Compute persistence diagram + simplextree.compute_persistence(homology_coeff_field=homology_coeff_field) + + # Get vertex pairs for optimization. First, get all simplex pairs + pairs = simplextree.lower_star_persistence_generators() + + L_indices = [] + for dimension in dimensions: + + finite_pairs = pairs[0][dimension] if len(pairs[0]) >= dimension+1 else np.empty(shape=[0,2]) + essential_pairs = pairs[1][dimension] if len(pairs[1]) >= dimension+1 else np.empty(shape=[0,1]) + + finite_indices = np.array(finite_pairs.flatten(), dtype=np.int32) + essential_indices = np.array(essential_pairs.flatten(), dtype=np.int32) + + L_indices.append((finite_indices, essential_indices)) + + return L_indices + +class LowerStarSimplexTreeLayer(tf.keras.layers.Layer): + """ + TensorFlow layer for computing lower-star persistence out of a simplex tree + """ + def __init__(self, simplextree, homology_dimensions, min_persistence=None, homology_coeff_field=11, **kwargs): + """ + Constructor for the LowerStarSimplexTreeLayer class + + Parameters: + simplextree (gudhi.SimplexTree): underlying simplex tree. Its vertices MUST be named with integers from 0 to n-1, where n is its number of vertices. Note that its filtration values are modified in each call of the class. + homology_dimensions (List[int]): list of homology dimensions + min_persistence (List[float]): minimum distance-to-diagonal of the points in the output persistence diagrams (default None, in which case 0. is used for all dimensions) + homology_coeff_field (int): homology field coefficient. Must be a prime number. Default value is 11. Max is 46337. + """ + super().__init__(dynamic=True, **kwargs) + self.dimensions = homology_dimensions + self.simplextree = simplextree + self.min_persistence = min_persistence if min_persistence != None else [0. for _ in range(len(self.dimensions))] + self.hcf = homology_coeff_field + assert len(self.min_persistence) == len(self.dimensions) + + def call(self, filtration): + """ + Compute lower-star persistence diagram associated to a function defined on the vertices of the simplex tree + + Parameters: + F (TensorFlow variable): filter function values over the vertices of the simplex tree. The ith entry of F corresponds to vertex i in self.simplextree + + Returns: + List[Tuple[tf.Tensor,tf.Tensor]]: List of lower-star persistence diagrams. The length of this list is the same than that of dimensions, i.e., there is one persistence diagram per homology dimension provided in the input list dimensions. Moreover, the finite and essential parts of the persistence diagrams are provided separately: each element of this list is a tuple of size two that contains the finite and essential parts of the corresponding persistence diagram, of shapes [num_finite_points, 2] and [num_essential_points, 1] respectively + """ + # Don't try to compute gradients for the vertex pairs + indices = _LowerStarSimplexTree(self.simplextree, filtration.numpy(), self.dimensions, self.hcf) + # Get persistence diagrams + self.dgms = [] + for idx_dim, dimension in enumerate(self.dimensions): + finite_dgm = tf.reshape(tf.gather(filtration, indices[idx_dim][0]), [-1,2]) + essential_dgm = tf.reshape(tf.gather(filtration, indices[idx_dim][1]), [-1,1]) + min_pers = self.min_persistence[idx_dim] + if min_pers >= 0: + persistent_indices = tf.where(tf.math.abs(finite_dgm[:,1]-finite_dgm[:,0]) > min_pers) + self.dgms.append((tf.reshape(tf.gather(finite_dgm, indices=persistent_indices),[-1,2]), essential_dgm)) + else: + self.dgms.append((finite_dgm, essential_dgm)) + return self.dgms + diff --git a/src/python/gudhi/tensorflow/rips_layer.py b/src/python/gudhi/tensorflow/rips_layer.py new file mode 100644 index 00000000..2a73472c --- /dev/null +++ b/src/python/gudhi/tensorflow/rips_layer.py @@ -0,0 +1,93 @@ +import numpy as np +import tensorflow as tf +from ..rips_complex import RipsComplex + +############################ +# Vietoris-Rips filtration # +############################ + +# The parameters of the model are the point coordinates. + +def _Rips(DX, max_edge, dimensions, homology_coeff_field): + # Parameters: DX (distance matrix), + # max_edge (maximum edge length for Rips filtration), + # dimensions (homology dimensions) + + # Compute the persistence pairs with Gudhi + rc = RipsComplex(distance_matrix=DX, max_edge_length=max_edge) + st = rc.create_simplex_tree(max_dimension=max(dimensions)+1) + st.compute_persistence(homology_coeff_field=homology_coeff_field) + pairs = st.flag_persistence_generators() + + L_indices = [] + for dimension in dimensions: + + if dimension == 0: + finite_pairs = pairs[0] + essential_pairs = pairs[2] + else: + finite_pairs = pairs[1][dimension-1] if len(pairs[1]) >= dimension else np.empty(shape=[0,4]) + essential_pairs = pairs[3][dimension-1] if len(pairs[3]) >= dimension else np.empty(shape=[0,2]) + + finite_indices = np.array(finite_pairs.flatten(), dtype=np.int32) + essential_indices = np.array(essential_pairs.flatten(), dtype=np.int32) + + L_indices.append((finite_indices, essential_indices)) + + return L_indices + +class RipsLayer(tf.keras.layers.Layer): + """ + TensorFlow layer for computing Rips persistence out of a point cloud + """ + def __init__(self, homology_dimensions, maximum_edge_length=np.inf, min_persistence=None, homology_coeff_field=11, **kwargs): + """ + Constructor for the RipsLayer class + + Parameters: + maximum_edge_length (float): maximum edge length for the Rips complex + homology_dimensions (List[int]): list of homology dimensions + min_persistence (List[float]): minimum distance-to-diagonal of the points in the output persistence diagrams (default None, in which case 0. is used for all dimensions) + homology_coeff_field (int): homology field coefficient. Must be a prime number. Default value is 11. Max is 46337. + """ + super().__init__(dynamic=True, **kwargs) + self.max_edge = maximum_edge_length + self.dimensions = homology_dimensions + self.min_persistence = min_persistence if min_persistence != None else [0. for _ in range(len(self.dimensions))] + self.hcf = homology_coeff_field + assert len(self.min_persistence) == len(self.dimensions) + + def call(self, X): + """ + Compute Rips persistence diagram associated to a point cloud + + Parameters: + X (TensorFlow variable): point cloud of shape [number of points, number of dimensions] + + Returns: + List[Tuple[tf.Tensor,tf.Tensor]]: List of Rips persistence diagrams. The length of this list is the same than that of dimensions, i.e., there is one persistence diagram per homology dimension provided in the input list dimensions. Moreover, the finite and essential parts of the persistence diagrams are provided separately: each element of this list is a tuple of size two that contains the finite and essential parts of the corresponding persistence diagram, of shapes [num_finite_points, 2] and [num_essential_points, 1] respectively + """ + # Compute distance matrix + DX = tf.norm(tf.expand_dims(X, 1)-tf.expand_dims(X, 0), axis=2) + # Compute vertices associated to positive and negative simplices + # Don't compute gradient for this operation + indices = _Rips(DX.numpy(), self.max_edge, self.dimensions, self.hcf) + # Get persistence diagrams by simply picking the corresponding entries in the distance matrix + self.dgms = [] + for idx_dim, dimension in enumerate(self.dimensions): + cur_idx = indices[idx_dim] + if dimension > 0: + finite_dgm = tf.reshape(tf.gather_nd(DX, tf.reshape(cur_idx[0], [-1,2])), [-1,2]) + essential_dgm = tf.reshape(tf.gather_nd(DX, tf.reshape(cur_idx[1], [-1,2])), [-1,1]) + else: + reshaped_cur_idx = tf.reshape(cur_idx[0], [-1,3]) + finite_dgm = tf.concat([tf.zeros([reshaped_cur_idx.shape[0],1]), tf.reshape(tf.gather_nd(DX, reshaped_cur_idx[:,1:]), [-1,1])], axis=1) + essential_dgm = tf.zeros([cur_idx[1].shape[0],1]) + min_pers = self.min_persistence[idx_dim] + if min_pers >= 0: + persistent_indices = tf.where(tf.math.abs(finite_dgm[:,1]-finite_dgm[:,0]) > min_pers) + self.dgms.append((tf.reshape(tf.gather(finite_dgm, indices=persistent_indices),[-1,2]), essential_dgm)) + else: + self.dgms.append((finite_dgm, essential_dgm)) + return self.dgms + diff --git a/src/python/gudhi/wasserstein/barycenter.py b/src/python/gudhi/wasserstein/barycenter.py index d67bcde7..bb6e641e 100644 --- a/src/python/gudhi/wasserstein/barycenter.py +++ b/src/python/gudhi/wasserstein/barycenter.py @@ -37,7 +37,7 @@ def lagrangian_barycenter(pdiagset, init=None, verbose=False): :param init: The initial value for barycenter estimate. If ``None``, init is made on a random diagram from the dataset. Otherwise, it can be an ``int`` (then initialization is made on ``pdiagset[init]``) - or a `(n x 2)` ``numpy.array`` enconding a persistence diagram with `n` points. + or a `(n x 2)` ``numpy.array`` encoding a persistence diagram with `n` points. :type init: ``int``, or (n x 2) ``np.array`` :param verbose: if ``True``, returns additional information about the barycenter. :type verbose: boolean @@ -45,7 +45,7 @@ def lagrangian_barycenter(pdiagset, init=None, verbose=False): (local minimum of the energy function). If ``pdiagset`` is empty, returns ``None``. If verbose, returns a couple ``(Y, log)`` where ``Y`` is the barycenter estimate, - and ``log`` is a ``dict`` that contains additional informations: + and ``log`` is a ``dict`` that contains additional information: - `"groupings"`, a list of list of pairs ``(i,j)``. Namely, ``G[k] = [...(i, j)...]``, where ``(i,j)`` indicates that `pdiagset[k][i]`` is matched to ``Y[j]`` if ``i = -1`` or ``j = -1``, it means they represent the diagonal. @@ -73,7 +73,7 @@ def lagrangian_barycenter(pdiagset, init=None, verbose=False): nb_iter = 0 - converged = False # stoping criterion + converged = False # stopping criterion while not converged: nb_iter += 1 K = len(Y) # current nb of points in Y (some might be on diagonal) diff --git a/src/python/gudhi/wasserstein/wasserstein.py b/src/python/gudhi/wasserstein/wasserstein.py index a9d1cdff..dc18806e 100644 --- a/src/python/gudhi/wasserstein/wasserstein.py +++ b/src/python/gudhi/wasserstein/wasserstein.py @@ -9,6 +9,7 @@ import numpy as np import scipy.spatial.distance as sc +import warnings try: import ot @@ -70,6 +71,7 @@ def _perstot_autodiff(X, order, internal_p): ''' return _dist_to_diag(X, internal_p).norms.lp(order) + def _perstot(X, order, internal_p, enable_autodiff): ''' :param X: (n x 2) numpy.array (points of a given diagram). @@ -79,6 +81,9 @@ def _perstot(X, order, internal_p, enable_autodiff): transparent to automatic differentiation. :type enable_autodiff: bool :returns: float, the total persistence of the diagram (that is, its distance to the empty diagram). + + .. note:: + Can be +inf if the diagram has an essential part (points with infinite coordinates). ''' if enable_autodiff: import eagerpy as ep @@ -88,32 +93,163 @@ def _perstot(X, order, internal_p, enable_autodiff): return np.linalg.norm(_dist_to_diag(X, internal_p), ord=order) -def wasserstein_distance(X, Y, matching=False, order=1., internal_p=np.inf, enable_autodiff=False): +def _get_essential_parts(a): ''' - :param X: (n x 2) numpy.array encoding the (finite points of the) first diagram. Must not contain essential points - (i.e. with infinite coordinate). - :param Y: (m x 2) numpy.array encoding the second diagram. - :param matching: if True, computes and returns the optimal matching between X and Y, encoded as - a (n x 2) np.array [...[i,j]...], meaning the i-th point in X is matched to - the j-th point in Y, with the convention (-1) represents the diagonal. - :param order: exponent for Wasserstein; Default value is 1. - :param internal_p: Ground metric on the (upper-half) plane (i.e. norm L^p in R^2); - Default value is `np.inf`. - :param enable_autodiff: If X and Y are torch.tensor or tensorflow.Tensor, make the computation + :param a: (n x 2) numpy.array (point of a diagram) + :returns: five lists of indices (between 0 and len(a)) accounting for the five types of points with infinite + coordinates that can occur in a diagram, namely: + type0 : (-inf, finite) + type1 : (finite, +inf) + type2 : (-inf, +inf) + type3 : (-inf, -inf) + type4 : (+inf, +inf) + .. note:: + For instance, a[_get_essential_parts(a)[0]] returns the points in a of coordinates (-inf, x) for some finite x. + Note also that points with (+inf, -inf) are not handled (points (x,y) in dgm satisfy by assumption (y >= x)). + + Finally, we consider that points with coordinates (-inf,-inf) and (+inf, +inf) belong to the diagonal. + ''' + if len(a): + first_coord_finite = np.isfinite(a[:,0]) + second_coord_finite = np.isfinite(a[:,1]) + first_coord_infinite_positive = (a[:,0] == np.inf) + second_coord_infinite_positive = (a[:,1] == np.inf) + first_coord_infinite_negative = (a[:,0] == -np.inf) + second_coord_infinite_negative = (a[:,1] == -np.inf) + + ess_first_type = np.where(second_coord_finite & first_coord_infinite_negative)[0] # coord (-inf, x) + ess_second_type = np.where(first_coord_finite & second_coord_infinite_positive)[0] # coord (x, +inf) + ess_third_type = np.where(first_coord_infinite_negative & second_coord_infinite_positive)[0] # coord (-inf, +inf) + + ess_fourth_type = np.where(first_coord_infinite_negative & second_coord_infinite_negative)[0] # coord (-inf, -inf) + ess_fifth_type = np.where(first_coord_infinite_positive & second_coord_infinite_positive)[0] # coord (+inf, +inf) + return ess_first_type, ess_second_type, ess_third_type, ess_fourth_type, ess_fifth_type + else: + return [], [], [], [], [] + + +def _cost_and_match_essential_parts(X, Y, idX, idY, order, axis): + ''' + :param X: (n x 2) numpy.array (dgm points) + :param Y: (n x 2) numpy.array (dgm points) + :param idX: indices to consider for this one dimensional OT problem (in X) + :param idY: indices to consider for this one dimensional OT problem (in Y) + :param order: exponent for Wasserstein distance computation + :param axis: must be 0 or 1, correspond to the coordinate which is finite. + :returns: cost (float) and match for points with *one* infinite coordinate. + + .. note:: + Assume idX, idY come when calling _handle_essential_parts, thus have same length. + ''' + u = X[idX, axis] + v = Y[idY, axis] + + cost = np.sum(np.abs(np.sort(u) - np.sort(v))**(order)) # OT cost in 1D + + sortidX = idX[np.argsort(u)] + sortidY = idY[np.argsort(v)] + # We return [i,j] sorted per value + match = list(zip(sortidX, sortidY)) + + return cost, match + + +def _handle_essential_parts(X, Y, order): + ''' + :param X: (n x 2) numpy array, first diagram. + :param Y: (n x 2) numpy array, second diagram. + :order: Wasserstein order for cost computation. + :returns: cost and matching due to essential parts. If cost is +inf, matching will be set to None. + ''' + ess_parts_X = _get_essential_parts(X) + ess_parts_Y = _get_essential_parts(Y) + + # Treats the case of infinite cost (cardinalities of essential parts differ). + for u, v in list(zip(ess_parts_X, ess_parts_Y))[:3]: # ignore types 4 and 5 as they belong to the diagonal + if len(u) != len(v): + return np.inf, None + + # Now we know each essential part has the same number of points in both diagrams. + # Handle type 0 and type 1 essential parts (those with one finite coordinates) + c1, m1 = _cost_and_match_essential_parts(X, Y, ess_parts_X[0], ess_parts_Y[0], axis=1, order=order) + c2, m2 = _cost_and_match_essential_parts(X, Y, ess_parts_X[1], ess_parts_Y[1], axis=0, order=order) + + c = c1 + c2 + m = m1 + m2 + + # Handle type3 (coordinates (-inf,+inf), so we just align points) + m += list(zip(ess_parts_X[2], ess_parts_Y[2])) + + # Handle type 4 and 5, considered as belonging to the diagonal so matched to (-1) with cost 0. + for z in ess_parts_X[3:]: + m += [(u, -1) for u in z] # points in X are matched to -1 + for z in ess_parts_Y[3:]: + m += [(-1, v) for v in z] # -1 is match to points in Y + + return c, np.array(m) + + +def _finite_part(X): + ''' + :param X: (n x 2) numpy array encoding a persistence diagram. + :returns: The finite part of a diagram `X` (points with finite coordinates). + ''' + return X[np.where(np.isfinite(X[:,0]) & np.isfinite(X[:,1]))] + + +def _warn_infty(matching): + ''' + Handle essential parts with different cardinalities. Warn the user about cost being infinite and (if + `matching=True`) about the returned matching being `None`. + ''' + if matching: + warnings.warn('Cardinality of essential parts differs. Distance (cost) is +inf, and the returned matching is None.') + return np.inf, None + else: + warnings.warn('Cardinality of essential parts differs. Distance (cost) is +inf.') + return np.inf + + +def wasserstein_distance(X, Y, matching=False, order=1., internal_p=np.inf, enable_autodiff=False, + keep_essential_parts=True): + ''' + Compute the Wasserstein distance between persistence diagram using Python Optimal Transport backend. + Diagrams can contain points with infinity coordinates (essential parts). + Points with (-inf,-inf) and (+inf,+inf) coordinates are considered as belonging to the diagonal. + If the distance between two diagrams is +inf (which happens if the cardinalities of essential + parts differ) and optimal matching is required, it will be set to ``None``. + + :param X: The first diagram. + :type X: n x 2 numpy.array + :param Y: The second diagram. + :type Y: m x 2 numpy.array + :param matching: if ``True``, computes and returns the optimal matching between X and Y, encoded as + a (n x 2) np.array [...[i,j]...], meaning the i-th point in X is matched to + the j-th point in Y, with the convention that (-1) represents the diagonal. + :param order: Wasserstein exponent q (1 <= q < infinity). + :type order: float + :param internal_p: Ground metric on the (upper-half) plane (i.e. norm L^p in R^2). + :type internal_p: float + :param enable_autodiff: If X and Y are ``torch.tensor`` or ``tensorflow.Tensor``, make the computation transparent to automatic differentiation. This requires the package EagerPy and is currently incompatible - with `matching=True`. + with ``matching=True`` and with ``keep_essential_parts=True``. - .. note:: This considers the function defined on the coordinates of the off-diagonal points of X and Y + .. note:: This considers the function defined on the coordinates of the off-diagonal finite points of X and Y and lets the various frameworks compute its gradient. It never pulls new points from the diagonal. :type enable_autodiff: bool - :returns: the Wasserstein distance of order q (1 <= q < infinity) between persistence diagrams with + :param keep_essential_parts: If ``False``, only considers the finite points in the diagrams. + Otherwise, include essential parts in cost and matching computation. + :type keep_essential_parts: bool + :returns: The Wasserstein distance of order q (1 <= q < infinity) between persistence diagrams with respect to the internal_p-norm as ground metric. If matching is set to True, also returns the optimal matching between X and Y. + If cost is +inf, any matching is optimal and thus it returns `None` instead. ''' + + # First step: handle empty diagrams n = len(X) m = len(Y) - # handle empty diagrams if n == 0: if m == 0: if not matching: @@ -122,16 +258,45 @@ def wasserstein_distance(X, Y, matching=False, order=1., internal_p=np.inf, enab else: return 0., np.array([]) else: - if not matching: - return _perstot(Y, order, internal_p, enable_autodiff) + cost = _perstot(Y, order, internal_p, enable_autodiff) + if cost == np.inf: + return _warn_infty(matching) else: - return _perstot(Y, order, internal_p, enable_autodiff), np.array([[-1, j] for j in range(m)]) + if not matching: + return cost + else: + return cost, np.array([[-1, j] for j in range(m)]) elif m == 0: - if not matching: - return _perstot(X, order, internal_p, enable_autodiff) + cost = _perstot(X, order, internal_p, enable_autodiff) + if cost == np.inf: + return _warn_infty(matching) else: - return _perstot(X, order, internal_p, enable_autodiff), np.array([[i, -1] for i in range(n)]) + if not matching: + return cost + else: + return cost, np.array([[i, -1] for i in range(n)]) + + # Check essential part and enable autodiff together + if enable_autodiff and keep_essential_parts: + warnings.warn('''enable_autodiff=True and keep_essential_parts=True are incompatible together. + keep_essential_parts is set to False: only points with finite coordinates are considered + in the following. + ''') + keep_essential_parts = False + + # Second step: handle essential parts if needed. + if keep_essential_parts: + essential_cost, essential_matching = _handle_essential_parts(X, Y, order=order) + if (essential_cost == np.inf): + return _warn_infty(matching) # Tells the user that cost is infty and matching (if True) is None. + # avoid computing transport cost between the finite parts if essential parts + # cardinalities do not match (saves time) + else: + essential_cost = 0 + essential_matching = None + + # Now the standard pipeline for finite parts if enable_autodiff: import eagerpy as ep @@ -139,6 +304,12 @@ def wasserstein_distance(X, Y, matching=False, order=1., internal_p=np.inf, enab Y_orig = ep.astensor(Y) X = X_orig.numpy() Y = Y_orig.numpy() + + # Extract finite points of the diagrams. + X, Y = _finite_part(X), _finite_part(Y) + n = len(X) + m = len(Y) + M = _build_dist_matrix(X, Y, order=order, internal_p=internal_p) a = np.ones(n+1) # weight vector of the input diagram. Uniform here. a[-1] = m @@ -154,7 +325,10 @@ def wasserstein_distance(X, Y, matching=False, order=1., internal_p=np.inf, enab # Now we turn to -1 points encoding the diagonal match[:,0][match[:,0] >= n] = -1 match[:,1][match[:,1] >= m] = -1 - return ot_cost ** (1./order) , match + # Finally incorporate the essential part matching + if essential_matching is not None: + match = np.concatenate([match, essential_matching]) if essential_matching.size else match + return (ot_cost + essential_cost) ** (1./order) , match if enable_autodiff: P = ot.emd(a=a, b=b, M=M, numItermax=2000000) @@ -173,9 +347,9 @@ def wasserstein_distance(X, Y, matching=False, order=1., internal_p=np.inf, enab return ep.concatenate(dists).norms.lp(order).raw # We can also concatenate the 3 vectors to compute just one norm. - # Comptuation of the otcost using the ot.emd2 library. + # Comptuation of the ot cost using the ot.emd2 library. # Note: it is the Wasserstein distance to the power q. # The default numItermax=100000 is not sufficient for some examples with 5000 points, what is a good value? ot_cost = ot.emd2(a, b, M, numItermax=2000000) - return ot_cost ** (1./order) + return (ot_cost + essential_cost) ** (1./order) diff --git a/src/python/gudhi/weighted_rips_complex.py b/src/python/gudhi/weighted_rips_complex.py index 0541572b..16f63c3d 100644 --- a/src/python/gudhi/weighted_rips_complex.py +++ b/src/python/gudhi/weighted_rips_complex.py @@ -12,9 +12,11 @@ from gudhi import SimplexTree class WeightedRipsComplex: """ Class to generate a weighted Rips complex from a distance matrix and weights on vertices, - in the way described in :cite:`dtmfiltrations`. + in the way described in :cite:`dtmfiltrations` with `p=1`. The filtration value of vertex `i` is `2*weights[i]`, + and the filtration value of edge `ij` is `distance_matrix[i][j]+weights[i]+weights[j]`, + or the maximum of the filtrations of its extremities, whichever is largest. Remark that all the filtration values are doubled compared to the definition in the paper - for the consistency with RipsComplex. + for consistency with RipsComplex. """ def __init__(self, distance_matrix, diff --git a/src/python/include/Alpha_complex_factory.h b/src/python/include/Alpha_complex_factory.h index 3405fdd6..41eb72c1 100644 --- a/src/python/include/Alpha_complex_factory.h +++ b/src/python/include/Alpha_complex_factory.h @@ -31,15 +31,34 @@ namespace Gudhi { namespace alpha_complex { -template <typename CgalPointType> -std::vector<double> pt_cgal_to_cython(CgalPointType const& point) { - std::vector<double> vd; - vd.reserve(point.dimension()); - for (auto coord = point.cartesian_begin(); coord != point.cartesian_end(); coord++) - vd.push_back(CGAL::to_double(*coord)); - return vd; -} +// template Functor that transforms a CGAL point to a vector of double as expected by cython +template<typename CgalPointType, bool Weighted> +struct Point_cgal_to_cython; + +// Specialized Unweighted Functor +template<typename CgalPointType> +struct Point_cgal_to_cython<CgalPointType, false> { + std::vector<double> operator()(CgalPointType const& point) const + { + std::vector<double> vd; + vd.reserve(point.dimension()); + for (auto coord = point.cartesian_begin(); coord != point.cartesian_end(); coord++) + vd.push_back(CGAL::to_double(*coord)); + return vd; + } +}; +// Specialized Weighted Functor +template<typename CgalPointType> +struct Point_cgal_to_cython<CgalPointType, true> { + std::vector<double> operator()(CgalPointType const& weighted_point) const + { + const auto& point = weighted_point.point(); + return Point_cgal_to_cython<decltype(point), false>()(point); + } +}; + +// Function that transforms a cython point (aka. a vector of double) to a CGAL point template <typename CgalPointType> static CgalPointType pt_cython_to_cgal(std::vector<double> const& vec) { return CgalPointType(vec.size(), vec.begin(), vec.end()); @@ -51,24 +70,35 @@ class Abstract_alpha_complex { virtual bool create_simplex_tree(Simplex_tree_interface<>* simplex_tree, double max_alpha_square, bool default_filtration_value) = 0; + + virtual std::size_t num_vertices() const = 0; virtual ~Abstract_alpha_complex() = default; }; -class Exact_Alphacomplex_dD final : public Abstract_alpha_complex { +template <bool Weighted = false> +class Exact_alpha_complex_dD final : public Abstract_alpha_complex { private: using Kernel = CGAL::Epeck_d<CGAL::Dynamic_dimension_tag>; - using Point = typename Kernel::Point_d; + using Bare_point = typename Kernel::Point_d; + using Point = std::conditional_t<Weighted, typename Kernel::Weighted_point_d, + typename Kernel::Point_d>; public: - Exact_Alphacomplex_dD(const std::vector<std::vector<double>>& points, bool exact_version) + Exact_alpha_complex_dD(const std::vector<std::vector<double>>& points, bool exact_version) + : exact_version_(exact_version), + alpha_complex_(boost::adaptors::transform(points, pt_cython_to_cgal<Bare_point>)) { + } + + Exact_alpha_complex_dD(const std::vector<std::vector<double>>& points, + const std::vector<double>& weights, bool exact_version) : exact_version_(exact_version), - alpha_complex_(boost::adaptors::transform(points, pt_cython_to_cgal<Point>)) { + alpha_complex_(boost::adaptors::transform(points, pt_cython_to_cgal<Bare_point>), weights) { } virtual std::vector<double> get_point(int vh) override { - Point const& point = alpha_complex_.get_point(vh); - return pt_cgal_to_cython(point); + // Can be a Weighted or a Bare point in function of Weighted + return Point_cgal_to_cython<Point, Weighted>()(alpha_complex_.get_point(vh)); } virtual bool create_simplex_tree(Simplex_tree_interface<>* simplex_tree, double max_alpha_square, @@ -76,65 +106,49 @@ class Exact_Alphacomplex_dD final : public Abstract_alpha_complex { return alpha_complex_.create_complex(*simplex_tree, max_alpha_square, exact_version_, default_filtration_value); } + virtual std::size_t num_vertices() const override { + return alpha_complex_.num_vertices(); + } + private: bool exact_version_; - Alpha_complex<Kernel> alpha_complex_; + Alpha_complex<Kernel, Weighted> alpha_complex_; }; -class Inexact_Alphacomplex_dD final : public Abstract_alpha_complex { +template <bool Weighted = false> +class Inexact_alpha_complex_dD final : public Abstract_alpha_complex { private: using Kernel = CGAL::Epick_d<CGAL::Dynamic_dimension_tag>; - using Point = typename Kernel::Point_d; + using Bare_point = typename Kernel::Point_d; + using Point = std::conditional_t<Weighted, typename Kernel::Weighted_point_d, + typename Kernel::Point_d>; public: - Inexact_Alphacomplex_dD(const std::vector<std::vector<double>>& points, bool exact_version) - : exact_version_(exact_version), - alpha_complex_(boost::adaptors::transform(points, pt_cython_to_cgal<Point>)) { + Inexact_alpha_complex_dD(const std::vector<std::vector<double>>& points) + : alpha_complex_(boost::adaptors::transform(points, pt_cython_to_cgal<Bare_point>)) { + } + + Inexact_alpha_complex_dD(const std::vector<std::vector<double>>& points, const std::vector<double>& weights) + : alpha_complex_(boost::adaptors::transform(points, pt_cython_to_cgal<Bare_point>), weights) { } virtual std::vector<double> get_point(int vh) override { - Point const& point = alpha_complex_.get_point(vh); - return pt_cgal_to_cython(point); + // Can be a Weighted or a Bare point in function of Weighted + return Point_cgal_to_cython<Point, Weighted>()(alpha_complex_.get_point(vh)); } virtual bool create_simplex_tree(Simplex_tree_interface<>* simplex_tree, double max_alpha_square, bool default_filtration_value) override { - return alpha_complex_.create_complex(*simplex_tree, max_alpha_square, exact_version_, default_filtration_value); + return alpha_complex_.create_complex(*simplex_tree, max_alpha_square, false, default_filtration_value); } - private: - bool exact_version_; - Alpha_complex<Kernel> alpha_complex_; -}; - -template <complexity Complexity> -class Alphacomplex_3D final : public Abstract_alpha_complex { - private: - using Point = typename Alpha_complex_3d<Complexity, false, false>::Bare_point_3; - - static Point pt_cython_to_cgal_3(std::vector<double> const& vec) { - return Point(vec[0], vec[1], vec[2]); - } - - public: - Alphacomplex_3D(const std::vector<std::vector<double>>& points) - : alpha_complex_(boost::adaptors::transform(points, pt_cython_to_cgal_3)) { - } - - virtual std::vector<double> get_point(int vh) override { - Point const& point = alpha_complex_.get_point(vh); - return pt_cgal_to_cython(point); - } - - virtual bool create_simplex_tree(Simplex_tree_interface<>* simplex_tree, double max_alpha_square, - bool default_filtration_value) override { - return alpha_complex_.create_complex(*simplex_tree, max_alpha_square); + virtual std::size_t num_vertices() const override { + return alpha_complex_.num_vertices(); } private: - Alpha_complex_3d<Complexity, false, false> alpha_complex_; + Alpha_complex<Kernel, Weighted> alpha_complex_; }; - } // namespace alpha_complex } // namespace Gudhi diff --git a/src/python/include/Alpha_complex_interface.h b/src/python/include/Alpha_complex_interface.h index 23be194d..469b91ce 100644 --- a/src/python/include/Alpha_complex_interface.h +++ b/src/python/include/Alpha_complex_interface.h @@ -27,10 +27,23 @@ namespace alpha_complex { class Alpha_complex_interface { public: - Alpha_complex_interface(const std::vector<std::vector<double>>& points, bool fast_version, bool exact_version) - : points_(points), - fast_version_(fast_version), - exact_version_(exact_version) { + Alpha_complex_interface(const std::vector<std::vector<double>>& points, + const std::vector<double>& weights, + bool fast_version, bool exact_version) { + const bool weighted = (weights.size() > 0); + if (fast_version) { + if (weighted) { + alpha_ptr_ = std::make_unique<Inexact_alpha_complex_dD<true>>(points, weights); + } else { + alpha_ptr_ = std::make_unique<Inexact_alpha_complex_dD<false>>(points); + } + } else { + if (weighted) { + alpha_ptr_ = std::make_unique<Exact_alpha_complex_dD<true>>(points, weights, exact_version); + } else { + alpha_ptr_ = std::make_unique<Exact_alpha_complex_dD<false>>(points, exact_version); + } + } } std::vector<double> get_point(int vh) { @@ -39,38 +52,23 @@ class Alpha_complex_interface { void create_simplex_tree(Simplex_tree_interface<>* simplex_tree, double max_alpha_square, bool default_filtration_value) { - if (points_.size() > 0) { - std::size_t dimension = points_[0].size(); - if (dimension == 3 && !default_filtration_value) { - if (fast_version_) - alpha_ptr_ = std::make_unique<Alphacomplex_3D<Gudhi::alpha_complex::complexity::FAST>>(points_); - else if (exact_version_) - alpha_ptr_ = std::make_unique<Alphacomplex_3D<Gudhi::alpha_complex::complexity::EXACT>>(points_); - else - alpha_ptr_ = std::make_unique<Alphacomplex_3D<Gudhi::alpha_complex::complexity::SAFE>>(points_); - if (!alpha_ptr_->create_simplex_tree(simplex_tree, max_alpha_square, default_filtration_value)) { - // create_simplex_tree will fail if all points are on a plane - Retry with dD by setting dimension to 2 - dimension--; - alpha_ptr_.reset(); - } - } - // Not ** else ** because we have to take into account if 3d fails - if (dimension != 3 || default_filtration_value) { - if (fast_version_) { - alpha_ptr_ = std::make_unique<Inexact_Alphacomplex_dD>(points_, exact_version_); - } else { - alpha_ptr_ = std::make_unique<Exact_Alphacomplex_dD>(points_, exact_version_); - } - alpha_ptr_->create_simplex_tree(simplex_tree, max_alpha_square, default_filtration_value); - } - } + // Nothing to be done in case of an empty point set + if (alpha_ptr_->num_vertices() > 0) + alpha_ptr_->create_simplex_tree(simplex_tree, max_alpha_square, default_filtration_value); + } + + static void set_float_relative_precision(double precision) { + // cf. Exact_alpha_complex_dD kernel type in Alpha_complex_factory.h + CGAL::Epeck_d<CGAL::Dynamic_dimension_tag>::FT::set_relative_precision_of_to_double(precision); + } + + static double get_float_relative_precision() { + // cf. Exact_alpha_complex_dD kernel type in Alpha_complex_factory.h + return CGAL::Epeck_d<CGAL::Dynamic_dimension_tag>::FT::get_relative_precision_of_to_double(); } private: std::unique_ptr<Abstract_alpha_complex> alpha_ptr_; - std::vector<std::vector<double>> points_; - bool fast_version_; - bool exact_version_; }; } // namespace alpha_complex diff --git a/src/python/include/Persistent_cohomology_interface.h b/src/python/include/Persistent_cohomology_interface.h index e5a3dfba..945378a0 100644 --- a/src/python/include/Persistent_cohomology_interface.h +++ b/src/python/include/Persistent_cohomology_interface.h @@ -12,6 +12,8 @@ #define INCLUDE_PERSISTENT_COHOMOLOGY_INTERFACE_H_ #include <gudhi/Persistent_cohomology.h> +#include <gudhi/Simplex_tree.h> // for Extended_simplex_type + #include <cstdlib> #include <vector> @@ -223,6 +225,44 @@ persistent_cohomology::Persistent_cohomology<FilteredComplex, persistent_cohomol return out; } + using Filtration_value = typename FilteredComplex::Filtration_value; + using Birth_death = std::pair<Filtration_value, Filtration_value>; + using Persistence_subdiagrams = std::vector<std::vector<std::pair<int, Birth_death>>>; + + Persistence_subdiagrams compute_extended_persistence_subdiagrams(Filtration_value min_persistence){ + Persistence_subdiagrams pers_subs(4); + auto const& persistent_pairs = Base::get_persistent_pairs(); + for (auto pair : persistent_pairs) { + std::pair<Filtration_value, Extended_simplex_type> px = stptr_->decode_extended_filtration(stptr_->filtration(get<0>(pair)), + stptr_->efd); + std::pair<Filtration_value, Extended_simplex_type> py = stptr_->decode_extended_filtration(stptr_->filtration(get<1>(pair)), + stptr_->efd); + std::pair<int, Birth_death> pd_point = std::make_pair(stptr_->dimension(get<0>(pair)), + std::make_pair(px.first, py.first)); + if(std::abs(px.first - py.first) > min_persistence){ + //Ordinary + if (px.second == Extended_simplex_type::UP && py.second == Extended_simplex_type::UP){ + pers_subs[0].push_back(pd_point); + } + // Relative + else if (px.second == Extended_simplex_type::DOWN && py.second == Extended_simplex_type::DOWN){ + pers_subs[1].push_back(pd_point); + } + else{ + // Extended+ + if (px.first < py.first){ + pers_subs[2].push_back(pd_point); + } + //Extended- + else{ + pers_subs[3].push_back(pd_point); + } + } + } + } + return pers_subs; + } + private: // A copy FilteredComplex* stptr_; diff --git a/src/python/include/Simplex_tree_interface.h b/src/python/include/Simplex_tree_interface.h index 629f6083..0317ea39 100644 --- a/src/python/include/Simplex_tree_interface.h +++ b/src/python/include/Simplex_tree_interface.h @@ -15,9 +15,7 @@ #include <gudhi/distance_functions.h> #include <gudhi/Simplex_tree.h> #include <gudhi/Points_off_io.h> -#ifdef GUDHI_USE_EIGEN3 #include <gudhi/Flag_complex_edge_collapser.h> -#endif #include <iostream> #include <vector> @@ -42,6 +40,9 @@ class Simplex_tree_interface : public Simplex_tree<SimplexTreeOptions> { using Complex_simplex_iterator = typename Base::Complex_simplex_iterator; using Extended_filtration_data = typename Base::Extended_filtration_data; using Boundary_simplex_iterator = typename Base::Boundary_simplex_iterator; + using Siblings = typename Base::Siblings; + using Node = typename Base::Node; + typedef bool (*blocker_func_t)(Simplex simplex, void *user_data); public: @@ -63,6 +64,30 @@ class Simplex_tree_interface : public Simplex_tree<SimplexTreeOptions> { return (result.second); } + void insert_matrix(double* filtrations, int n, int stride0, int stride1, double max_filtration) { + // We could delegate to insert_graph, but wrapping the matrix in a graph interface is too much work, + // and this is a bit more efficient. + auto& rm = this->root()->members_; + for(int i=0; i<n; ++i) { + char* p = reinterpret_cast<char*>(filtrations) + i * stride0; + double fv = *reinterpret_cast<double*>(p + i * stride1); + if(fv > max_filtration) continue; + auto sh = rm.emplace_hint(rm.end(), i, Node(this->root(), fv)); + Siblings* children = nullptr; + // Should we make a first pass to count the number of edges so we can reserve the right space? + for(int j=i+1; j<n; ++j) { + double fe = *reinterpret_cast<double*>(p + j * stride1); + if(fe > max_filtration) continue; + if(!children) { + children = new Siblings(this->root(), i); + sh->second.assign_children(children); + } + children->members().emplace_hint(children->members().end(), j, Node(children, fe)); + } + } + + } + // Do not interface this function, only used in alpha complex interface for complex creation bool insert_simplex(const Simplex& simplex, Filtration_value filtration = 0) { Insertion_result result = Base::insert_simplex(simplex, filtration); @@ -133,38 +158,7 @@ class Simplex_tree_interface : public Simplex_tree<SimplexTreeOptions> { return; } - std::vector<std::vector<std::pair<int, std::pair<Filtration_value, Filtration_value>>>> compute_extended_persistence_subdiagrams(const std::vector<std::pair<int, std::pair<Filtration_value, Filtration_value>>>& dgm, Filtration_value min_persistence){ - std::vector<std::vector<std::pair<int, std::pair<Filtration_value, Filtration_value>>>> new_dgm(4); - for (unsigned int i = 0; i < dgm.size(); i++){ - std::pair<Filtration_value, Extended_simplex_type> px = this->decode_extended_filtration(dgm[i].second.first, this->efd); - std::pair<Filtration_value, Extended_simplex_type> py = this->decode_extended_filtration(dgm[i].second.second, this->efd); - std::pair<int, std::pair<Filtration_value, Filtration_value>> pd_point = std::make_pair(dgm[i].first, std::make_pair(px.first, py.first)); - if(std::abs(px.first - py.first) > min_persistence){ - //Ordinary - if (px.second == Extended_simplex_type::UP && py.second == Extended_simplex_type::UP){ - new_dgm[0].push_back(pd_point); - } - // Relative - else if (px.second == Extended_simplex_type::DOWN && py.second == Extended_simplex_type::DOWN){ - new_dgm[1].push_back(pd_point); - } - else{ - // Extended+ - if (px.first < py.first){ - new_dgm[2].push_back(pd_point); - } - //Extended- - else{ - new_dgm[3].push_back(pd_point); - } - } - } - } - return new_dgm; - } - Simplex_tree_interface* collapse_edges(int nb_collapse_iteration) { -#ifdef GUDHI_USE_EIGEN3 using Filtered_edge = std::tuple<Vertex_handle, Vertex_handle, Filtration_value>; std::vector<Filtered_edge> edges; for (Simplex_handle sh : Base::skeleton_simplex_range(1)) { @@ -178,7 +172,7 @@ class Simplex_tree_interface : public Simplex_tree<SimplexTreeOptions> { } for (int iteration = 0; iteration < nb_collapse_iteration; iteration++) { - edges = Gudhi::collapse::flag_complex_collapse_edges(edges); + edges = Gudhi::collapse::flag_complex_collapse_edges(std::move(edges)); } Simplex_tree_interface* collapsed_stree_ptr = new Simplex_tree_interface(); // Copy the original 0-skeleton @@ -190,9 +184,13 @@ class Simplex_tree_interface : public Simplex_tree<SimplexTreeOptions> { collapsed_stree_ptr->insert({std::get<0>(remaining_edge), std::get<1>(remaining_edge)}, std::get<2>(remaining_edge)); } return collapsed_stree_ptr; -#else - throw std::runtime_error("Unable to collapse edges as it requires Eigen3 >= 3.1.0."); -#endif + } + + void expansion_with_blockers_callback(int dimension, blocker_func_t user_func, void *user_data) { + Base::expansion_with_blockers(dimension, [&](Simplex_handle sh){ + Simplex simplex(Base::simplex_vertex_range(sh).begin(), Base::simplex_vertex_range(sh).end()); + return user_func(simplex, user_data); + }); } // Iterator over the simplex tree diff --git a/src/python/pyproject.toml b/src/python/pyproject.toml new file mode 100644 index 00000000..55b64466 --- /dev/null +++ b/src/python/pyproject.toml @@ -0,0 +1,3 @@ +[build-system] +requires = ["setuptools>=24.2.0", "wheel", "numpy>=1.15.0", "cython>=0.27", "pybind11"] +build-backend = "setuptools.build_meta" diff --git a/src/python/setup.py.in b/src/python/setup.py.in index 98d058fc..6eb0db42 100644 --- a/src/python/setup.py.in +++ b/src/python/setup.py.in @@ -5,6 +5,7 @@ Copyright (C) 2019 Inria Modification(s): + - 2021/12 Vincent Rouvreau: Python 3.5 as minimal version - YYYY/MM Author: Description of the modification """ @@ -41,17 +42,12 @@ for module in cython_modules: libraries=libraries, library_dirs=library_dirs, include_dirs=include_dirs, - runtime_library_dirs=runtime_library_dirs, - cython_directives = {'language_level': str(sys.version_info[0])},)) + runtime_library_dirs=runtime_library_dirs,)) -ext_modules = cythonize(ext_modules) +ext_modules = cythonize(ext_modules, compiler_directives={'language_level': '3'}) for module in pybind11_modules: my_include_dirs = include_dirs + [pybind11.get_include(False), pybind11.get_include(True)] - if module == 'hera/wasserstein': - my_include_dirs = ['@HERA_WASSERSTEIN_INCLUDE_DIR@'] + my_include_dirs - elif module == 'hera/bottleneck': - my_include_dirs = ['@HERA_BOTTLENECK_INCLUDE_DIR@'] + my_include_dirs ext_modules.append(Extension( 'gudhi.' + module.replace('/', '.'), sources = [source_dir + module + '.cc'], @@ -72,7 +68,7 @@ setup( name = 'gudhi', packages=find_packages(), # find_namespace_packages(include=["gudhi*"]) author='GUDHI Editorial Board', - author_email='gudhi-contact@lists.gforge.inria.fr', + author_email='gudhi-contact@inria.fr', version='@GUDHI_VERSION@', url='https://gudhi.inria.fr/', project_urls={ @@ -83,10 +79,11 @@ setup( }, description='The Gudhi library is an open source library for ' \ 'Computational Topology and Topological Data Analysis (TDA).', + data_files=[('.', ['./introduction.rst'])], long_description_content_type='text/x-rst', long_description=long_description, ext_modules = ext_modules, - install_requires = ['numpy >= 1.9',], - setup_requires = ['cython','numpy >= 1.9','pybind11',], + python_requires='>=3.5.0', + install_requires = ['numpy >= 1.15.0',], package_data={"": ["*.dll"], }, ) diff --git a/src/python/test/test_alpha_complex.py b/src/python/test/test_alpha_complex.py index 814f8289..f81e6137 100755 --- a/src/python/test/test_alpha_complex.py +++ b/src/python/test/test_alpha_complex.py @@ -8,10 +8,12 @@ - YYYY/MM Author: Description of the modification """ -import gudhi as gd +from gudhi import AlphaComplex import math import numpy as np import pytest +import warnings + try: # python3 from itertools import zip_longest @@ -19,22 +21,24 @@ except ImportError: # python2 from itertools import izip_longest as zip_longest -__author__ = "Vincent Rouvreau" -__copyright__ = "Copyright (C) 2016 Inria" -__license__ = "MIT" def _empty_alpha(precision): - alpha_complex = gd.AlphaComplex(points=[[0, 0]], precision = precision) + alpha_complex = AlphaComplex(precision = precision) + assert alpha_complex.__is_defined() == True + +def _one_2d_point_alpha(precision): + alpha_complex = AlphaComplex(points=[[0, 0]], precision = precision) assert alpha_complex.__is_defined() == True def test_empty_alpha(): for precision in ['fast', 'safe', 'exact']: _empty_alpha(precision) + _one_2d_point_alpha(precision) def _infinite_alpha(precision): point_list = [[0, 0], [1, 0], [0, 1], [1, 1]] - alpha_complex = gd.AlphaComplex(points=point_list, precision = precision) + alpha_complex = AlphaComplex(points=point_list, precision = precision) assert alpha_complex.__is_defined() == True simplex_tree = alpha_complex.create_simplex_tree() @@ -69,18 +73,9 @@ def _infinite_alpha(precision): assert point_list[1] == alpha_complex.get_point(1) assert point_list[2] == alpha_complex.get_point(2) assert point_list[3] == alpha_complex.get_point(3) - try: - alpha_complex.get_point(4) == [] - except IndexError: - pass - else: - assert False - try: - alpha_complex.get_point(125) == [] - except IndexError: - pass - else: - assert False + + with pytest.raises(IndexError): + alpha_complex.get_point(len(point_list)) def test_infinite_alpha(): for precision in ['fast', 'safe', 'exact']: @@ -88,7 +83,7 @@ def test_infinite_alpha(): def _filtered_alpha(precision): point_list = [[0, 0], [1, 0], [0, 1], [1, 1]] - filtered_alpha = gd.AlphaComplex(points=point_list, precision = precision) + filtered_alpha = AlphaComplex(points=point_list, precision = precision) simplex_tree = filtered_alpha.create_simplex_tree(max_alpha_square=0.25) @@ -99,18 +94,9 @@ def _filtered_alpha(precision): assert point_list[1] == filtered_alpha.get_point(1) assert point_list[2] == filtered_alpha.get_point(2) assert point_list[3] == filtered_alpha.get_point(3) - try: - filtered_alpha.get_point(4) == [] - except IndexError: - pass - else: - assert False - try: - filtered_alpha.get_point(125) == [] - except IndexError: - pass - else: - assert False + + with pytest.raises(IndexError): + filtered_alpha.get_point(len(point_list)) assert list(simplex_tree.get_filtration()) == [ ([0], 0.0), @@ -141,10 +127,10 @@ def _safe_alpha_persistence_comparison(precision): embedding2 = [[signal[i], delayed[i]] for i in range(len(time))] #build alpha complex and simplex tree - alpha_complex1 = gd.AlphaComplex(points=embedding1, precision = precision) + alpha_complex1 = AlphaComplex(points=embedding1, precision = precision) simplex_tree1 = alpha_complex1.create_simplex_tree() - alpha_complex2 = gd.AlphaComplex(points=embedding2, precision = precision) + alpha_complex2 = AlphaComplex(points=embedding2, precision = precision) simplex_tree2 = alpha_complex2.create_simplex_tree() diag1 = simplex_tree1.persistence() @@ -162,7 +148,7 @@ def test_safe_alpha_persistence_comparison(): def _delaunay_complex(precision): point_list = [[0, 0], [1, 0], [0, 1], [1, 1]] - filtered_alpha = gd.AlphaComplex(points=point_list, precision = precision) + filtered_alpha = AlphaComplex(points=point_list, precision = precision) simplex_tree = filtered_alpha.create_simplex_tree(default_filtration_value = True) @@ -173,18 +159,11 @@ def _delaunay_complex(precision): assert point_list[1] == filtered_alpha.get_point(1) assert point_list[2] == filtered_alpha.get_point(2) assert point_list[3] == filtered_alpha.get_point(3) - try: - filtered_alpha.get_point(4) == [] - except IndexError: - pass - else: - assert False - try: - filtered_alpha.get_point(125) == [] - except IndexError: - pass - else: - assert False + + with pytest.raises(IndexError): + filtered_alpha.get_point(4) + with pytest.raises(IndexError): + filtered_alpha.get_point(125) for filtered_value in simplex_tree.get_filtration(): assert math.isnan(filtered_value[1]) @@ -198,7 +177,13 @@ def test_delaunay_complex(): _delaunay_complex(precision) def _3d_points_on_a_plane(precision, default_filtration_value): - alpha = gd.AlphaComplex(off_file='alphacomplexdoc.off', precision = precision) + alpha = AlphaComplex(points = [[1.0, 1.0 , 0.0], + [7.0, 0.0 , 0.0], + [4.0, 6.0 , 0.0], + [9.0, 6.0 , 0.0], + [0.0, 14.0, 0.0], + [2.0, 19.0, 0.0], + [9.0, 17.0, 0.0]], precision = precision) simplex_tree = alpha.create_simplex_tree(default_filtration_value = default_filtration_value) assert simplex_tree.dimension() == 2 @@ -206,28 +191,16 @@ def _3d_points_on_a_plane(precision, default_filtration_value): assert simplex_tree.num_simplices() == 25 def test_3d_points_on_a_plane(): - off_file = open("alphacomplexdoc.off", "w") - off_file.write("OFF \n" \ - "7 0 0 \n" \ - "1.0 1.0 0.0\n" \ - "7.0 0.0 0.0\n" \ - "4.0 6.0 0.0\n" \ - "9.0 6.0 0.0\n" \ - "0.0 14.0 0.0\n" \ - "2.0 19.0 0.0\n" \ - "9.0 17.0 0.0\n" ) - off_file.close() - for default_filtration_value in [True, False]: for precision in ['fast', 'safe', 'exact']: _3d_points_on_a_plane(precision, default_filtration_value) def _3d_tetrahedrons(precision): points = 10*np.random.rand(10, 3) - alpha = gd.AlphaComplex(points=points, precision = precision) + alpha = AlphaComplex(points = points, precision = precision) st_alpha = alpha.create_simplex_tree(default_filtration_value = False) # New AlphaComplex for get_point to work - delaunay = gd.AlphaComplex(points=points, precision = precision) + delaunay = AlphaComplex(points = points, precision = precision) st_delaunay = delaunay.create_simplex_tree(default_filtration_value = True) delaunay_tetra = [] @@ -256,3 +229,87 @@ def _3d_tetrahedrons(precision): def test_3d_tetrahedrons(): for precision in ['fast', 'safe', 'exact']: _3d_tetrahedrons(precision) + +def test_off_file_deprecation_warning(): + off_file = open("alphacomplexdoc.off", "w") + off_file.write("OFF \n" \ + "7 0 0 \n" \ + "1.0 1.0 0.0\n" \ + "7.0 0.0 0.0\n" \ + "4.0 6.0 0.0\n" \ + "9.0 6.0 0.0\n" \ + "0.0 14.0 0.0\n" \ + "2.0 19.0 0.0\n" \ + "9.0 17.0 0.0\n" ) + off_file.close() + + with pytest.warns(DeprecationWarning): + alpha = AlphaComplex(off_file="alphacomplexdoc.off") + +def test_non_existing_off_file(): + with pytest.warns(DeprecationWarning): + with pytest.raises(FileNotFoundError): + alpha = AlphaComplex(off_file="pouetpouettralala.toubiloubabdou") + +def test_inconsistency_points_and_weights(): + points = [[1.0, 1.0 , 0.0], + [7.0, 0.0 , 0.0], + [4.0, 6.0 , 0.0], + [9.0, 6.0 , 0.0], + [0.0, 14.0, 0.0], + [2.0, 19.0, 0.0], + [9.0, 17.0, 0.0]] + with pytest.raises(ValueError): + # 7 points, 8 weights, on purpose + alpha = AlphaComplex(points = points, + weights = [1., 2., 3., 4., 5., 6., 7., 8.]) + + with pytest.raises(ValueError): + # 7 points, 6 weights, on purpose + alpha = AlphaComplex(points = points, + weights = [1., 2., 3., 4., 5., 6.]) + +def _weighted_doc_example(precision): + stree = AlphaComplex(points=[[ 1., -1., -1.], + [-1., 1., -1.], + [-1., -1., 1.], + [ 1., 1., 1.], + [ 2., 2., 2.]], + weights = [4., 4., 4., 4., 1.], + precision = precision).create_simplex_tree() + + assert stree.filtration([0, 1, 2, 3]) == pytest.approx(-1.) + assert stree.filtration([0, 1, 3, 4]) == pytest.approx(95.) + assert stree.filtration([0, 2, 3, 4]) == pytest.approx(95.) + assert stree.filtration([1, 2, 3, 4]) == pytest.approx(95.) + +def test_weighted_doc_example(): + for precision in ['fast', 'safe', 'exact']: + _weighted_doc_example(precision) + +def test_float_relative_precision(): + assert AlphaComplex.get_float_relative_precision() == 1e-5 + # Must be > 0. + with pytest.raises(ValueError): + AlphaComplex.set_float_relative_precision(0.) + # Must be < 1. + with pytest.raises(ValueError): + AlphaComplex.set_float_relative_precision(1.) + + points = [[1, 1], [7, 0], [4, 6], [9, 6], [0, 14], [2, 19], [9, 17]] + st = AlphaComplex(points=points).create_simplex_tree() + filtrations = list(st.get_filtration()) + + # Get a better precision + AlphaComplex.set_float_relative_precision(1e-15) + assert AlphaComplex.get_float_relative_precision() == 1e-15 + + st = AlphaComplex(points=points).create_simplex_tree() + filtrations_better_resolution = list(st.get_filtration()) + + assert len(filtrations) == len(filtrations_better_resolution) + for idx in range(len(filtrations)): + # check simplex is the same + assert filtrations[idx][0] == filtrations_better_resolution[idx][0] + # check filtration is about the same with a relative precision of the worst case + assert filtrations[idx][1] == pytest.approx(filtrations_better_resolution[idx][1], rel=1e-5) diff --git a/src/python/test/test_betti_curve_representations.py b/src/python/test/test_betti_curve_representations.py new file mode 100755 index 00000000..6a45da4d --- /dev/null +++ b/src/python/test/test_betti_curve_representations.py @@ -0,0 +1,59 @@ +import numpy as np +import scipy.interpolate +import pytest + +from gudhi.representations.vector_methods import BettiCurve + +def test_betti_curve_is_irregular_betti_curve_followed_by_interpolation(): + m = 10 + n = 1000 + pinf = 0.05 + pzero = 0.05 + res = 100 + + pds = [] + for i in range(0, m): + pd = np.zeros((n, 2)) + pd[:, 0] = np.random.uniform(0, 10, n) + pd[:, 1] = np.random.uniform(pd[:, 0], 10, n) + pd[np.random.uniform(0, 1, n) < pzero, 0] = 0 + pd[np.random.uniform(0, 1, n) < pinf, 1] = np.inf + pds.append(pd) + + bc = BettiCurve(resolution=None, predefined_grid=None) + bc.fit(pds) + bettis = bc.transform(pds) + + bc2 = BettiCurve(resolution=None, predefined_grid=None) + bettis2 = bc2.fit_transform(pds) + assert((bc2.grid_ == bc.grid_).all()) + assert((bettis2 == bettis).all()) + + for i in range(0, m): + grid = np.linspace(pds[i][np.isfinite(pds[i])].min(), pds[i][np.isfinite(pds[i])].max() + 1, res) + bc_gridded = BettiCurve(predefined_grid=grid) + bc_gridded.fit([]) + bettis_gridded = bc_gridded(pds[i]) + + interp = scipy.interpolate.interp1d(bc.grid_, bettis[i, :], kind="previous", fill_value="extrapolate") + bettis_interp = np.array(interp(grid), dtype=int) + assert((bettis_interp == bettis_gridded).all()) + + +def test_empty_with_predefined_grid(): + random_grid = np.sort(np.random.uniform(0, 1, 100)) + bc = BettiCurve(predefined_grid=random_grid) + bettis = bc.fit_transform([]) + assert((bc.grid_ == random_grid).all()) + assert((bettis == 0).all()) + + +def test_empty(): + bc = BettiCurve(resolution=None, predefined_grid=None) + bettis = bc.fit_transform([]) + assert(bc.grid_ == [-np.inf]) + assert((bettis == 0).all()) + +def test_wrong_value_of_predefined_grid(): + with pytest.raises(ValueError): + BettiCurve(predefined_grid=[1, 2, 3]) diff --git a/src/python/test/test_cubical_complex.py b/src/python/test/test_cubical_complex.py index d0e4e9e8..29d559b3 100755 --- a/src/python/test/test_cubical_complex.py +++ b/src/python/test/test_cubical_complex.py @@ -174,3 +174,28 @@ def test_periodic_cofaces_of_persistence_pairs_when_pd_has_no_paired_birth_and_d assert np.array_equal(pairs[1][0], np.array([0])) assert np.array_equal(pairs[1][1], np.array([0, 1])) assert np.array_equal(pairs[1][2], np.array([1])) + +def test_cubical_persistence_intervals_in_dimension(): + cub = CubicalComplex( + dimensions=[3, 3], + top_dimensional_cells=[1, 2, 3, 4, 5, 6, 7, 8, 9], + ) + cub.compute_persistence() + H0 = cub.persistence_intervals_in_dimension(0) + assert np.array_equal(H0, np.array([[ 1., float("inf")]])) + assert cub.persistence_intervals_in_dimension(1).shape == (0, 2) + +def test_periodic_cubical_persistence_intervals_in_dimension(): + cub = PeriodicCubicalComplex( + dimensions=[3, 3], + top_dimensional_cells=[1, 2, 3, 4, 5, 6, 7, 8, 9], + periodic_dimensions = [True, True] + ) + cub.compute_persistence() + H0 = cub.persistence_intervals_in_dimension(0) + assert np.array_equal(H0, np.array([[ 1., float("inf")]])) + H1 = cub.persistence_intervals_in_dimension(1) + assert np.array_equal(H1, np.array([[ 3., float("inf")], [ 7., float("inf")]])) + H2 = cub.persistence_intervals_in_dimension(2) + assert np.array_equal(H2, np.array([[ 9., float("inf")]])) + assert cub.persistence_intervals_in_dimension(3).shape == (0, 2) diff --git a/src/python/test/test_datasets_generators.py b/src/python/test/test_datasets_generators.py new file mode 100755 index 00000000..91ec4a65 --- /dev/null +++ b/src/python/test/test_datasets_generators.py @@ -0,0 +1,39 @@ +""" This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + Author(s): Hind Montassif + + Copyright (C) 2021 Inria + + Modification(s): + - YYYY/MM Author: Description of the modification +""" + +from gudhi.datasets.generators import points + +import pytest + +def test_sphere(): + assert points.sphere(n_samples = 10, ambient_dim = 2, radius = 1., sample = 'random').shape == (10, 2) + + with pytest.raises(ValueError): + points.sphere(n_samples = 10, ambient_dim = 2, radius = 1., sample = 'other') + +def _basic_torus(impl): + assert impl(n_samples = 64, dim = 3, sample = 'random').shape == (64, 6) + assert impl(n_samples = 64, dim = 3, sample = 'grid').shape == (64, 6) + + assert impl(n_samples = 10, dim = 4, sample = 'random').shape == (10, 8) + + # Here 1**dim < n_samples < 2**dim, the output shape is therefore (1, 2*dim) = (1, 8), where shape[0] is rounded down to the closest perfect 'dim'th power + assert impl(n_samples = 10, dim = 4, sample = 'grid').shape == (1, 8) + + with pytest.raises(ValueError): + impl(n_samples = 10, dim = 4, sample = 'other') + +def test_torus(): + for torus_impl in [points.torus, points.ctorus]: + _basic_torus(torus_impl) + # Check that the two versions (torus and ctorus) generate the same output + assert points.ctorus(n_samples = 64, dim = 3, sample = 'random').all() == points.torus(n_samples = 64, dim = 3, sample = 'random').all() + assert points.ctorus(n_samples = 64, dim = 3, sample = 'grid').all() == points.torus(n_samples = 64, dim = 3, sample = 'grid').all() + assert points.ctorus(n_samples = 10, dim = 3, sample = 'grid').all() == points.torus(n_samples = 10, dim = 3, sample = 'grid').all() diff --git a/src/python/test/test_diff.py b/src/python/test/test_diff.py new file mode 100644 index 00000000..dca001a9 --- /dev/null +++ b/src/python/test/test_diff.py @@ -0,0 +1,78 @@ +from gudhi.tensorflow import * +import numpy as np +import tensorflow as tf +import gudhi as gd + +def test_rips_diff(): + + Xinit = np.array([[1.,1.],[2.,2.]], dtype=np.float32) + X = tf.Variable(initial_value=Xinit, trainable=True) + rl = RipsLayer(maximum_edge_length=2., homology_dimensions=[0]) + + with tf.GradientTape() as tape: + dgm = rl.call(X)[0][0] + loss = tf.math.reduce_sum(tf.square(.5*(dgm[:,1]-dgm[:,0]))) + grads = tape.gradient(loss, [X]) + assert tf.norm(grads[0]-tf.constant([[-.5,-.5],[.5,.5]]),1) <= 1e-6 + +def test_cubical_diff(): + + Xinit = np.array([[0.,2.,2.],[2.,2.,2.],[2.,2.,1.]], dtype=np.float32) + X = tf.Variable(initial_value=Xinit, trainable=True) + cl = CubicalLayer(homology_dimensions=[0]) + + with tf.GradientTape() as tape: + dgm = cl.call(X)[0][0] + loss = tf.math.reduce_sum(tf.square(.5*(dgm[:,1]-dgm[:,0]))) + grads = tape.gradient(loss, [X]) + assert tf.norm(grads[0]-tf.constant([[0.,0.,0.],[0.,.5,0.],[0.,0.,-.5]]),1) <= 1e-6 + +def test_nonsquare_cubical_diff(): + + Xinit = np.array([[-1.,1.,0.],[1.,1.,1.]], dtype=np.float32) + X = tf.Variable(initial_value=Xinit, trainable=True) + cl = CubicalLayer(homology_dimensions=[0]) + + with tf.GradientTape() as tape: + dgm = cl.call(X)[0][0] + loss = tf.math.reduce_sum(tf.square(.5*(dgm[:,1]-dgm[:,0]))) + grads = tape.gradient(loss, [X]) + assert tf.norm(grads[0]-tf.constant([[0.,0.5,-0.5],[0.,0.,0.]]),1) <= 1e-6 + +def test_st_diff(): + + st = gd.SimplexTree() + st.insert([0]) + st.insert([1]) + st.insert([2]) + st.insert([3]) + st.insert([4]) + st.insert([5]) + st.insert([6]) + st.insert([7]) + st.insert([8]) + st.insert([9]) + st.insert([10]) + st.insert([0, 1]) + st.insert([1, 2]) + st.insert([2, 3]) + st.insert([3, 4]) + st.insert([4, 5]) + st.insert([5, 6]) + st.insert([6, 7]) + st.insert([7, 8]) + st.insert([8, 9]) + st.insert([9, 10]) + + Finit = np.array([6.,4.,3.,4.,5.,4.,3.,2.,3.,4.,5.], dtype=np.float32) + F = tf.Variable(initial_value=Finit, trainable=True) + sl = LowerStarSimplexTreeLayer(simplextree=st, homology_dimensions=[0]) + + with tf.GradientTape() as tape: + dgm = sl.call(F)[0][0] + loss = tf.math.reduce_sum(tf.square(.5*(dgm[:,1]-dgm[:,0]))) + grads = tape.gradient(loss, [F]) + + assert tf.math.reduce_all(tf.math.equal(grads[0].indices, tf.constant([2,4]))) + assert tf.math.reduce_all(tf.math.equal(grads[0].values, tf.constant([-1.,1.]))) + diff --git a/src/python/test/test_dtm.py b/src/python/test/test_dtm.py index 0a52279e..b276f041 100755 --- a/src/python/test/test_dtm.py +++ b/src/python/test/test_dtm.py @@ -13,6 +13,7 @@ import numpy import pytest import torch import math +import warnings def test_dtm_compare_euclidean(): @@ -87,3 +88,14 @@ def test_density(): assert density == pytest.approx(expected) density = DTMDensity(weights=[0.5, 0.5], metric="neighbors", dim=1).fit_transform(distances) assert density == pytest.approx(expected) + +def test_dtm_overflow_warnings(): + pts = numpy.array([[10., 100000000000000000000000000000.], [1000., 100000000000000000000000000.]]) + impl_warn = ["keops", "hnsw"] + for impl in impl_warn: + with warnings.catch_warnings(record=True) as w: + dtm = DistanceToMeasure(2, implementation=impl) + r = dtm.fit_transform(pts) + assert len(w) == 1 + assert issubclass(w[0].category, RuntimeWarning) + assert "Overflow" in str(w[0].message) diff --git a/src/python/test/test_off.py b/src/python/test/test_off.py new file mode 100644 index 00000000..aea1941b --- /dev/null +++ b/src/python/test/test_off.py @@ -0,0 +1,21 @@ +""" This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + Author(s): Marc Glisse + + Copyright (C) 2022 Inria + + Modification(s): + - YYYY/MM Author: Description of the modification +""" + +import gudhi as gd +import numpy as np +import pytest + + +def test_off_rw(): + for dim in range(2, 6): + X = np.random.rand(123, dim) + gd.write_points_to_off_file("rand.off", X) + Y = gd.read_points_from_off_file("rand.off") + assert Y == pytest.approx(X) diff --git a/src/python/test/test_persistence_graphical_tools.py b/src/python/test/test_persistence_graphical_tools.py new file mode 100644 index 00000000..0e2ac3f8 --- /dev/null +++ b/src/python/test/test_persistence_graphical_tools.py @@ -0,0 +1,122 @@ +""" This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + Author(s): Vincent Rouvreau + + Copyright (C) 2021 Inria + + Modification(s): + - YYYY/MM Author: Description of the modification +""" + +import gudhi as gd +import numpy as np +import matplotlib as plt +import pytest +import warnings + + +def test_array_handler(): + diags = np.array([[1, 2], [3, 4], [5, 6]], float) + arr_diags = gd.persistence_graphical_tools._array_handler(diags) + for idx in range(len(diags)): + assert arr_diags[idx][0] == 0 + np.testing.assert_array_equal(arr_diags[idx][1], diags[idx]) + + diags = [(1.0, 2.0), (3.0, 4.0), (5.0, 6.0)] + arr_diags = gd.persistence_graphical_tools._array_handler(diags) + for idx in range(len(diags)): + assert arr_diags[idx][0] == 0 + assert arr_diags[idx][1] == diags[idx] + + diags = [(0, (1.0, 2.0)), (0, (3.0, 4.0)), (0, (5.0, 6.0))] + assert gd.persistence_graphical_tools._array_handler(diags) == diags + + +def test_min_birth_max_death(): + diags = [ + (0, (0.0, float("inf"))), + (0, (0.0983494, float("inf"))), + (0, (0.0, 0.122545)), + (0, (0.0, 0.12047)), + (0, (0.0, 0.118398)), + (0, (0.118398, 1.0)), + (0, (0.0, 0.117908)), + (0, (0.0, 0.112307)), + (0, (0.0, 0.107535)), + (0, (0.0, 0.106382)), + ] + assert gd.persistence_graphical_tools.__min_birth_max_death(diags) == (0.0, 1.0) + assert gd.persistence_graphical_tools.__min_birth_max_death(diags, band=4.0) == (0.0, 5.0) + + +def test_limit_min_birth_max_death(): + diags = [ + (0, (2.0, float("inf"))), + (0, (2.0, float("inf"))), + ] + assert gd.persistence_graphical_tools.__min_birth_max_death(diags) == (2.0, 3.0) + assert gd.persistence_graphical_tools.__min_birth_max_death(diags, band=4.0) == (2.0, 6.0) + + +def test_limit_to_max_intervals(): + diags = [ + (0, (0.0, float("inf"))), + (0, (0.0983494, float("inf"))), + (0, (0.0, 0.122545)), + (0, (0.0, 0.12047)), + (0, (0.0, 0.118398)), + (0, (0.118398, 1.0)), + (0, (0.0, 0.117908)), + (0, (0.0, 0.112307)), + (0, (0.0, 0.107535)), + (0, (0.0, 0.106382)), + ] + # check no warnings if max_intervals equals to the diagrams number + with warnings.catch_warnings(): + warnings.simplefilter("error") + truncated_diags = gd.persistence_graphical_tools._limit_to_max_intervals( + diags, 10, key=lambda life_time: life_time[1][1] - life_time[1][0] + ) + # check diagrams are not sorted + assert truncated_diags == diags + + # check warning if max_intervals lower than the diagrams number + with pytest.warns(UserWarning) as record: + truncated_diags = gd.persistence_graphical_tools._limit_to_max_intervals( + diags, 5, key=lambda life_time: life_time[1][1] - life_time[1][0] + ) + # check diagrams are truncated and sorted by life time + assert truncated_diags == [ + (0, (0.0, float("inf"))), + (0, (0.0983494, float("inf"))), + (0, (0.118398, 1.0)), + (0, (0.0, 0.122545)), + (0, (0.0, 0.12047)), + ] + assert len(record) == 1 + + +def _limit_plot_persistence(function): + pplot = function(persistence=[]) + assert isinstance(pplot, plt.axes.SubplotBase) + pplot = function(persistence=[], legend=True) + assert isinstance(pplot, plt.axes.SubplotBase) + pplot = function(persistence=[(0, float("inf"))]) + assert isinstance(pplot, plt.axes.SubplotBase) + pplot = function(persistence=[(0, float("inf"))], legend=True) + assert isinstance(pplot, plt.axes.SubplotBase) + + +def test_limit_plot_persistence(): + for function in [gd.plot_persistence_barcode, gd.plot_persistence_diagram, gd.plot_persistence_density]: + _limit_plot_persistence(function) + + +def _non_existing_persistence_file(function): + with pytest.raises(FileNotFoundError): + function(persistence_file="pouetpouettralala.toubiloubabdou") + + +def test_non_existing_persistence_file(): + for function in [gd.plot_persistence_barcode, gd.plot_persistence_diagram, gd.plot_persistence_density]: + _non_existing_persistence_file(function) diff --git a/src/python/test/test_reader_utils.py b/src/python/test/test_reader_utils.py index 90da6651..fdfddc4b 100755 --- a/src/python/test/test_reader_utils.py +++ b/src/python/test/test_reader_utils.py @@ -8,8 +8,9 @@ - YYYY/MM Author: Description of the modification """ -import gudhi +import gudhi as gd import numpy as np +from pytest import raises __author__ = "Vincent Rouvreau" __copyright__ = "Copyright (C) 2017 Inria" @@ -18,7 +19,7 @@ __license__ = "MIT" def test_non_existing_csv_file(): # Try to open a non existing file - matrix = gudhi.read_lower_triangular_matrix_from_csv_file( + matrix = gd.read_lower_triangular_matrix_from_csv_file( csv_file="pouetpouettralala.toubiloubabdou" ) assert matrix == [] @@ -29,8 +30,8 @@ def test_full_square_distance_matrix_csv_file(): test_file = open("full_square_distance_matrix.csv", "w") test_file.write("0;1;2;3;\n1;0;4;5;\n2;4;0;6;\n3;5;6;0;") test_file.close() - matrix = gudhi.read_lower_triangular_matrix_from_csv_file( - csv_file="full_square_distance_matrix.csv" + matrix = gd.read_lower_triangular_matrix_from_csv_file( + csv_file="full_square_distance_matrix.csv", separator=";" ) assert matrix == [[], [1.0], [2.0, 4.0], [3.0, 5.0, 6.0]] @@ -40,7 +41,7 @@ def test_lower_triangular_distance_matrix_csv_file(): test_file = open("lower_triangular_distance_matrix.csv", "w") test_file.write("\n1,\n2,3,\n4,5,6,\n7,8,9,10,") test_file.close() - matrix = gudhi.read_lower_triangular_matrix_from_csv_file( + matrix = gd.read_lower_triangular_matrix_from_csv_file( csv_file="lower_triangular_distance_matrix.csv", separator="," ) assert matrix == [[], [1.0], [2.0, 3.0], [4.0, 5.0, 6.0], [7.0, 8.0, 9.0, 10.0]] @@ -48,11 +49,11 @@ def test_lower_triangular_distance_matrix_csv_file(): def test_non_existing_persistence_file(): # Try to open a non existing file - persistence = gudhi.read_persistence_intervals_grouped_by_dimension( + persistence = gd.read_persistence_intervals_grouped_by_dimension( persistence_file="pouetpouettralala.toubiloubabdou" ) assert persistence == [] - persistence = gudhi.read_persistence_intervals_in_dimension( + persistence = gd.read_persistence_intervals_in_dimension( persistence_file="pouetpouettralala.toubiloubabdou", only_this_dim=1 ) np.testing.assert_array_equal(persistence, []) @@ -65,21 +66,21 @@ def test_read_persistence_intervals_without_dimension(): "# Simple persistence diagram without dimension\n2.7 3.7\n9.6 14.\n34.2 34.974\n3. inf" ) test_file.close() - persistence = gudhi.read_persistence_intervals_in_dimension( + persistence = gd.read_persistence_intervals_in_dimension( persistence_file="persistence_intervals_without_dimension.pers" ) np.testing.assert_array_equal( persistence, [(2.7, 3.7), (9.6, 14.0), (34.2, 34.974), (3.0, float("Inf"))] ) - persistence = gudhi.read_persistence_intervals_in_dimension( + persistence = gd.read_persistence_intervals_in_dimension( persistence_file="persistence_intervals_without_dimension.pers", only_this_dim=0 ) np.testing.assert_array_equal(persistence, []) - persistence = gudhi.read_persistence_intervals_in_dimension( + persistence = gd.read_persistence_intervals_in_dimension( persistence_file="persistence_intervals_without_dimension.pers", only_this_dim=1 ) np.testing.assert_array_equal(persistence, []) - persistence = gudhi.read_persistence_intervals_grouped_by_dimension( + persistence = gd.read_persistence_intervals_grouped_by_dimension( persistence_file="persistence_intervals_without_dimension.pers" ) assert persistence == { @@ -94,29 +95,29 @@ def test_read_persistence_intervals_with_dimension(): "# Simple persistence diagram with dimension\n0 2.7 3.7\n1 9.6 14.\n3 34.2 34.974\n1 3. inf" ) test_file.close() - persistence = gudhi.read_persistence_intervals_in_dimension( + persistence = gd.read_persistence_intervals_in_dimension( persistence_file="persistence_intervals_with_dimension.pers" ) np.testing.assert_array_equal( persistence, [(2.7, 3.7), (9.6, 14.0), (34.2, 34.974), (3.0, float("Inf"))] ) - persistence = gudhi.read_persistence_intervals_in_dimension( + persistence = gd.read_persistence_intervals_in_dimension( persistence_file="persistence_intervals_with_dimension.pers", only_this_dim=0 ) np.testing.assert_array_equal(persistence, [(2.7, 3.7)]) - persistence = gudhi.read_persistence_intervals_in_dimension( + persistence = gd.read_persistence_intervals_in_dimension( persistence_file="persistence_intervals_with_dimension.pers", only_this_dim=1 ) np.testing.assert_array_equal(persistence, [(9.6, 14.0), (3.0, float("Inf"))]) - persistence = gudhi.read_persistence_intervals_in_dimension( + persistence = gd.read_persistence_intervals_in_dimension( persistence_file="persistence_intervals_with_dimension.pers", only_this_dim=2 ) np.testing.assert_array_equal(persistence, []) - persistence = gudhi.read_persistence_intervals_in_dimension( + persistence = gd.read_persistence_intervals_in_dimension( persistence_file="persistence_intervals_with_dimension.pers", only_this_dim=3 ) np.testing.assert_array_equal(persistence, [(34.2, 34.974)]) - persistence = gudhi.read_persistence_intervals_grouped_by_dimension( + persistence = gd.read_persistence_intervals_grouped_by_dimension( persistence_file="persistence_intervals_with_dimension.pers" ) assert persistence == { diff --git a/src/python/test/test_remote_datasets.py b/src/python/test/test_remote_datasets.py new file mode 100644 index 00000000..e5d2de82 --- /dev/null +++ b/src/python/test/test_remote_datasets.py @@ -0,0 +1,87 @@ +# This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. +# See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. +# Author(s): Hind Montassif +# +# Copyright (C) 2021 Inria +# +# Modification(s): +# - YYYY/MM Author: Description of the modification + +from gudhi.datasets import remote + +import shutil +import io +import sys +import pytest + +from os.path import isdir, expanduser, exists +from os import remove, environ + +def test_data_home(): + # Test _get_data_home and clear_data_home on new empty folder + empty_data_home = remote._get_data_home(data_home="empty_folder_for_test") + assert isdir(empty_data_home) + + remote.clear_data_home(data_home=empty_data_home) + assert not isdir(empty_data_home) + +def test_fetch_remote(): + # Test fetch with a wrong checksum + with pytest.raises(OSError): + remote._fetch_remote("https://raw.githubusercontent.com/GUDHI/gudhi-data/main/points/spiral_2d/spiral_2d.npy", "tmp_spiral_2d.npy", file_checksum = 'XXXXXXXXXX') + assert not exists("tmp_spiral_2d.npy") + +def _get_bunny_license_print(accept_license = False): + capturedOutput = io.StringIO() + # Redirect stdout + sys.stdout = capturedOutput + + bunny_arr = remote.fetch_bunny("./tmp_for_test/bunny.npy", accept_license) + assert bunny_arr.shape == (35947, 3) + del bunny_arr + remove("./tmp_for_test/bunny.npy") + + # Reset redirect + sys.stdout = sys.__stdout__ + return capturedOutput + +def test_print_bunny_license(): + # Test not printing bunny.npy LICENSE when accept_license = True + assert "" == _get_bunny_license_print(accept_license = True).getvalue() + # Test printing bunny.LICENSE file when fetching bunny.npy with accept_license = False (default) + with open("./tmp_for_test/bunny.LICENSE") as f: + assert f.read().rstrip("\n") == _get_bunny_license_print().getvalue().rstrip("\n") + shutil.rmtree("./tmp_for_test") + +def test_fetch_remote_datasets_wrapped(): + # Test fetch_spiral_2d and fetch_bunny wrapping functions with data directory different from default (twice, to test case of already fetched files) + # Default case is not tested because it would fail in case the user sets the 'GUDHI_DATA' environment variable locally + for i in range(2): + spiral_2d_arr = remote.fetch_spiral_2d("./another_fetch_folder_for_test/spiral_2d.npy") + assert spiral_2d_arr.shape == (114562, 2) + + bunny_arr = remote.fetch_bunny("./another_fetch_folder_for_test/bunny.npy") + assert bunny_arr.shape == (35947, 3) + + # Check that the directory was created + assert isdir("./another_fetch_folder_for_test") + # Check downloaded files + assert exists("./another_fetch_folder_for_test/spiral_2d.npy") + assert exists("./another_fetch_folder_for_test/bunny.npy") + assert exists("./another_fetch_folder_for_test/bunny.LICENSE") + + # Remove test folders + del spiral_2d_arr + del bunny_arr + shutil.rmtree("./another_fetch_folder_for_test") + +def test_gudhi_data_env(): + # Set environment variable "GUDHI_DATA" + environ["GUDHI_DATA"] = "./test_folder_from_env_var" + bunny_arr = remote.fetch_bunny() + assert bunny_arr.shape == (35947, 3) + assert exists("./test_folder_from_env_var/points/bunny/bunny.npy") + assert exists("./test_folder_from_env_var/points/bunny/bunny.LICENSE") + # Remove test folder + del bunny_arr + shutil.rmtree("./test_folder_from_env_var") diff --git a/src/python/test/test_representations.py b/src/python/test/test_representations.py index cda1a15b..f4ffbdc1 100755 --- a/src/python/test/test_representations.py +++ b/src/python/test/test_representations.py @@ -3,9 +3,23 @@ import sys import matplotlib.pyplot as plt import numpy as np import pytest +import random from sklearn.cluster import KMeans +# Vectorization +from gudhi.representations import (Landscape, Silhouette, BettiCurve, ComplexPolynomial,\ + TopologicalVector, PersistenceImage, Entropy) + +# Preprocessing +from gudhi.representations import (BirthPersistenceTransform, Clamping, DiagramScaler, Padding, ProminentPoints, \ + DiagramSelector) + +# Kernel +from gudhi.representations import (PersistenceWeightedGaussianKernel, \ + PersistenceScaleSpaceKernel, SlicedWassersteinDistance,\ + SlicedWassersteinKernel, PersistenceFisherKernel, WassersteinDistance) + def test_representations_examples(): # Disable graphics for testing purposes @@ -91,10 +105,165 @@ def test_dummy_atol(): from gudhi.representations.vector_methods import BettiCurve - def test_infinity(): a = np.array([[1.0, 8.0], [2.0, np.inf], [3.0, 4.0]]) c = BettiCurve(20, [0.0, 10.0])(a) assert c[1] == 0 assert c[7] == 3 assert c[9] == 2 + +def test_preprocessing_empty_diagrams(): + empty_diag = np.empty(shape = [0, 2]) + assert not np.any(BirthPersistenceTransform()(empty_diag)) + assert not np.any(Clamping().fit_transform(empty_diag)) + assert not np.any(DiagramScaler()(empty_diag)) + assert not np.any(Padding()(empty_diag)) + assert not np.any(ProminentPoints()(empty_diag)) + assert not np.any(DiagramSelector()(empty_diag)) + +def pow(n): + return lambda x: np.power(x[1]-x[0],n) + +def test_vectorization_empty_diagrams(): + empty_diag = np.empty(shape = [0, 2]) + random_resolution = random.randint(50,100)*10 # between 500 and 1000 + print("resolution = ", random_resolution) + lsc = Landscape(resolution=random_resolution)(empty_diag) + assert not np.any(lsc) + assert lsc.shape[0]%random_resolution == 0 + slt = Silhouette(resolution=random_resolution, weight=pow(2))(empty_diag) + assert not np.any(slt) + assert slt.shape[0] == random_resolution + btc = BettiCurve(resolution=random_resolution)(empty_diag) + assert not np.any(btc) + assert btc.shape[0] == random_resolution + cpp = ComplexPolynomial(threshold=random_resolution, polynomial_type="T")(empty_diag) + assert not np.any(cpp) + assert cpp.shape[0] == random_resolution + tpv = TopologicalVector(threshold=random_resolution)(empty_diag) + assert tpv.shape[0] == random_resolution + assert not np.any(tpv) + prmg = PersistenceImage(resolution=[random_resolution,random_resolution])(empty_diag) + assert not np.any(prmg) + assert prmg.shape[0] == random_resolution * random_resolution + sce = Entropy(mode="scalar", resolution=random_resolution)(empty_diag) + assert not np.any(sce) + assert sce.shape[0] == 1 + scv = Entropy(mode="vector", normalized=False, resolution=random_resolution)(empty_diag) + assert not np.any(scv) + assert scv.shape[0] == random_resolution + +def test_entropy_miscalculation(): + diag_ex = np.array([[0.0,1.0], [0.0,1.0], [0.0,2.0]]) + def pe(pd): + l = pd[:,1] - pd[:,0] + l = l/sum(l) + return -np.dot(l, np.log(l)) + sce = Entropy(mode="scalar") + assert [[pe(diag_ex)]] == sce.fit_transform([diag_ex]) + sce = Entropy(mode="vector", resolution=4, normalized=False, keep_endpoints=True) + pef = [-1/4*np.log(1/4)-1/4*np.log(1/4)-1/2*np.log(1/2), + -1/4*np.log(1/4)-1/4*np.log(1/4)-1/2*np.log(1/2), + -1/2*np.log(1/2), + 0.0] + assert all(([pef] == sce.fit_transform([diag_ex]))[0]) + sce = Entropy(mode="vector", resolution=4, normalized=True) + pefN = (sce.fit_transform([diag_ex]))[0] + area = np.linalg.norm(pefN, ord=1) + assert area==pytest.approx(1) + +def test_kernel_empty_diagrams(): + empty_diag = np.empty(shape = [0, 2]) + assert SlicedWassersteinDistance(num_directions=100)(empty_diag, empty_diag) == 0. + assert SlicedWassersteinKernel(num_directions=100, bandwidth=1.)(empty_diag, empty_diag) == 1. + assert WassersteinDistance(mode="hera", delta=0.0001)(empty_diag, empty_diag) == 0. + assert WassersteinDistance(mode="pot")(empty_diag, empty_diag) == 0. + assert BottleneckDistance(epsilon=.001)(empty_diag, empty_diag) == 0. + assert BottleneckDistance()(empty_diag, empty_diag) == 0. +# PersistenceWeightedGaussianKernel(bandwidth=1., kernel_approx=None, weight=arctan(1.,1.))(empty_diag, empty_diag) +# PersistenceWeightedGaussianKernel(kernel_approx=RBFSampler(gamma=1./2, n_components=100000).fit(np.ones([1,2])), weight=arctan(1.,1.))(empty_diag, empty_diag) +# PersistenceScaleSpaceKernel(bandwidth=1.)(empty_diag, empty_diag) +# PersistenceScaleSpaceKernel(kernel_approx=RBFSampler(gamma=1./2, n_components=100000).fit(np.ones([1,2])))(empty_diag, empty_diag) +# PersistenceFisherKernel(bandwidth_fisher=1., bandwidth=1.)(empty_diag, empty_diag) +# PersistenceFisherKernel(bandwidth_fisher=1., bandwidth=1., kernel_approx=RBFSampler(gamma=1./2, n_components=100000).fit(np.ones([1,2])))(empty_diag, empty_diag) + + +def test_silhouette_permutation_invariance(): + dgm = _n_diags(1)[0] + dgm_permuted = dgm[np.random.permutation(dgm.shape[0]).astype(int)] + random_resolution = random.randint(50, 100) * 10 + slt = Silhouette(resolution=random_resolution, weight=pow(2)) + + assert np.all(np.isclose(slt(dgm), slt(dgm_permuted))) + + +def test_silhouette_multiplication_invariance(): + dgm = _n_diags(1)[0] + n_repetitions = np.random.randint(2, high=10) + dgm_augmented = np.repeat(dgm, repeats=n_repetitions, axis=0) + + random_resolution = random.randint(50, 100) * 10 + slt = Silhouette(resolution=random_resolution, weight=pow(2)) + assert np.all(np.isclose(slt(dgm), slt(dgm_augmented))) + + +def test_silhouette_numeric(): + dgm = np.array([[2., 3.], [5., 6.]]) + slt = Silhouette(resolution=9, weight=pow(1), sample_range=[2., 6.]) + #slt.fit([dgm]) + # x_values = array([2., 2.5, 3., 3.5, 4., 4.5, 5., 5.5, 6.]) + + expected_silhouette = np.array([0., 0.5, 0., 0., 0., 0., 0., 0.5, 0.])/np.sqrt(2) + output_silhouette = slt(dgm) + assert np.all(np.isclose(output_silhouette, expected_silhouette)) + + +def test_landscape_small_persistence_invariance(): + dgm = np.array([[2., 6.], [2., 5.], [3., 7.]]) + small_persistence_pts = np.random.rand(10, 2) + small_persistence_pts[:, 1] += small_persistence_pts[:, 0] + small_persistence_pts += np.min(dgm) + dgm_augmented = np.concatenate([dgm, small_persistence_pts], axis=0) + + lds = Landscape(num_landscapes=2, resolution=5) + lds_dgm, lds_dgm_augmented = lds(dgm), lds(dgm_augmented) + + assert np.all(np.isclose(lds_dgm, lds_dgm_augmented)) + + +def test_landscape_numeric(): + dgm = np.array([[2., 6.], [3., 5.]]) + lds_ref = np.array([ + 0., 0.5, 1., 1.5, 2., 1.5, 1., 0.5, 0., # tent of [2, 6] + 0., 0., 0., 0.5, 1., 0.5, 0., 0., 0., + 0., 0., 0., 0., 0., 0., 0., 0., 0., + 0., 0., 0., 0., 0., 0., 0., 0., 0., + ]) + lds_ref *= np.sqrt(2) + lds = Landscape(num_landscapes=4, resolution=9, sample_range=[2., 6.]) + lds_dgm = lds(dgm) + assert np.all(np.isclose(lds_dgm, lds_ref)) + + +def test_landscape_nan_range(): + dgm = np.array([[2., 6.], [3., 5.]]) + lds = Landscape(num_landscapes=2, resolution=9, sample_range=[np.nan, 6.]) + lds_dgm = lds(dgm) + assert (lds.sample_range_fixed[0] == 2) & (lds.sample_range_fixed[1] == 6) + assert lds.new_resolution == 10 + +def test_endpoints(): + diags = [ np.array([[2., 3.]]) ] + for vec in [ Landscape(), Silhouette(), BettiCurve(), Entropy(mode="vector") ]: + vec.fit(diags) + assert vec.grid_[0] > 2 and vec.grid_[-1] < 3 + for vec in [ Landscape(keep_endpoints=True), Silhouette(keep_endpoints=True), BettiCurve(keep_endpoints=True), Entropy(mode="vector", keep_endpoints=True)]: + vec.fit(diags) + assert vec.grid_[0] == 2 and vec.grid_[-1] == 3 + vec = BettiCurve(resolution=None) + vec.fit(diags) + assert np.equal(vec.grid_, [-np.inf, 2., 3.]).all() + +def test_get_params(): + for vec in [ Landscape(), Silhouette(), BettiCurve(), Entropy(mode="vector") ]: + vec.get_params() diff --git a/src/python/test/test_representations_preprocessing.py b/src/python/test/test_representations_preprocessing.py new file mode 100644 index 00000000..838cf30c --- /dev/null +++ b/src/python/test/test_representations_preprocessing.py @@ -0,0 +1,39 @@ +""" This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + Author(s): Vincent Rouvreau + + Copyright (C) 2021 Inria + + Modification(s): + - YYYY/MM Author: Description of the modification +""" + +from gudhi.representations.preprocessing import DimensionSelector +import numpy as np +import pytest + +H0_0 = np.array([0.0, 0.0]) +H1_0 = np.array([1.0, 0.0]) +H0_1 = np.array([0.0, 1.0]) +H1_1 = np.array([1.0, 1.0]) +H0_2 = np.array([0.0, 2.0]) +H1_2 = np.array([1.0, 2.0]) + + +def test_dimension_selector(): + X = [[H0_0, H1_0], [H0_1, H1_1], [H0_2, H1_2]] + ds = DimensionSelector(index=0) + h0 = ds.fit_transform(X) + np.testing.assert_array_equal(h0[0], H0_0) + np.testing.assert_array_equal(h0[1], H0_1) + np.testing.assert_array_equal(h0[2], H0_2) + + ds = DimensionSelector(index=1) + h1 = ds.fit_transform(X) + np.testing.assert_array_equal(h1[0], H1_0) + np.testing.assert_array_equal(h1[1], H1_1) + np.testing.assert_array_equal(h1[2], H1_2) + + ds = DimensionSelector(index=2) + with pytest.raises(IndexError): + h2 = ds.fit_transform([[H0_0, H1_0], [H0_1, H1_1], [H0_2, H1_2]]) diff --git a/src/python/test/test_rips_complex.py b/src/python/test/test_rips_complex.py index b86e7498..a2f43a1b 100755 --- a/src/python/test/test_rips_complex.py +++ b/src/python/test/test_rips_complex.py @@ -133,3 +133,24 @@ def test_filtered_rips_from_distance_matrix(): assert simplex_tree.num_simplices() == 8 assert simplex_tree.num_vertices() == 4 + + +def test_sparse_with_multiplicity(): + points = [ + [3, 4], + [0.1, 2], + [0.1, 2], + [0.1, 2], + [0.1, 2], + [0.1, 2], + [0.1, 2], + [0.1, 2], + [0.1, 2], + [0.1, 2], + [0.1, 2], + [3, 4.1], + ] + rips = RipsComplex(points=points, sparse=0.01) + simplex_tree = rips.create_simplex_tree(max_dimension=2) + assert simplex_tree.num_simplices() == 7 + diag = simplex_tree.persistence() diff --git a/src/python/test/test_simplex_generators.py b/src/python/test/test_simplex_generators.py index 8a9b4844..c567d4c1 100755 --- a/src/python/test/test_simplex_generators.py +++ b/src/python/test/test_simplex_generators.py @@ -14,7 +14,7 @@ import numpy as np def test_flag_generators(): pts = np.array([[0, 0], [0, 1.01], [1, 0], [1.02, 1.03], [100, 0], [100, 3.01], [103, 0], [103.02, 3.03]]) - r = gudhi.RipsComplex(pts, max_edge_length=4) + r = gudhi.RipsComplex(points=pts, max_edge_length=4) st = r.create_simplex_tree(max_dimension=50) st.persistence() g = st.flag_persistence_generators() diff --git a/src/python/test/test_simplex_tree.py b/src/python/test/test_simplex_tree.py index a3eacaa9..2ccbfbf5 100755 --- a/src/python/test/test_simplex_tree.py +++ b/src/python/test/test_simplex_tree.py @@ -8,7 +8,8 @@ - YYYY/MM Author: Description of the modification """ -from gudhi import SimplexTree, __GUDHI_USE_EIGEN3 +from gudhi import SimplexTree +import numpy as np import pytest __author__ = "Vincent Rouvreau" @@ -248,6 +249,7 @@ def test_make_filtration_non_decreasing(): assert st.filtration([3, 4]) == 2.0 assert st.filtration([4, 5]) == 2.0 + def test_extend_filtration(): # Inserted simplex: @@ -256,82 +258,87 @@ def test_extend_filtration(): # / \ / # o o # /2\ /3 - # o o - # 1 0 - - st = SimplexTree() - st.insert([0,2]) - st.insert([1,2]) - st.insert([0,3]) - st.insert([2,5]) - st.insert([3,4]) - st.insert([3,5]) - st.assign_filtration([0], 1.) - st.assign_filtration([1], 2.) - st.assign_filtration([2], 3.) - st.assign_filtration([3], 4.) - st.assign_filtration([4], 5.) - st.assign_filtration([5], 6.) - - assert list(st.get_filtration()) == [ - ([0, 2], 0.0), - ([1, 2], 0.0), - ([0, 3], 0.0), - ([3, 4], 0.0), - ([2, 5], 0.0), - ([3, 5], 0.0), - ([0], 1.0), - ([1], 2.0), - ([2], 3.0), - ([3], 4.0), - ([4], 5.0), - ([5], 6.0) + # o o + # 1 0 + + st = SimplexTree() + st.insert([0, 2]) + st.insert([1, 2]) + st.insert([0, 3]) + st.insert([2, 5]) + st.insert([3, 4]) + st.insert([3, 5]) + st.assign_filtration([0], 1.0) + st.assign_filtration([1], 2.0) + st.assign_filtration([2], 3.0) + st.assign_filtration([3], 4.0) + st.assign_filtration([4], 5.0) + st.assign_filtration([5], 6.0) + + assert list(st.get_filtration()) == [ + ([0, 2], 0.0), + ([1, 2], 0.0), + ([0, 3], 0.0), + ([3, 4], 0.0), + ([2, 5], 0.0), + ([3, 5], 0.0), + ([0], 1.0), + ([1], 2.0), + ([2], 3.0), + ([3], 4.0), + ([4], 5.0), + ([5], 6.0), ] - + st.extend_filtration() - - assert list(st.get_filtration()) == [ - ([6], -3.0), - ([0], -2.0), - ([1], -1.8), - ([2], -1.6), - ([0, 2], -1.6), - ([1, 2], -1.6), - ([3], -1.4), - ([0, 3], -1.4), - ([4], -1.2), - ([3, 4], -1.2), - ([5], -1.0), - ([2, 5], -1.0), - ([3, 5], -1.0), - ([5, 6], 1.0), - ([4, 6], 1.2), - ([3, 6], 1.4), + + assert list(st.get_filtration()) == [ + ([6], -3.0), + ([0], -2.0), + ([1], -1.8), + ([2], -1.6), + ([0, 2], -1.6), + ([1, 2], -1.6), + ([3], -1.4), + ([0, 3], -1.4), + ([4], -1.2), + ([3, 4], -1.2), + ([5], -1.0), + ([2, 5], -1.0), + ([3, 5], -1.0), + ([5, 6], 1.0), + ([4, 6], 1.2), + ([3, 6], 1.4), ([3, 4, 6], 1.4), - ([3, 5, 6], 1.4), - ([2, 6], 1.6), - ([2, 5, 6], 1.6), - ([1, 6], 1.8), - ([1, 2, 6], 1.8), - ([0, 6], 2.0), - ([0, 2, 6], 2.0), - ([0, 3, 6], 2.0) + ([3, 5, 6], 1.4), + ([2, 6], 1.6), + ([2, 5, 6], 1.6), + ([1, 6], 1.8), + ([1, 2, 6], 1.8), + ([0, 6], 2.0), + ([0, 2, 6], 2.0), + ([0, 3, 6], 2.0), ] - dgms = st.extended_persistence(min_persistence=-1.) + dgms = st.extended_persistence(min_persistence=-1.0) + assert len(dgms) == 4 + # Sort by (death-birth) descending - we are only interested in those with the longest life span + for idx in range(4): + dgms[idx] = sorted(dgms[idx], key=lambda x: (-abs(x[1][0] - x[1][1]))) + + assert dgms[0][0][1][0] == pytest.approx(2.0) + assert dgms[0][0][1][1] == pytest.approx(3.0) + assert dgms[1][0][1][0] == pytest.approx(5.0) + assert dgms[1][0][1][1] == pytest.approx(4.0) + assert dgms[2][0][1][0] == pytest.approx(1.0) + assert dgms[2][0][1][1] == pytest.approx(6.0) + assert dgms[3][0][1][0] == pytest.approx(6.0) + assert dgms[3][0][1][1] == pytest.approx(1.0) - assert dgms[0][0][1][0] == pytest.approx(2.) - assert dgms[0][0][1][1] == pytest.approx(3.) - assert dgms[1][0][1][0] == pytest.approx(5.) - assert dgms[1][0][1][1] == pytest.approx(4.) - assert dgms[2][0][1][0] == pytest.approx(1.) - assert dgms[2][0][1][1] == pytest.approx(6.) - assert dgms[3][0][1][0] == pytest.approx(6.) - assert dgms[3][0][1][1] == pytest.approx(1.) def test_simplices_iterator(): st = SimplexTree() - + assert st.insert([0, 1, 2], filtration=4.0) == True assert st.insert([2, 3, 4], filtration=2.0) == True @@ -341,9 +348,10 @@ def test_simplices_iterator(): print("filtration is: ", simplex[1]) assert st.filtration(simplex[0]) == simplex[1] + def test_collapse_edges(): st = SimplexTree() - + assert st.insert([0, 1], filtration=1.0) == True assert st.insert([1, 2], filtration=1.0) == True assert st.insert([2, 3], filtration=1.0) == True @@ -353,38 +361,35 @@ def test_collapse_edges(): assert st.num_simplices() == 10 - if __GUDHI_USE_EIGEN3: - st.collapse_edges() - assert st.num_simplices() == 9 - assert st.find([1, 3]) == False - for simplex in st.get_skeleton(0): - assert simplex[1] == 1. - else: - # If no Eigen3, collapse_edges throws an exception - with pytest.raises(RuntimeError): - st.collapse_edges() + st.collapse_edges() + assert st.num_simplices() == 9 + assert st.find([0, 2]) == False # [1, 3] would be fine as well + for simplex in st.get_skeleton(0): + assert simplex[1] == 1.0 + def test_reset_filtration(): st = SimplexTree() - - assert st.insert([0, 1, 2], 3.) == True - assert st.insert([0, 3], 2.) == True - assert st.insert([3, 4, 5], 3.) == True - assert st.insert([0, 1, 6, 7], 4.) == True + + assert st.insert([0, 1, 2], 3.0) == True + assert st.insert([0, 3], 2.0) == True + assert st.insert([3, 4, 5], 3.0) == True + assert st.insert([0, 1, 6, 7], 4.0) == True # Guaranteed by construction for simplex in st.get_simplices(): - assert st.filtration(simplex[0]) >= 2. - + assert st.filtration(simplex[0]) >= 2.0 + # dimension until 5 even if simplex tree is of dimension 3 to test the limits for dimension in range(5, -1, -1): - st.reset_filtration(0., dimension) + st.reset_filtration(0.0, dimension) for simplex in st.get_skeleton(3): print(simplex) if len(simplex[0]) < (dimension) + 1: - assert st.filtration(simplex[0]) >= 2. + assert st.filtration(simplex[0]) >= 2.0 else: - assert st.filtration(simplex[0]) == 0. + assert st.filtration(simplex[0]) == 0.0 + def test_boundaries_iterator(): st = SimplexTree() @@ -400,7 +405,242 @@ def test_boundaries_iterator(): list(st.get_boundaries([])) with pytest.raises(RuntimeError): - list(st.get_boundaries([0, 4])) # (0, 4) does not exist + list(st.get_boundaries([0, 4])) # (0, 4) does not exist with pytest.raises(RuntimeError): - list(st.get_boundaries([6])) # (6) does not exist + list(st.get_boundaries([6])) # (6) does not exist + + +def test_persistence_intervals_in_dimension(): + # Here is our triangulation of a 2-torus - taken from https://dioscuri-tda.org/Paris_TDA_Tutorial_2021.html + # 0-----3-----4-----0 + # | \ | \ | \ | \ | + # | \ | \ | \| \ | + # 1-----8-----7-----1 + # | \ | \ | \ | \ | + # | \ | \ | \ | \ | + # 2-----5-----6-----2 + # | \ | \ | \ | \ | + # | \ | \ | \ | \ | + # 0-----3-----4-----0 + st = SimplexTree() + st.insert([0, 1, 8]) + st.insert([0, 3, 8]) + st.insert([3, 7, 8]) + st.insert([3, 4, 7]) + st.insert([1, 4, 7]) + st.insert([0, 1, 4]) + st.insert([1, 2, 5]) + st.insert([1, 5, 8]) + st.insert([5, 6, 8]) + st.insert([6, 7, 8]) + st.insert([2, 6, 7]) + st.insert([1, 2, 7]) + st.insert([0, 2, 3]) + st.insert([2, 3, 5]) + st.insert([3, 4, 5]) + st.insert([4, 5, 6]) + st.insert([0, 4, 6]) + st.insert([0, 2, 6]) + st.compute_persistence(persistence_dim_max=True) + + H0 = st.persistence_intervals_in_dimension(0) + assert np.array_equal(H0, np.array([[0.0, float("inf")]])) + H1 = st.persistence_intervals_in_dimension(1) + assert np.array_equal(H1, np.array([[0.0, float("inf")], [0.0, float("inf")]])) + H2 = st.persistence_intervals_in_dimension(2) + assert np.array_equal(H2, np.array([[0.0, float("inf")]])) + # Test empty case + assert st.persistence_intervals_in_dimension(3).shape == (0, 2) + + +def test_equality_operator(): + st1 = SimplexTree() + st2 = SimplexTree() + + assert st1 == st2 + + st1.insert([1, 2, 3], 4.0) + assert st1 != st2 + + st2.insert([1, 2, 3], 4.0) + assert st1 == st2 + + +def test_simplex_tree_deep_copy(): + st = SimplexTree() + st.insert([1, 2, 3], 0.0) + # compute persistence only on the original + st.compute_persistence() + + st_copy = st.copy() + assert st_copy == st + st_filt_list = list(st.get_filtration()) + + # check persistence is not copied + assert st.__is_persistence_defined() == True + assert st_copy.__is_persistence_defined() == False + + # remove something in the copy and check the copy is included in the original + st_copy.remove_maximal_simplex([1, 2, 3]) + a_filt_list = list(st_copy.get_filtration()) + assert len(a_filt_list) < len(st_filt_list) + + for a_splx in a_filt_list: + assert a_splx in st_filt_list + + # test double free + del st + del st_copy + + +def test_simplex_tree_deep_copy_constructor(): + st = SimplexTree() + st.insert([1, 2, 3], 0.0) + # compute persistence only on the original + st.compute_persistence() + + st_copy = SimplexTree(st) + assert st_copy == st + st_filt_list = list(st.get_filtration()) + + # check persistence is not copied + assert st.__is_persistence_defined() == True + assert st_copy.__is_persistence_defined() == False + + # remove something in the copy and check the copy is included in the original + st_copy.remove_maximal_simplex([1, 2, 3]) + a_filt_list = list(st_copy.get_filtration()) + assert len(a_filt_list) < len(st_filt_list) + + for a_splx in a_filt_list: + assert a_splx in st_filt_list + + # test double free + del st + del st_copy + + +def test_simplex_tree_constructor_exception(): + with pytest.raises(TypeError): + st = SimplexTree(other="Construction from a string shall raise an exception") + + +def test_create_from_array(): + a = np.array([[1, 4, 13, 6], [4, 3, 11, 5], [13, 11, 10, 12], [6, 5, 12, 2]]) + st = SimplexTree.create_from_array(a, max_filtration=5.0) + assert list(st.get_filtration()) == [([0], 1.0), ([3], 2.0), ([1], 3.0), ([0, 1], 4.0), ([1, 3], 5.0)] + + +def test_insert_edges_from_coo_matrix(): + try: + from scipy.sparse import coo_matrix + from scipy.spatial import cKDTree + except ImportError: + print("Skipping, no SciPy") + return + + st = SimplexTree() + st.insert([1, 2, 7], 7) + row = np.array([2, 5, 3]) + col = np.array([1, 4, 6]) + dat = np.array([1, 2, 3]) + edges = coo_matrix((dat, (row, col))) + st.insert_edges_from_coo_matrix(edges) + assert list(st.get_filtration()) == [ + ([1], 1.0), + ([2], 1.0), + ([1, 2], 1.0), + ([4], 2.0), + ([5], 2.0), + ([4, 5], 2.0), + ([3], 3.0), + ([6], 3.0), + ([3, 6], 3.0), + ([7], 7.0), + ([1, 7], 7.0), + ([2, 7], 7.0), + ([1, 2, 7], 7.0), + ] + + pts = np.random.rand(100, 2) + tree = cKDTree(pts) + edges = tree.sparse_distance_matrix(tree, max_distance=0.15, output_type="coo_matrix") + st = SimplexTree() + st.insert_edges_from_coo_matrix(edges) + assert 100 < st.num_simplices() < 1000 + + +def test_insert_batch(): + st = SimplexTree() + # vertices + st.insert_batch(np.array([[6, 1, 5]]), np.array([-5.0, 2.0, -3.0])) + # triangles + st.insert_batch(np.array([[2, 10], [5, 0], [6, 11]]), np.array([4.0, 0.0])) + # edges + st.insert_batch(np.array([[1, 5], [2, 5]]), np.array([1.0, 3.0])) + + assert list(st.get_filtration()) == [ + ([6], -5.0), + ([5], -3.0), + ([0], 0.0), + ([10], 0.0), + ([0, 10], 0.0), + ([11], 0.0), + ([0, 11], 0.0), + ([10, 11], 0.0), + ([0, 10, 11], 0.0), + ([1], 1.0), + ([2], 1.0), + ([1, 2], 1.0), + ([2, 5], 4.0), + ([2, 6], 4.0), + ([5, 6], 4.0), + ([2, 5, 6], 4.0), + ] + + +def test_expansion_with_blocker(): + st = SimplexTree() + st.insert([0, 1], 0) + st.insert([0, 2], 1) + st.insert([0, 3], 2) + st.insert([1, 2], 3) + st.insert([1, 3], 4) + st.insert([2, 3], 5) + st.insert([2, 4], 6) + st.insert([3, 6], 7) + st.insert([4, 5], 8) + st.insert([4, 6], 9) + st.insert([5, 6], 10) + st.insert([6], 10) + + def blocker(simplex): + try: + # Block all simplices that contain vertex 6 + simplex.index(6) + print(simplex, " is blocked") + return True + except ValueError: + print(simplex, " is accepted") + st.assign_filtration(simplex, st.filtration(simplex) + 1.0) + return False + + st.expansion_with_blocker(2, blocker) + assert st.num_simplices() == 22 + assert st.dimension() == 2 + assert st.find([4, 5, 6]) == False + assert st.filtration([0, 1, 2]) == 4.0 + assert st.filtration([0, 1, 3]) == 5.0 + assert st.filtration([0, 2, 3]) == 6.0 + assert st.filtration([1, 2, 3]) == 6.0 + + st.expansion_with_blocker(3, blocker) + assert st.num_simplices() == 23 + assert st.dimension() == 3 + assert st.find([4, 5, 6]) == False + assert st.filtration([0, 1, 2]) == 4.0 + assert st.filtration([0, 1, 3]) == 5.0 + assert st.filtration([0, 2, 3]) == 6.0 + assert st.filtration([1, 2, 3]) == 6.0 + assert st.filtration([0, 1, 2, 3]) == 7.0 diff --git a/src/python/test/test_sklearn_cubical_persistence.py b/src/python/test/test_sklearn_cubical_persistence.py new file mode 100644 index 00000000..1c05a215 --- /dev/null +++ b/src/python/test/test_sklearn_cubical_persistence.py @@ -0,0 +1,59 @@ +""" This file is part of the Gudhi Library - https://gudhi.inria.fr/ - which is released under MIT. + See file LICENSE or go to https://gudhi.inria.fr/licensing/ for full license details. + Author(s): Vincent Rouvreau + + Copyright (C) 2021 Inria + + Modification(s): + - YYYY/MM Author: Description of the modification +""" + +from gudhi.sklearn.cubical_persistence import CubicalPersistence +import numpy as np +from sklearn import datasets + +CUBICAL_PERSISTENCE_H0_IMG0 = np.array([[0.0, 6.0], [0.0, 8.0], [0.0, np.inf]]) + + +def test_simple_constructor_from_top_cells(): + cells = datasets.load_digits().images[0] + cp = CubicalPersistence(homology_dimensions=0) + np.testing.assert_array_equal(cp._CubicalPersistence__transform_only_this_dim(cells), CUBICAL_PERSISTENCE_H0_IMG0) + cp = CubicalPersistence(homology_dimensions=[0, 2]) + diags = cp._CubicalPersistence__transform(cells) + assert len(diags) == 2 + np.testing.assert_array_equal(diags[0], CUBICAL_PERSISTENCE_H0_IMG0) + + +def test_simple_constructor_from_top_cells_list(): + digits = datasets.load_digits().images[:10] + cp = CubicalPersistence(homology_dimensions=0, n_jobs=-2) + + diags = cp.fit_transform(digits) + assert len(diags) == 10 + np.testing.assert_array_equal(diags[0], CUBICAL_PERSISTENCE_H0_IMG0) + + cp = CubicalPersistence(homology_dimensions=[0, 1], n_jobs=-1) + diagsH0H1 = cp.fit_transform(digits) + assert len(diagsH0H1) == 10 + for idx in range(10): + np.testing.assert_array_equal(diags[idx], diagsH0H1[idx][0]) + +def test_simple_constructor_from_flattened_cells(): + cells = datasets.load_digits().images[0] + # Not squared (extended) flatten cells + flat_cells = np.hstack((cells, np.zeros((cells.shape[0], 2)))).flatten() + + cp = CubicalPersistence(homology_dimensions=0, newshape=[-1, 8, 10]) + diags = cp.fit_transform([flat_cells]) + + np.testing.assert_array_equal(diags[0], CUBICAL_PERSISTENCE_H0_IMG0) + + # Not squared (extended) non-flatten cells + cells = np.hstack((cells, np.zeros((cells.shape[0], 2)))) + + # The aim of this second part of the test is to resize even if not mandatory + cp = CubicalPersistence(homology_dimensions=0, newshape=[-1, 8, 10]) + diags = cp.fit_transform([cells]) + + np.testing.assert_array_equal(diags[0], CUBICAL_PERSISTENCE_H0_IMG0) diff --git a/src/python/test/test_subsampling.py b/src/python/test/test_subsampling.py index 4019852e..c1cb4e3f 100755 --- a/src/python/test/test_subsampling.py +++ b/src/python/test/test_subsampling.py @@ -16,17 +16,9 @@ __license__ = "MIT" def test_write_off_file_for_tests(): - file = open("subsample.off", "w") - file.write("nOFF\n") - file.write("2 7 0 0\n") - file.write("1.0 1.0\n") - file.write("7.0 0.0\n") - file.write("4.0 6.0\n") - file.write("9.0 6.0\n") - file.write("0.0 14.0\n") - file.write("2.0 19.0\n") - file.write("9.0 17.0\n") - file.close() + gudhi.write_points_to_off_file( + "subsample.off", [[1.0, 1.0], [7.0, 0.0], [4.0, 6.0], [9.0, 6.0], [0.0, 14.0], [2.0, 19.0], [9.0, 17.0]] + ) def test_simple_choose_n_farthest_points_with_a_starting_point(): @@ -34,54 +26,29 @@ def test_simple_choose_n_farthest_points_with_a_starting_point(): i = 0 for point in point_set: # The iteration starts with the given starting point - sub_set = gudhi.choose_n_farthest_points( - points=point_set, nb_points=1, starting_point=i - ) + sub_set = gudhi.choose_n_farthest_points(points=point_set, nb_points=1, starting_point=i) assert sub_set[0] == point_set[i] i = i + 1 # The iteration finds then the farthest - sub_set = gudhi.choose_n_farthest_points( - points=point_set, nb_points=2, starting_point=1 - ) + sub_set = gudhi.choose_n_farthest_points(points=point_set, nb_points=2, starting_point=1) assert sub_set[1] == point_set[3] - sub_set = gudhi.choose_n_farthest_points( - points=point_set, nb_points=2, starting_point=3 - ) + sub_set = gudhi.choose_n_farthest_points(points=point_set, nb_points=2, starting_point=3) assert sub_set[1] == point_set[1] - sub_set = gudhi.choose_n_farthest_points( - points=point_set, nb_points=2, starting_point=0 - ) + sub_set = gudhi.choose_n_farthest_points(points=point_set, nb_points=2, starting_point=0) assert sub_set[1] == point_set[2] - sub_set = gudhi.choose_n_farthest_points( - points=point_set, nb_points=2, starting_point=2 - ) + sub_set = gudhi.choose_n_farthest_points(points=point_set, nb_points=2, starting_point=2) assert sub_set[1] == point_set[0] # Test the limits - assert ( - gudhi.choose_n_farthest_points(points=[], nb_points=0, starting_point=0) == [] - ) - assert ( - gudhi.choose_n_farthest_points(points=[], nb_points=1, starting_point=0) == [] - ) - assert ( - gudhi.choose_n_farthest_points(points=[], nb_points=0, starting_point=1) == [] - ) - assert ( - gudhi.choose_n_farthest_points(points=[], nb_points=1, starting_point=1) == [] - ) + assert gudhi.choose_n_farthest_points(points=[], nb_points=0, starting_point=0) == [] + assert gudhi.choose_n_farthest_points(points=[], nb_points=1, starting_point=0) == [] + assert gudhi.choose_n_farthest_points(points=[], nb_points=0, starting_point=1) == [] + assert gudhi.choose_n_farthest_points(points=[], nb_points=1, starting_point=1) == [] # From off file test for i in range(0, 7): - assert ( - len( - gudhi.choose_n_farthest_points( - off_file="subsample.off", nb_points=i, starting_point=i - ) - ) - == i - ) + assert len(gudhi.choose_n_farthest_points(off_file="subsample.off", nb_points=i, starting_point=i)) == i def test_simple_choose_n_farthest_points_randomed(): @@ -91,7 +58,7 @@ def test_simple_choose_n_farthest_points_randomed(): assert gudhi.choose_n_farthest_points(points=[], nb_points=1) == [] assert gudhi.choose_n_farthest_points(points=point_set, nb_points=0) == [] - # Go furter than point set on purpose + # Go further than point set on purpose for iter in range(1, 10): sub_set = gudhi.choose_n_farthest_points(points=point_set, nb_points=iter) for sub in sub_set: @@ -104,10 +71,7 @@ def test_simple_choose_n_farthest_points_randomed(): # From off file test for i in range(0, 7): - assert ( - len(gudhi.choose_n_farthest_points(off_file="subsample.off", nb_points=i)) - == i - ) + assert len(gudhi.choose_n_farthest_points(off_file="subsample.off", nb_points=i)) == i def test_simple_pick_n_random_points(): @@ -117,7 +81,7 @@ def test_simple_pick_n_random_points(): assert gudhi.pick_n_random_points(points=[], nb_points=1) == [] assert gudhi.pick_n_random_points(points=point_set, nb_points=0) == [] - # Go furter than point set on purpose + # Go further than point set on purpose for iter in range(1, 10): sub_set = gudhi.pick_n_random_points(points=point_set, nb_points=iter) for sub in sub_set: @@ -130,9 +94,7 @@ def test_simple_pick_n_random_points(): # From off file test for i in range(0, 7): - assert ( - len(gudhi.pick_n_random_points(off_file="subsample.off", nb_points=i)) == i - ) + assert len(gudhi.pick_n_random_points(off_file="subsample.off", nb_points=i)) == i def test_simple_sparsify_points(): @@ -152,31 +114,10 @@ def test_simple_sparsify_points(): ] assert gudhi.sparsify_point_set(points=point_set, min_squared_dist=2.001) == [[0, 1]] - assert ( - len(gudhi.sparsify_point_set(off_file="subsample.off", min_squared_dist=0.0)) - == 7 - ) - assert ( - len(gudhi.sparsify_point_set(off_file="subsample.off", min_squared_dist=30.0)) - == 5 - ) - assert ( - len(gudhi.sparsify_point_set(off_file="subsample.off", min_squared_dist=40.1)) - == 4 - ) - assert ( - len(gudhi.sparsify_point_set(off_file="subsample.off", min_squared_dist=89.9)) - == 3 - ) - assert ( - len(gudhi.sparsify_point_set(off_file="subsample.off", min_squared_dist=100.0)) - == 2 - ) - assert ( - len(gudhi.sparsify_point_set(off_file="subsample.off", min_squared_dist=324.9)) - == 2 - ) - assert ( - len(gudhi.sparsify_point_set(off_file="subsample.off", min_squared_dist=325.01)) - == 1 - ) + assert len(gudhi.sparsify_point_set(off_file="subsample.off", min_squared_dist=0.0)) == 7 + assert len(gudhi.sparsify_point_set(off_file="subsample.off", min_squared_dist=30.0)) == 5 + assert len(gudhi.sparsify_point_set(off_file="subsample.off", min_squared_dist=40.1)) == 4 + assert len(gudhi.sparsify_point_set(off_file="subsample.off", min_squared_dist=89.9)) == 3 + assert len(gudhi.sparsify_point_set(off_file="subsample.off", min_squared_dist=100.0)) == 2 + assert len(gudhi.sparsify_point_set(off_file="subsample.off", min_squared_dist=324.9)) == 2 + assert len(gudhi.sparsify_point_set(off_file="subsample.off", min_squared_dist=325.01)) == 1 diff --git a/src/python/test/test_tomato.py b/src/python/test/test_tomato.py index ecab03c4..c571f799 100755 --- a/src/python/test/test_tomato.py +++ b/src/python/test/test_tomato.py @@ -37,7 +37,7 @@ def test_tomato_1(): t = Tomato(metric="euclidean", graph_type="radius", r=4.7, k=4) t.fit(a) assert t.max_weight_per_cc_.size == 2 - assert np.array_equal(t.neighbors_, [[0, 1, 2], [0, 1, 2], [0, 1, 2], [3, 4, 5, 6], [3, 4, 5], [3, 4, 5], [3, 6]]) + assert t.neighbors_ == [[0, 1, 2], [0, 1, 2], [0, 1, 2], [3, 4, 5, 6], [3, 4, 5], [3, 4, 5], [3, 6]] t.plot_diagram() t = Tomato(graph_type="radius", r=4.7, k=4, symmetrize_graph=True) diff --git a/src/python/test/test_wasserstein_distance.py b/src/python/test/test_wasserstein_distance.py index e3b521d6..a76b6ce7 100755 --- a/src/python/test/test_wasserstein_distance.py +++ b/src/python/test/test_wasserstein_distance.py @@ -5,25 +5,98 @@ Copyright (C) 2019 Inria Modification(s): + - 2020/07 Théo Lacombe: Added tests about handling essential parts in diagrams. - YYYY/MM Author: Description of the modification """ -from gudhi.wasserstein.wasserstein import _proj_on_diag +from gudhi.wasserstein.wasserstein import _proj_on_diag, _finite_part, _handle_essential_parts, _get_essential_parts +from gudhi.wasserstein.wasserstein import _warn_infty from gudhi.wasserstein import wasserstein_distance as pot from gudhi.hera import wasserstein_distance as hera import numpy as np import pytest + __author__ = "Theo Lacombe" __copyright__ = "Copyright (C) 2019 Inria" __license__ = "MIT" + def test_proj_on_diag(): dgm = np.array([[1., 1.], [1., 2.], [3., 5.]]) assert np.array_equal(_proj_on_diag(dgm), [[1., 1.], [1.5, 1.5], [4., 4.]]) empty = np.empty((0, 2)) assert np.array_equal(_proj_on_diag(empty), empty) + +def test_finite_part(): + diag = np.array([[0, 1], [3, 5], [2, np.inf], [3, np.inf], [-np.inf, 8], [-np.inf, 12], [-np.inf, -np.inf], + [np.inf, np.inf], [-np.inf, np.inf], [-np.inf, np.inf]]) + assert np.array_equal(_finite_part(diag), [[0, 1], [3, 5]]) + + +def test_handle_essential_parts(): + diag1 = np.array([[0, 1], [3, 5], + [2, np.inf], [3, np.inf], + [-np.inf, 8], [-np.inf, 12], + [-np.inf, -np.inf], + [np.inf, np.inf], + [-np.inf, np.inf], [-np.inf, np.inf]]) + + diag2 = np.array([[0, 2], [3, 5], + [2, np.inf], [4, np.inf], + [-np.inf, 8], [-np.inf, 11], + [-np.inf, -np.inf], + [np.inf, np.inf], + [-np.inf, np.inf], [-np.inf, np.inf]]) + + diag3 = np.array([[0, 2], [3, 5], + [2, np.inf], [4, np.inf], [6, np.inf], + [-np.inf, 8], [-np.inf, 11], + [-np.inf, -np.inf], + [np.inf, np.inf], + [-np.inf, np.inf], [-np.inf, np.inf]]) + + c, m = _handle_essential_parts(diag1, diag2, order=1) + assert c == pytest.approx(2, 0.0001) # Note: here c is only the cost due to essential part (thus 2, not 3) + # Similarly, the matching only corresponds to essential parts. + # Note that (-inf,-inf) and (+inf,+inf) coordinates are matched to the diagonal. + assert np.array_equal(m, [[4, 4], [5, 5], [2, 2], [3, 3], [8, 8], [9, 9], [6, -1], [7, -1], [-1, 6], [-1, 7]]) + + c, m = _handle_essential_parts(diag1, diag3, order=1) + assert c == np.inf + assert (m is None) + + +def test_get_essential_parts(): + diag1 = np.array([[0, 1], [3, 5], [2, np.inf], [3, np.inf], [-np.inf, 8], [-np.inf, 12], [-np.inf, -np.inf], + [np.inf, np.inf], [-np.inf, np.inf], [-np.inf, np.inf]]) + + diag2 = np.array([[0, 1], [3, 5], [2, np.inf], [3, np.inf]]) + + res = _get_essential_parts(diag1) + res2 = _get_essential_parts(diag2) + assert np.array_equal(res[0], [4, 5]) + assert np.array_equal(res[1], [2, 3]) + assert np.array_equal(res[2], [8, 9]) + assert np.array_equal(res[3], [6] ) + assert np.array_equal(res[4], [7] ) + + assert np.array_equal(res2[0], [] ) + assert np.array_equal(res2[1], [2, 3]) + assert np.array_equal(res2[2], [] ) + assert np.array_equal(res2[3], [] ) + assert np.array_equal(res2[4], [] ) + + +def test_warn_infty(): + with pytest.warns(UserWarning): + assert _warn_infty(matching=False)==np.inf + c, m = _warn_infty(matching=True) + assert (c == np.inf) + assert (m is None) + + def _basic_wasserstein(wasserstein_distance, delta, test_infinity=True, test_matching=True): diag1 = np.array([[2.7, 3.7], [9.6, 14.0], [34.2, 34.974]]) diag2 = np.array([[2.8, 4.45], [9.5, 14.1]]) @@ -64,7 +137,7 @@ def _basic_wasserstein(wasserstein_distance, delta, test_infinity=True, test_mat assert wasserstein_distance(diag4, diag5) == np.inf assert wasserstein_distance(diag5, diag6, order=1, internal_p=np.inf) == approx(4.) - + assert wasserstein_distance(diag5, emptydiag) == np.inf if test_matching: match = wasserstein_distance(emptydiag, emptydiag, matching=True, internal_p=1., order=2)[1] @@ -78,6 +151,31 @@ def _basic_wasserstein(wasserstein_distance, delta, test_infinity=True, test_mat match = wasserstein_distance(diag1, diag2, matching=True, internal_p=2., order=2.)[1] assert np.array_equal(match, [[0, 0], [1, 1], [2, -1]]) + if test_matching and test_infinity: + diag7 = np.array([[0, 3], [4, np.inf], [5, np.inf]]) + diag8 = np.array([[0,1], [0, np.inf], [-np.inf, -np.inf], [np.inf, np.inf]]) + diag9 = np.array([[-np.inf, -np.inf], [np.inf, np.inf]]) + diag10 = np.array([[0,1], [-np.inf, -np.inf], [np.inf, np.inf]]) + + match = wasserstein_distance(diag5, diag6, matching=True, internal_p=2., order=2.)[1] + assert np.array_equal(match, [[0, -1], [-1,0], [-1, 1], [1, 2]]) + match = wasserstein_distance(diag5, diag7, matching=True, internal_p=2., order=2.)[1] + assert (match is None) + cost, match = wasserstein_distance(diag7, emptydiag, matching=True, internal_p=2., order=2.3) + assert (cost == np.inf) + assert (match is None) + cost, match = wasserstein_distance(emptydiag, diag7, matching=True, internal_p=2.42, order=2.) + assert (cost == np.inf) + assert (match is None) + cost, match = wasserstein_distance(diag8, diag9, matching=True, internal_p=2., order=2.) + assert (cost == np.inf) + assert (match is None) + cost, match = wasserstein_distance(diag9, diag10, matching=True, internal_p=1., order=1.) + assert (cost == 1) + assert (match == [[0, -1],[1, -1],[-1, 0], [-1, 1], [-1, 2]]) # type 4 and 5 are match to the diag anyway. + cost, match = wasserstein_distance(diag9, emptydiag, matching=True, internal_p=2., order=2.) + assert (cost == 0.) + assert (match == [[0, -1], [1, -1]]) def hera_wrap(**extra): @@ -85,15 +183,19 @@ def hera_wrap(**extra): return hera(*kargs,**kwargs,**extra) return fun + def pot_wrap(**extra): def fun(*kargs,**kwargs): return pot(*kargs,**kwargs,**extra) return fun + def test_wasserstein_distance_pot(): - _basic_wasserstein(pot, 1e-15, test_infinity=False, test_matching=True) - _basic_wasserstein(pot_wrap(enable_autodiff=True), 1e-15, test_infinity=False, test_matching=False) + _basic_wasserstein(pot, 1e-15, test_infinity=False, test_matching=True) # pot with its standard args + _basic_wasserstein(pot_wrap(enable_autodiff=True, keep_essential_parts=False), 1e-15, test_infinity=False, test_matching=False) + def test_wasserstein_distance_hera(): _basic_wasserstein(hera_wrap(delta=1e-12), 1e-12, test_matching=False) _basic_wasserstein(hera_wrap(delta=.1), .1, test_matching=False) + |